NO742794L - - Google Patents
Info
- Publication number
- NO742794L NO742794L NO742794A NO742794A NO742794L NO 742794 L NO742794 L NO 742794L NO 742794 A NO742794 A NO 742794A NO 742794 A NO742794 A NO 742794A NO 742794 L NO742794 L NO 742794L
- Authority
- NO
- Norway
- Prior art keywords
- halogen
- mol
- substituted
- cyano
- alkyl radical
- Prior art date
Links
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 19
- 229910052801 chlorine Inorganic materials 0.000 claims description 19
- 239000000460 chlorine Substances 0.000 claims description 19
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 16
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 16
- 229910052794 bromium Inorganic materials 0.000 claims description 16
- 229910052736 halogen Inorganic materials 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 13
- 125000005843 halogen group Chemical group 0.000 claims description 12
- -1 hydroxy- Chemical class 0.000 claims description 11
- 150000002367 halogens Chemical group 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000005031 thiocyano group Chemical group S(C#N)* 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 4
- 239000003139 biocide Substances 0.000 claims description 4
- 125000001475 halogen functional group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical group 0.000 claims 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 32
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 17
- 229960000583 acetic acid Drugs 0.000 description 16
- 239000012362 glacial acetic acid Substances 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 230000008018 melting Effects 0.000 description 14
- 238000002844 melting Methods 0.000 description 14
- 239000001632 sodium acetate Substances 0.000 description 13
- 235000017281 sodium acetate Nutrition 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 238000004042 decolorization Methods 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 239000002904 solvent Substances 0.000 description 8
- 235000015097 nutrients Nutrition 0.000 description 7
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 6
- 239000000370 acceptor Substances 0.000 description 4
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 238000009987 spinning Methods 0.000 description 4
- 229920001817 Agar Polymers 0.000 description 3
- 241000195493 Cryptophyta Species 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 239000008272 agar Substances 0.000 description 3
- 244000052616 bacterial pathogen Species 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 2
- 239000005695 Ammonium acetate Substances 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 229940043376 ammonium acetate Drugs 0.000 description 2
- 235000019257 ammonium acetate Nutrition 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- ZJRCIQAMTAINCB-UHFFFAOYSA-N benzoylacetonitrile Chemical compound N#CCC(=O)C1=CC=CC=C1 ZJRCIQAMTAINCB-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000005068 cooling lubricant Substances 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 230000008029 eradication Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 239000003292 glue Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000010985 leather Substances 0.000 description 2
- MHXYWUNYSPAWFW-UHFFFAOYSA-N methyl 2-cyano-3-oxo-3-phenylpropanoate Chemical compound COC(=O)C(C#N)C(=O)C1=CC=CC=C1 MHXYWUNYSPAWFW-UHFFFAOYSA-N 0.000 description 2
- RJEUAEFRQVZQJY-UHFFFAOYSA-N methyl 2-cyano-3-oxobutanoate Chemical compound COC(=O)C(C#N)C(C)=O RJEUAEFRQVZQJY-UHFFFAOYSA-N 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- KETIGQNBJUHYCA-UHFFFAOYSA-N 3-(2-bromophenyl)-3-oxopropanenitrile Chemical compound BrC1=CC=CC=C1C(=O)CC#N KETIGQNBJUHYCA-UHFFFAOYSA-N 0.000 description 1
- FTFBLKQQKNWLIQ-UHFFFAOYSA-N 3-oxo-3-phenylpropanenitrile;sodium Chemical compound [Na].N#CCC(=O)C1=CC=CC=C1 FTFBLKQQKNWLIQ-UHFFFAOYSA-N 0.000 description 1
- 241000228245 Aspergillus niger Species 0.000 description 1
- 241000206761 Bacillariophyta Species 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241001123663 Penicillium expansum Species 0.000 description 1
- 239000001888 Peptone Substances 0.000 description 1
- 108010080698 Peptones Proteins 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 230000005791 algae growth Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000000498 cooling water Substances 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- GUTQMBQKTSGBPQ-UHFFFAOYSA-N dithiophen-2-ylmethanone Chemical compound C=1C=CSC=1C(=O)C1=CC=CS1 GUTQMBQKTSGBPQ-UHFFFAOYSA-N 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000001962 electrophoresis Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000007380 fibre production Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 238000010409 ironing Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- VPGVLVYCTKEJSX-UHFFFAOYSA-N methyl 2-bromo-2-cyano-3-oxobutanoate Chemical compound COC(=O)C(Br)(C#N)C(C)=O VPGVLVYCTKEJSX-UHFFFAOYSA-N 0.000 description 1
- ARPGZMIRSBUKBU-UHFFFAOYSA-N methyl 2-bromo-2-cyanoacetate Chemical compound COC(=O)C(Br)C#N ARPGZMIRSBUKBU-UHFFFAOYSA-N 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 229940124561 microbicide Drugs 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 235000019319 peptone Nutrition 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C331/00—Derivatives of thiocyanic acid or of isothiocyanic acid
- C07C331/02—Thiocyanates
- C07C331/04—Thiocyanates having sulfur atoms of thiocyanate groups bound to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/22—Radicals substituted by doubly bound hetero atoms, or by two hetero atoms other than halogen singly bound to the same carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO751248A NO751248L (fa) | 1973-08-02 | 1975-04-09 |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732339109 DE2339109A1 (de) | 1973-08-02 | 1973-08-02 | Alpha-halogenketone |
| DE2423981A DE2423981A1 (de) | 1974-05-17 | 1974-05-17 | Alpha - halogenketone |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO742794L true NO742794L (fa) | 1975-03-03 |
Family
ID=25765593
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO742794A NO742794L (fa) | 1973-08-02 | 1974-08-01 |
Country Status (10)
| Country | Link |
|---|---|
| DK (1) | DK410774A (fa) |
| FI (1) | FI228574A7 (fa) |
| FR (1) | FR2239456B1 (fa) |
| GB (1) | GB1450300A (fa) |
| IE (1) | IE39729B1 (fa) |
| IT (1) | IT1021594B (fa) |
| LU (1) | LU70637A1 (fa) |
| NL (1) | NL164851C (fa) |
| NO (1) | NO742794L (fa) |
| SE (1) | SE7409929L (fa) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2823658A1 (de) * | 1978-05-30 | 1979-12-06 | Bayer Ag | Mittel zur bekaempfung von pflanzenbakteriosen |
| DE3514688A1 (de) * | 1985-04-24 | 1986-11-06 | Henkel KGaA, 4000 Düsseldorf | Antimikrobiell wirksame nitrile und ihre herstellung |
| DE3514689A1 (de) * | 1985-04-24 | 1986-11-06 | Henkel KGaA, 4000 Düsseldorf | Verwendung von nitrilen als antimikrobielle wirkstoffe |
-
1974
- 1974-07-30 FI FI2285/74A patent/FI228574A7/fi unknown
- 1974-07-30 NL NL7410248.A patent/NL164851C/xx not_active IP Right Cessation
- 1974-07-31 IT IT52364/74A patent/IT1021594B/it active
- 1974-07-31 LU LU70637A patent/LU70637A1/xx unknown
- 1974-08-01 IE IE1633/74A patent/IE39729B1/xx unknown
- 1974-08-01 GB GB3392474A patent/GB1450300A/en not_active Expired
- 1974-08-01 NO NO742794A patent/NO742794L/no unknown
- 1974-08-01 SE SE7409929A patent/SE7409929L/xx unknown
- 1974-08-01 DK DK410774A patent/DK410774A/da unknown
- 1974-08-02 FR FR7426979A patent/FR2239456B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT1021594B (it) | 1978-02-20 |
| FR2239456B1 (fa) | 1980-02-08 |
| NL7410248A (nl) | 1975-02-04 |
| LU70637A1 (fa) | 1975-05-21 |
| FR2239456A1 (fa) | 1975-02-28 |
| SE7409929L (fa) | 1975-02-03 |
| NL164851C (nl) | 1981-02-16 |
| IE39729B1 (en) | 1978-12-20 |
| NL164851B (nl) | 1980-09-15 |
| FI228574A7 (fa) | 1975-02-03 |
| GB1450300A (en) | 1976-09-22 |
| DK410774A (fa) | 1975-04-07 |
| IE39729L (en) | 1975-02-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4079148A (en) | Antimicrobial sulfonyl-acrylonitriles and amides thereof | |
| JPS61227577A (ja) | ヨードプロパルギルエーテル類、それらの製造法およびそれらの使用 | |
| US4049807A (en) | 2-Amino-1,3-thiazines their use and preparation | |
| US3484473A (en) | Methylene bisesters of thiolsulfonic acids | |
| DE69612611T2 (de) | Triazin-derivate | |
| NO742794L (fa) | ||
| US2937202A (en) | Substituted benzenesulfonanilides | |
| US3950349A (en) | N-(N1 -11 -Benzisothiazolin-31 -31 -onylcarbonylthio)-1,2-benzisothiazolin-3-one | |
| US2818425A (en) | 4-(chlorophenoxy) valeric acids | |
| JPS59116203A (ja) | ピロ−ル誘導体を含有する殺菌剤 | |
| US3519624A (en) | Antimicrobial preparations containing n-acyl-3,4-dihydro-oxazines-(1,3) | |
| US4210645A (en) | (1,4)Dithiino(2,3-b)(1,2,5)-thiadiazole(3,4-e)pyrazine-6,7-dicarbonitrile | |
| US5596102A (en) | Biocides | |
| US5633219A (en) | 5H-pyrrolo(3',4':5,6)(1,4)dithiino(2,3-C)(1,2,5)thiadiazole-5,7(6H)-dione, compositions containing them and their use as antimicrobial and marine antifouling agents | |
| US4199581A (en) | 1,4-Dithiino pyrazine tetracarbonitriles | |
| US4198428A (en) | Aryl-thiocarboxylic acid thiocyanomethyl esters | |
| US4183957A (en) | N'-(substituted phenyl)-N-(2-(halophenoxy)ethyl)alkylanimidamides | |
| US5187172A (en) | Biocides | |
| US3142616A (en) | Controlling microorganisms employing sulfonylacetonitriles | |
| EP0052341B1 (en) | Orotic acid derivatives and their use as agricultural chemicals | |
| DE2423981A1 (de) | Alpha - halogenketone | |
| US3988328A (en) | 5-Amino-2,3,7,8-tetrathiaalkane-1,9-dioic acids, esters and salts | |
| US4647687A (en) | Halogenated sulphides, process for their preparation and their use in microbicidal agents | |
| DE2339109A1 (de) | Alpha-halogenketone | |
| JPH07116004B2 (ja) | 微生物を防除する薬剤 |