NO129524B - - Google Patents
Download PDFInfo
- Publication number
- NO129524B NO129524B NO02256/70A NO225670A NO129524B NO 129524 B NO129524 B NO 129524B NO 02256/70 A NO02256/70 A NO 02256/70A NO 225670 A NO225670 A NO 225670A NO 129524 B NO129524 B NO 129524B
- Authority
- NO
- Norway
- Prior art keywords
- compounds
- general formula
- formyl
- meaning
- group
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 28
- 238000000034 method Methods 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 235000019253 formic acid Nutrition 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 239000000543 intermediate Substances 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 239000002168 alkylating agent Substances 0.000 claims description 2
- 229940100198 alkylating agent Drugs 0.000 claims description 2
- 125000000129 anionic group Chemical group 0.000 claims description 2
- 229940049706 benzodiazepine Drugs 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- SEPPVOUBHWNCAW-FNORWQNLSA-N (E)-4-oxonon-2-enal Chemical compound CCCCCC(=O)\C=C\C=O SEPPVOUBHWNCAW-FNORWQNLSA-N 0.000 description 1
- AVMHMVJVHYGDOO-NSCUHMNNSA-N (e)-1-bromobut-2-ene Chemical compound C\C=C\CBr AVMHMVJVHYGDOO-NSCUHMNNSA-N 0.000 description 1
- ZHYMGSPDEVXULU-UHFFFAOYSA-N 1,2-benzodiazepin-3-one Chemical class N1=NC(=O)C=CC2=CC=CC=C21 ZHYMGSPDEVXULU-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical group CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- FOYWCEUVVIHJKD-UHFFFAOYSA-N 2-methyl-5-(1h-pyrazol-5-yl)pyridine Chemical compound C1=NC(C)=CC=C1C1=CC=NN1 FOYWCEUVVIHJKD-UHFFFAOYSA-N 0.000 description 1
- LLBZPESJRQGYMB-UHFFFAOYSA-N 4-one Natural products O1C(C(=O)CC)CC(C)C11C2(C)CCC(C3(C)C(C(C)(CO)C(OC4C(C(O)C(O)C(COC5C(C(O)C(O)CO5)OC5C(C(OC6C(C(O)C(O)C(CO)O6)O)C(O)C(CO)O5)OC5C(C(O)C(O)C(C)O5)O)O4)O)CC3)CC3)=C3C2(C)CC1 LLBZPESJRQGYMB-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical class [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- ZGSDJMADBJCNPN-UHFFFAOYSA-N [S-][NH3+] Chemical compound [S-][NH3+] ZGSDJMADBJCNPN-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 125000002576 diazepinyl group Chemical group N1N=C(C=CC=C1)* 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000004255 ion exchange chromatography Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- -1 pyridine Chemical class 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/12—1,5-Benzodiazepines; Hydrogenated 1,5-benzodiazepines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691929656 DE1929656A1 (de) | 1969-06-11 | 1969-06-11 | Neue Tetrahydro-benzodiazepinone |
| DE19702006600 DE2006600A1 (en) | 1970-02-13 | 1970-02-13 | Tetrahydro-1,5-benzodiazepine-4-ones |
| DE19702019627 DE2019627A1 (de) | 1969-06-11 | 1970-04-23 | Neue Tetrahydrobenzodiazepinone |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO129524B true NO129524B (OSRAM) | 1974-04-22 |
Family
ID=27181978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO02256/70A NO129524B (OSRAM) | 1969-06-11 | 1970-06-10 |
Country Status (16)
| Country | Link |
|---|---|
| JP (3) | JPS49192B1 (OSRAM) |
| AT (2) | AT303746B (OSRAM) |
| BE (1) | BE751834A (OSRAM) |
| BG (4) | BG17602A3 (OSRAM) |
| CA (1) | CA967154A (OSRAM) |
| CH (1) | CH549582A (OSRAM) |
| ES (4) | ES380557A1 (OSRAM) |
| FR (1) | FR2052950B1 (OSRAM) |
| GB (1) | GB1317475A (OSRAM) |
| IE (1) | IE35727B1 (OSRAM) |
| IL (1) | IL34689A (OSRAM) |
| NL (1) | NL7008404A (OSRAM) |
| NO (1) | NO129524B (OSRAM) |
| RO (4) | RO58640A (OSRAM) |
| SE (1) | SE381873B (OSRAM) |
| SU (1) | SU423299A3 (OSRAM) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN110183397B (zh) * | 2019-06-24 | 2022-08-23 | 陕西师范大学 | 二氯二茂锆催化制备1,5-苯并噻嗪类化合物的方法 |
| CN110256365B (zh) * | 2019-06-24 | 2022-06-07 | 陕西师范大学 | 二氯二茂钛催化制备苯二氮卓衍生物的方法 |
-
1970
- 1970-04-10 BG BG014913A patent/BG17602A3/xx unknown
- 1970-06-05 RO RO69783A patent/RO58640A/ro unknown
- 1970-06-05 CA CA084,760A patent/CA967154A/en not_active Expired
- 1970-06-05 RO RO69784A patent/RO58641A/ro unknown
- 1970-06-05 SU SU701666624A patent/SU423299A3/ru active
- 1970-06-05 RO RO63562A patent/RO58405A/ro unknown
- 1970-06-05 RO RO69785A patent/RO58887A/ro unknown
- 1970-06-09 ES ES380557A patent/ES380557A1/es not_active Expired
- 1970-06-09 IL IL34689A patent/IL34689A/en unknown
- 1970-06-09 CH CH863170A patent/CH549582A/xx not_active IP Right Cessation
- 1970-06-10 BG BG017289A patent/BG17974A3/xx unknown
- 1970-06-10 NO NO02256/70A patent/NO129524B/no unknown
- 1970-06-10 BG BG017287A patent/BG17973A3/xx unknown
- 1970-06-10 AT AT00409/72A patent/AT303746B/de not_active IP Right Cessation
- 1970-06-10 IE IE753/70A patent/IE35727B1/xx unknown
- 1970-06-10 GB GB2819770A patent/GB1317475A/en not_active Expired
- 1970-06-10 AT AT522570A patent/AT303737B/de not_active IP Right Cessation
- 1970-06-10 NL NL7008404A patent/NL7008404A/xx unknown
- 1970-06-11 SE SE7008152A patent/SE381873B/xx unknown
- 1970-06-11 BE BE751834D patent/BE751834A/xx unknown
- 1970-06-11 FR FR7021448A patent/FR2052950B1/fr not_active Expired
-
1971
- 1971-01-11 ES ES71387137A patent/ES387137A1/es not_active Expired
- 1971-01-11 ES ES387136A patent/ES387136A1/es not_active Expired
- 1971-01-11 ES ES387138A patent/ES387138A1/es not_active Expired
- 1971-04-07 BG BG017288A patent/BG17603A3/xx unknown
- 1971-10-01 JP JP46077046A patent/JPS49192B1/ja active Pending
- 1971-10-01 JP JP46077047A patent/JPS5013273B1/ja active Pending
- 1971-10-01 JP JP46077048A patent/JPS5031158B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IL34689A (en) | 1973-03-30 |
| JPS5013273B1 (OSRAM) | 1975-05-19 |
| BG17974A3 (bg) | 1974-03-05 |
| ES387136A1 (es) | 1974-01-01 |
| GB1317475A (en) | 1973-05-16 |
| JPS5031158B1 (OSRAM) | 1975-10-07 |
| IE35727L (en) | 1970-12-11 |
| JPS49192B1 (OSRAM) | 1974-01-05 |
| ES387137A1 (es) | 1974-01-01 |
| BG17603A3 (bg) | 1973-11-10 |
| FR2052950A1 (OSRAM) | 1971-04-16 |
| CH549582A (de) | 1974-05-31 |
| AT303737B (de) | 1972-12-11 |
| BG17602A3 (bg) | 1973-11-10 |
| RO58640A (OSRAM) | 1975-10-15 |
| IE35727B1 (en) | 1976-05-12 |
| FR2052950B1 (OSRAM) | 1974-08-30 |
| BE751834A (fr) | 1970-12-11 |
| ES380557A1 (es) | 1973-04-01 |
| ES387138A1 (es) | 1973-05-01 |
| SU423299A3 (ru) | 1974-04-05 |
| AT303746B (de) | 1972-11-15 |
| BG17973A3 (bg) | 1974-03-05 |
| IL34689A0 (en) | 1970-08-19 |
| CA967154A (en) | 1975-05-06 |
| NL7008404A (OSRAM) | 1970-12-15 |
| RO58405A (OSRAM) | 1975-11-15 |
| RO58641A (OSRAM) | 1975-09-15 |
| RO58887A (OSRAM) | 1975-10-15 |
| SE381873B (sv) | 1975-12-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4675332A (en) | Acidic tetrazolyl substituted indole compounds and their use as antiallergy agents | |
| DE69221988T2 (de) | Verfahren zur Herstellung substituierter Maleimide | |
| US3752826A (en) | Aroyl substituted pyrroles | |
| Sternbach et al. | Quinazoline 3-Oxide Structure of Compounds Previously Described in the Literature as 3.1. 4-Benzoxadiazepines1 | |
| IE914518A1 (en) | N-acyl-2,3-benzodiazepine derivatives, pharmaceutical¹compositions containing them and process for preparing same | |
| EP0028834A1 (en) | Imidazole-5-acetic acid derivatives, their production and use | |
| Asselin et al. | Cycloalkanoindoles. 1. Syntheses and antiinflammatory actions of some acidic tetrahydrocarbazoles, cyclopentindoles, and cycloheptindoles | |
| GB1594867A (en) | Benzodiazepine derivatives | |
| IE41440B1 (en) | 7-methoxy-6-thiatetracyclines and their preparation | |
| EP0012866B1 (en) | New 3h-naphtho(1,2-d)imidazoles, processes for preparing them, compounds for use as antiinflammatory and antimicrobial agents and compositions for that use containing them | |
| Stempel et al. | Quinazolines and 1, 4-Benzodiazepines. XXVII. 1 Mechanism of Ring Enlargement of Quinazoline 3-Oxides with Alkali2 to 1, 4-Benzodiazepin-2-one 4-Oxides | |
| NO129524B (OSRAM) | ||
| Sarges et al. | Synthesis of aryl-substituted 1, 3-and 1, 4-diazocine derivatives | |
| FI79838B (fi) | Foerfarande foer framstaellning av farmakologiskt anvaendbara azabicyklo/3.1.0/hexan-2,4-dioner | |
| US3671544A (en) | 3,4,4a,9a-tetrahydro-2-(1h)carbazolones | |
| US3939152A (en) | 5-Phenyl-2,4-benzodiazepines | |
| Stillings et al. | Substituted 5H-dibenz [b, g]-1, 4-oxazocines and related amino acids with antiinflammatory activity | |
| US3314942A (en) | 3, 4, 5, 6-tetrahydro-1h-azepino(4, 3, 2-cd) indoles | |
| FI83214C (fi) | Foerfarande foer framstaellning av aromatas inhiberande azabicyklo-/3.1.1./heptan-2,4-dioner. | |
| US3453283A (en) | Novel 6-substituted-1-(piperidyl-alkyl)-1,2,3,4-tetrahydronaphthalenes | |
| Anderson et al. | Carboxyarylindoles as nonsteroidal antiinflammatory agents | |
| SU517258A3 (ru) | Способ получени производных бензодиазепина | |
| DK156391B (da) | Analogifremgangsmaade til fremstilling af 3-aminopyrrolderivater | |
| Wenkert et al. | Derivatives of Oxytryptophol1 | |
| US3457258A (en) | 5h-1,4-benzodiazepin-5-ones and-5-thiones |