NO132535B - - Google Patents
Download PDFInfo
- Publication number
- NO132535B NO132535B NO17371A NO17371A NO132535B NO 132535 B NO132535 B NO 132535B NO 17371 A NO17371 A NO 17371A NO 17371 A NO17371 A NO 17371A NO 132535 B NO132535 B NO 132535B
- Authority
- NO
- Norway
- Prior art keywords
- alanine
- phenylacetyl
- ethyl acetate
- water
- methoxy
- Prior art date
Links
- 241000588724 Escherichia coli Species 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Chemical group 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 81
- -1 DL-N-phenylacetyl-3-(3-methoxy-phenyl)-alanine Chemical compound 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 30
- 229960003767 alanine Drugs 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 108700023418 Amidases Proteins 0.000 description 20
- 102000005922 amidase Human genes 0.000 description 20
- 239000000203 mixture Substances 0.000 description 19
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- WTDRDQBEARUVNC-LURJTMIESA-N L-DOPA Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-LURJTMIESA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 14
- 238000003776 cleavage reaction Methods 0.000 description 13
- 230000007017 scission Effects 0.000 description 13
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- WTDRDQBEARUVNC-UHFFFAOYSA-N L-Dopa Natural products OC(=O)C(N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 229940024606 amino acid Drugs 0.000 description 11
- 239000012071 phase Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 235000001014 amino acid Nutrition 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 150000001413 amino acids Chemical class 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 8
- 239000013078 crystal Substances 0.000 description 7
- 229960003638 dopamine Drugs 0.000 description 7
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- JZKXXXDKRQWDET-QMMMGPOBSA-N L-m-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC(O)=C1 JZKXXXDKRQWDET-QMMMGPOBSA-N 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 239000012300 argon atmosphere Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- OIRRALFLTWWHOP-AWEZNQCLSA-N (2S)-3-(4-hydroxy-3-methoxyphenyl)-2-[(2-phenylacetyl)amino]propanoic acid Chemical compound C1(=CC=CC=C1)CC(=O)N[C@@H](CC1=CC(=C(C=C1)O)OC)C(=O)O OIRRALFLTWWHOP-AWEZNQCLSA-N 0.000 description 4
- XTXGLOBWOMUGQB-VIFPVBQESA-N (2s)-2-azaniumyl-3-(3-methoxyphenyl)propanoate Chemical compound COC1=CC=CC(C[C@H](N)C(O)=O)=C1 XTXGLOBWOMUGQB-VIFPVBQESA-N 0.000 description 4
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 208000018737 Parkinson disease Diseases 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 238000011534 incubation Methods 0.000 description 4
- 230000000707 stereoselective effect Effects 0.000 description 4
- 229940126062 Compound A Drugs 0.000 description 3
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 235000004279 alanine Nutrition 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- XHBLRJRZRFZSGW-UHFFFAOYSA-N 2-azaniumyl-3-(1,3-benzodioxol-5-yl)propanoate Chemical compound OC(=O)C(N)CC1=CC=C2OCOC2=C1 XHBLRJRZRFZSGW-UHFFFAOYSA-N 0.000 description 2
- TYQRIRQLGBYKEP-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)-2-[(2-phenylacetyl)amino]propanoic acid Chemical compound C1(=CC=CC=C1)CC(=O)NC(CC1=CC(=C(C=C1)OC)OC)C(=O)O TYQRIRQLGBYKEP-UHFFFAOYSA-N 0.000 description 2
- WMPDAIZRQDCGFH-UHFFFAOYSA-N 3-methoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1 WMPDAIZRQDCGFH-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 230000008499 blood brain barrier function Effects 0.000 description 2
- 210000001218 blood-brain barrier Anatomy 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000007071 enzymatic hydrolysis Effects 0.000 description 2
- 238000006047 enzymatic hydrolysis reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 229940071870 hydroiodic acid Drugs 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 210000002569 neuron Anatomy 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- UTYVDVLMYQPLQB-UHFFFAOYSA-N phenylacetylglycine Chemical compound OC(=O)CNC(=O)CC1=CC=CC=C1 UTYVDVLMYQPLQB-UHFFFAOYSA-N 0.000 description 2
- SATCULPHIDQDRE-UHFFFAOYSA-N piperonal Chemical compound O=CC1=CC=C2OCOC2=C1 SATCULPHIDQDRE-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- WJUFSDZVCOTFON-UHFFFAOYSA-N veratraldehyde Chemical compound COC1=CC=C(C=O)C=C1OC WJUFSDZVCOTFON-UHFFFAOYSA-N 0.000 description 2
- NNJPGOLRFBJNIW-HNNXBMFYSA-N (-)-demecolcine Chemical compound C1=C(OC)C(=O)C=C2[C@@H](NC)CCC3=CC(OC)=C(OC)C(OC)=C3C2=C1 NNJPGOLRFBJNIW-HNNXBMFYSA-N 0.000 description 1
- UTEYHKAJNNCEDX-VIFPVBQESA-N (2s)-3-(4-hydroxyphenyl)-2-(methoxyamino)propanoic acid Chemical compound CON[C@H](C(O)=O)CC1=CC=C(O)C=C1 UTEYHKAJNNCEDX-VIFPVBQESA-N 0.000 description 1
- SIOJFYRPBYGHOO-UHFFFAOYSA-N 2-(4-fluorophenyl)acetyl chloride Chemical compound FC1=CC=C(CC(Cl)=O)C=C1 SIOJFYRPBYGHOO-UHFFFAOYSA-N 0.000 description 1
- PFDUUKDQEHURQC-ZETCQYMHSA-N 3-O-methyldopa Chemical compound COC1=CC(C[C@H](N)C(O)=O)=CC=C1O PFDUUKDQEHURQC-ZETCQYMHSA-N 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- UXHQLGLGLZKHTC-CUNXSJBXSA-N 4-[(3s,3ar)-3-cyclopentyl-7-(4-hydroxypiperidine-1-carbonyl)-3,3a,4,5-tetrahydropyrazolo[3,4-f]quinolin-2-yl]-2-chlorobenzonitrile Chemical compound C1CC(O)CCN1C(=O)C1=CC=C(C=2[C@@H]([C@H](C3CCCC3)N(N=2)C=2C=C(Cl)C(C#N)=CC=2)CC2)C2=N1 UXHQLGLGLZKHTC-CUNXSJBXSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000160765 Erebia ligea Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 150000008575 L-amino acids Chemical class 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 229940008309 acetone / ethanol Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 210000001159 caudate nucleus Anatomy 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000007850 degeneration Effects 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229960004502 levodopa Drugs 0.000 description 1
- LZPNXAULYJPXEH-UHFFFAOYSA-N m-Methoxycinnamic acid Natural products COC1=CC=CC(C=CC(O)=O)=C1 LZPNXAULYJPXEH-UHFFFAOYSA-N 0.000 description 1
- JZKXXXDKRQWDET-UHFFFAOYSA-N meta-tyrosine Natural products OC(=O)C(N)CC1=CC=CC(O)=C1 JZKXXXDKRQWDET-UHFFFAOYSA-N 0.000 description 1
- 229940008139 methylenedioxycinnamic acid Drugs 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 229940081310 piperonal Drugs 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 210000002637 putamen Anatomy 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 210000003523 substantia nigra Anatomy 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE00615/70A SE341406B (enExample) | 1970-01-19 | 1970-01-19 | |
| SE08836/70A SE359821B (enExample) | 1970-06-25 | 1970-06-25 | |
| SE08835/70A SE359820B (enExample) | 1970-06-25 | 1970-06-25 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO132535B true NO132535B (enExample) | 1975-08-18 |
| NO132535C NO132535C (enExample) | 1975-11-26 |
Family
ID=27354244
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO17371A NO132535C (enExample) | 1970-01-19 | 1971-01-18 |
Country Status (3)
| Country | Link |
|---|---|
| IE (1) | IE34895B1 (enExample) |
| IL (1) | IL35937A (enExample) |
| NO (1) | NO132535C (enExample) |
-
1970
- 1970-12-30 IL IL35937A patent/IL35937A/xx unknown
-
1971
- 1971-01-18 NO NO17371A patent/NO132535C/no unknown
- 1971-01-18 IE IE5371A patent/IE34895B1/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL35937A (en) | 1974-06-30 |
| IE34895B1 (en) | 1975-09-17 |
| IE34895L (en) | 1971-07-19 |
| IL35937A0 (en) | 1971-02-25 |
| NO132535C (enExample) | 1975-11-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2001614C1 (ru) | R (+)-N-Пропаргил-1-аминоиндан и его фармацевтически пригодные кислотно-аддитивные соли и фармацевтическа композици , обладающа ингибирующей B-форму фермента моноаминооксидазы активностью | |
| CH638241A5 (de) | Enzympraeparat mit l-alpha-aminoacylamidase-aktivitaet. | |
| US4319040A (en) | Process for the production of optically active threo-3-(3,4-dihydroxyphenyl)serine | |
| US5447928A (en) | Benzoxazine derivatives and their application in therapy | |
| AU680672B2 (en) | Substituted kynurenines, a process for their preparation, and use as medicaments | |
| GB1584464A (en) | Ergot alkaloids | |
| US4775695A (en) | Substituted amidinoalkoxy and amidinoalkylamino indanones and salts thereof | |
| JPS6310953B2 (enExample) | ||
| NO132535B (enExample) | ||
| FR2661919A1 (fr) | Methode de preparation de derives de furo (3,4-c) pyridine sous forme non-racemique. | |
| US20110021589A1 (en) | Imidazolic compounds and use thereof as alpha-2 adrenergic receptors | |
| US4220719A (en) | Process for the production of Coenzyme Q10 | |
| FI78699B (fi) | Foerfarande foer framstaellning av nya, terapeutiskt anvaendbara spiro-imidazolidin-2,2',5-trionderivat. | |
| US6054594A (en) | Process for the production of enantiomerically enriched N-acylazetidine-2-carboxylic acids | |
| US6218566B1 (en) | Process for manufacturing of L-DOPA ethyl ester | |
| Huszti et al. | Monoamine oxidase inhibiting properties of AB-15—Comparison with tranylcypromine, nialamide and pargyline | |
| US3669837A (en) | Process for producing 3-(3,4-dimethoxyphenyl)l-alanine by resolution | |
| US3202700A (en) | Hydroxylamino acetic acid derivatives | |
| Dagley et al. | Excretion of α-ketoglutaric acid during oxidation of acetate by a vibrio | |
| US5217886A (en) | Method for the production of (-)-4-difluoromethyl-ornithine | |
| MXPA06006522A (es) | Un proceso para la resolucion de nefopam. | |
| DE2100445A1 (de) | Verfahren zur Herstellung von L Dopa und L m Tyrosin | |
| PT862551E (pt) | Derivados do acido benzoilpropionico fluoro-substituidos | |
| US4187244A (en) | Process for the resolution of racemic alpha-aminonitriles | |
| JPS60199394A (ja) | インダニル誘導体の製法 |