NO760779L - - Google Patents
Info
- Publication number
- NO760779L NO760779L NO760779A NO760779A NO760779L NO 760779 L NO760779 L NO 760779L NO 760779 A NO760779 A NO 760779A NO 760779 A NO760779 A NO 760779A NO 760779 L NO760779 L NO 760779L
- Authority
- NO
- Norway
- Prior art keywords
- pyridinyl
- pyrimidinyl
- formula
- pyrimidine
- amino
- Prior art date
Links
- -1 2-pyridinyl Chemical group 0.000 claims description 78
- 150000001875 compounds Chemical class 0.000 claims description 67
- 229910052739 hydrogen Inorganic materials 0.000 claims description 34
- 239000001257 hydrogen Substances 0.000 claims description 34
- AFNZWLWIUXHAIW-UHFFFAOYSA-N 2-pyridin-4-ylpyrimidin-4-amine Chemical compound NC1=CC=NC(C=2C=CN=CC=2)=N1 AFNZWLWIUXHAIW-UHFFFAOYSA-N 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 29
- 238000006243 chemical reaction Methods 0.000 claims description 25
- 150000003839 salts Chemical class 0.000 claims description 25
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 21
- 239000004202 carbamide Substances 0.000 claims description 21
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 16
- PFKFTWBEEFSNDU-UHFFFAOYSA-N 1,1'-Carbonyldiimidazole Substances C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- MGOLNIXAPIAKFM-UHFFFAOYSA-N 2-isocyanato-2-methylpropane Chemical compound CC(C)(C)N=C=O MGOLNIXAPIAKFM-UHFFFAOYSA-N 0.000 claims description 13
- 239000012458 free base Substances 0.000 claims description 13
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 12
- 150000002431 hydrogen Chemical class 0.000 claims description 12
- 150000001412 amines Chemical class 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 150000001204 N-oxides Chemical class 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 239000012948 isocyanate Substances 0.000 claims description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 6
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- 150000002513 isocyanates Chemical class 0.000 claims description 5
- 239000007800 oxidant agent Substances 0.000 claims description 5
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical class [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 claims description 3
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 89
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 61
- 239000000203 mixture Substances 0.000 description 53
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 41
- 239000000243 solution Substances 0.000 description 38
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 33
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 32
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- 239000007787 solid Substances 0.000 description 29
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 28
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- 239000011541 reaction mixture Substances 0.000 description 26
- 229910000104 sodium hydride Inorganic materials 0.000 description 20
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 19
- 239000012312 sodium hydride Substances 0.000 description 19
- 239000004533 oil dispersion Substances 0.000 description 18
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 17
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 14
- 238000003756 stirring Methods 0.000 description 13
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 12
- 229960000583 acetic acid Drugs 0.000 description 11
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- 239000002244 precipitate Substances 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 11
- 239000000706 filtrate Substances 0.000 description 10
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 8
- 241000700159 Rattus Species 0.000 description 8
- 239000000908 ammonium hydroxide Substances 0.000 description 8
- KNXKVYCVGXFLES-UHFFFAOYSA-N pyridine-2-carboximidamide Chemical compound NC(=N)C1=CC=CC=N1 KNXKVYCVGXFLES-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 239000003814 drug Substances 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- OBXXCFFJBAUAAE-UHFFFAOYSA-N 1-tert-butyl-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound CC(C)(C)NC(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 OBXXCFFJBAUAAE-UHFFFAOYSA-N 0.000 description 5
- CQVKMVQRSNNAGO-UHFFFAOYSA-N 2-[4-formyl-3-methyl-n-(2-methylsulfonyloxyethyl)anilino]ethyl methanesulfonate Chemical compound CC1=CC(N(CCOS(C)(=O)=O)CCOS(C)(=O)=O)=CC=C1C=O CQVKMVQRSNNAGO-UHFFFAOYSA-N 0.000 description 5
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 5
- USBDVWRRXXQEOL-UHFFFAOYSA-N 2-pyridin-3-ylpyrimidin-4-amine Chemical compound NC1=CC=NC(C=2C=NC=CC=2)=N1 USBDVWRRXXQEOL-UHFFFAOYSA-N 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 229940098779 methanesulfonic acid Drugs 0.000 description 5
- UDHZYEWSTDYKCZ-UHFFFAOYSA-N pyridine-4-carboxamide;hydrochloride Chemical compound Cl.NC(=O)C1=CC=NC=C1 UDHZYEWSTDYKCZ-UHFFFAOYSA-N 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- VFMNIYGZWOAILQ-UHFFFAOYSA-N butyl n-(2-pyridin-4-ylpyrimidin-4-yl)carbamate Chemical compound CCCCOC(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 VFMNIYGZWOAILQ-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 125000004076 pyridyl group Chemical group 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- VIHXWWJJHFGFIX-UHFFFAOYSA-N (6-methyl-2-pyridin-4-ylpyrimidin-4-yl)hydrazine Chemical compound CC1=CC(NN)=NC(C=2C=CN=CC=2)=N1 VIHXWWJJHFGFIX-UHFFFAOYSA-N 0.000 description 3
- SJJOXQXXTAJQNH-UHFFFAOYSA-N 1-propan-2-yl-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound CC(C)NC(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 SJJOXQXXTAJQNH-UHFFFAOYSA-N 0.000 description 3
- OPVQYFLTGBIQKG-UHFFFAOYSA-N 2-(piperidin-1-ylmethyl)prop-2-enenitrile Chemical compound N#CC(=C)CN1CCCCC1 OPVQYFLTGBIQKG-UHFFFAOYSA-N 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- JMDXPMYETBVHIN-UHFFFAOYSA-N 6-amino-2-pyridin-4-yl-1h-pyrimidin-4-one Chemical compound N1C(N)=CC(=O)N=C1C1=CC=NC=C1 JMDXPMYETBVHIN-UHFFFAOYSA-N 0.000 description 3
- UFMQZZRBKSOEKS-UHFFFAOYSA-N 6-methyl-2-pyridin-4-yl-1h-pyrimidin-4-one Chemical compound N1C(C)=CC(=O)N=C1C1=CC=NC=C1 UFMQZZRBKSOEKS-UHFFFAOYSA-N 0.000 description 3
- KNKKGGMVDGAMLG-UHFFFAOYSA-N 6-methyl-2-pyridin-4-ylpyrimidin-4-amine Chemical compound CC1=CC(N)=NC(C=2C=CN=CC=2)=N1 KNKKGGMVDGAMLG-UHFFFAOYSA-N 0.000 description 3
- FDBQKMBNSZRZOG-UHFFFAOYSA-N 6-propyl-2-pyridin-4-ylpyrimidin-4-amine Chemical compound CCCC1=CC(N)=NC(C=2C=CN=CC=2)=N1 FDBQKMBNSZRZOG-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 230000003266 anti-allergic effect Effects 0.000 description 3
- 239000000043 antiallergic agent Substances 0.000 description 3
- 239000000010 aprotic solvent Substances 0.000 description 3
- NRDQFWXVTPZZAZ-UHFFFAOYSA-N butyl carbonochloridate Chemical compound CCCCOC(Cl)=O NRDQFWXVTPZZAZ-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- VFQXVTODMYMSMJ-UHFFFAOYSA-N isonicotinamide Chemical compound NC(=O)C1=CC=NC=C1 VFQXVTODMYMSMJ-UHFFFAOYSA-N 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- ZZLJJAGIUYYIRN-UHFFFAOYSA-N n-(2-pyridin-4-ylpyrimidin-4-yl)acetamide Chemical compound CC(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 ZZLJJAGIUYYIRN-UHFFFAOYSA-N 0.000 description 3
- GGQNTXJGAGWGFD-UHFFFAOYSA-N n-(2-pyridin-4-ylpyrimidin-4-yl)imidazole-1-carboxamide Chemical compound C1=CN=CN1C(=O)NC(N=1)=CC=NC=1C1=CC=NC=C1 GGQNTXJGAGWGFD-UHFFFAOYSA-N 0.000 description 3
- GSBUSAXXQRTXHM-UHFFFAOYSA-N n-ethyl-2-pyridin-4-ylpyrimidin-4-amine Chemical compound CCNC1=CC=NC(C=2C=CN=CC=2)=N1 GSBUSAXXQRTXHM-UHFFFAOYSA-N 0.000 description 3
- XRCXVDGCHVDNNM-UHFFFAOYSA-N n-methyl-2-pyridin-4-ylpyrimidin-4-amine Chemical compound CNC1=CC=NC(C=2C=CN=CC=2)=N1 XRCXVDGCHVDNNM-UHFFFAOYSA-N 0.000 description 3
- DNEXFQYHSNWHMY-UHFFFAOYSA-N n-methyl-n-(2-pyridin-4-ylpyrimidin-4-yl)imidazole-1-carboxamide Chemical compound C=1C=NC(C=2C=CN=CC=2)=NC=1N(C)C(=O)N1C=CN=C1 DNEXFQYHSNWHMY-UHFFFAOYSA-N 0.000 description 3
- GVDHZFJYZKAQNS-UHFFFAOYSA-N n-tert-butyl-2-pyridin-4-ylpyrimidin-4-amine Chemical compound CC(C)(C)NC1=CC=NC(C=2C=CN=CC=2)=N1 GVDHZFJYZKAQNS-UHFFFAOYSA-N 0.000 description 3
- PQPFFKCJENSZKL-UHFFFAOYSA-N pentan-3-amine Chemical compound CCC(N)CC PQPFFKCJENSZKL-UHFFFAOYSA-N 0.000 description 3
- LJXQPZWIHJMPQQ-UHFFFAOYSA-N pyrimidin-2-amine Chemical compound NC1=NC=CC=N1 LJXQPZWIHJMPQQ-UHFFFAOYSA-N 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- CNKRRFAEIGKEGM-UHFFFAOYSA-N (2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound NC(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 CNKRRFAEIGKEGM-UHFFFAOYSA-N 0.000 description 2
- HUPVIAINOSTNBJ-HWKANZROSA-N (e)-3-ethoxyprop-2-enenitrile Chemical compound CCO\C=C\C#N HUPVIAINOSTNBJ-HWKANZROSA-N 0.000 description 2
- AZEUCUSUIMCPBR-UHFFFAOYSA-N 1-butyl-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound CCCCNC(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 AZEUCUSUIMCPBR-UHFFFAOYSA-N 0.000 description 2
- ATGVVYDHVDFRIG-UHFFFAOYSA-N 1-ethyl-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound CCNC(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 ATGVVYDHVDFRIG-UHFFFAOYSA-N 0.000 description 2
- RMWJEHRXXITFPZ-UHFFFAOYSA-N 1-phenyl-3-pyrimidin-4-ylurea Chemical compound C=1C=NC=NC=1NC(=O)NC1=CC=CC=C1 RMWJEHRXXITFPZ-UHFFFAOYSA-N 0.000 description 2
- NTAKWJMSIAKFNC-UHFFFAOYSA-N 1-propan-2-yl-3-(2-pyridin-3-ylpyrimidin-4-yl)urea Chemical compound CC(C)NC(=O)NC1=CC=NC(C=2C=NC=CC=2)=N1 NTAKWJMSIAKFNC-UHFFFAOYSA-N 0.000 description 2
- SLKJVTYGOQRQIM-UHFFFAOYSA-N 2-(2,6-dimethylpyridin-4-yl)pyrimidin-4-amine Chemical compound CC1=NC(C)=CC(C=2N=C(N)C=CN=2)=C1 SLKJVTYGOQRQIM-UHFFFAOYSA-N 0.000 description 2
- AADBRLIAYJLVMH-UHFFFAOYSA-N 2-(2-ethylpyridin-4-yl)pyrimidin-4-amine Chemical compound C1=NC(CC)=CC(C=2N=C(N)C=CN=2)=C1 AADBRLIAYJLVMH-UHFFFAOYSA-N 0.000 description 2
- NWPDZYPZSYEIKZ-UHFFFAOYSA-N 2-(2-methylpyridin-4-yl)pyrimidin-4-amine Chemical compound C1=NC(C)=CC(C=2N=C(N)C=CN=2)=C1 NWPDZYPZSYEIKZ-UHFFFAOYSA-N 0.000 description 2
- CRVQOVRFQOPXPG-UHFFFAOYSA-N 2-(3-methylpyridin-4-yl)pyrimidin-4-amine Chemical compound CC1=CN=CC=C1C1=NC=CC(N)=N1 CRVQOVRFQOPXPG-UHFFFAOYSA-N 0.000 description 2
- CRLLPKLYUMUJHY-UHFFFAOYSA-N 2-pyridin-2-ylpyrimidin-4-amine Chemical compound NC1=CC=NC(C=2N=CC=CC=2)=N1 CRLLPKLYUMUJHY-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- DHNOAUDHLPLXQG-UHFFFAOYSA-N 4-amino-2-pyridin-4-ylpyrimidine-5-carbonitrile Chemical compound C1=C(C#N)C(N)=NC(C=2C=CN=CC=2)=N1 DHNOAUDHLPLXQG-UHFFFAOYSA-N 0.000 description 2
- ZSRSIZQAKUIMTE-UHFFFAOYSA-N 4-chloro-6-methyl-2-pyridin-4-ylpyrimidine Chemical compound CC1=CC(Cl)=NC(C=2C=CN=CC=2)=N1 ZSRSIZQAKUIMTE-UHFFFAOYSA-N 0.000 description 2
- OZQWBFMYEFXYRX-UHFFFAOYSA-N 5-methyl-2-pyridin-4-ylpyrimidin-4-amine Chemical compound N1=C(N)C(C)=CN=C1C1=CC=NC=C1 OZQWBFMYEFXYRX-UHFFFAOYSA-N 0.000 description 2
- MPYZHDZCEHZQSB-UHFFFAOYSA-N 6-propyl-2-pyridin-4-yl-1h-pyrimidin-4-one Chemical compound CCCC1=CC(O)=NC(C=2C=CN=CC=2)=N1 MPYZHDZCEHZQSB-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- NLQDARDXBZWFKE-UHFFFAOYSA-N CC(N(C1=CC=NC(C2=CC=NC=C2)=N1)O)=O Chemical compound CC(N(C1=CC=NC(C2=CC=NC=C2)=N1)O)=O NLQDARDXBZWFKE-UHFFFAOYSA-N 0.000 description 2
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 150000007514 bases Chemical class 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 2
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 2
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- QAXZWHGWYSJAEI-UHFFFAOYSA-N n,n-dimethylformamide;ethanol Chemical compound CCO.CN(C)C=O QAXZWHGWYSJAEI-UHFFFAOYSA-N 0.000 description 2
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 2
- YXQGCGONENVUBS-UHFFFAOYSA-N n-propan-2-yl-2-pyridin-4-ylpyrimidin-4-amine Chemical compound CC(C)NC1=CC=NC(C=2C=CN=CC=2)=N1 YXQGCGONENVUBS-UHFFFAOYSA-N 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- DNENQQPLJPZMGZ-UHFFFAOYSA-N pyrimidin-2-ylurea Chemical class NC(=O)NC1=NC=CC=N1 DNENQQPLJPZMGZ-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical compound O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- RDMBFHKPEDAOOP-UHFFFAOYSA-N (6-propyl-2-pyridin-4-ylpyrimidin-4-yl)hydrazine Chemical compound CCCC1=CC(NN)=NC(C=2C=CN=CC=2)=N1 RDMBFHKPEDAOOP-UHFFFAOYSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- PATRWXZXMJPFMI-UHFFFAOYSA-N 1,1-bis(2-hydroxyethyl)-3-methyl-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound OCCN(CCO)C(=O)N(C)C1=CC=NC(C=2C=CN=CC=2)=N1 PATRWXZXMJPFMI-UHFFFAOYSA-N 0.000 description 1
- VJJRJOLUUXILGW-UHFFFAOYSA-N 1,1-diethyl-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound CCN(CC)C(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 VJJRJOLUUXILGW-UHFFFAOYSA-N 0.000 description 1
- BNHKHVDRAVIGRX-UHFFFAOYSA-N 1-(1-hydroxy-2-methylpropan-2-yl)-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound OCC(C)(C)NC(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 BNHKHVDRAVIGRX-UHFFFAOYSA-N 0.000 description 1
- QZGUBUFPPQSVRB-UHFFFAOYSA-N 1-(2-methylprop-2-enyl)-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound CC(=C)CNC(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 QZGUBUFPPQSVRB-UHFFFAOYSA-N 0.000 description 1
- VFXLWXZCARSXQI-UHFFFAOYSA-N 1-cyclohexyl-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound C=1C=NC(C=2C=CN=CC=2)=NC=1NC(=O)NC1CCCCC1 VFXLWXZCARSXQI-UHFFFAOYSA-N 0.000 description 1
- SRHOJYGQXSOCDV-UHFFFAOYSA-N 1-cyclopentyl-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound C=1C=NC(C=2C=CN=CC=2)=NC=1NC(=O)NC1CCCC1 SRHOJYGQXSOCDV-UHFFFAOYSA-N 0.000 description 1
- SQINWOOEPDWUNX-UHFFFAOYSA-N 1-ethyl-1-methyl-3-propan-2-yl-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound CCN(C)C(=O)N(C(C)C)C1=CC=NC(C=2C=CN=CC=2)=N1 SQINWOOEPDWUNX-UHFFFAOYSA-N 0.000 description 1
- CLYZVOZARZHKGC-UHFFFAOYSA-N 1-ethyl-3-(2-pyridin-3-ylpyrimidin-4-yl)urea Chemical compound CCNC(=O)NC1=CC=NC(C=2C=NC=CC=2)=N1 CLYZVOZARZHKGC-UHFFFAOYSA-N 0.000 description 1
- LFDGMBVSODIHBX-UHFFFAOYSA-N 1-ethyl-3-propan-2-yl-1-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound CC(C)NC(=O)N(CC)C1=CC=NC(C=2C=CN=CC=2)=N1 LFDGMBVSODIHBX-UHFFFAOYSA-N 0.000 description 1
- LBZUYRGCVDEVMA-UHFFFAOYSA-N 1-hexyl-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound CCCCCCNC(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 LBZUYRGCVDEVMA-UHFFFAOYSA-N 0.000 description 1
- OQURWGJAWSLGQG-UHFFFAOYSA-N 1-isocyanatopropane Chemical compound CCCN=C=O OQURWGJAWSLGQG-UHFFFAOYSA-N 0.000 description 1
- IOGJBCXXNAZISH-UHFFFAOYSA-N 1-methyl-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound CNC(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 IOGJBCXXNAZISH-UHFFFAOYSA-N 0.000 description 1
- UUFQTNFCRMXOAE-UHFFFAOYSA-N 1-methylmethylene Chemical compound C[CH] UUFQTNFCRMXOAE-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- NTJSLEPDQIGERJ-UHFFFAOYSA-N 1-propyl-3-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound CCCNC(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 NTJSLEPDQIGERJ-UHFFFAOYSA-N 0.000 description 1
- KBKPRCGGLSZMRZ-UHFFFAOYSA-N 1-tert-butyl-3-(6-methyl-2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound CC1=CC(NC(=O)NC(C)(C)C)=NC(C=2C=CN=CC=2)=N1 KBKPRCGGLSZMRZ-UHFFFAOYSA-N 0.000 description 1
- NLNDQHXIAGZYOC-UHFFFAOYSA-N 2,6-dimethylpyridine-4-carboxamide Chemical compound CC1=CC(C(N)=O)=CC(C)=N1 NLNDQHXIAGZYOC-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- KGIWPGKKIFFMKP-UHFFFAOYSA-N 2-(ethoxymethylidene)-3-hydroxybutanedinitrile Chemical compound CCOC=C(C#N)C(O)C#N KGIWPGKKIFFMKP-UHFFFAOYSA-N 0.000 description 1
- OEICGMPRFOJHKO-UHFFFAOYSA-N 2-(ethoxymethylidene)propanedinitrile Chemical compound CCOC=C(C#N)C#N OEICGMPRFOJHKO-UHFFFAOYSA-N 0.000 description 1
- VZLVJKSSFSNFPB-UHFFFAOYSA-N 2-[(2-pyridin-4-ylpyrimidin-4-yl)amino]ethanol Chemical compound OCCNC1=CC=NC(C=2C=CN=CC=2)=N1 VZLVJKSSFSNFPB-UHFFFAOYSA-N 0.000 description 1
- UXFQFBNBSPQBJW-UHFFFAOYSA-N 2-amino-2-methylpropane-1,3-diol Chemical compound OCC(N)(C)CO UXFQFBNBSPQBJW-UHFFFAOYSA-N 0.000 description 1
- LWTBJUQFUISATQ-UHFFFAOYSA-N 2-ethylpyridine-4-carboxamide Chemical compound CCC1=CC(C(N)=O)=CC=N1 LWTBJUQFUISATQ-UHFFFAOYSA-N 0.000 description 1
- MCKLFMRKFKYTFJ-UHFFFAOYSA-N 2-methyl-n-(2-pyridin-4-ylpyrimidin-4-yl)propanamide Chemical compound CC(C)C(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 MCKLFMRKFKYTFJ-UHFFFAOYSA-N 0.000 description 1
- FCYVWWWTHPPJII-UHFFFAOYSA-N 2-methylidenepropanedinitrile Chemical compound N#CC(=C)C#N FCYVWWWTHPPJII-UHFFFAOYSA-N 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- BRSYTDWQLDZUPF-UHFFFAOYSA-N 2-methylpyridine-4-carboxamide Chemical compound CC1=CC(C(N)=O)=CC=N1 BRSYTDWQLDZUPF-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- QWZCVWDBKDSCOA-UHFFFAOYSA-N 2-pyridin-4-ylpyrimidin-4-amine;dihydrochloride Chemical compound Cl.Cl.NC1=CC=NC(C=2C=CN=CC=2)=N1 QWZCVWDBKDSCOA-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- BPNXXMUMCQMFLU-UHFFFAOYSA-N 3-isocyanato-2-methylprop-1-ene Chemical compound CC(=C)CN=C=O BPNXXMUMCQMFLU-UHFFFAOYSA-N 0.000 description 1
- QMDMUIQZTHZWGH-UHFFFAOYSA-N 3-methylpyridine-4-carboxamide Chemical compound CC1=CN=CC=C1C(N)=O QMDMUIQZTHZWGH-UHFFFAOYSA-N 0.000 description 1
- ZJQBJLXZTYYXGC-UHFFFAOYSA-N 3-tert-butyl-1-methyl-1-(2-pyridin-4-ylpyrimidin-4-yl)urea Chemical compound CC(C)(C)NC(=O)N(C)C1=CC=NC(C=2C=CN=CC=2)=N1 ZJQBJLXZTYYXGC-UHFFFAOYSA-N 0.000 description 1
- BBRWYVYBIRGEQK-UHFFFAOYSA-N 4-chloro-2-pyridin-4-ylpyrimidine Chemical compound ClC1=CC=NC(C=2C=CN=CC=2)=N1 BBRWYVYBIRGEQK-UHFFFAOYSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- AVIGQIBKXVCDKC-UHFFFAOYSA-N 5-ethyl-2-pyridin-4-ylpyrimidin-4-amine Chemical compound N1=C(N)C(CC)=CN=C1C1=CC=NC=C1 AVIGQIBKXVCDKC-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 235000006491 Acacia senegal Nutrition 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 101100167062 Caenorhabditis elegans chch-3 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- AAWZDTNXLSGCEK-UHFFFAOYSA-N Cordycepinsaeure Natural products OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 108060003951 Immunoglobulin Proteins 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- VLCDUOXHFNUCKK-UHFFFAOYSA-N N,N'-Dimethylthiourea Chemical compound CNC(=S)NC VLCDUOXHFNUCKK-UHFFFAOYSA-N 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- 125000000815 N-oxide group Chemical group 0.000 description 1
- DCEXDOWHJWIRNN-UHFFFAOYSA-N NC1=CC=[N+]([O-])C(C=2C=CN=CC=2)=N1 Chemical compound NC1=CC=[N+]([O-])C(C=2C=CN=CC=2)=N1 DCEXDOWHJWIRNN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- AAWZDTNXLSGCEK-ZHQZDSKASA-N Quinic acid Natural products O[C@H]1CC(O)(C(O)=O)C[C@H](O)C1O AAWZDTNXLSGCEK-ZHQZDSKASA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 206010047700 Vomiting Diseases 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- HXBPYFMVGFDZFT-UHFFFAOYSA-N allyl isocyanate Chemical compound C=CCN=C=O HXBPYFMVGFDZFT-UHFFFAOYSA-N 0.000 description 1
- RMRFFCXPLWYOOY-UHFFFAOYSA-N allyl radical Chemical compound [CH2]C=C RMRFFCXPLWYOOY-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- IBDMRHDXAQZJAP-UHFFFAOYSA-N dichlorophosphorylbenzene Chemical compound ClP(Cl)(=O)C1=CC=CC=C1 IBDMRHDXAQZJAP-UHFFFAOYSA-N 0.000 description 1
- CLJWYXVAGLXDQW-UHFFFAOYSA-N dicyclohexylsulfamic acid Chemical class C1CCCCC1N(S(=O)(=O)O)C1CCCCC1 CLJWYXVAGLXDQW-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000004990 dihydroxyalkyl group Chemical group 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- AINBZKYUNWUTRE-UHFFFAOYSA-N ethanol;propan-2-ol Chemical compound CCO.CC(C)O AINBZKYUNWUTRE-UHFFFAOYSA-N 0.000 description 1
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- JYVHOGDBFNJNMR-UHFFFAOYSA-N hexane;hydrate Chemical compound O.CCCCCC JYVHOGDBFNJNMR-UHFFFAOYSA-N 0.000 description 1
- YWGHUJQYGPDNKT-UHFFFAOYSA-N hexanoyl chloride Chemical compound CCCCCC(Cl)=O YWGHUJQYGPDNKT-UHFFFAOYSA-N 0.000 description 1
- ANJPRQPHZGHVQB-UHFFFAOYSA-N hexyl isocyanate Chemical compound CCCCCCN=C=O ANJPRQPHZGHVQB-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 102000018358 immunoglobulin Human genes 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000037230 mobility Effects 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- QMKKJBRRKIKWFK-UHFFFAOYSA-N n,2,2-trimethylpropanamide Chemical compound CNC(=O)C(C)(C)C QMKKJBRRKIKWFK-UHFFFAOYSA-N 0.000 description 1
- HGXADWSUAXJGSP-UHFFFAOYSA-N n,6-dimethyl-2-pyridin-4-ylpyrimidin-4-amine Chemical compound CNC1=CC(C)=NC(C=2C=CN=CC=2)=N1 HGXADWSUAXJGSP-UHFFFAOYSA-N 0.000 description 1
- OFCCYDUUBNUJIB-UHFFFAOYSA-N n,n-diethylcarbamoyl chloride Chemical compound CCN(CC)C(Cl)=O OFCCYDUUBNUJIB-UHFFFAOYSA-N 0.000 description 1
- KMODMELPUBASHE-UHFFFAOYSA-N n-(2-pyridin-4-ylpyrimidin-4-yl)hexanamide Chemical compound CCCCCC(=O)NC1=CC=NC(C=2C=CN=CC=2)=N1 KMODMELPUBASHE-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- YDFTXRCSHWSELZ-UHFFFAOYSA-N n-ethyl-n-(2-pyridin-4-ylpyrimidin-4-yl)imidazole-1-carboxamide Chemical compound C=1C=NC(C=2C=CN=CC=2)=NC=1N(CC)C(=O)N1C=CN=C1 YDFTXRCSHWSELZ-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- UJKKNNPWQLWKRY-UHFFFAOYSA-N n-propan-2-yl-n-(2-pyridin-4-ylpyrimidin-4-yl)imidazole-1-carboxamide Chemical compound C=1C=NC(C=2C=CN=CC=2)=NC=1N(C(C)C)C(=O)N1C=CN=C1 UJKKNNPWQLWKRY-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- GSUAURPIYWEOII-UHFFFAOYSA-N pyridine-3-carboxamide;dihydrochloride Chemical compound Cl.Cl.NC(=O)C1=CC=CN=C1 GSUAURPIYWEOII-UHFFFAOYSA-N 0.000 description 1
- RJLCIACWXJHILW-UHFFFAOYSA-N pyridine-4-carboxamide;dihydrochloride Chemical compound Cl.Cl.NC(=O)C1=CC=NC=C1 RJLCIACWXJHILW-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- OYRRZWATULMEPF-UHFFFAOYSA-N pyrimidin-4-amine Chemical compound NC1=CC=NC=N1 OYRRZWATULMEPF-UHFFFAOYSA-N 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- ZHNFLHYOFXQIOW-LPYZJUEESA-N quinine sulfate dihydrate Chemical compound [H+].[H+].O.O.[O-]S([O-])(=O)=O.C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21.C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 ZHNFLHYOFXQIOW-LPYZJUEESA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 238000012453 sprague-dawley rat model Methods 0.000 description 1
- 238000007655 standard test method Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 235000012976 tarts Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- ISHLCKAQWKBMAU-UHFFFAOYSA-N tert-butyl n-diazocarbamate Chemical compound CC(C)(C)OC(=O)N=[N+]=[N-] ISHLCKAQWKBMAU-UHFFFAOYSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 230000008673 vomiting Effects 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US05/556,213 US4008235A (en) | 1975-03-07 | 1975-03-07 | N-[2-(pyridinyl)-4-pyrimidinyl]ureas |
Publications (1)
Publication Number | Publication Date |
---|---|
NO760779L true NO760779L (xx) | 1976-09-08 |
Family
ID=24220364
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO760779A NO760779L (xx) | 1975-03-07 | 1976-03-05 |
Country Status (15)
Country | Link |
---|---|
US (1) | US4008235A (xx) |
JP (1) | JPS51113884A (xx) |
AU (1) | AU1169176A (xx) |
BE (1) | BE839163A (xx) |
CA (1) | CA1051432A (xx) |
DE (1) | DE2609208A1 (xx) |
DK (1) | DK97476A (xx) |
FI (1) | FI760555A (xx) |
FR (1) | FR2302744A1 (xx) |
GB (1) | GB1530412A (xx) |
NL (1) | NL7602379A (xx) |
NO (1) | NO760779L (xx) |
PH (1) | PH11387A (xx) |
SE (1) | SE7603051L (xx) |
ZA (1) | ZA761300B (xx) |
Families Citing this family (10)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4144338A (en) * | 1977-02-17 | 1979-03-13 | Merck & Co., Inc. | N-pyrimidinyl-N-dialkylaminoalkyl ureas |
US4415575A (en) * | 1979-03-13 | 1983-11-15 | Merck & Co., Inc. | Suppression of gastric acid secretion using pyrimidylcarbamates |
US4226871A (en) * | 1979-03-13 | 1980-10-07 | Merck & Co., Inc. | Heterocyclic carbamates |
CA1244028A (en) * | 1983-04-14 | 1988-11-01 | Hans Maag | Pyrimidine derivatives |
US4504482A (en) * | 1983-07-28 | 1985-03-12 | Sterling Drug Inc. | [5(or 4)-(Pyridinyl)-2-pyrimidinyl]ureas and cardiotonic use thereof |
DE3675197D1 (de) * | 1985-12-03 | 1990-11-29 | Sumitomo Chemical Co | Pyridinylpyrimidin-derivate, verfahren zu deren herstellung und diese als wirksamen stoff enthaltende pflanzenkrankheiten-schutzmittel. |
PH23565A (en) * | 1986-09-05 | 1989-08-25 | Sumitomo Chemical Co | Novel pyrimidinylpyrimidine derivatives and a plant disease protectant containing them as the active ingredient |
NZ219486A (en) * | 1987-03-04 | 1990-05-28 | Kenneth Wilfred Feisst | Foldable and rollable building |
EP0489925B1 (en) * | 1990-07-03 | 1996-06-12 | Mitsui Petrochemical Industries, Ltd. | Pyrimidine compound and pharmaceutically acceptable salt thereof |
EP2368883A1 (en) * | 2010-03-24 | 2011-09-28 | Lonza Ltd. | Process for the preparation of 2-substituted 4-amino-5-cyanopyrimidines |
Family Cites Families (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3673184A (en) * | 1970-09-02 | 1972-06-27 | Dainippon Pharmaceutical Co | Certain 2-substituted-5,8-dihydro-5-oxopyrido{8 2,3-d{9 pyrimidine-6-carboxylic acid derivatives |
-
1975
- 1975-03-07 US US05/556,213 patent/US4008235A/en not_active Expired - Lifetime
-
1976
- 1976-02-23 GB GB7110/76A patent/GB1530412A/en not_active Expired
- 1976-03-04 FI FI760555A patent/FI760555A/fi not_active Application Discontinuation
- 1976-03-04 AU AU11691/76A patent/AU1169176A/en not_active Expired
- 1976-03-04 BE BE1007228A patent/BE839163A/xx unknown
- 1976-03-04 CA CA247,151A patent/CA1051432A/en not_active Expired
- 1976-03-04 ZA ZA761300A patent/ZA761300B/xx unknown
- 1976-03-05 PH PH18176A patent/PH11387A/en unknown
- 1976-03-05 FR FR7606352A patent/FR2302744A1/fr active Granted
- 1976-03-05 JP JP51024067A patent/JPS51113884A/ja active Pending
- 1976-03-05 DK DK97476*#A patent/DK97476A/da unknown
- 1976-03-05 DE DE19762609208 patent/DE2609208A1/de active Pending
- 1976-03-05 SE SE7603051A patent/SE7603051L/xx unknown
- 1976-03-05 NL NL7602379A patent/NL7602379A/xx not_active Application Discontinuation
- 1976-03-05 NO NO760779A patent/NO760779L/no unknown
Also Published As
Publication number | Publication date |
---|---|
AU1169176A (en) | 1977-09-08 |
ZA761300B (en) | 1977-02-23 |
FR2302744B1 (xx) | 1979-09-21 |
DE2609208A1 (de) | 1976-09-16 |
CA1051432A (en) | 1979-03-27 |
JPS51113884A (en) | 1976-10-07 |
US4008235A (en) | 1977-02-15 |
SE7603051L (sv) | 1976-09-08 |
FI760555A (xx) | 1976-09-08 |
PH11387A (en) | 1977-11-22 |
FR2302744A1 (fr) | 1976-10-01 |
BE839163A (fr) | 1976-09-06 |
DK97476A (da) | 1976-09-08 |
GB1530412A (en) | 1978-11-01 |
NL7602379A (nl) | 1976-09-09 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
FI89265C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara substituerade piperazinylpyridiner eller piperazinylimidazoler | |
DE69826883T2 (de) | Heteroaryl diazacycloalkane als cholinergische ligande für nikotin-acetylcholin-rezeptoren | |
NO760779L (xx) | ||
CA2874938A1 (en) | Heterocycles capable of modulating t-cell responses, and methods of using same | |
US20060058354A1 (en) | Conjugated aromatic compounds with a pyridine substituent | |
US5854232A (en) | Acyclic anc cyclic amides as neurotransmitter release enhancers | |
PL164989B1 (en) | Method of obtaining diamides of pyrimidin-4,6-dicarboxylic acid | |
US5925655A (en) | αv β3 antagonists | |
US4118571A (en) | 4-Acylamino-2-(pyridinyl)pyrimidine derivatives | |
Whitehead et al. | Diuretics. III. 4, 6-Diaminopyrimidines | |
US4053475A (en) | N-[2-(Pyridinyl)-4-pyrimidinyl]ureas preparation | |
JPS5995287A (ja) | 2−(ピリジニルまたはヒドロキシフエニル)8−置換ピリド〔2,3−d〕ピリミジン−5(8H)−オン類、その製造方法およびそれを含む医薬組成物 | |
US4764519A (en) | 3-hydroxypyridines | |
US4032523A (en) | 4-amino (or halo or hydroxy or hydrazino)-2-(pyridinyl)pyrimidines | |
JPS60502003A (ja) | 強心剤として有効な〔(ピリジニル)−2−ピリミジニル〕尿素及び同化合物を含む製剤 | |
DE2900288A1 (de) | Aminoderivate von pyrazol eckige klammer auf 1,5-a eckige klammer zu s-triazin, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
NO851066L (no) | Pyridinyl-2-pyrimidinaminer egnet som kardiotoniske midler samt fremstilling derav | |
DE2418498A1 (de) | Verschmolzene pyrimidine und deren herstellung | |
US4086233A (en) | 4-(Substituted-amino)-2-(pyridinyl) pyrimidine derivatives | |
DE3427823A1 (de) | 5-subst.-(1,2,4) triazolo (1,5-c) pyrimidin-2-amine | |
US4109092A (en) | Preparation of 2-(pyridinyl)-4-pyrimidinamines | |
US4514400A (en) | Cardiotonic 5-heteroaryl-pyridone | |
AU696007B2 (en) | Use of unsubstituted and substituted N-(pyrrol-1-yl) pyridinamines as anticonvulsant agents | |
DE69331234T2 (de) | Neue nicotinsäureester | |
DD201594A5 (de) | Verfahren zur herstellung von neuen polyazaheterocyclischen verbindungen |