NO127922B - - Google Patents
Download PDFInfo
- Publication number
- NO127922B NO127922B NO03007/68A NO300768A NO127922B NO 127922 B NO127922 B NO 127922B NO 03007/68 A NO03007/68 A NO 03007/68A NO 300768 A NO300768 A NO 300768A NO 127922 B NO127922 B NO 127922B
- Authority
- NO
- Norway
- Prior art keywords
- phenyl
- group
- lower alkyl
- formula
- atoms
- Prior art date
Links
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 17
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 11
- 150000001414 amino alcohols Chemical class 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- 230000003288 anthiarrhythmic effect Effects 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 claims description 4
- 230000000916 dilatatory effect Effects 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- ZGCHLAJIRWDGFE-UHFFFAOYSA-N 1-aminopropane-1,1-diol Chemical class CCC(N)(O)O ZGCHLAJIRWDGFE-UHFFFAOYSA-N 0.000 claims description 3
- -1 1-piperazinyl group Chemical group 0.000 claims description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 150000003335 secondary amines Chemical class 0.000 claims description 2
- 125000005504 styryl group Chemical group 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- 150000002924 oxiranes Chemical class 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 229910001868 water Inorganic materials 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 150000002118 epoxides Chemical class 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 6
- 230000001077 hypotensive effect Effects 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 210000002216 heart Anatomy 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- BUHYMJLFRZAFBF-UHFFFAOYSA-N 3,4,5-trimethoxybenzoyl chloride Chemical compound COC1=CC(C(Cl)=O)=CC(OC)=C1OC BUHYMJLFRZAFBF-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000007937 lozenge Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 150000003333 secondary alcohols Chemical group 0.000 description 3
- MMBMNIIFGNSOFO-UHFFFAOYSA-N 1-chloro-3-prop-2-ynoxypropan-2-ol Chemical compound ClCC(O)COCC#C MMBMNIIFGNSOFO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000003416 antiarrhythmic agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000005840 aryl radicals Chemical group 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000003218 coronary vasodilator agent Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 125000001302 tertiary amino group Chemical group 0.000 description 2
- FJXVYZMGZACQOS-UHFFFAOYSA-N 1-chloro-3-phenylmethoxypropan-2-ol Chemical compound ClCC(O)COCC1=CC=CC=C1 FJXVYZMGZACQOS-UHFFFAOYSA-N 0.000 description 1
- JDQCMQVLZFTHAQ-UHFFFAOYSA-N 2-methyl-2-phenylmethoxyoxirane Chemical compound C=1C=CC=CC=1COC1(C)CO1 JDQCMQVLZFTHAQ-UHFFFAOYSA-N 0.000 description 1
- DNUJVGBNIXGTHC-UHFFFAOYSA-N 3,6-dihydro-2h-oxazine Chemical compound C1NOCC=C1 DNUJVGBNIXGTHC-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 206010002660 Anoxia Diseases 0.000 description 1
- 241000976983 Anoxia Species 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 206010052895 Coronary artery insufficiency Diseases 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- 206010021143 Hypoxia Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000007953 anoxia Effects 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 210000005242 cardiac chamber Anatomy 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 210000000748 cardiovascular system Anatomy 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 210000000038 chest Anatomy 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 210000002837 heart atrium Anatomy 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 235000015110 jellies Nutrition 0.000 description 1
- 239000008274 jelly Substances 0.000 description 1
- 239000008176 lyophilized powder Substances 0.000 description 1
- 230000002107 myocardial effect Effects 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- 210000005241 right ventricle Anatomy 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/22—Ethers with hydroxy compounds containing no oxirane rings with monohydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR116738A FR6571M (fi) | 1967-08-03 | 1967-08-03 | |
| FR143676A FR352F (fi) | 1967-08-03 | 1968-03-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO127922B true NO127922B (fi) | 1973-09-03 |
Family
ID=26178598
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO03007/68A NO127922B (fi) | 1967-08-03 | 1968-07-31 |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3781432A (fi) |
| BE (1) | BE718425A (fi) |
| CH (2) | CH492677A (fi) |
| ES (1) | ES356703A1 (fi) |
| FR (2) | FR6571M (fi) |
| GB (1) | GB1211307A (fi) |
| NL (1) | NL6811028A (fi) |
| NO (1) | NO127922B (fi) |
| SE (1) | SE333735B (fi) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU183721B (en) * | 1981-11-06 | 1984-05-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing new cyclic imine derivatives |
| BR8208033A (pt) * | 1981-12-28 | 1983-11-22 | Carter Wallace | Processo quimico |
-
1967
- 1967-08-03 FR FR116738A patent/FR6571M/fr not_active Expired
-
1968
- 1968-03-14 FR FR143676A patent/FR352F/fr not_active Expired
- 1968-07-12 CH CH1049768A patent/CH492677A/fr not_active IP Right Cessation
- 1968-07-12 CH CH1049668A patent/CH486483A/fr not_active IP Right Cessation
- 1968-07-17 GB GB34115/68A patent/GB1211307A/en not_active Expired
- 1968-07-23 BE BE718425D patent/BE718425A/xx unknown
- 1968-07-31 NO NO03007/68A patent/NO127922B/no unknown
- 1968-07-31 ES ES356703A patent/ES356703A1/es not_active Expired
- 1968-08-02 NL NL6811028A patent/NL6811028A/xx unknown
- 1968-08-02 SE SE10487/68A patent/SE333735B/xx unknown
-
1971
- 1971-08-23 US US00174179A patent/US3781432A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR352F (fi) | 1971-09-10 |
| SE333735B (fi) | 1971-03-29 |
| NL6811028A (fi) | 1969-02-05 |
| ES356703A1 (es) | 1970-02-01 |
| DE1795060B2 (de) | 1976-03-18 |
| US3781432A (en) | 1973-12-25 |
| CH486483A (fr) | 1970-02-28 |
| FR6571M (fi) | 1968-12-23 |
| DE1795060A1 (de) | 1972-03-09 |
| BE718425A (fi) | 1968-12-31 |
| GB1211307A (en) | 1970-11-04 |
| CH492677A (fr) | 1970-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3962238A (en) | Ethers of n-propanol amine | |
| SU862826A3 (ru) | Способ получени производных фталазина или их солей с фармацевтически приемлемыми кислотами | |
| NO124312B (fi) | ||
| JP2651043B2 (ja) | ジフェニルメチルピペラジン誘導体 | |
| US4191765A (en) | 1-Aryloxy-2-hydroxy-3-aminopropanes | |
| KR100225764B1 (ko) | 콜레스테롤 생합성 억제제로서의 신규 피페리딜 에테르 및 티오에테르 | |
| JPS6230780A (ja) | １，７−ナフチリジン誘導体及びこれを含有する薬剤 | |
| AU665172B2 (en) | 1,4-disubstituted piperazines | |
| EP0015156A1 (en) | Basically-substituted tricyclic pyrazoles, their preparation and their use as antiinflammatory agents | |
| US3944549A (en) | Amino derivatives of 1,4-benzodioxan | |
| SU1331424A3 (ru) | Способ получени 2- @ 2 @ -гидрокси-3-(1,1-диметилпропиламино)-пропокси @ - @ -фенилпропиофенона или его фармакологически приемлемых солей | |
| PL90038B1 (fi) | ||
| US4340541A (en) | 4-(2-Benzoyloxy-3-tert.-butylaminopropoxy-2-methyl indole | |
| NO140348B (no) | Analogifremgangsmaate til fremstilling av nye terapeutisk aktive 3-(amino-2-hydroksypropoksy)-isoindolin-1-on-forbindelser | |
| US4434176A (en) | Use of 4-(2-benzoyloxy-3-tert-butylaminopropoxy)-2-methyl-indole for inducing beta-adrenoceptor blocade | |
| NO127922B (fi) | ||
| US3141019A (en) | Chaohj | |
| KR900005133B1 (ko) | 아릴옥시-n-(아미노알킬)-1-피롤리딘 및 피페리딘 카복스아미드 및 카보티오아미드의 제조방법, 및 이를 함유하는 약제조성물 | |
| US2704757A (en) | 5-hydroxy-3, 4, 5, 6-tetrahydropyriminines | |
| NO160864B (no) | Fremgangsmaate til fremstilling av et varmebehandlet nikkel-jern-basert legeringsprodukt. | |
| DK151965B (da) | Analogifremgangsmaade til fremstilling af piperazinsubstituerede 3-alkyltheobrominforbindelser | |
| JP2539734B2 (ja) | フェニルアルカン酸エステル | |
| DK152491B (da) | Analogifremgangsmaade til fremstilling af esterholdige phenoxypropanolaminer eller farmaceutisk anvendelige salte deraf | |
| US4014920A (en) | N-cinnamylcarbamic acid esters | |
| US4707499A (en) | 3-alkyl-5-(substituted amino)methyl)dihydro-3-phenyl-2(3H)-furanones and imino analogs thereof used for treatment of arrhythmia |