NO131672B - - Google Patents
Download PDFInfo
- Publication number
- NO131672B NO131672B NO4606/71A NO460671A NO131672B NO 131672 B NO131672 B NO 131672B NO 4606/71 A NO4606/71 A NO 4606/71A NO 460671 A NO460671 A NO 460671A NO 131672 B NO131672 B NO 131672B
- Authority
- NO
- Norway
- Prior art keywords
- acid
- triiodo
- phenoxy
- ethyl
- acetylamino
- Prior art date
Links
- -1 Amino-triiodo-phenoxy compounds Chemical class 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 17
- YMFIJXDFAPHJIN-VIFPVBQESA-N (2s)-2-[2-(3-acetamido-2,4,6-triiodophenoxy)ethoxymethyl]butanoic acid Chemical compound CC[C@H](C(O)=O)COCCOC1=C(I)C=C(I)C(NC(C)=O)=C1I YMFIJXDFAPHJIN-VIFPVBQESA-N 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 239000011575 calcium Substances 0.000 claims description 3
- 230000000694 effects Effects 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 34
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 20
- 238000009835 boiling Methods 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000002253 acid Substances 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 238000002844 melting Methods 0.000 description 11
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- 229960000583 acetic acid Drugs 0.000 description 10
- 239000012362 glacial acetic acid Substances 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 125000004494 ethyl ester group Chemical group 0.000 description 9
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 9
- 239000002872 contrast media Substances 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 7
- UHEPVJLCZBCTFG-UHFFFAOYSA-N ethyl 2-(2-iodoethoxymethyl)butanoate Chemical compound C(C)OC(C(COCCI)CC)=O UHEPVJLCZBCTFG-UHFFFAOYSA-N 0.000 description 7
- 159000000000 sodium salts Chemical class 0.000 description 7
- 210000000941 bile Anatomy 0.000 description 6
- 229910052753 mercury Inorganic materials 0.000 description 6
- IWCIVEUHXDLUBF-UHFFFAOYSA-N 1lambda3,2-iodoxane-1-carboxylic acid Chemical compound I1(OCCCC1)C(=O)O IWCIVEUHXDLUBF-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- OIRFJRBSRORBCM-UHFFFAOYSA-N Iopanoic acid Chemical compound CCC(C(O)=O)CC1=C(I)C=C(I)C(N)=C1I OIRFJRBSRORBCM-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- SCNMDYBNRBCFEX-UHFFFAOYSA-N ethyl 2-(2-chloroethoxymethyl)butanoate Chemical compound CCOC(=O)C(CC)COCCCl SCNMDYBNRBCFEX-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- BPLPANYMHXJFOX-UHFFFAOYSA-N N-(3-hydroxy-2,4,6-triiodophenyl)acetamide Chemical compound CC(=O)NC1=C(I)C=C(I)C(O)=C1I BPLPANYMHXJFOX-UHFFFAOYSA-N 0.000 description 3
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 3
- RJCJZXUMMNDAIG-UHFFFAOYSA-M [Na+].CC(=O)NC1=C(I)C=C(I)C([O-])=C1I Chemical compound [Na+].CC(=O)NC1=C(I)C=C(I)C([O-])=C1I RJCJZXUMMNDAIG-UHFFFAOYSA-M 0.000 description 3
- 210000000013 bile duct Anatomy 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000009606 cholecystography Methods 0.000 description 3
- VQAZCUCWHIIFGE-UHFFFAOYSA-N diethyl 2-ethylpropanedioate Chemical compound CCOC(=O)C(CC)C(=O)OCC VQAZCUCWHIIFGE-UHFFFAOYSA-N 0.000 description 3
- 238000006266 etherification reaction Methods 0.000 description 3
- FNLRASUXYNOXTI-UHFFFAOYSA-N ethyl 2-(3-iodopropoxymethyl)butanoate Chemical compound C(C)OC(C(COCCCI)CC)=O FNLRASUXYNOXTI-UHFFFAOYSA-N 0.000 description 3
- ACAMMVQFPGRJJH-UHFFFAOYSA-N ethyl 2-(4-iodobutoxymethyl)butanoate Chemical compound C(C)OC(C(COCCCCI)CC)=O ACAMMVQFPGRJJH-UHFFFAOYSA-N 0.000 description 3
- KXZIBANDBFLTTR-UHFFFAOYSA-N ethyl 3-(2-iodoethoxy)-2-methylpropanoate Chemical compound C(C)OC(C(COCCI)C)=O KXZIBANDBFLTTR-UHFFFAOYSA-N 0.000 description 3
- 230000029142 excretion Effects 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 210000000936 intestine Anatomy 0.000 description 3
- 229960002979 iopanoic acid Drugs 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 3
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 3
- 235000009518 sodium iodide Nutrition 0.000 description 3
- LUTWEKBTDWRTSE-UHFFFAOYSA-N 1-chloro-2-(chloromethoxy)ethane Chemical compound ClCCOCCl LUTWEKBTDWRTSE-UHFFFAOYSA-N 0.000 description 2
- FBFQIFVDMSLROB-UHFFFAOYSA-N 2-[3-(3-acetamido-2,4,6-triiodophenoxy)propoxymethyl]butanoic acid Chemical compound CCC(C(O)=O)COCCCOC1=C(I)C=C(I)C(NC(C)=O)=C1I FBFQIFVDMSLROB-UHFFFAOYSA-N 0.000 description 2
- COHDMGNRFCTTIG-UHFFFAOYSA-N 2-[4-(3-acetamido-2,4,6-triiodophenoxy)butoxymethyl]butanoic acid Chemical compound CCC(C(O)=O)COCCCCOC1=C(I)C=C(I)C(NC(C)=O)=C1I COHDMGNRFCTTIG-UHFFFAOYSA-N 0.000 description 2
- HFXNYAICIBJXJH-UHFFFAOYSA-N 3-[2-(3-acetamido-2,4,6-triiodophenoxy)ethoxy]-2-methylpropanoic acid Chemical compound OC(=O)C(C)COCCOC1=C(I)C=C(I)C(NC(C)=O)=C1I HFXNYAICIBJXJH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- YUAXDRYJOSOTDV-UHFFFAOYSA-N diethyl 2-(2-chloroethoxymethyl)-2-ethylpropanedioate Chemical compound C(C)OC(C(C(=O)OCC)(CC)COCCCl)=O YUAXDRYJOSOTDV-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000003384 imaging method Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- WOMTYMDHLQTCHY-UHFFFAOYSA-N 3-methylamino-1,2-propanediol Chemical compound CNCC(O)CO WOMTYMDHLQTCHY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- YEVNEJGLAKHJJH-UHFFFAOYSA-N C(C)OC(C(C(=O)OCC)(CC)COCCCCl)=O Chemical compound C(C)OC(C(C(=O)OCC)(CC)COCCCCl)=O YEVNEJGLAKHJJH-UHFFFAOYSA-N 0.000 description 1
- AEXUAELKEXRGQM-UHFFFAOYSA-N C(C)OC(C(COCCOC1=C(C(=C(C=C1I)I)NC(C)=O)I)CC)=O Chemical compound C(C)OC(C(COCCOC1=C(C(=C(C=C1I)I)NC(C)=O)I)CC)=O AEXUAELKEXRGQM-UHFFFAOYSA-N 0.000 description 1
- UELAJOIADWOXLN-UHFFFAOYSA-M C(CC)(=O)NC=1C(=C(C(=CC=1I)I)[O-])I.[Na+] Chemical compound C(CC)(=O)NC=1C(=C(C(=CC=1I)I)[O-])I.[Na+] UELAJOIADWOXLN-UHFFFAOYSA-M 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 241000792859 Enema Species 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical class CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- HGINADPHJQTSKN-UHFFFAOYSA-N Monoethyl malonic acid Chemical class CCOC(=O)CC(O)=O HGINADPHJQTSKN-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- 206010029155 Nephropathy toxic Diseases 0.000 description 1
- 206010058667 Oral toxicity Diseases 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000007942 carboxylates Chemical group 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- ZCXOCDMJBBRVEM-UHFFFAOYSA-N diethyl 2-(2-chloroethoxymethyl)-2-methylpropanedioate Chemical compound C(C)OC(C(C(=O)OCC)(C)COCCCl)=O ZCXOCDMJBBRVEM-UHFFFAOYSA-N 0.000 description 1
- UPQZOUHVTJNGFK-UHFFFAOYSA-N diethyl 2-methylpropanedioate Chemical compound CCOC(=O)C(C)C(=O)OCC UPQZOUHVTJNGFK-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000007920 enema Substances 0.000 description 1
- 229940079360 enema for constipation Drugs 0.000 description 1
- CVOZLIBGQAUAIC-UHFFFAOYSA-N ethyl 2-(3-chloropropoxymethyl)butanoate Chemical compound C(C)OC(C(COCCCCl)CC)=O CVOZLIBGQAUAIC-UHFFFAOYSA-N 0.000 description 1
- CAFPZIRNMRTJSY-UHFFFAOYSA-N ethyl 2-(4-chlorobutoxymethyl)butanoate Chemical compound C(C)OC(C(COCCCCCl)CC)=O CAFPZIRNMRTJSY-UHFFFAOYSA-N 0.000 description 1
- WYIWGUNQJFJSHT-UHFFFAOYSA-N ethyl 3-(2-chloroethoxy)-2-methylpropanoate Chemical compound C(C)OC(C(COCCCl)C)=O WYIWGUNQJFJSHT-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000007694 nephrotoxicity Effects 0.000 description 1
- 231100000417 nephrotoxicity Toxicity 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 231100000418 oral toxicity Toxicity 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229940031827 phenolate sodium Drugs 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 239000000811 xylitol Substances 0.000 description 1
- 229960002675 xylitol Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1862170A CH532396A (de) | 1970-12-15 | 1970-12-15 | Neue Röntgenkontrastmittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO131672B true NO131672B (Direct) | 1975-04-01 |
| NO131672C NO131672C (Direct) | 1975-07-09 |
Family
ID=4434222
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO4606/71A NO131672C (Direct) | 1970-12-15 | 1971-12-14 |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3842124A (Direct) |
| JP (1) | JPS5020054B1 (Direct) |
| AT (2) | AT301748B (Direct) |
| AU (1) | AU453621B2 (Direct) |
| BE (1) | BE772035A (Direct) |
| BG (1) | BG18828A3 (Direct) |
| CA (1) | CA947312A (Direct) |
| CH (1) | CH532396A (Direct) |
| CS (1) | CS176173B2 (Direct) |
| DK (1) | DK131089B (Direct) |
| ES (1) | ES395599A1 (Direct) |
| FI (1) | FI51272C (Direct) |
| FR (1) | FR2117869B1 (Direct) |
| GB (1) | GB1313443A (Direct) |
| HU (1) | HU162727B (Direct) |
| IL (1) | IL37421A (Direct) |
| NL (1) | NL147723B (Direct) |
| NO (1) | NO131672C (Direct) |
| PL (1) | PL90337B1 (Direct) |
| RO (1) | RO62279A (Direct) |
| SE (1) | SE369072B (Direct) |
| SU (1) | SU400077A3 (Direct) |
| YU (1) | YU34975B (Direct) |
| ZA (1) | ZA715240B (Direct) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS544955U (Direct) * | 1977-06-13 | 1979-01-13 | ||
| US5250283A (en) * | 1990-03-28 | 1993-10-05 | Molecular Biosystems, Inc. | Organic contrast agent analog and method of making same |
| DE4142191A1 (de) * | 1991-12-20 | 1993-06-24 | Bayer Ag | Verfahren zur herstellung von 3-alkoxy-acrylestern |
| US7731678B2 (en) * | 2004-10-13 | 2010-06-08 | Hyprotek, Inc. | Syringe devices and methods for mixing and administering medication |
-
1970
- 1970-12-15 CH CH1862170A patent/CH532396A/de not_active IP Right Cessation
-
1971
- 1971-06-17 AT AT525171A patent/AT301748B/de not_active IP Right Cessation
- 1971-06-21 PL PL1971148950A patent/PL90337B1/pl unknown
- 1971-06-25 BG BG017905A patent/BG18828A3/xx unknown
- 1971-08-02 IL IL37421A patent/IL37421A/xx unknown
- 1971-08-06 ZA ZA715240A patent/ZA715240B/xx unknown
- 1971-08-11 GB GB3777771A patent/GB1313443A/en not_active Expired
- 1971-08-26 RO RO7100068031A patent/RO62279A/ro unknown
- 1971-08-31 BE BE772035A patent/BE772035A/xx not_active IP Right Cessation
- 1971-09-14 AT AT797871A patent/AT311943B/de not_active IP Right Cessation
- 1971-09-16 AU AU33561/71A patent/AU453621B2/en not_active Expired
- 1971-09-30 ES ES395599A patent/ES395599A1/es not_active Expired
- 1971-10-01 JP JP46076420A patent/JPS5020054B1/ja active Pending
- 1971-10-06 FI FI712808A patent/FI51272C/fi active
- 1971-10-20 CS CS7357A patent/CS176173B2/cs unknown
- 1971-10-21 SE SE13337/71A patent/SE369072B/xx unknown
- 1971-11-04 NL NL717115204A patent/NL147723B/xx not_active IP Right Cessation
- 1971-11-16 YU YU2890/71A patent/YU34975B/xx unknown
- 1971-11-18 FR FR7141319A patent/FR2117869B1/fr not_active Expired
- 1971-11-26 US US00202381A patent/US3842124A/en not_active Expired - Lifetime
- 1971-11-30 CA CA128,911A patent/CA947312A/en not_active Expired
- 1971-12-06 SU SU1719965A patent/SU400077A3/ru active
- 1971-12-13 DK DK608571AA patent/DK131089B/da unknown
- 1971-12-14 NO NO4606/71A patent/NO131672C/no unknown
- 1971-12-15 HU HU71BA2678A patent/HU162727B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| RO62279A (fr) | 1977-11-15 |
| US3842124A (en) | 1974-10-15 |
| YU34975B (en) | 1980-06-30 |
| ES395599A1 (es) | 1973-12-16 |
| DK131089B (da) | 1975-05-26 |
| FI51272B (Direct) | 1976-08-31 |
| HU162727B (en) | 1973-04-28 |
| YU289071A (en) | 1979-12-31 |
| DE2128902A1 (de) | 1972-06-22 |
| AT311943B (de) | 1973-12-10 |
| BE772035A (fr) | 1972-02-29 |
| CA947312A (en) | 1974-05-14 |
| DK131089C (Direct) | 1975-10-13 |
| NL147723B (nl) | 1975-11-17 |
| AT301748B (de) | 1972-09-11 |
| NL7115204A (Direct) | 1972-06-19 |
| ZA715240B (en) | 1972-04-26 |
| IL37421A (en) | 1974-11-29 |
| NO131672C (Direct) | 1975-07-09 |
| JPS5020054B1 (Direct) | 1975-07-11 |
| FR2117869A1 (Direct) | 1972-07-28 |
| FR2117869B1 (Direct) | 1975-06-06 |
| AU3356171A (en) | 1973-03-22 |
| GB1313443A (en) | 1973-04-11 |
| PL90337B1 (Direct) | 1977-01-31 |
| AU453621B2 (en) | 1974-10-03 |
| DE2128902B2 (de) | 1973-02-08 |
| SU400077A3 (Direct) | 1973-10-03 |
| BG18828A3 (bg) | 1975-03-20 |
| SE369072B (Direct) | 1974-08-05 |
| FI51272C (fi) | 1976-12-10 |
| CS176173B2 (Direct) | 1977-06-30 |
| IL37421A0 (en) | 1971-11-29 |
| CH532396A (de) | 1973-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2500157C2 (de) | N-Acyl-4-(2-aminoäthyl)-benzoesäuren, deren Salze und Ester, Verfahren zu deren Herstellung und deren Verwendung | |
| US3781328A (en) | Phenoxy-alkyl-carboxylic acid compounds | |
| US4337263A (en) | 1-Aryl-4-γ-arylsulphonyl-3-aminopropoxy-1H-pyrazoles and their use as hypolipemiant and hypocholesterolemiant agents | |
| NO131672B (Direct) | ||
| US4151303A (en) | Phenoxyalkylcarboxylic acid compounds and serum-lipid and triglyceride depressing therapeutic compositions | |
| DE2149070C3 (de) | Phenoxyalkylcarbonsäurederivate und deren Salze, Verfahren zu deren Herstellung und Arzneimittel | |
| DE3131527A1 (de) | 1-phenyl-2-aminocarbonylindol-verbindungen sowie verfahren und zwischenprodukte zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| US4234742A (en) | Bis-(aryloxycarboxylic acid) compounds | |
| US4500731A (en) | Derivatives of 4-phenyl-4-oxobuten-2-oic acid, pharmaceutical compositions containing them, and therapeutic uses for them | |
| NO118798B (Direct) | ||
| US4473583A (en) | Compositions containing certain derivatives of 4-phenyl-4-oxobuten-2-oic acid and methods of treatment using them | |
| WO2020182228A1 (zh) | 一种牛磺胆酸钠的精制方法 | |
| SU588917A3 (ru) | Способ получени 1/2-( -нафтилокси)-этил/-3метилпиразолона-5 | |
| DE2432560A1 (de) | Neue phenoxyalkylcarbonsaeurederivate und verfahren zur herstellung derselben | |
| CS199550B2 (en) | Process for preparing derivatives of thianthrene,thioxanthene and phenoxathiine | |
| US3853866A (en) | 3-amino-2,4,6-triiodobenzoic acid derivatives | |
| US4000186A (en) | Erythrodiol derivatives | |
| NO121611B (Direct) | ||
| JPS635053A (ja) | ビスフエノ−ル誘導体の製造方法 | |
| US5310757A (en) | 3,3,5-trimethylcyclohexyl 2-methylpropionate derivatives, their method of preparation and therapeutic compositions in which they are present | |
| Kipnis et al. | New Compounds. Kojic Acid Derivatives | |
| US2478788A (en) | Process for preparing amino acids | |
| US3352903A (en) | Phenylalkanoic acids | |
| US4539419A (en) | Naphthalenyloxy substituted carboxylic acids | |
| Johnson et al. | Gliotoxin. VIII. Derivatives of 3-Hydroxyindoline-2-carboxylic Acid1 |