NO332348B1 - Vannloselige gjodselblandinger og fremgangsmate for a unnga utfelling av naeringsstoffer i en vandig gjodselblanding - Google Patents
Vannloselige gjodselblandinger og fremgangsmate for a unnga utfelling av naeringsstoffer i en vandig gjodselblanding Download PDFInfo
- Publication number
- NO332348B1 NO332348B1 NO20021662A NO20021662A NO332348B1 NO 332348 B1 NO332348 B1 NO 332348B1 NO 20021662 A NO20021662 A NO 20021662A NO 20021662 A NO20021662 A NO 20021662A NO 332348 B1 NO332348 B1 NO 332348B1
- Authority
- NO
- Norway
- Prior art keywords
- acid
- mixture
- fertilizer
- approx
- weight
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 199
- 239000003337 fertilizer Substances 0.000 title claims abstract description 142
- 238000001556 precipitation Methods 0.000 title claims description 35
- 235000015097 nutrients Nutrition 0.000 title claims description 28
- 238000000034 method Methods 0.000 title claims description 4
- 239000002253 acid Substances 0.000 claims abstract description 108
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 79
- 230000000694 effects Effects 0.000 claims abstract description 51
- 235000021073 macronutrients Nutrition 0.000 claims abstract description 41
- 230000003050 macronutrient Effects 0.000 claims abstract description 35
- 239000011785 micronutrient Substances 0.000 claims abstract description 31
- 235000013369 micronutrients Nutrition 0.000 claims abstract description 31
- 239000007787 solid Substances 0.000 claims abstract description 24
- 150000007524 organic acids Chemical class 0.000 claims abstract description 23
- 229910019142 PO4 Inorganic materials 0.000 claims abstract description 20
- 239000000463 material Substances 0.000 claims abstract description 20
- 238000010494 dissociation reaction Methods 0.000 claims abstract description 11
- 230000005593 dissociations Effects 0.000 claims abstract description 11
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 42
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 36
- 239000011574 phosphorus Substances 0.000 claims description 32
- 229910052698 phosphorus Inorganic materials 0.000 claims description 32
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 27
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 27
- 150000007513 acids Chemical class 0.000 claims description 26
- LFVGISIMTYGQHF-UHFFFAOYSA-N ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 claims description 23
- 229910000387 ammonium dihydrogen phosphate Inorganic materials 0.000 claims description 23
- 239000006012 monoammonium phosphate Substances 0.000 claims description 23
- 235000019837 monoammonium phosphate Nutrition 0.000 claims description 23
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 claims description 20
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 claims description 20
- 235000021317 phosphate Nutrition 0.000 claims description 19
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 16
- LWIHDJKSTIGBAC-UHFFFAOYSA-K potassium phosphate Substances [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 claims description 16
- 150000003467 sulfuric acid derivatives Chemical class 0.000 claims description 16
- 239000008233 hard water Substances 0.000 claims description 15
- 150000002823 nitrates Chemical class 0.000 claims description 15
- 230000020477 pH reduction Effects 0.000 claims description 14
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 10
- 239000011976 maleic acid Substances 0.000 claims description 10
- 229910000402 monopotassium phosphate Inorganic materials 0.000 claims description 10
- 235000019796 monopotassium phosphate Nutrition 0.000 claims description 10
- GNSKLFRGEWLPPA-UHFFFAOYSA-M potassium dihydrogen phosphate Chemical compound [K+].OP(O)([O-])=O GNSKLFRGEWLPPA-UHFFFAOYSA-M 0.000 claims description 10
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 10
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 claims description 6
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 claims description 6
- 238000003860 storage Methods 0.000 claims description 5
- 229910021654 trace metal Inorganic materials 0.000 claims description 5
- 239000005696 Diammonium phosphate Substances 0.000 claims description 4
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 claims description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 4
- DHKHZGZAXCWQTA-UHFFFAOYSA-N [N].[K] Chemical compound [N].[K] DHKHZGZAXCWQTA-UHFFFAOYSA-N 0.000 claims description 4
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 4
- 239000004327 boric acid Substances 0.000 claims description 4
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical class [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 claims description 4
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 claims description 4
- 229910000388 diammonium phosphate Inorganic materials 0.000 claims description 4
- 235000019838 diammonium phosphate Nutrition 0.000 claims description 4
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical class [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 claims description 4
- 235000007079 manganese sulphate Nutrition 0.000 claims description 4
- SQQMAOCOWKFBNP-UHFFFAOYSA-L manganese(II) sulfate Chemical class [Mn+2].[O-]S([O-])(=O)=O SQQMAOCOWKFBNP-UHFFFAOYSA-L 0.000 claims description 4
- 239000011591 potassium Substances 0.000 claims description 4
- 229910052700 potassium Inorganic materials 0.000 claims description 4
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical class [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 claims description 4
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 claims description 3
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 claims description 3
- 239000001361 adipic acid Substances 0.000 claims description 3
- 235000011037 adipic acid Nutrition 0.000 claims description 3
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 claims description 3
- 159000000007 calcium salts Chemical class 0.000 claims description 3
- 229940014800 succinic anhydride Drugs 0.000 claims description 3
- 229910000404 tripotassium phosphate Inorganic materials 0.000 claims description 3
- 235000019798 tripotassium phosphate Nutrition 0.000 claims description 3
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 claims description 2
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 claims description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 claims description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 claims description 2
- 150000003863 ammonium salts Chemical class 0.000 claims description 2
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 claims description 2
- KTVIXTQDYHMGHF-UHFFFAOYSA-L cobalt(2+) sulfate Chemical class [Co+2].[O-]S([O-])(=O)=O KTVIXTQDYHMGHF-UHFFFAOYSA-L 0.000 claims description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 2
- 239000001630 malic acid Substances 0.000 claims description 2
- 235000011090 malic acid Nutrition 0.000 claims description 2
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 159000000001 potassium salts Chemical class 0.000 claims description 2
- 150000003672 ureas Chemical class 0.000 claims description 2
- 159000000003 magnesium salts Chemical class 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 abstract description 11
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 abstract description 6
- 239000010452 phosphate Substances 0.000 abstract description 5
- 239000000243 solution Substances 0.000 description 41
- 239000011550 stock solution Substances 0.000 description 34
- DZHMRSPXDUUJER-UHFFFAOYSA-N [amino(hydroxy)methylidene]azanium;dihydrogen phosphate Chemical compound NC(N)=O.OP(O)(O)=O DZHMRSPXDUUJER-UHFFFAOYSA-N 0.000 description 25
- 239000011575 calcium Substances 0.000 description 23
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 21
- 229910052791 calcium Inorganic materials 0.000 description 21
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 19
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 17
- 239000011973 solid acid Substances 0.000 description 16
- 239000000523 sample Substances 0.000 description 14
- 239000002585 base Substances 0.000 description 13
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 239000011573 trace mineral Substances 0.000 description 12
- 235000013619 trace mineral Nutrition 0.000 description 12
- 239000011777 magnesium Substances 0.000 description 11
- 235000011007 phosphoric acid Nutrition 0.000 description 11
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 9
- 229910052749 magnesium Inorganic materials 0.000 description 9
- 235000005985 organic acids Nutrition 0.000 description 9
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 8
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 229910000019 calcium carbonate Inorganic materials 0.000 description 6
- 235000006408 oxalic acid Nutrition 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 238000009472 formulation Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 4
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 4
- 239000008234 soft water Substances 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- KQTIIICEAUMSDG-UHFFFAOYSA-N tricarballylic acid Chemical compound OC(=O)CC(C(O)=O)CC(O)=O KQTIIICEAUMSDG-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 3
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 3
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 239000011702 manganese sulphate Substances 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 229910052750 molybdenum Inorganic materials 0.000 description 3
- 239000011733 molybdenum Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229960003330 pentetic acid Drugs 0.000 description 3
- 230000005588 protonation Effects 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- ODINCKMPIJJUCX-UHFFFAOYSA-N Calcium oxide Chemical compound [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000002535 acidifier Substances 0.000 description 2
- 229960000250 adipic acid Drugs 0.000 description 2
- APUPEJJSWDHEBO-UHFFFAOYSA-P ammonium molybdate Chemical compound [NH4+].[NH4+].[O-][Mo]([O-])(=O)=O APUPEJJSWDHEBO-UHFFFAOYSA-P 0.000 description 2
- 239000011609 ammonium molybdate Substances 0.000 description 2
- 235000018660 ammonium molybdate Nutrition 0.000 description 2
- 229940010552 ammonium molybdate Drugs 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 229910000365 copper sulfate Inorganic materials 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 2
- 229940099596 manganese sulfate Drugs 0.000 description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- -1 metal sulphates Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 230000008635 plant growth Effects 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 2
- 229910052939 potassium sulfate Inorganic materials 0.000 description 2
- 235000011151 potassium sulphates Nutrition 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 229960001367 tartaric acid Drugs 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 2
- 229910000368 zinc sulfate Inorganic materials 0.000 description 2
- 229960001763 zinc sulfate Drugs 0.000 description 2
- STGNLGBPLOVYMA-TZKOHIRVSA-N (z)-but-2-enedioic acid Chemical compound OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O STGNLGBPLOVYMA-TZKOHIRVSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- ULHLNVIDIVAORK-UHFFFAOYSA-N 2-hydroxybutanedioic acid Chemical compound OC(=O)C(O)CC(O)=O.OC(=O)C(O)CC(O)=O ULHLNVIDIVAORK-UHFFFAOYSA-N 0.000 description 1
- GIEGKXINITVUOO-UHFFFAOYSA-N 2-methylidenebutanedioic acid Chemical compound OC(=O)CC(=C)C(O)=O.OC(=O)CC(=C)C(O)=O GIEGKXINITVUOO-UHFFFAOYSA-N 0.000 description 1
- OORRCVPWRPVJEK-UHFFFAOYSA-N 2-oxidanylethanoic acid Chemical compound OCC(O)=O.OCC(O)=O OORRCVPWRPVJEK-UHFFFAOYSA-N 0.000 description 1
- FZIPCQLKPTZZIM-UHFFFAOYSA-N 2-oxidanylpropane-1,2,3-tricarboxylic acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.OC(=O)CC(O)(C(O)=O)CC(O)=O FZIPCQLKPTZZIM-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- 239000001358 L(+)-tartaric acid Substances 0.000 description 1
- 235000011002 L(+)-tartaric acid Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-LWMBPPNESA-N L-(+)-Tartaric acid Natural products OC(=O)[C@@H](O)[C@H](O)C(O)=O FEWJPZIEWOKRBE-LWMBPPNESA-N 0.000 description 1
- FEWJPZIEWOKRBE-XIXRPRMCSA-N Mesotartaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-XIXRPRMCSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- YUWBVKYVJWNVLE-UHFFFAOYSA-N [N].[P] Chemical compound [N].[P] YUWBVKYVJWNVLE-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229940095602 acidifiers Drugs 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- OVYQSRKFHNKIBM-UHFFFAOYSA-N butanedioic acid Chemical compound OC(=O)CCC(O)=O.OC(=O)CCC(O)=O OVYQSRKFHNKIBM-UHFFFAOYSA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 229940043430 calcium compound Drugs 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 229940048879 dl tartaric acid Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000012527 feed solution Substances 0.000 description 1
- 239000011790 ferrous sulphate Substances 0.000 description 1
- 235000003891 ferrous sulphate Nutrition 0.000 description 1
- 230000035558 fertility Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- ZXBQUWHJJKQKGW-UHFFFAOYSA-N furan-2,5-dione Chemical compound O=C1OC(=O)C=C1.O=C1OC(=O)C=C1 ZXBQUWHJJKQKGW-UHFFFAOYSA-N 0.000 description 1
- 229960004275 glycolic acid Drugs 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- XEUHNWODXVYLFD-UHFFFAOYSA-N heptanedioic acid Chemical compound OC(=O)CCCCCC(O)=O.OC(=O)CCCCCC(O)=O XEUHNWODXVYLFD-UHFFFAOYSA-N 0.000 description 1
- YVSCCMNRWFOKDU-UHFFFAOYSA-N hexanedioic acid Chemical compound OC(=O)CCCCC(O)=O.OC(=O)CCCCC(O)=O YVSCCMNRWFOKDU-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000003621 irrigation water Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 150000002681 magnesium compounds Chemical class 0.000 description 1
- GVALZJMUIHGIMD-UHFFFAOYSA-H magnesium phosphate Chemical compound [Mg+2].[Mg+2].[Mg+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O GVALZJMUIHGIMD-UHFFFAOYSA-H 0.000 description 1
- 239000004137 magnesium phosphate Substances 0.000 description 1
- 229910000157 magnesium phosphate Inorganic materials 0.000 description 1
- 229960002261 magnesium phosphate Drugs 0.000 description 1
- 235000010994 magnesium phosphates Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- MIVBAHRSNUNMPP-UHFFFAOYSA-N manganese(2+);dinitrate Chemical compound [Mn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MIVBAHRSNUNMPP-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011684 sodium molybdate Substances 0.000 description 1
- 235000015393 sodium molybdate Nutrition 0.000 description 1
- TVXXNOYZHKPKGW-UHFFFAOYSA-N sodium molybdate (anhydrous) Chemical compound [Na+].[Na+].[O-][Mo]([O-])(=O)=O TVXXNOYZHKPKGW-UHFFFAOYSA-N 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 239000012224 working solution Substances 0.000 description 1
- 239000011686 zinc sulphate Substances 0.000 description 1
- 235000009529 zinc sulphate Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05D—INORGANIC FERTILISERS NOT COVERED BY SUBCLASSES C05B, C05C; FERTILISERS PRODUCING CARBON DIOXIDE
- C05D9/00—Other inorganic fertilisers
- C05D9/02—Other inorganic fertilisers containing trace elements
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05F—ORGANIC FERTILISERS NOT COVERED BY SUBCLASSES C05B, C05C, e.g. FERTILISERS FROM WASTE OR REFUSE
- C05F11/00—Other organic fertilisers
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05G—MIXTURES OF FERTILISERS COVERED INDIVIDUALLY BY DIFFERENT SUBCLASSES OF CLASS C05; MIXTURES OF ONE OR MORE FERTILISERS WITH MATERIALS NOT HAVING A SPECIFIC FERTILISING ACTIVITY, e.g. PESTICIDES, SOIL-CONDITIONERS, WETTING AGENTS; FERTILISERS CHARACTERISED BY THEIR FORM
- C05G5/00—Fertilisers characterised by their form
- C05G5/20—Liquid fertilisers
- C05G5/23—Solutions
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Inorganic Chemistry (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US09/414,214 US6312493B1 (en) | 1999-10-07 | 1999-10-07 | Water soluble fertilizer compositions |
| PCT/US2000/027846 WO2001025168A1 (en) | 1999-10-07 | 2000-10-06 | Improved water soluble fertilizer compositions |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NO20021662D0 NO20021662D0 (no) | 2002-04-08 |
| NO20021662L NO20021662L (no) | 2002-06-03 |
| NO332348B1 true NO332348B1 (no) | 2012-09-03 |
Family
ID=23640468
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO20021662A NO332348B1 (no) | 1999-10-07 | 2002-04-08 | Vannloselige gjodselblandinger og fremgangsmate for a unnga utfelling av naeringsstoffer i en vandig gjodselblanding |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US6312493B1 (enExample) |
| EP (1) | EP1230195B1 (enExample) |
| JP (1) | JP4672945B2 (enExample) |
| AT (1) | ATE520635T1 (enExample) |
| AU (1) | AU781502B2 (enExample) |
| CA (1) | CA2386510C (enExample) |
| ES (1) | ES2371860T3 (enExample) |
| IL (1) | IL149018A0 (enExample) |
| MX (1) | MXPA02003511A (enExample) |
| NO (1) | NO332348B1 (enExample) |
| NZ (1) | NZ518310A (enExample) |
| WO (1) | WO2001025168A1 (enExample) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI112938B (fi) * | 2002-01-15 | 2004-02-13 | Kemira Growhow Oy | Hapan kaliumnitraatti |
| IL154007A (en) * | 2003-01-16 | 2007-09-20 | Rotem Amfert Negev Ltd | Soluble fertilizer compositions comprising calcium and/or magnesium phosphates |
| ITBO20030476A1 (it) * | 2003-08-04 | 2005-02-05 | Biolchim S P A | Concime idrosolubile in polvere contenente fosforo (p2 o5) e calcio (cao) in rapporti diversi. |
| US7569091B1 (en) | 2005-08-26 | 2009-08-04 | Peters Robert B | Compound fertilizers and method of producing them |
| US8821646B1 (en) | 2006-01-30 | 2014-09-02 | John C. Miller | Compositions and methods for cleaning and preventing plugging in micro-irrigation systems |
| US9439345B1 (en) | 2006-01-30 | 2016-09-13 | John C. Miller | Method and composition for preventing plugging in micro-irrigation systems |
| US10046369B1 (en) | 2006-01-30 | 2018-08-14 | John C. Miller | Method for cleaning micro-irrigation systems |
| NZ578197A (en) * | 2006-12-22 | 2012-05-25 | Opal Australasia Pty Ltd | Adjuvant composition containing ammonium sulfate and a surfactant |
| US8025709B2 (en) * | 2009-01-09 | 2011-09-27 | Specialty Feritlizer Products, LLC | Quick drying polymeric coating |
| US8419820B2 (en) * | 2009-01-28 | 2013-04-16 | Everris International B.V. | Fast dissolving water-soluble fertilizer formulations and methods and uses thereof |
| US8192520B2 (en) * | 2009-10-05 | 2012-06-05 | Specialty Fertilizer Products, Llc | Enhanced fertilizer products with polymer adjuvants |
| US7686863B1 (en) | 2009-10-05 | 2010-03-30 | Specialty Fertilizer Products, Llc | Gypsum fertilizer products with polymer adjuvants |
| BR112012007786B1 (pt) * | 2009-10-05 | 2021-05-18 | Specialty Fertilizer Products, Llc | composição fertilizante, método para sua preparação, e método para fertilização da terra |
| CN101723741B (zh) * | 2009-12-08 | 2011-12-14 | 北京林业大学 | 芍药切花设施栽培用营养液及其应用 |
| US8288587B2 (en) * | 2010-10-23 | 2012-10-16 | Mohammad Hassan Nazaran | Chelate compounds |
| WO2012058102A1 (en) * | 2010-10-27 | 2012-05-03 | Miller Chemical & Fertilizer Corporation | Soluble calcium fertilizer formulation |
| PL2522410T3 (pl) * | 2011-05-13 | 2018-06-29 | Prophos Chemicals S.R.L. | Proces regeneracji proszków gaśniczych |
| WO2012156906A1 (en) * | 2011-05-16 | 2012-11-22 | Zinchem - A Division Of Zimco Group (Pty) Ltd | Soil conditioning |
| US9145340B2 (en) | 2012-08-13 | 2015-09-29 | Verdesian Life Sciences, Llc | Method of reducing atmospheric ammonia in livestock and poultry containment facilities |
| NO336052B1 (no) * | 2012-08-29 | 2015-04-27 | Yara Int Asa | Sikre blandinger av ammoniumnitrat (AN) med urea, eller av et AN-omfattende produkt med et urea-omfattende produkt |
| US9961922B2 (en) | 2012-10-15 | 2018-05-08 | Verdesian Life Sciences, Llc | Animal feed and/or water amendments for lowering ammonia concentrations in animal excrement |
| ES2727389T3 (es) | 2013-04-30 | 2019-10-15 | Saudi Basic Ind Corp | Composición de fertirrigación y método para fertirrigación |
| US11254620B2 (en) | 2013-08-05 | 2022-02-22 | Verdesian Life Sciences U.S., Llc | Micronutrient-enhanced polymeric seed coatings |
| TW201522390A (zh) | 2013-08-27 | 2015-06-16 | 特級肥料產品公司 | 聚陰離子聚合物 |
| WO2015035031A1 (en) | 2013-09-05 | 2015-03-12 | Verdesian Life Sciences, Llc | Polymer-boric acid compositions |
| US10238104B2 (en) * | 2013-09-19 | 2019-03-26 | Suunil Sudhakar CHAUDHRY | Multifunctional nutritional adjuvant chemical composition for use in agriculture |
| WO2015179687A1 (en) | 2014-05-21 | 2015-11-26 | Verdesian Life Sciences, Llc | Polymer soil treatment compositions including humic acids |
| CA2946202C (en) | 2014-05-22 | 2022-06-21 | Verdesian Life Sciences, Llc | Polymeric compositions |
| CN107787183B (zh) | 2015-04-20 | 2021-10-08 | 三井化学Agro株式会社 | 肥料兼农用化学品制剂 |
| DE102016220648A1 (de) * | 2016-10-20 | 2018-04-26 | Thyssenkrupp Ag | Ammoniumsulfat enthaltendes Granulat |
| CN110799475B (zh) | 2017-05-17 | 2023-02-21 | 沙特基础工业全球技术公司 | 抗结块肥料组合物 |
| WO2020104916A1 (en) | 2018-11-20 | 2020-05-28 | Sabic Global Technologies B.V. | Coated fertilizer containing urease inhibitor |
| US12281052B2 (en) | 2018-12-11 | 2025-04-22 | SABIC Agri-Nutrients Company | Acidified NP, PK, NPK fertilizer granules for fertigation |
| US11560339B2 (en) | 2019-05-30 | 2023-01-24 | Koch Agronomie Services, LLC | Micronutrient foliar solutions |
| PL4149911T3 (pl) * | 2020-05-13 | 2024-11-25 | Lima Europe | Nawóz rozpuszczalny w wodzie |
| MX2022002905A (es) | 2022-03-09 | 2023-09-11 | Enrique Munoz Morate | Formulacion y metodo para obtencion de acidos nutricionales para vegetales. |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5560085A (en) * | 1978-10-26 | 1980-05-06 | Nisshin Oil Mills Ltd | Solid fertilizer |
| US4328025A (en) * | 1979-07-30 | 1982-05-04 | Bd. Of Regents For The Okla. Agri. And Mech. Colleges Acting For & On Behalf Of Oklahoma State University | Micronutrient fertilizer |
| JPS6270285A (ja) * | 1985-09-21 | 1987-03-31 | 昭和電工株式会社 | 溶解性の改良された粒状肥料の製造方法 |
| JPS6456388A (en) * | 1987-08-27 | 1989-03-03 | Japan Tobacco Inc | Foamable solid fertilizer |
| JPH0274584A (ja) * | 1988-09-06 | 1990-03-14 | Kumamoto Pref Gov Kajitsu Nogyo Kiudoukumiai Rengokai | 液体複合肥料 |
| US5797976A (en) * | 1988-09-09 | 1998-08-25 | Yamashita; Thomas T. | Method and composition for promoting and controlling growth of plants |
| JP2790488B2 (ja) * | 1989-09-08 | 1998-08-27 | 第一製網株式会社 | 肥料又は培養液 |
| JP2790270B2 (ja) * | 1990-02-13 | 1998-08-27 | 俊雄 増田 | 有機中性液状肥料 |
| JPH03237083A (ja) * | 1990-02-13 | 1991-10-22 | Toshio Masuda | 中性固体状肥料 |
| JPH0474784A (ja) * | 1990-07-10 | 1992-03-10 | Mitsubishi Gas Chem Co Inc | 液肥 |
| IL95241A (en) * | 1990-07-31 | 1991-06-30 | Yoram Zivion | Fertilizer compositions for administering ionic metal microelements to plant roots |
| DE69223136T2 (de) | 1991-01-31 | 1998-04-02 | Oms Investments, Inc., Wilmington, Del. | Lösliche Düngemittelzusammenstellungen |
| US5514200B1 (en) | 1994-02-07 | 1997-07-08 | Univ | Formulation of phosphorus fertilizer for plants |
| JP3538258B2 (ja) * | 1995-04-26 | 2004-06-14 | 吉野石膏株式会社 | カルシウム葉面散布剤 |
| US5704961A (en) * | 1996-10-17 | 1998-01-06 | Hudson; Alice P. | Corrosion inhibitors for liquid fertilizers |
| US5772723A (en) * | 1996-11-22 | 1998-06-30 | Frit, Inc. | Method of manufacturing citric acid chelates |
| AU7963698A (en) * | 1998-06-11 | 1999-12-30 | Oms Investments, Inc. | Water soluble fertilizer compositions and processes for their preparation |
-
1999
- 1999-10-07 US US09/414,214 patent/US6312493B1/en not_active Expired - Lifetime
-
2000
- 2000-10-06 WO PCT/US2000/027846 patent/WO2001025168A1/en not_active Ceased
- 2000-10-06 EP EP00972038A patent/EP1230195B1/en not_active Expired - Lifetime
- 2000-10-06 NZ NZ518310A patent/NZ518310A/en not_active IP Right Cessation
- 2000-10-06 AT AT00972038T patent/ATE520635T1/de not_active IP Right Cessation
- 2000-10-06 CA CA002386510A patent/CA2386510C/en not_active Expired - Lifetime
- 2000-10-06 MX MXPA02003511A patent/MXPA02003511A/es active IP Right Grant
- 2000-10-06 ES ES00972038T patent/ES2371860T3/es not_active Expired - Lifetime
- 2000-10-06 AU AU10756/01A patent/AU781502B2/en not_active Expired
- 2000-10-06 JP JP2001528120A patent/JP4672945B2/ja not_active Expired - Lifetime
- 2000-10-06 IL IL14901800A patent/IL149018A0/xx unknown
-
2002
- 2002-04-08 NO NO20021662A patent/NO332348B1/no not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ATE520635T1 (de) | 2011-09-15 |
| CA2386510A1 (en) | 2001-04-12 |
| MXPA02003511A (es) | 2002-09-02 |
| EP1230195A1 (en) | 2002-08-14 |
| EP1230195B1 (en) | 2011-08-17 |
| WO2001025168A9 (en) | 2002-09-26 |
| IL149018A0 (en) | 2002-11-10 |
| ES2371860T3 (es) | 2012-01-10 |
| EP1230195A4 (en) | 2004-06-02 |
| JP4672945B2 (ja) | 2011-04-20 |
| AU781502B2 (en) | 2005-05-26 |
| AU1075601A (en) | 2001-05-10 |
| CA2386510C (en) | 2007-05-22 |
| NO20021662D0 (no) | 2002-04-08 |
| JP2003511333A (ja) | 2003-03-25 |
| US6312493B1 (en) | 2001-11-06 |
| NO20021662L (no) | 2002-06-03 |
| NZ518310A (en) | 2004-02-27 |
| WO2001025168A1 (en) | 2001-04-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO332348B1 (no) | Vannloselige gjodselblandinger og fremgangsmate for a unnga utfelling av naeringsstoffer i en vandig gjodselblanding | |
| US8419820B2 (en) | Fast dissolving water-soluble fertilizer formulations and methods and uses thereof | |
| US5171349A (en) | Solubility compound fertilizer compositions | |
| US11325872B2 (en) | Concentrated aqueous suspension of microfibrillated cellulose comprising salts for plant nutrition | |
| CA2345952C (en) | Solubility compound fertilizer compositions | |
| UA129724C2 (uk) | Частинки добрива, які містять залізо | |
| CA2644258C (en) | Soluble pk fertilizer compositions | |
| US5454850A (en) | Calcium phosphate and urea phosphate soluble compound fertilizer compositions | |
| GB2076795A (en) | Aqueous fertiliser solutions | |
| Burt | Fertigation chemicals | |
| CA1210952A (en) | Ammonia stabilized high analysis liquid fertilizers | |
| LT4697B (lt) | Skystos kompleksinės trąšos ir jų gavimo būdas | |
| WO2001000542A1 (en) | Ca-N-P SOLUTION FERTILIZER |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| CHAD | Change of the owner's name or address (par. 44 patent law, par. patentforskriften) |
Owner name: EVERRIS INTERNATIONAL BV, NL |
|
| MK1K | Patent expired |