NO743160L - - Google Patents
Info
- Publication number
- NO743160L NO743160L NO743160A NO743160A NO743160L NO 743160 L NO743160 L NO 743160L NO 743160 A NO743160 A NO 743160A NO 743160 A NO743160 A NO 743160A NO 743160 L NO743160 L NO 743160L
- Authority
- NO
- Norway
- Prior art keywords
- chromium
- acid
- salt
- mixture
- stated
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 85
- 150000001844 chromium Chemical class 0.000 claims description 58
- 239000002253 acid Substances 0.000 claims description 54
- 239000011651 chromium Substances 0.000 claims description 46
- 229910052804 chromium Inorganic materials 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 41
- 239000000243 solution Substances 0.000 claims description 40
- 150000003839 salts Chemical class 0.000 claims description 30
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 claims description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 27
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 25
- 239000003960 organic solvent Substances 0.000 claims description 20
- -1 aliphatic monocarboxylic acid Chemical class 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 claims description 14
- OBETXYAYXDNJHR-SSDOTTSWSA-M (2r)-2-ethylhexanoate Chemical compound CCCC[C@@H](CC)C([O-])=O OBETXYAYXDNJHR-SSDOTTSWSA-M 0.000 claims description 12
- 125000001931 aliphatic group Chemical class 0.000 claims description 11
- 150000003863 ammonium salts Chemical class 0.000 claims description 11
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 11
- 235000010755 mineral Nutrition 0.000 claims description 11
- 239000011707 mineral Substances 0.000 claims description 11
- 238000004519 manufacturing process Methods 0.000 claims description 10
- 239000002480 mineral oil Substances 0.000 claims description 10
- 235000010446 mineral oil Nutrition 0.000 claims description 10
- 239000003208 petroleum Substances 0.000 claims description 10
- AITAOEOXKILIIK-UHFFFAOYSA-K chromium(3+) hexanoate Chemical compound [Cr+3].CCCCCC([O-])=O.CCCCCC([O-])=O.CCCCCC([O-])=O AITAOEOXKILIIK-UHFFFAOYSA-K 0.000 claims description 9
- NPCUWXDZFXSRLT-UHFFFAOYSA-N chromium;2-ethylhexanoic acid Chemical compound [Cr].CCCCC(CC)C(O)=O NPCUWXDZFXSRLT-UHFFFAOYSA-N 0.000 claims description 9
- 229930195733 hydrocarbon Natural products 0.000 claims description 9
- 241000779819 Syncarpia glomulifera Species 0.000 claims description 8
- LJAOOBNHPFKCDR-UHFFFAOYSA-K chromium(3+) trichloride hexahydrate Chemical group O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Cr+3] LJAOOBNHPFKCDR-UHFFFAOYSA-K 0.000 claims description 8
- 239000001739 pinus spp. Substances 0.000 claims description 8
- 229940036248 turpentine Drugs 0.000 claims description 8
- 239000007864 aqueous solution Substances 0.000 claims description 7
- 150000002430 hydrocarbons Chemical class 0.000 claims description 7
- WOWYPHJOHOCYII-VOTSOKGWSA-N (e)-2-ethylhex-2-enoic acid Chemical compound CCC\C=C(/CC)C(O)=O WOWYPHJOHOCYII-VOTSOKGWSA-N 0.000 claims description 5
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 150000002763 monocarboxylic acids Chemical class 0.000 claims description 4
- 239000003921 oil Substances 0.000 claims description 4
- XTCNGAJYWUIFFB-UHFFFAOYSA-N 2-ethyl-4-methylpentanoic acid Chemical compound CCC(C(O)=O)CC(C)C XTCNGAJYWUIFFB-UHFFFAOYSA-N 0.000 claims description 3
- OILUAKBAMVLXGF-UHFFFAOYSA-N 3,5,5-trimethyl-hexanoic acid Chemical compound OC(=O)CC(C)CC(C)(C)C OILUAKBAMVLXGF-UHFFFAOYSA-N 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims description 3
- BFGKITSFLPAWGI-UHFFFAOYSA-N chromium(3+) Chemical class [Cr+3] BFGKITSFLPAWGI-UHFFFAOYSA-N 0.000 claims description 3
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 3
- RXGPYPPCEXISOV-UHFFFAOYSA-N 2-propylheptanoic acid Chemical compound CCCCCC(C(O)=O)CCC RXGPYPPCEXISOV-UHFFFAOYSA-N 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 2
- JGFYAUCVQZTNGI-UHFFFAOYSA-K C(CC)C(C(=O)[O-])CCCCC.[Cr+3].C(CC)C(C(=O)[O-])CCCCC.C(CC)C(C(=O)[O-])CCCCC Chemical compound C(CC)C(C(=O)[O-])CCCCC.[Cr+3].C(CC)C(C(=O)[O-])CCCCC.C(CC)C(C(=O)[O-])CCCCC JGFYAUCVQZTNGI-UHFFFAOYSA-K 0.000 claims 1
- OUEVMDCGCPQYCX-UHFFFAOYSA-K chromium(3+) 2-ethyl-4-methylpentanoate Chemical compound C(C)C(C(=O)[O-])CC(C)C.[Cr+3].C(C)C(C(=O)[O-])CC(C)C.C(C)C(C(=O)[O-])CC(C)C OUEVMDCGCPQYCX-UHFFFAOYSA-K 0.000 claims 1
- IGRSPAMYVWCECY-UHFFFAOYSA-K chromium(3+);3,5,5-trimethylhexanoate Chemical compound [Cr+3].[O-]C(=O)CC(C)CC(C)(C)C.[O-]C(=O)CC(C)CC(C)(C)C.[O-]C(=O)CC(C)CC(C)(C)C IGRSPAMYVWCECY-UHFFFAOYSA-K 0.000 claims 1
- 239000012071 phase Substances 0.000 description 17
- 239000012266 salt solution Substances 0.000 description 16
- 239000012074 organic phase Substances 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 150000007513 acids Chemical class 0.000 description 12
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 10
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 10
- 239000000908 ammonium hydroxide Substances 0.000 description 10
- 230000000052 comparative effect Effects 0.000 description 10
- 238000011084 recovery Methods 0.000 description 10
- 238000003756 stirring Methods 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000446 fuel Substances 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- FGKJLKRYENPLQH-UHFFFAOYSA-N isocaproic acid Chemical compound CC(C)CCC(O)=O FGKJLKRYENPLQH-UHFFFAOYSA-N 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 235000015096 spirit Nutrition 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 3
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 2
- NKBWMBRPILTCRD-UHFFFAOYSA-N 2-Methylheptanoic acid Chemical compound CCCCCC(C)C(O)=O NKBWMBRPILTCRD-UHFFFAOYSA-N 0.000 description 2
- KUSYIGBGHPOWEL-UHFFFAOYSA-N 2-methyl nonaoic acid Chemical compound CCCCCCCC(C)C(O)=O KUSYIGBGHPOWEL-UHFFFAOYSA-N 0.000 description 2
- LAIUFBWHERIJIH-UHFFFAOYSA-N 3-Methylheptane Chemical compound CCCCC(C)CC LAIUFBWHERIJIH-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229910021556 Chromium(III) chloride Inorganic materials 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- PHFQLYPOURZARY-UHFFFAOYSA-N chromium trinitrate Chemical compound [Cr+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O PHFQLYPOURZARY-UHFFFAOYSA-N 0.000 description 2
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 2
- 239000011636 chromium(III) chloride Substances 0.000 description 2
- 235000007831 chromium(III) chloride Nutrition 0.000 description 2
- DMEGYFMYUHOHGS-UHFFFAOYSA-N cycloheptane Chemical compound C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 2
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 2
- GHVNFZFCNZKVNT-UHFFFAOYSA-N decanoic acid Chemical compound CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 2
- UMCAHYXGMIMRBJ-UHFFFAOYSA-L dichlorochromium hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].[Cl-].[Cr+2] UMCAHYXGMIMRBJ-UHFFFAOYSA-L 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 2
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 2
- XMGQYMWWDOXHJM-UHFFFAOYSA-N limonene Chemical compound CC(=C)C1CCC(C)=CC1 XMGQYMWWDOXHJM-UHFFFAOYSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- FBUKVWPVBMHYJY-UHFFFAOYSA-N nonanoic acid Chemical compound CCCCCCCCC(O)=O FBUKVWPVBMHYJY-UHFFFAOYSA-N 0.000 description 2
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 2
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 2
- 229910001414 potassium ion Inorganic materials 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 239000001602 (E)-hex-3-enoic acid Substances 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical group ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- VUAXHMVRKOTJKP-UHFFFAOYSA-N 2,2-dimethylbutyric acid Chemical compound CCC(C)(C)C(O)=O VUAXHMVRKOTJKP-UHFFFAOYSA-N 0.000 description 1
- IKNDGHRNXGEHTO-UHFFFAOYSA-N 2,2-dimethyloctanoic acid Chemical compound CCCCCCC(C)(C)C(O)=O IKNDGHRNXGEHTO-UHFFFAOYSA-N 0.000 description 1
- XFOASZQZPWEJAA-UHFFFAOYSA-N 2,3-dimethylbutyric acid Chemical compound CC(C)C(C)C(O)=O XFOASZQZPWEJAA-UHFFFAOYSA-N 0.000 description 1
- YCEXWYRQBCLZPT-UHFFFAOYSA-N 2,3-dimethylhex-3-enoic acid Chemical compound CCC=C(C)C(C)C(O)=O YCEXWYRQBCLZPT-UHFFFAOYSA-N 0.000 description 1
- LBUDVZDSWKZABS-UHFFFAOYSA-N 2,3-dimethylpentanoic acid Chemical compound CCC(C)C(C)C(O)=O LBUDVZDSWKZABS-UHFFFAOYSA-N 0.000 description 1
- OHHDBSVXENZHSY-UHFFFAOYSA-N 2,4,5-trimethylhex-3-enoic acid Chemical compound CC(C)C(C)=CC(C)C(O)=O OHHDBSVXENZHSY-UHFFFAOYSA-N 0.000 description 1
- DCELYZLYGOHVMN-FNORWQNLSA-N 2,4-Dimethyl-2-hexenoic acid Chemical compound CCC(C)\C=C(/C)C(O)=O DCELYZLYGOHVMN-FNORWQNLSA-N 0.000 description 1
- WLAMNBDJUVNPJU-BYPYZUCNSA-N 2-Methylbutanoic acid Natural products CC[C@H](C)C(O)=O WLAMNBDJUVNPJU-BYPYZUCNSA-N 0.000 description 1
- ODECEOSYVXMJSY-UHFFFAOYSA-N 2-ethyl-2,3-dimethylbutanoic acid Chemical compound CCC(C)(C(C)C)C(O)=O ODECEOSYVXMJSY-UHFFFAOYSA-N 0.000 description 1
- UUFJSYYIHBBQAO-UHFFFAOYSA-N 2-ethyl-4-methylheptanoic acid Chemical compound CCCC(C)CC(CC)C(O)=O UUFJSYYIHBBQAO-UHFFFAOYSA-N 0.000 description 1
- UOWVUSQOFFHRDX-UHFFFAOYSA-N 2-ethyl-5,5-dimethylhexanoic acid Chemical compound CCC(C(O)=O)CCC(C)(C)C UOWVUSQOFFHRDX-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-UHFFFAOYSA-N 2-methylbutyric acid Chemical compound CCC(C)C(O)=O WLAMNBDJUVNPJU-UHFFFAOYSA-N 0.000 description 1
- MLMQPDHYNJCQAO-UHFFFAOYSA-N 3,3-dimethylbutyric acid Chemical compound CC(C)(C)CC(O)=O MLMQPDHYNJCQAO-UHFFFAOYSA-N 0.000 description 1
- IVNGZEIOFBESSH-UHFFFAOYSA-N 3,3-dimethyloctanoic acid Chemical compound CCCCCC(C)(C)CC(O)=O IVNGZEIOFBESSH-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-M 3-Methylbutanoic acid Natural products CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 1
- DFXIEQPEDLPPFF-UHFFFAOYSA-N 3-ethyl-3-methylheptanoic acid Chemical compound CCCCC(C)(CC)CC(O)=O DFXIEQPEDLPPFF-UHFFFAOYSA-N 0.000 description 1
- QCRHZXIWQNRGFW-UHFFFAOYSA-N 3-ethylhept-2-enoic acid Chemical compound CCCCC(CC)=CC(O)=O QCRHZXIWQNRGFW-UHFFFAOYSA-N 0.000 description 1
- ZVFMGRBZBQCROK-UHFFFAOYSA-N 3-methyl-2-propylhexanoic acid Chemical compound CCCC(C)C(C(O)=O)CCC ZVFMGRBZBQCROK-UHFFFAOYSA-N 0.000 description 1
- GBBXAKWLJDVDQY-UHFFFAOYSA-N 3-methylhex-3-enoic acid Chemical compound CCC=C(C)CC(O)=O GBBXAKWLJDVDQY-UHFFFAOYSA-N 0.000 description 1
- ZNTOJVABYRHABR-UHFFFAOYSA-N 3-propan-2-ylhex-2-enoic acid Chemical compound CCCC(C(C)C)=CC(O)=O ZNTOJVABYRHABR-UHFFFAOYSA-N 0.000 description 1
- GTZIRUJXPHARLG-UHFFFAOYSA-N 3-propylheptanoic acid Chemical compound CCCCC(CCC)CC(O)=O GTZIRUJXPHARLG-UHFFFAOYSA-N 0.000 description 1
- WQUHPLQCUQJSQW-VOTSOKGWSA-N 4-[(e)-2-phenylethenyl]benzonitrile Chemical compound C1=CC(C#N)=CC=C1\C=C\C1=CC=CC=C1 WQUHPLQCUQJSQW-VOTSOKGWSA-N 0.000 description 1
- OHWAWCCJNMDSHS-UHFFFAOYSA-N 5-ethyl-2-methylheptanoic acid Chemical compound CCC(CC)CCC(C)C(O)=O OHWAWCCJNMDSHS-UHFFFAOYSA-N 0.000 description 1
- DHODJQDPMFRMDA-UHFFFAOYSA-N 5-methyl-2-propylhexanoic acid Chemical compound CCCC(C(O)=O)CCC(C)C DHODJQDPMFRMDA-UHFFFAOYSA-N 0.000 description 1
- BWDBEAQIHAEVLV-UHFFFAOYSA-N 6-methylheptan-1-ol Chemical compound CC(C)CCCCCO BWDBEAQIHAEVLV-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XXHDAWYDNSXJQM-UHFFFAOYSA-N Chloride-3-Hexenoic acid Natural products CCC=CCC(O)=O XXHDAWYDNSXJQM-UHFFFAOYSA-N 0.000 description 1
- 229910021554 Chromium(II) chloride Inorganic materials 0.000 description 1
- 102000013382 Gelatinases Human genes 0.000 description 1
- 108010026132 Gelatinases Proteins 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 244000154870 Viola adunca Species 0.000 description 1
- 235000005811 Viola adunca Nutrition 0.000 description 1
- 235000013487 Viola odorata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- NNBFNNNWANBMTI-UHFFFAOYSA-M brilliant green Chemical compound OS([O-])(=O)=O.C1=CC(N(CC)CC)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](CC)CC)C=C1 NNBFNNNWANBMTI-UHFFFAOYSA-M 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229940068911 chloride hexahydrate Drugs 0.000 description 1
- OIDPCXKPHYRNKH-UHFFFAOYSA-J chrome alum Chemical compound [K]OS(=O)(=O)O[Cr]1OS(=O)(=O)O1 OIDPCXKPHYRNKH-UHFFFAOYSA-J 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 150000001845 chromium compounds Chemical class 0.000 description 1
- DSHWASKZZBZKOE-UHFFFAOYSA-K chromium(3+);hydroxide;sulfate Chemical compound [OH-].[Cr+3].[O-]S([O-])(=O)=O DSHWASKZZBZKOE-UHFFFAOYSA-K 0.000 description 1
- XBWRJSSJWDOUSJ-UHFFFAOYSA-L chromium(ii) chloride Chemical compound Cl[Cr]Cl XBWRJSSJWDOUSJ-UHFFFAOYSA-L 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- VOAPTKOANCCNFV-UHFFFAOYSA-N hexahydrate;hydrochloride Chemical compound O.O.O.O.O.O.Cl VOAPTKOANCCNFV-UHFFFAOYSA-N 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000001282 iso-butane Substances 0.000 description 1
- 229940059904 light mineral oil Drugs 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical class CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- HVAMZGADVCBITI-UHFFFAOYSA-N pent-4-enoic acid Chemical compound OC(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-N 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- XXHDAWYDNSXJQM-ONEGZZNKSA-N trans-hex-3-enoic acid Chemical compound CC\C=C\CC(O)=O XXHDAWYDNSXJQM-ONEGZZNKSA-N 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C53/00—Saturated compounds having only one carboxyl group bound to an acyclic carbon atom or hydrogen
- C07C53/126—Acids containing more than four carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F11/00—Compounds containing elements of Groups 6 or 16 of the Periodic Table
- C07F11/005—Compounds containing elements of Groups 6 or 16 of the Periodic Table compounds without a metal-carbon linkage
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
- Paints Or Removers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/403,319 US3932285A (en) | 1973-10-03 | 1973-10-03 | Chromium salt compositions and a process for their production |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO743160L true NO743160L (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1975-04-28 |
Family
ID=23595355
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO743160A NO743160L (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1973-10-03 | 1974-09-03 |
Country Status (15)
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4104293A (en) * | 1976-05-05 | 1978-08-01 | Petrolite Corporation | Oil-soluble chromium compositions |
| US4177162A (en) * | 1977-12-05 | 1979-12-04 | Phillips Petroleum Company | Sulfiding and reoxidation of chromium catalyst |
| US4263151A (en) * | 1979-08-03 | 1981-04-21 | Petrolite Corporation | Oil solutions and/or dispersions of hydrated chromium oxides |
| US4440574A (en) * | 1983-02-22 | 1984-04-03 | E. I. Du Pont De Nemours & Company | Nonsludging complexes of chromium and stearic acid |
| US4863892A (en) * | 1983-08-16 | 1989-09-05 | Phillips Petroleum Company | Antifoulants comprising tin, antimony and aluminum for thermal cracking processes |
| US4636572A (en) * | 1985-03-11 | 1987-01-13 | Phillips Petroleum Company | Permeability contrast correction employing propionate-sequestered chromium(III) prepared by nitrite/dichromate redox |
| US4644073A (en) * | 1985-03-11 | 1987-02-17 | Phillips Petroleum Company | Permeability contrast correction employing a sulfate-free propionate-sequestered chromium (III) solution |
| DE69408373T2 (de) * | 1993-06-01 | 1998-07-16 | Ono Pharmaceutical Co | Pentansäurederivate |
| US6300373B1 (en) | 1993-09-10 | 2001-10-09 | American Biogenetic Sciences, Inc. | Antiproliferative and neurotrophic molecules |
| US5672746A (en) | 1994-08-30 | 1997-09-30 | American Biogenetic Sciences, Inc. | Antiproliferative and neurotrophic molecules |
| US5591878A (en) * | 1995-09-19 | 1997-01-07 | Kemin Industries, Inc. | Catalyzed process for producing metal carboxylates for use as animal feed supplements |
| HUP0102456A3 (en) | 1998-06-22 | 2003-07-28 | American Biogenetic Sciences | The use of valproic acid analog for the treatment and prevention of migraine and affective illness |
| RU2190058C2 (ru) * | 2000-12-13 | 2002-09-27 | Хабаровский государственный технический университет | Каток на пневматических шинах |
| US20050187418A1 (en) * | 2004-02-19 | 2005-08-25 | Small Brooke L. | Olefin oligomerization |
| US20070043181A1 (en) * | 2005-08-19 | 2007-02-22 | Knudsen Ronald D | Methods of preparation of an olefin oligomerization catalyst |
| US20050187098A1 (en) * | 2004-02-20 | 2005-08-25 | Knudsen Ronald D. | Methods of preparation of an olefin oligomerization catalyst |
| US9550841B2 (en) | 2004-02-20 | 2017-01-24 | Chevron Phillips Chemical Company Lp | Methods of preparation of an olefin oligomerization catalyst |
| US7384886B2 (en) * | 2004-02-20 | 2008-06-10 | Chevron Phillips Chemical Company Lp | Methods of preparation of an olefin oligomerization catalyst |
| CA2556520C (en) * | 2005-01-27 | 2008-10-28 | Ocean Nutrition Canada Ltd. | Chromium-fatty acid compounds and methods of making and using thereof |
| US7902415B2 (en) * | 2007-12-21 | 2011-03-08 | Chevron Phillips Chemical Company Lp | Processes for dimerizing or isomerizing olefins |
| WO2010051405A1 (en) * | 2008-10-31 | 2010-05-06 | Chevron Phillips Chemical Company Lp | Compositions and catalyst systems of metal precursors and olefinic diluents |
| US8471085B2 (en) | 2008-10-31 | 2013-06-25 | Chevron Phillips Chemical Company Lp | Oligomerization catalyst system and process for oligomerizing olefins |
| US8957235B2 (en) | 2011-12-12 | 2015-02-17 | Chevron Phillips Chemical Company Lp | Preparation of transition metal carboxylates |
| US9956548B2 (en) | 2011-12-12 | 2018-05-01 | Chevron Phillips Chemical Company Lp | Preparation of an olefin oligomerization catalyst |
| US9586872B2 (en) | 2011-12-30 | 2017-03-07 | Chevron Phillips Chemical Company Lp | Olefin oligomerization methods |
| CN114790136A (zh) * | 2022-03-08 | 2022-07-26 | 中国石油天然气股份有限公司 | 活性三价有机铬化合物的制备方法及应用 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3136796A (en) * | 1961-06-08 | 1964-06-09 | Du Pont | Werner complex compounds of chromium and polycarboxylic acids |
-
1973
- 1973-10-03 US US05/403,319 patent/US3932285A/en not_active Expired - Lifetime
-
1974
- 1974-08-07 ZA ZA00745050A patent/ZA745050B/xx unknown
- 1974-08-14 IL IL45476A patent/IL45476A/en unknown
- 1974-08-27 BE BE147949A patent/BE819245A/xx unknown
- 1974-08-27 FR FR7429267A patent/FR2246531B1/fr not_active Expired
- 1974-09-02 CH CH1190574A patent/CH605546A5/xx not_active IP Right Cessation
- 1974-09-03 NO NO743160A patent/NO743160L/no unknown
- 1974-09-18 GB GB4075274A patent/GB1469986A/en not_active Expired
- 1974-09-19 NL NL7412409A patent/NL7412409A/xx not_active Application Discontinuation
- 1974-10-01 IT IT53317/74A patent/IT1029599B/it active
- 1974-10-01 DD DD181438A patent/DD113887A5/xx unknown
- 1974-10-01 JP JP49112374A patent/JPS5059314A/ja active Pending
- 1974-10-02 DE DE19742447080 patent/DE2447080A1/de not_active Withdrawn
- 1974-10-02 DK DK519374A patent/DK519374A/da not_active Application Discontinuation
- 1974-10-02 SE SE7412407A patent/SE400293B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2246531B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1979-01-05 |
| IT1029599B (it) | 1979-03-20 |
| NL7412409A (nl) | 1975-04-07 |
| BE819245A (fr) | 1974-12-16 |
| JPS5059314A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1975-05-22 |
| DE2447080A1 (de) | 1975-04-10 |
| IL45476A0 (en) | 1974-11-29 |
| DD113887A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1975-07-05 |
| SE7412407L (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1975-04-04 |
| AU7383074A (en) | 1976-04-08 |
| US3932285A (en) | 1976-01-13 |
| CH605546A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1978-09-29 |
| DK519374A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1975-06-09 |
| FR2246531A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1975-05-02 |
| ZA745050B (en) | 1975-08-27 |
| IL45476A (en) | 1977-05-31 |
| SE400293B (sv) | 1978-03-20 |
| GB1469986A (en) | 1977-04-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO743160L (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| NO119746B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| JPH07502035A (ja) | 不飽和脂肪酸又はそのエステルの酸化分解によるカルボン酸又はそのエステルの製造方法 | |
| US4380632A (en) | Method of preparing quinolines, naphthyridines and other nitrogen bi-heterocyclic compounds | |
| EP0097626B1 (en) | Process for preparing trithiocarbonic acid diesters | |
| US2727928A (en) | Stabilization of alkyl phenol compounds | |
| NO136093B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE2610675A1 (de) | Verfahren zur herstellung von cyanazofarbstoffen | |
| DE60003323T2 (de) | Verfahren für die herstellung von methylenbisphosphonsäure und deren salze | |
| EP0368911B1 (en) | Catalyst composition | |
| DE3314029C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| US3941606A (en) | Metal carboxylate-alkoxy alcoholate composition and process | |
| JPS6054396A (ja) | 炭水化物の新規製造方法 | |
| US2866786A (en) | Production of sultames | |
| JP4253755B2 (ja) | アルミニウムアルキルアセトアセテート化合物及びその製法と印刷インキ付加剤としての使用 | |
| US3652623A (en) | Organic aluminum compounds | |
| EP0142384A2 (en) | A method for the preparation of photoinitiators | |
| US1750299A (en) | Production of acyl resorcinols | |
| EP1174435B1 (de) | Verfahren zur Herstellung von Platin-Alkenylpolysiloxan-Komplexen, insbesondere von Platin-Divinyltetramethyldisiloxan | |
| DE4118444A1 (de) | Verfahren zur herstellung von (2-hydroxyphenyl)essigsaeure | |
| JPS5938216B2 (ja) | コバルト石けんの製造方法 | |
| IL27766A (en) | Process for the preparation of 3,4-dihydro-4-oxo-1,2,3-benzotriazinyl-3-yl methyl thionothiol-phosphoric(-phosphonic,-phosphinic)acid esters | |
| US2468916A (en) | Method for producing organic titanium compounds | |
| US3223719A (en) | Process for producing carboxylic esters from organo manganese compounds | |
| US1888187A (en) | Glucosaminic salts of antimony |