NO130397B - - Google Patents
Download PDFInfo
- Publication number
- NO130397B NO130397B NO01022/69A NO102269A NO130397B NO 130397 B NO130397 B NO 130397B NO 01022/69 A NO01022/69 A NO 01022/69A NO 102269 A NO102269 A NO 102269A NO 130397 B NO130397 B NO 130397B
- Authority
- NO
- Norway
- Prior art keywords
- product
- reaction
- reaction mixture
- diamine
- yield
- Prior art date
Links
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 34
- 239000011541 reaction mixture Substances 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 22
- 235000011007 phosphoric acid Nutrition 0.000 claims description 18
- 239000003054 catalyst Substances 0.000 claims description 15
- 150000004985 diamines Chemical class 0.000 claims description 11
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 7
- 150000001412 amines Chemical class 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 239000011593 sulfur Substances 0.000 claims description 6
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- NDKJATAIMQKTPM-UHFFFAOYSA-N 2,3-dimethylbenzenethiol Chemical compound CC1=CC=CC(S)=C1C NDKJATAIMQKTPM-UHFFFAOYSA-N 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 150000003464 sulfur compounds Chemical class 0.000 claims description 3
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical group CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 125000006839 xylylene group Chemical group 0.000 claims description 2
- 239000000047 product Substances 0.000 description 34
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- 238000002474 experimental method Methods 0.000 description 21
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 16
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 13
- 239000002904 solvent Substances 0.000 description 12
- 229910052757 nitrogen Inorganic materials 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- -1 diamine compound Chemical class 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- WNYIBZHOMJZDKN-UHFFFAOYSA-N n-(2-acetamidoethyl)acetamide Chemical compound CC(=O)NCCNC(C)=O WNYIBZHOMJZDKN-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 3
- 238000010924 continuous production Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 229950000688 phenothiazine Drugs 0.000 description 3
- 230000007306 turnover Effects 0.000 description 3
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 238000010923 batch production Methods 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- KVEDKKLZCJBVNP-UHFFFAOYSA-N n-(4-acetamidophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(NC(C)=O)C=C1 KVEDKKLZCJBVNP-UHFFFAOYSA-N 0.000 description 2
- 150000002927 oxygen compounds Chemical class 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- JTPNRXUCIXHOKM-UHFFFAOYSA-N 1-chloronaphthalene Chemical class C1=CC=C2C(Cl)=CC=CC2=C1 JTPNRXUCIXHOKM-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PWWVAXIEGOYWEE-UHFFFAOYSA-N Isophenergan Chemical compound C1=CC=C2N(CC(C)N(C)C)C3=CC=CC=C3SC2=C1 PWWVAXIEGOYWEE-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- IFQUWYZCAGRUJN-UHFFFAOYSA-N ethylenediaminediacetic acid Chemical compound OC(=O)CNCCNCC(O)=O IFQUWYZCAGRUJN-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- RTWNYYOXLSILQN-UHFFFAOYSA-N methanediamine Chemical compound NCN RTWNYYOXLSILQN-UHFFFAOYSA-N 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 238000003541 multi-stage reaction Methods 0.000 description 1
- RRSCVDMNAXVDSV-UHFFFAOYSA-N n-(acetamidomethyl)acetamide Chemical compound CC(=O)NCNC(C)=O RRSCVDMNAXVDSV-UHFFFAOYSA-N 0.000 description 1
- HRSYISMFWLVXAQ-UHFFFAOYSA-N n-[2-(diacetylamino)ethyl]acetamide Chemical compound CC(=O)NCCN(C(C)=O)C(C)=O HRSYISMFWLVXAQ-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical class [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 238000009489 vacuum treatment Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/90—Carboxylic acid amides having nitrogen atoms of carboxamide groups further acylated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US71259768A | 1968-03-13 | 1968-03-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO130397B true NO130397B (enExample) | 1974-08-26 |
Family
ID=24862797
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO01022/69A NO130397B (enExample) | 1968-03-13 | 1969-03-12 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3539629A (enExample) |
| BE (1) | BE729185A (enExample) |
| CH (1) | CH509269A (enExample) |
| DE (1) | DE1910300A1 (enExample) |
| ES (1) | ES364754A1 (enExample) |
| FR (1) | FR2003753A1 (enExample) |
| GB (1) | GB1216294A (enExample) |
| NL (1) | NL146487B (enExample) |
| NO (1) | NO130397B (enExample) |
| SE (1) | SE363626B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3888894A (en) * | 1972-10-02 | 1975-06-10 | Sun Research Development | Tertiary diamides |
| US3886212A (en) * | 1973-02-19 | 1975-05-27 | Wacker Chemie Gmbh | Process for preparing N,N,N{40 ,N{40 -tetraacetyl compounds |
| US4144225A (en) * | 1975-08-18 | 1979-03-13 | Kanebo, Ltd. | Novel aromatic diamine compounds and flame-resistant polyamide compositions containing said compounds |
| EP0004919B1 (de) * | 1978-04-14 | 1981-06-10 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von N,N,N',N'-Tetraacetyl-ethylendiamin |
| DE2828765A1 (de) * | 1978-06-30 | 1980-01-10 | Hoechst Ag | Verfahren zur herstellung von n,n'-diacetylethylendiamin |
| US4676915A (en) * | 1985-03-27 | 1987-06-30 | Colgate-Palmolive Company | Antistatic composition and detergent compositions containing antistatic components |
| DK156052C (da) * | 1987-02-11 | 1989-11-06 | Cheminova As | Fremgangsmaade til fremstilling af n,n,n',n'-tetraacetylethylendiamin |
| EP2850056A1 (en) | 2012-05-18 | 2015-03-25 | Warwick International Group Limited | Activation of peroxygen bleach |
| JP7305677B2 (ja) * | 2018-04-16 | 2023-07-10 | ダウ グローバル テクノロジーズ エルエルシー | 漂白活性化剤として有用なテトラアセチルジアミンおよびトリアセチルジアミンの誘導体 |
| FR3109355B3 (fr) | 2020-04-15 | 2022-03-25 | Psa Automobiles Sa | Traverse supérieure de bloc avant pour véhicule automobile |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES257803A1 (es) * | 1959-06-06 | 1960-11-01 | Konink Ind Mij Voorheen Noury | Un procedimiento para preparar un agente de lavado y o de blanqueo |
-
1968
- 1968-03-13 US US712597A patent/US3539629A/en not_active Expired - Lifetime
-
1969
- 1969-02-27 FR FR6905227A patent/FR2003753A1/fr not_active Withdrawn
- 1969-02-28 BE BE729185D patent/BE729185A/xx unknown
- 1969-02-28 DE DE19691910300 patent/DE1910300A1/de not_active Withdrawn
- 1969-03-11 GB GB02809/69A patent/GB1216294A/en not_active Expired
- 1969-03-11 CH CH365769A patent/CH509269A/de not_active IP Right Cessation
- 1969-03-12 NL NL696903845A patent/NL146487B/xx unknown
- 1969-03-12 NO NO01022/69A patent/NO130397B/no unknown
- 1969-03-13 SE SE03502/69A patent/SE363626B/xx unknown
- 1969-03-13 ES ES364754A patent/ES364754A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3539629A (en) | 1970-11-10 |
| GB1216294A (en) | 1970-12-16 |
| SE363626B (enExample) | 1974-01-28 |
| FR2003753A1 (enExample) | 1969-11-14 |
| BE729185A (enExample) | 1969-08-01 |
| NL6903845A (enExample) | 1969-09-16 |
| DE1910300A1 (de) | 1969-09-18 |
| NL146487B (nl) | 1975-07-15 |
| CH509269A (de) | 1971-06-30 |
| ES364754A1 (es) | 1971-01-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO130397B (enExample) | ||
| SU608476A3 (ru) | Способ получени 5-или-6замещенных бензоксазолкарбоновых кислот | |
| SK280544B6 (sk) | Spôsob prípravy kreatínu alebo monohydrátu kreatín | |
| NO314257B1 (no) | Fremgangsmåte ved fremstilling av en halogen-substituert aromatisk syre | |
| US3824286A (en) | Preparation of polyacetylalkylene diamines | |
| US20040171872A1 (en) | Purification of 2-nitro-4-methylsuphonyblenzoic acid | |
| JPS6233223B2 (enExample) | ||
| Henne et al. | Positive Bromine from Perfluorinated N-Bromoimides1 | |
| US4317916A (en) | Process for producing N-substituted-N-acetyl-2,6-dialkyl-anilines | |
| CN109836344B (zh) | 一种有机溶剂生产甘氨酸的方法 | |
| US4059634A (en) | Production of pinacolone | |
| US4332727A (en) | Preparation of 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-3-indolylacetoxyacetic acid | |
| SU457698A1 (ru) | Способ получени производных индолил-2-уксусной кислоты | |
| US4454345A (en) | Process for preparing 2,5-dichloro-3-nitrobenzoic acid | |
| RU2323207C1 (ru) | Способ получения хлорзамещенных аминоанилидов ароматических карбоновых кислот | |
| SU368231A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ АЦЕТАТОВ ВТОРИЧНЫХ а-ОКСИАЛКИЛПЕРЕКИСЕЙ | |
| SU1318157A3 (ru) | Способ получени производных 1-карбамоил-3-(3,5-дихлорфенил)-гидантоина | |
| EP0190524B1 (fr) | Nouveau procédé industriel de synthèse du N-[(1'-allyl 2'-pyrrolidinyl) méthyl] 2-méthoxy 4,5-azimido benzamide | |
| US3176024A (en) | Preparation of chloro-phthalanes | |
| US3427306A (en) | Process for the manufacture of n-(5 - nitro - 2 - furfuryliden) - 1 - amino-hydantoin | |
| SU1761741A1 (ru) | Способ получени @ -хлораллилового спирта | |
| RU2234492C1 (ru) | Способ получения 2,3,4-триметоксибензальдегида | |
| SU429585A3 (ru) | СПОСОБ ПОЛУЧЕНИЯ ЗАМЕЩЕННОГО а-НАФТОКСИАЦЕТАМИДА | |
| SU1077883A1 (ru) | Способ получени @ -хлорэтилсульфохлорида | |
| SU389085A1 (ru) | ::;С&:СО;ОЗНАЯ ., ,- -:,vv:--( •( -••f">&f"r'~',i!iQ |