NO742478L - - Google Patents
Info
- Publication number
- NO742478L NO742478L NO742478A NO742478A NO742478L NO 742478 L NO742478 L NO 742478L NO 742478 A NO742478 A NO 742478A NO 742478 A NO742478 A NO 742478A NO 742478 L NO742478 L NO 742478L
- Authority
- NO
- Norway
- Prior art keywords
- carbon atoms
- compounds
- alkyl
- formula
- hexahydrobenz
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 38
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 239000002253 acid Chemical group 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 125000004036 acetal group Chemical group 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Chemical group 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 56
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000003208 petroleum Substances 0.000 description 8
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 7
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 5
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- -1 dimethylformamide Chemical class 0.000 description 3
- 230000000054 salidiuretic effect Effects 0.000 description 3
- HJKLEAOXCZIMPI-UHFFFAOYSA-N 2,2-diethoxyethanamine Chemical compound CCOC(CN)OCC HJKLEAOXCZIMPI-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 150000002357 guanidines Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- QXXRLUXAOFVOTE-UHFFFAOYSA-N 1,3-dioxolan-2-ylmethanamine Chemical compound NCC1OCCO1 QXXRLUXAOFVOTE-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- JNAQYWWCTUEVKR-UHFFFAOYSA-N 2-(1,3-dioxolan-2-yl)ethanamine Chemical compound NCCC1OCCO1 JNAQYWWCTUEVKR-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- FWWOWPGPERBCNJ-UHFFFAOYSA-N 2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid Chemical compound OCCOC(=O)CC(O)C(O)=O FWWOWPGPERBCNJ-UHFFFAOYSA-N 0.000 description 1
- PXXMSHBZYAOHBD-UHFFFAOYSA-N 3,3-diethoxypropan-1-amine Chemical compound CCOC(CCN)OCC PXXMSHBZYAOHBD-UHFFFAOYSA-N 0.000 description 1
- GFLPSABXBDCMCN-UHFFFAOYSA-N 4,4-diethoxybutan-1-amine Chemical compound CCOC(OCC)CCCN GFLPSABXBDCMCN-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- GHVZOJONCUEWAV-UHFFFAOYSA-N [K].CCO Chemical compound [K].CCO GHVZOJONCUEWAV-UHFFFAOYSA-N 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000006196 deacetylation Effects 0.000 description 1
- 238000003381 deacetylation reaction Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- AINBZKYUNWUTRE-UHFFFAOYSA-N ethanol;propan-2-ol Chemical compound CCO.CC(C)O AINBZKYUNWUTRE-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000000593 indol-1-yl group Chemical group [H]C1=C([H])C([H])=C2N([*])C([H])=C([H])C2=C1[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000008664 renal activity Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/80—[b, c]- or [b, d]-condensed
- C07D209/90—Benzo [c, d] indoles; Hydrogenated benzo [c, d] indoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1032873A CH581108A5 (en) | 1973-07-16 | 1973-07-16 | Hexahydro-benzo(c,d)indol-1-yl-N''-hydroxyguinidine derivs - including acetals, salidiuretics, prepd from corresp benzo-indolyl-isothioureas |
| CH1032773A CH589625A5 (en) | 1973-07-16 | 1973-07-16 | Hexahydro-benzo(c,d)indol-1-yl-N''-hydroxyguinidine derivs - including acetals, salidiuretics, prepd from corresp benzo-indolyl-isothioureas |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO742478L true NO742478L (enExample) | 1975-02-10 |
Family
ID=25706354
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO742478A NO742478L (enExample) | 1973-07-16 | 1974-07-08 |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4057560A (enExample) |
| JP (1) | JPS5037773A (enExample) |
| AT (1) | ATA582674A (enExample) |
| AU (1) | AU7128774A (enExample) |
| DD (1) | DD112125A5 (enExample) |
| DE (1) | DE2433308A1 (enExample) |
| DK (1) | DK365974A (enExample) |
| ES (1) | ES428267A1 (enExample) |
| FI (1) | FI206974A7 (enExample) |
| FR (1) | FR2237627B1 (enExample) |
| GB (1) | GB1474133A (enExample) |
| HU (1) | HU168858B (enExample) |
| IL (1) | IL45265A0 (enExample) |
| NL (1) | NL7409441A (enExample) |
| NO (1) | NO742478L (enExample) |
| SE (1) | SE7408978L (enExample) |
| YU (1) | YU197474A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5302612A (en) * | 1990-02-26 | 1994-04-12 | Eli Lilly And Company | 6-substituted-hexahydrobenz[cd]indoles |
| US5229409A (en) * | 1990-08-15 | 1993-07-20 | Eli Lilly And Company | 6-substituted-tetrahydrobenz[cd]indoles |
| US5229410A (en) * | 1990-08-15 | 1993-07-20 | Eli Lilly And Company | 6-substituted-hexahydrobenz[cd]indoles |
| US5347013A (en) * | 1991-03-28 | 1994-09-13 | Eli Lilly And Company | 6-heterocyclic-4-amino-1,2,2a,3,4,5-hexahydrobenz[cd]indoles |
| US5244912A (en) * | 1991-03-28 | 1993-09-14 | Eli Lilly And Company | 6-heterocyclic-4-amino-1,3,4,5-tetrahydrobenz(cd)indoles and pharmaceutical use thereof |
| US5364856A (en) * | 1991-03-28 | 1994-11-15 | Eli Lilly And Company | 6-heterocyclic-4-amino-1,3,4,5-tetrahydrobenz[CD]indoles |
| US5648356A (en) * | 1991-03-28 | 1997-07-15 | Eli Lilly And Company | 6-heterocyclic-4-amino-1,2,2a,3,4,5-hexahydrobenz[CD]indoles |
| US5244911A (en) * | 1991-03-28 | 1993-09-14 | Eli Lilly And Company | 6-heterocyclic-4-amino-1,2,2a,3,4,5-hexahydrobenz(cd)indoles and pharmaceutical use thereof |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3030378A (en) * | 1959-05-29 | 1962-04-17 | Ciba Pharmaccutical Products I | Five-membered nu-heterocyclic guanidines |
| US3304306A (en) * | 1964-01-02 | 1967-02-14 | Ciba Geigy Corp | Nu (amidino-lower alkyl)-benzhydryl piperidines |
| CH517730A (de) * | 1969-10-24 | 1972-01-15 | Sandoz Ag | Verfahren zur Herstellung neuer Guanidin-Verbindungen |
| BE757879A (fr) * | 1969-10-24 | 1971-04-22 | Sandoz Sa | Derives du benzo(cd)indole, leur preparation et medicaments contenant ces derives |
| CH517732A (de) * | 1969-10-24 | 1972-01-15 | Sandoz Ag | Verfahren zur Herstellung neuer Guanidin- Verbindungen |
-
1974
- 1974-07-05 FI FI2069/74A patent/FI206974A7/fi unknown
- 1974-07-08 SE SE7408978A patent/SE7408978L/xx unknown
- 1974-07-08 DK DK365974A patent/DK365974A/da unknown
- 1974-07-08 NO NO742478A patent/NO742478L/no unknown
- 1974-07-10 US US05/487,194 patent/US4057560A/en not_active Expired - Lifetime
- 1974-07-11 DE DE2433308A patent/DE2433308A1/de active Pending
- 1974-07-12 NL NL7409441A patent/NL7409441A/xx unknown
- 1974-07-15 YU YU01974/74A patent/YU197474A/xx unknown
- 1974-07-15 DD DD179923A patent/DD112125A5/xx unknown
- 1974-07-15 JP JP49080290A patent/JPS5037773A/ja active Pending
- 1974-07-15 IL IL45265A patent/IL45265A0/xx unknown
- 1974-07-15 HU HUSA2673A patent/HU168858B/hu unknown
- 1974-07-15 ES ES428267A patent/ES428267A1/es not_active Expired
- 1974-07-15 AT AT582674A patent/ATA582674A/de not_active Application Discontinuation
- 1974-07-16 FR FR7424627A patent/FR2237627B1/fr not_active Expired
- 1974-07-16 GB GB3140774A patent/GB1474133A/en not_active Expired
- 1974-07-16 AU AU71287/74A patent/AU7128774A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2237627B1 (enExample) | 1978-07-21 |
| DE2433308A1 (de) | 1975-02-06 |
| ATA582674A (de) | 1978-03-15 |
| IL45265A0 (en) | 1974-10-22 |
| AU7128774A (en) | 1976-01-22 |
| DK365974A (enExample) | 1975-03-17 |
| FR2237627A1 (enExample) | 1975-02-14 |
| FI206974A7 (enExample) | 1975-01-17 |
| JPS5037773A (enExample) | 1975-04-08 |
| HU168858B (enExample) | 1976-07-28 |
| DD112125A5 (enExample) | 1975-03-20 |
| ES428267A1 (es) | 1977-02-16 |
| YU197474A (en) | 1982-05-31 |
| NL7409441A (nl) | 1975-01-20 |
| GB1474133A (en) | 1977-05-18 |
| SE7408978L (sv) | 1975-01-17 |
| US4057560A (en) | 1977-11-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3586695A (en) | Substituted imidazolinyl indoles | |
| EP0252713B1 (en) | Indolinone derivatives | |
| US4503066A (en) | Spiro-linked pyrrolidine-2,5-diones active as enzyme aldose reductase inhibitors | |
| HU186736B (en) | Process for producing new 4-aroylimidazol2-one derivatives | |
| US3852291A (en) | Heterocyclic derivatives of phenoxypropanolamines | |
| NO820937L (no) | 9-(2-(3-indolyl)etyl)-1-oksa-4,9-diazaspiro(5,5)-undekan-3-oner og fremgangsmaate for deres fremstilling | |
| NO742478L (enExample) | ||
| US4314943A (en) | Heterocyclic substituted aryloxy 3-indolyl-tertiary butylaminopropanols | |
| EP0432648B1 (en) | Isatine derivatives, their preparation and use | |
| US4436913A (en) | 1H- and 2H- indazole derivatives | |
| US4086353A (en) | Certain azolinylamino (azolidinylimino) indazoles | |
| US4734501A (en) | N-alkylation of dihydrolysergic acid | |
| EP0637307B1 (en) | Imidazole, triazole and tetrazole derivatives | |
| GB1568398A (en) | Triazolo pyridazine derivatives | |
| BG61186B1 (bg) | Цис-2,3,3а,4,5,9в-хексахидро-1н-бензо(е)- индолови производни | |
| FI84825B (fi) | Foerfarande foer framstaellning av piperazin-1-ylergolinderivat. | |
| US4292323A (en) | Phenyl-1,2,3,4-tetrahydrocarbazoles and use thereof | |
| WO1988001270A1 (en) | Pyridopyrimidinediones | |
| CA1094553A (en) | 1-amino substituted indoline derivatives as vasoconstricting agents | |
| US3957785A (en) | Bβ-Pyrimidino-aminomethyl-10α-ergoline and 10α-methoxyergoline derivatives | |
| US4140858A (en) | 3-(1H-imidazol-1-ylmethyl)-2-(disubstitutedaminomethyl)indoles and a method for their production | |
| US3770766A (en) | 2-(2-amino-2,2-dialkylamino-3-hydroxy-3-phenyl-1h-benz(f)isoindole-1-ones | |
| EP0109039B1 (en) | Benzo(f)quinoline derivatives | |
| CZ357190A3 (en) | Dihydropyrimidothiazine derivatives, process of their preparation and pharmaceutical compositions containing thereof | |
| FR2639944A1 (fr) | Nouveaux derives de l'indole, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |