NO136493B - - Google Patents
Download PDFInfo
- Publication number
- NO136493B NO136493B NO2524/69A NO252469A NO136493B NO 136493 B NO136493 B NO 136493B NO 2524/69 A NO2524/69 A NO 2524/69A NO 252469 A NO252469 A NO 252469A NO 136493 B NO136493 B NO 136493B
- Authority
- NO
- Norway
- Prior art keywords
- fluorobenzoyl
- piperidine
- mol
- mixture
- acetyl
- Prior art date
Links
- -1 ethoxy, 1,2-dihydroxyethyl Chemical group 0.000 claims description 48
- 150000003839 salts Chemical class 0.000 claims description 32
- 150000001875 compounds Chemical class 0.000 claims description 25
- 239000002253 acid Substances 0.000 claims description 17
- 238000002360 preparation method Methods 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 15
- ABERUOJGWHYBJL-UHFFFAOYSA-N (4-fluorophenyl)-piperidin-4-ylmethanone Chemical compound C1=CC(F)=CC=C1C(=O)C1CCNCC1 ABERUOJGWHYBJL-UHFFFAOYSA-N 0.000 claims description 8
- 125000006332 fluoro benzoyl group Chemical group 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 7
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 claims description 5
- UISSKLNYXVTSHO-UHFFFAOYSA-N 1-[4-(3-bromopropoxy)-3-methoxyphenyl]ethanone Chemical compound COC1=CC(C(C)=O)=CC=C1OCCCBr UISSKLNYXVTSHO-UHFFFAOYSA-N 0.000 claims description 4
- 239000012948 isocyanate Substances 0.000 claims description 4
- QKFJKGMPGYROCL-UHFFFAOYSA-N phenyl isothiocyanate Chemical compound S=C=NC1=CC=CC=C1 QKFJKGMPGYROCL-UHFFFAOYSA-N 0.000 claims description 4
- QUINACONPGHHMC-UHFFFAOYSA-N 1-[4-[3-[4-(4-fluorobenzoyl)piperidin-1-ium-1-yl]propoxy]-3-methoxyphenyl]ethanone;chloride Chemical compound [Cl-].COC1=CC(C(C)=O)=CC=C1OCCC[NH+]1CCC(C(=O)C=2C=CC(F)=CC=2)CC1 QUINACONPGHHMC-UHFFFAOYSA-N 0.000 claims description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- CMUOJBJRZUHRMU-UHFFFAOYSA-N nitrourea Chemical compound NC(=O)N[N+]([O-])=O CMUOJBJRZUHRMU-UHFFFAOYSA-N 0.000 claims description 3
- GRLLEUJTVGLTQN-UHFFFAOYSA-N 1-[4-(4-bromobutoxy)-3-methoxyphenyl]ethanone Chemical compound COC1=CC(C(C)=O)=CC=C1OCCCCBr GRLLEUJTVGLTQN-UHFFFAOYSA-N 0.000 claims description 2
- GOKUDEWVRNZXDZ-UHFFFAOYSA-N 1-bromo-3-(3-bromopropoxy)propane Chemical compound BrCCCOCCCBr GOKUDEWVRNZXDZ-UHFFFAOYSA-N 0.000 claims description 2
- NOHQUGRVHSJYMR-UHFFFAOYSA-N 1-chloro-2-isocyanatobenzene Chemical compound ClC1=CC=CC=C1N=C=O NOHQUGRVHSJYMR-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003435 aroyl group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 125000006331 halo benzoyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 claims description 2
- 229940117953 phenylisothiocyanate Drugs 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims 2
- 125000001207 fluorophenyl group Chemical group 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 111
- 239000000203 mixture Substances 0.000 description 74
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 73
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 70
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 54
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 51
- 239000000243 solution Substances 0.000 description 43
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 40
- 239000007787 solid Substances 0.000 description 31
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 27
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 25
- 239000000706 filtrate Substances 0.000 description 24
- 239000000047 product Substances 0.000 description 24
- 238000001953 recrystallisation Methods 0.000 description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 229910000027 potassium carbonate Inorganic materials 0.000 description 20
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- 239000002904 solvent Substances 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000010410 layer Substances 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- 239000012258 stirred mixture Substances 0.000 description 9
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 9
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 8
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 8
- 235000019441 ethanol Nutrition 0.000 description 8
- 239000000284 extract Substances 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- GPKDBZQZPNOBGM-UHFFFAOYSA-N (4-fluorophenyl)-piperidin-4-ylmethanone;hydron;chloride Chemical compound [Cl-].C1=CC(F)=CC=C1C(=O)C1CC[NH2+]CC1 GPKDBZQZPNOBGM-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 241000699670 Mus sp. Species 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- DDRCHUGHUHZNKZ-UHFFFAOYSA-N phenyl(piperidin-4-yl)methanone Chemical compound C=1C=CC=CC=1C(=O)C1CCNCC1 DDRCHUGHUHZNKZ-UHFFFAOYSA-N 0.000 description 5
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 239000012458 free base Substances 0.000 description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 4
- DGEYTDCFMQMLTH-UHFFFAOYSA-N methanol;propan-2-ol Chemical compound OC.CC(C)O DGEYTDCFMQMLTH-UHFFFAOYSA-N 0.000 description 4
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 230000003000 nontoxic effect Effects 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- ZYKYHSIACDLOCE-UHFFFAOYSA-N (4-methoxyphenyl)-piperidin-4-ylmethanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1CCNCC1 ZYKYHSIACDLOCE-UHFFFAOYSA-N 0.000 description 3
- JCGSSOIJYPBNJE-UHFFFAOYSA-N 1-[4-(4-fluorobenzoyl)piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCC1C(=O)C1=CC=C(F)C=C1 JCGSSOIJYPBNJE-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 239000011260 aqueous acid Substances 0.000 description 3
- 239000002026 chloroform extract Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 239000012467 final product Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- LZUYKOBTHSPKED-UHFFFAOYSA-N (4-chlorophenyl)-piperidin-4-ylmethanone;hydrochloride Chemical compound Cl.C1=CC(Cl)=CC=C1C(=O)C1CCNCC1 LZUYKOBTHSPKED-UHFFFAOYSA-N 0.000 description 2
- QRLFOJWBXIEVJA-UHFFFAOYSA-N (4-fluorophenyl)-[1-(2-hydroxyethyl)piperidin-4-yl]methanone Chemical compound C1CN(CCO)CCC1C(=O)C1=CC=C(F)C=C1 QRLFOJWBXIEVJA-UHFFFAOYSA-N 0.000 description 2
- PBRPKYRJVDJZTF-UHFFFAOYSA-N 1-(2-bromoethoxy)-2-methoxybenzene Chemical compound COC1=CC=CC=C1OCCBr PBRPKYRJVDJZTF-UHFFFAOYSA-N 0.000 description 2
- RQVMJPJBWMFWFT-UHFFFAOYSA-N 1-(4-benzoylpiperidin-1-yl)ethanone Chemical compound C1CN(C(=O)C)CCC1C(=O)C1=CC=CC=C1 RQVMJPJBWMFWFT-UHFFFAOYSA-N 0.000 description 2
- DAYUONWXAFBWGE-UHFFFAOYSA-N 1-[4-(3-bromopropoxy)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(OCCCBr)C=C1 DAYUONWXAFBWGE-UHFFFAOYSA-N 0.000 description 2
- OHCPVLJEAHBMEG-UHFFFAOYSA-N 1-acetylpiperidine-4-carbonyl chloride Chemical compound CC(=O)N1CCC(C(Cl)=O)CC1 OHCPVLJEAHBMEG-UHFFFAOYSA-N 0.000 description 2
- NWZYRRPOEASODK-UHFFFAOYSA-N 1-acetylpiperidine-4-carboxamide Chemical compound CC(=O)N1CCC(C(N)=O)CC1 NWZYRRPOEASODK-UHFFFAOYSA-N 0.000 description 2
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical compound OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000000199 molecular distillation Methods 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- GEVPUGOOGXGPIO-UHFFFAOYSA-N oxalic acid;dihydrate Chemical compound O.O.OC(=O)C(O)=O GEVPUGOOGXGPIO-UHFFFAOYSA-N 0.000 description 2
- TXXOWSICLRODES-UHFFFAOYSA-N phenyl(piperidin-3-yl)methanone Chemical compound C=1C=CC=CC=1C(=O)C1CCCNC1 TXXOWSICLRODES-UHFFFAOYSA-N 0.000 description 2
- 230000001624 sedative effect Effects 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 239000003204 tranquilizing agent Substances 0.000 description 2
- 230000002936 tranquilizing effect Effects 0.000 description 2
- IYGWDOXHCPQXKN-UHFFFAOYSA-N (4-chlorophenyl)-piperidin-4-ylmethanone Chemical compound C1=CC(Cl)=CC=C1C(=O)C1CCNCC1 IYGWDOXHCPQXKN-UHFFFAOYSA-N 0.000 description 1
- AKXHPNYPANDETL-UHFFFAOYSA-N (4-fluorophenyl)-[1-(3-hydroxypropyl)piperidin-4-yl]methanone Chemical compound C1CN(CCCO)CCC1C(=O)C1=CC=C(F)C=C1 AKXHPNYPANDETL-UHFFFAOYSA-N 0.000 description 1
- BBDTWYQCXXFKDH-UHFFFAOYSA-N (4-methoxyphenyl)-piperidin-4-ylmethanone;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1C(=O)C1CCNCC1 BBDTWYQCXXFKDH-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- IOYHGBZPUZBUTJ-UHFFFAOYSA-N 1-(2-bromoethoxy)-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1OCCBr IOYHGBZPUZBUTJ-UHFFFAOYSA-N 0.000 description 1
- MIZXIUCLUPWMEY-UHFFFAOYSA-N 1-(3-benzoylpyrrolidin-1-yl)ethanone Chemical compound C1N(C(=O)C)CCC1C(=O)C1=CC=CC=C1 MIZXIUCLUPWMEY-UHFFFAOYSA-N 0.000 description 1
- DFYOBINAKRYPOT-UHFFFAOYSA-N 1-(3-bromopropoxy)-2-methoxybenzene Chemical compound COC1=CC=CC=C1OCCCBr DFYOBINAKRYPOT-UHFFFAOYSA-N 0.000 description 1
- VKNUENLPKPOOPS-UHFFFAOYSA-N 1-(3-bromopropoxy)-4-fluorobenzene Chemical compound FC1=CC=C(OCCCBr)C=C1 VKNUENLPKPOOPS-UHFFFAOYSA-N 0.000 description 1
- QQNHNRJCBDCDES-UHFFFAOYSA-N 1-(4-chlorophenyl)-4-[4-(4-fluorobenzoyl)piperidin-1-yl]butan-1-one;hydrochloride Chemical compound Cl.C1=CC(F)=CC=C1C(=O)C1CCN(CCCC(=O)C=2C=CC(Cl)=CC=2)CC1 QQNHNRJCBDCDES-UHFFFAOYSA-N 0.000 description 1
- XIGOHFDSSKKYAQ-UHFFFAOYSA-N 1-[4-(2-bromoethoxy)-3-methoxyphenyl]ethanone Chemical compound COC1=CC(C(C)=O)=CC=C1OCCBr XIGOHFDSSKKYAQ-UHFFFAOYSA-N 0.000 description 1
- GRINJXMJGUDRRJ-UHFFFAOYSA-N 1-acetylpiperidine-2-carbonitrile Chemical compound CC(=O)N1CCCCC1C#N GRINJXMJGUDRRJ-UHFFFAOYSA-N 0.000 description 1
- MIFWTSLDLPGOCM-UHFFFAOYSA-N 1-acetylpiperidine-3-carboxamide Chemical compound CC(=O)N1CCCC(C(N)=O)C1 MIFWTSLDLPGOCM-UHFFFAOYSA-N 0.000 description 1
- ODPIDTOGVIDBLN-UHFFFAOYSA-N 1-acetylpiperidine-3-carboxylic acid Chemical compound CC(=O)N1CCCC(C(O)=O)C1 ODPIDTOGVIDBLN-UHFFFAOYSA-N 0.000 description 1
- NFDGRMQIOHRQHF-UHFFFAOYSA-N 1-acetylpiperidine-4-carbonitrile Chemical compound CC(=O)N1CCC(C#N)CC1 NFDGRMQIOHRQHF-UHFFFAOYSA-N 0.000 description 1
- HHIRBXHEYVDUAM-UHFFFAOYSA-N 1-chloro-3-isocyanatobenzene Chemical compound ClC1=CC=CC(N=C=O)=C1 HHIRBXHEYVDUAM-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- SSZWWUDQMAHNAQ-UHFFFAOYSA-N 3-chloropropane-1,2-diol Chemical compound OCC(O)CCl SSZWWUDQMAHNAQ-UHFFFAOYSA-N 0.000 description 1
- ZIJIVCQJKDRJOL-UHFFFAOYSA-N 4-[4-(4-chlorobenzoyl)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride Chemical compound Cl.C1=CC(F)=CC=C1C(=O)CCCN1CCC(C(=O)C=2C=CC(Cl)=CC=2)CC1 ZIJIVCQJKDRJOL-UHFFFAOYSA-N 0.000 description 1
- BUPKTBMYUMORNV-UHFFFAOYSA-N 4-[4-(4-fluorobenzoyl)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride Chemical compound [Cl-].C1=CC(F)=CC=C1C(=O)CCC[NH+]1CCC(C(=O)C=2C=CC(F)=CC=2)CC1 BUPKTBMYUMORNV-UHFFFAOYSA-N 0.000 description 1
- DEXFNLNNUZKHNO-UHFFFAOYSA-N 6-[3-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-3-oxopropyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)C(CCC1=CC2=C(NC(O2)=O)C=C1)=O DEXFNLNNUZKHNO-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical compound CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 230000036506 anxiety Effects 0.000 description 1
- 230000000949 anxiolytic effect Effects 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000004792 aryl magnesium halides Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- OAABHEHWRQAHEJ-UHFFFAOYSA-N butan-1-ol;chloroform Chemical compound ClC(Cl)Cl.CCCCO OAABHEHWRQAHEJ-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- MKYNHKOAYQRSBD-UHFFFAOYSA-N dioxouranium;nitric acid Chemical compound O=[U]=O.O[N+]([O-])=O.O[N+]([O-])=O MKYNHKOAYQRSBD-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000004658 ketimines Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000014380 magnesium carbonate Nutrition 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- PYLWMHQQBFSUBP-UHFFFAOYSA-N monofluorobenzene Chemical compound FC1=CC=CC=C1 PYLWMHQQBFSUBP-UHFFFAOYSA-N 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- MNODEQCNDLADAL-UHFFFAOYSA-N phenyl(piperidin-3-yl)methanone;hydrochloride Chemical compound Cl.C=1C=CC=CC=1C(=O)C1CCCNC1 MNODEQCNDLADAL-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- RCYQTTNQDIKOBZ-UHFFFAOYSA-N piperidin-4-yl-[3-(trifluoromethyl)phenyl]methanone Chemical compound FC(F)(F)C1=CC=CC(C(=O)C2CCNCC2)=C1 RCYQTTNQDIKOBZ-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- ZVCDLGYNFYZZOK-UHFFFAOYSA-M sodium cyanate Chemical compound [Na]OC#N ZVCDLGYNFYZZOK-UHFFFAOYSA-M 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/18—Radicals substituted by singly bound oxygen or sulfur atoms
- C07D317/20—Free hydroxyl or mercaptan
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/30—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by doubly bound oxygen or sulfur atoms or by two oxygen or sulfur atoms singly bound to the same carbon atom
- C07D211/32—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by doubly bound oxygen or sulfur atoms or by two oxygen or sulfur atoms singly bound to the same carbon atom by oxygen atoms
-
- G—PHYSICS
- G06—COMPUTING; CALCULATING OR COUNTING
- G06Q—INFORMATION AND COMMUNICATION TECHNOLOGY [ICT] SPECIALLY ADAPTED FOR ADMINISTRATIVE, COMMERCIAL, FINANCIAL, MANAGERIAL OR SUPERVISORY PURPOSES; SYSTEMS OR METHODS SPECIALLY ADAPTED FOR ADMINISTRATIVE, COMMERCIAL, FINANCIAL, MANAGERIAL OR SUPERVISORY PURPOSES, NOT OTHERWISE PROVIDED FOR
- G06Q20/00—Payment architectures, schemes or protocols
- G06Q20/04—Payment circuits
- G06Q20/047—Payment circuits using payment protocols involving electronic receipts
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Business, Economics & Management (AREA)
- Accounting & Taxation (AREA)
- Strategic Management (AREA)
- Physics & Mathematics (AREA)
- General Business, Economics & Management (AREA)
- General Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Theoretical Computer Science (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US73842068A | 1968-06-20 | 1968-06-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO136493B true NO136493B (ja) | 1977-06-06 |
| NO136493C NO136493C (no) | 1977-09-14 |
Family
ID=24967943
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO2524/69A NO136493C (no) | 1968-06-20 | 1969-06-19 | Analogifremgangsm}te ved fremstilling av terapeutisk aktive 1-substituerte 3(4)-aroylpiperidiner |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3576810A (ja) |
| JP (2) | JPS5022033B1 (ja) |
| AT (1) | AT291258B (ja) |
| BE (1) | BE734755A (ja) |
| BR (1) | BR6909774D0 (ja) |
| CA (1) | CA991642A (ja) |
| CH (2) | CH555335A (ja) |
| DE (1) | DE1930818C3 (ja) |
| DK (1) | DK132947C (ja) |
| ES (1) | ES368552A1 (ja) |
| FI (1) | FI51347C (ja) |
| FR (1) | FR2011339A1 (ja) |
| GB (1) | GB1268909A (ja) |
| IE (1) | IE33848B1 (ja) |
| IL (1) | IL32431A (ja) |
| MY (1) | MY7300424A (ja) |
| NL (1) | NL158488B (ja) |
| NO (1) | NO136493C (ja) |
| SE (1) | SE377118B (ja) |
| TR (1) | TR17521A (ja) |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE791088A (fr) * | 1971-11-09 | 1973-03-01 | Richardson Merrell Inc | Nouveaux derives d'aryl (piperidyl-4) cetone, utiles notamment comme analgesiques et anticoagulants, et leur procede de preparation |
| US4101662A (en) * | 1973-05-03 | 1978-07-18 | A. H. Robins Company, Incorporated | Method for inhibiting emesis and compositions therefor |
| SE7409245L (ja) * | 1973-07-19 | 1975-01-20 | Robins Co Inc A H | |
| US3922276A (en) * | 1974-12-11 | 1975-11-25 | Robins Co Inc A H | 1-Substituted-4-benzylidenepiperidines |
| US4032642A (en) * | 1974-12-11 | 1977-06-28 | A. H. Robins Company, Incorporated | 1-Substituted-4-benzylpiperidines |
| US3956296A (en) * | 1974-12-11 | 1976-05-11 | A. H. Robins Company, Incorporated | 1-Substituted-4-benzylpiperidines |
| JPS52142126U (ja) * | 1976-04-23 | 1977-10-27 | ||
| GB1561023A (en) * | 1977-04-22 | 1980-02-13 | Beecham Group Ltd | 2-methoxy - 5 - chloro aniline derivatives |
| JPS54139937U (ja) * | 1978-03-20 | 1979-09-28 | ||
| US4216325A (en) * | 1978-07-11 | 1980-08-05 | A. H. Robins Company, Inc. | 4-(p-Fluorobenzoyl)-1-[3-(p-fluorobenzoyl)propyl]piperidine |
| US4246268A (en) * | 1979-02-09 | 1981-01-20 | Richardson-Merrell Inc. | Neuroleptic-4-(naphthylmethyl)piperidine derivatives |
| JPS5628625U (ja) * | 1979-08-10 | 1981-03-18 | ||
| US4284636A (en) * | 1979-09-04 | 1981-08-18 | Richardson-Merrell Inc. | Cinnamoylpiperidinobutyrophenone antipsychotic agents |
| US4283404A (en) * | 1979-09-04 | 1981-08-11 | Richardson-Merrell Inc. | Aroylethenylpiperidinobutyrophenone antipsychotic agents |
| JPS56129232U (ja) * | 1980-02-29 | 1981-10-01 | ||
| DK149133C (da) * | 1980-09-18 | 1986-09-08 | Ucb Sa | Analogifremgangsmaade til fremstilling af 2-(4-(diphenylmethylen)- l-piperidinyl)- eddikesyrer eller farmaceutisk acceptable salte heraf |
| JPS5783219A (en) * | 1980-11-12 | 1982-05-25 | Iseki Agricult Mach | Conveying device for threshed straw |
| US4408053A (en) * | 1981-11-12 | 1983-10-04 | Hoechst-Roussel Pharmaceuticals Inc. | (4-Piperidyl)-substituted phenyl ketones |
| FR2581993B1 (fr) * | 1985-05-14 | 1988-03-18 | Synthelabo | Derives de (benzoyl-4 piperidino)-2 phenyl-1 alcanols, leur preparation et leur application en therapeutique |
| US4783471A (en) * | 1985-07-02 | 1988-11-08 | Merrell Dow Pharmaceuticals Inc. | N-aralkyl piperidine methanol derivatives and the uses thereof |
| US4912117A (en) * | 1985-07-02 | 1990-03-27 | Merrell Dow Pharmaceuticals Inc. | Novel chemical compounds |
| DK623586A (da) * | 1985-12-27 | 1987-06-28 | Eisai Co Ltd | Piperidinderivater eller salte deraf og farmaceutiske kompositioner indeholdende forbindelserne |
| KR910006138B1 (ko) * | 1986-09-30 | 1991-08-16 | 에자이 가부시끼가이샤 | 환상아민 유도체 |
| US5523307A (en) * | 1987-11-27 | 1996-06-04 | Eisai Co., Ltd. | Cyclic amine and pharmacological composition |
| US5196439A (en) * | 1987-11-27 | 1993-03-23 | Eisai Co., Ltd. | Piperidine compounds useful to treat cerebrovascular diseases |
| DE3854991T2 (de) * | 1987-11-27 | 1996-07-18 | Eisai Co Ltd | Cyclische Amine und pharmakologische Verbindungen |
| US5093341A (en) * | 1987-12-17 | 1992-03-03 | Merrell Dow Pharmaceuticals Inc. | N-aralkyl piperidine derivatives useful as antithrombolytic agents |
| US5064838A (en) * | 1988-01-21 | 1991-11-12 | Merrell Dow Pharmaceuticals | 1,4-disubstituted-piperidinyl compounds as pain relievers |
| US4921863A (en) * | 1988-02-17 | 1990-05-01 | Eisai Co., Ltd. | Cyclic amine derivatives |
| US5198449A (en) * | 1990-04-27 | 1993-03-30 | A. H. Robins Company Incorporated | N-substituted alpha-arylazacycloalkylmethanamines and their use as cardiovascular agents |
| US5143923B1 (en) * | 1991-04-29 | 1993-11-02 | Hoechst-Roussel Pharmaceuticals Incorporated | Benzoisothiazole-and benzisoxazole-3-carboxamides |
| US5225412A (en) * | 1991-04-29 | 1993-07-06 | Hoechst-Roussel Pharmaceuticals Incorporated | Benzoisothiazole-and benzisoxazole-3-carboxamides |
| US5378714A (en) * | 1991-11-27 | 1995-01-03 | Novo Nordisk A/S | Antipsychotic piperidine derivatives |
| ES2066721B1 (es) * | 1993-05-18 | 1996-02-16 | Ferrer Int | Nuevos compuestos derivados de la piridina 1,4-disustituida. |
| DK60893D0 (da) * | 1993-05-26 | 1993-05-26 | Novo Nordisk As | Piperidinderivater, deres fremstilling og anvendelse |
| EP0661266A1 (en) * | 1993-12-27 | 1995-07-05 | Toa Eiyo Ltd. | Substituted cyclic amine compounds as 5HT2 antagonists |
| IL112764A0 (en) * | 1994-03-18 | 1995-05-26 | Ferrer Int | New chromene derivatives |
| DE4410822A1 (de) * | 1994-03-24 | 1995-09-28 | Schering Ag | Neue Piperidin-Derivate |
| US5880128A (en) * | 1996-05-08 | 1999-03-09 | Schering Corporation | Carbonyl piperazinyl and piperidinyl compounds |
| EP1436281B1 (en) * | 2001-10-17 | 2010-06-16 | Schering Corporation | Piperidine- and piperazineacetamides as 17beta hydroxysteroid dehydrogenase type 3 inhibitors for the treatment of androgen dependent diseases |
| US6770659B2 (en) * | 2002-08-26 | 2004-08-03 | Sk Corporation | Benzoyl piperidine compounds |
| BRPI0516407A (pt) * | 2004-12-24 | 2008-09-02 | Prosidion Ltd | agonistas de receptor acoplado à proteìna g (gpr116) e uso destes para o tratamento de obesidade e diabetes |
| CA2613235A1 (en) * | 2005-06-30 | 2007-01-11 | Prosidion Limited | Gpcr agonists |
| PL2076508T3 (pl) * | 2006-10-18 | 2011-05-31 | Pfizer Prod Inc | Związki biaryloeteru mocznika |
| PT2114933E (pt) * | 2007-01-04 | 2011-12-20 | Prosidion Ltd | Agonistas do gpcr de piperidina |
| AR064735A1 (es) * | 2007-01-04 | 2009-04-22 | Prosidion Ltd | Agonistas de gpcr y composicion farmaceutica en base al compuesto |
| AR064736A1 (es) * | 2007-01-04 | 2009-04-22 | Prosidion Ltd | Agonistas de gpcr |
| DE102011118614B9 (de) | 2011-11-16 | 2013-08-22 | Johannes Herrnsdorf | Kopfunterlage, System zum Abstellen von Schnarchen und Verfahren hierzu |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3029244A (en) * | 1959-08-31 | 1962-04-10 | Research Corp | Aroylpiperidinols and esters thereof |
-
1968
- 1968-06-20 US US738420A patent/US3576810A/en not_active Expired - Lifetime
-
1969
- 1969-06-16 IE IE821/69A patent/IE33848B1/xx unknown
- 1969-06-16 BR BR209774/69A patent/BR6909774D0/pt unknown
- 1969-06-18 GB GB30871/69A patent/GB1268909A/en not_active Expired
- 1969-06-18 SE SE6908681A patent/SE377118B/xx unknown
- 1969-06-18 DE DE1930818A patent/DE1930818C3/de not_active Expired
- 1969-06-18 BE BE734755D patent/BE734755A/xx not_active IP Right Cessation
- 1969-06-19 ES ES368552A patent/ES368552A1/es not_active Expired
- 1969-06-19 DK DK330369A patent/DK132947C/da not_active IP Right Cessation
- 1969-06-19 NL NL6909384.A patent/NL158488B/xx not_active IP Right Cessation
- 1969-06-19 CH CH145673A patent/CH555335A/xx not_active IP Right Cessation
- 1969-06-19 NO NO2524/69A patent/NO136493C/no unknown
- 1969-06-19 CA CA054,803A patent/CA991642A/en not_active Expired
- 1969-06-19 FI FI691833A patent/FI51347C/fi active
- 1969-06-19 CH CH940769A patent/CH555334A/xx not_active IP Right Cessation
- 1969-06-19 IL IL32431A patent/IL32431A/xx unknown
- 1969-06-20 FR FR6920789A patent/FR2011339A1/fr not_active Withdrawn
- 1969-06-20 AT AT587569A patent/AT291258B/de not_active IP Right Cessation
- 1969-06-20 TR TR17521A patent/TR17521A/xx unknown
- 1969-06-20 JP JP44048351A patent/JPS5022033B1/ja active Pending
-
1973
- 1973-12-30 MY MY424/73A patent/MY7300424A/xx unknown
-
1974
- 1974-11-20 JP JP49133473A patent/JPS5112633B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| TR17521A (tr) | 1975-07-23 |
| SE377118B (ja) | 1975-06-23 |
| DE1930818C3 (de) | 1982-05-06 |
| CH555335A (de) | 1974-10-31 |
| MY7300424A (en) | 1973-12-31 |
| GB1268909A (en) | 1972-03-29 |
| CA991642A (en) | 1976-06-22 |
| CH555334A (de) | 1974-10-31 |
| IL32431A0 (en) | 1969-08-27 |
| FI51347C (fi) | 1976-12-10 |
| JPS5022033B1 (ja) | 1975-07-28 |
| NL6909384A (ja) | 1969-12-23 |
| NL158488B (nl) | 1978-11-15 |
| DE1930818B2 (de) | 1981-04-09 |
| ES368552A1 (es) | 1971-07-01 |
| AT291258B (de) | 1971-07-12 |
| IE33848B1 (en) | 1974-11-27 |
| US3576810A (en) | 1971-04-27 |
| DK132947B (da) | 1976-03-01 |
| NO136493C (no) | 1977-09-14 |
| BE734755A (ja) | 1969-12-01 |
| DK132947C (da) | 1976-08-02 |
| IE33848L (en) | 1969-12-20 |
| FR2011339A1 (ja) | 1970-02-27 |
| IL32431A (en) | 1974-05-16 |
| FI51347B (ja) | 1976-08-31 |
| JPS5112633B1 (ja) | 1976-04-21 |
| DE1930818A1 (de) | 1970-01-08 |
| BR6909774D0 (pt) | 1973-02-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO136493B (ja) | ||
| CA1340192C (en) | Cyclic amine compound | |
| US4289772A (en) | 1-Piperidinophthalazines as cardiac stimulants | |
| US4029801A (en) | Pharmaceutical compositions and methods of treating hypertension | |
| US3980658A (en) | (Indolyl-piperidino or -1,2,5,6-tetrahydro-pyridyl)-p-fluoro-butyrophenones and salts thereof | |
| US4241071A (en) | Antidepressant (α-phenyl-2-tolyl)azacycloalkanes | |
| HU196370B (en) | Process for producing piperidine derivatives and pharmaceutical compositions comprising such compounds | |
| CA1147733A (en) | 4-phenoxypiperidines, process for their preparation, their use and medicaments containing them | |
| US6677330B1 (en) | Fluorides of 4-substituted piperidine derivatives | |
| JPS61100562A (ja) | １‐（アミノアルキル）α，α‐ジアリールピロリジン‐ピペリジン‐及びホモピペリジン‐アセトアミド並びにアセトニトリル | |
| US4021431A (en) | 3-(Piperidino-lower-alkyl)-indoles | |
| US4261990A (en) | N-alkyleneiminoalkyl-dicarboximides as antiallergics and antiasthmatics | |
| US4216218A (en) | Antidepressant and analgesic 4-aryloxy- and 4-arylthio-3-phenylpiperidines | |
| HU186024B (en) | Process for preparing new carboxylic acid amides | |
| CA1257277A (en) | Aryloxymethylpyrrolidinols and piperidinols having antidepressant, antiarrhythmic or hypotensive activity | |
| DK165741B (da) | Analogifremgangsmaade til fremstilling af 3-phenoxy-1-azetidincarboxamider | |
| US4324791A (en) | Heterocyclic antidiarrheal compositions & methods of use | |
| US3426036A (en) | N - (p - phenoxybenzoyl - lower alkyl)-4-phenyl-tetrahydropyridyl derivatives; the corresponding alcohol,carbamate and lower alkylene derivatives | |
| EP0057870A1 (en) | N-optionelly substituted-2-amino-alpha-phenylphenethylamines and a method for their preparation | |
| US5118693A (en) | 4,4-disubstituted piperidine derivatives, pharmaceutical compositions containing them and process for preparing same | |
| US3743645A (en) | 1-substituted-4-phenoxypiperidines | |
| US3448192A (en) | Pharmaceutical compositions containing phenyl ethyl piperazines | |
| US3992389A (en) | Heterocyclic compounds | |
| US4096331A (en) | 1-Substituted-3-aminoethoxypyrrolidines | |
| US4767767A (en) | 2-pyrrolidinylethyl-2-(7-trifluoromethyl-4-quinolyl-aminobenzoate having analgesic, antipyretic and anti-inflammatory activities |