NO127582B - - Google Patents
Download PDFInfo
- Publication number
- NO127582B NO127582B NO01941/70A NO194170A NO127582B NO 127582 B NO127582 B NO 127582B NO 01941/70 A NO01941/70 A NO 01941/70A NO 194170 A NO194170 A NO 194170A NO 127582 B NO127582 B NO 127582B
- Authority
- NO
- Norway
- Prior art keywords
- shaped
- trimethoxy
- panel
- grooves
- mol
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 10
- 238000005253 cladding Methods 0.000 claims 4
- 238000003780 insertion Methods 0.000 claims 1
- 230000037431 insertion Effects 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- 125000000217 alkyl group Chemical group 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 125000004433 nitrogen atom Chemical group N* 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 125000003545 alkoxy group Chemical group 0.000 description 9
- DMSSTTLDFWKBSX-UHFFFAOYSA-N 1h-1,2,3-benzotriazin-4-one Chemical class C1=CC=C2C(=O)N=NNC2=C1 DMSSTTLDFWKBSX-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 229940072033 potash Drugs 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 235000015320 potassium carbonate Nutrition 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 4
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 4
- 125000003341 7 membered heterocyclic group Chemical group 0.000 description 4
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 125000003282 alkyl amino group Chemical group 0.000 description 4
- 230000004872 arterial blood pressure Effects 0.000 description 4
- 125000000753 cycloalkyl group Chemical group 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- PXBFMLJZNCDSMP-UHFFFAOYSA-N 2-Aminobenzamide Chemical class NC(=O)C1=CC=CC=C1N PXBFMLJZNCDSMP-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 210000004351 coronary vessel Anatomy 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000011835 investigation Methods 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000052 vinegar Substances 0.000 description 3
- 235000021419 vinegar Nutrition 0.000 description 3
- JFCITVLHUMNYAL-UHFFFAOYSA-N 3,4,5-trimethoxy-2-nitrobenzoyl chloride Chemical compound [N+](=O)([O-])C1=C(C(=O)Cl)C=C(C(=C1OC)OC)OC JFCITVLHUMNYAL-UHFFFAOYSA-N 0.000 description 2
- BUHYMJLFRZAFBF-UHFFFAOYSA-N 3,4,5-trimethoxybenzoyl chloride Chemical compound COC1=CC(C(Cl)=O)=CC(OC)=C1OC BUHYMJLFRZAFBF-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- 235000019439 ethyl acetate Nutrition 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 210000001105 femoral artery Anatomy 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000029058 respiratory gaseous exchange Effects 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- -1 3-(γ-chloro-3-hydroxy-propyl)-6,7,8-trimethoxy-1,2,3-benzo-triazin-4(3H)-one Chemical compound 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 230000000916 dilatatory effect Effects 0.000 description 1
- 230000010339 dilation Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/08—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1926075A DE1926075C3 (de) | 1969-05-22 | 1969-05-22 | 3-(3-Amino-2-benzoxy-propyl)-6,7,8trimethoxy-3H-1 ^3-benzotriazin-4on-Derivate, ihre Herstellung und Verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO127582B true NO127582B (fi) | 1973-07-16 |
Family
ID=5734859
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO01941/70A NO127582B (fi) | 1969-05-22 | 1970-05-21 |
Country Status (19)
| Country | Link |
|---|---|
| US (4) | US3706739A (fi) |
| AT (2) | AT297721B (fi) |
| BE (1) | BE750841A (fi) |
| BR (1) | BR6915398D0 (fi) |
| CA (1) | CA972371A (fi) |
| CH (2) | CH551988A (fi) |
| CS (2) | CS155240B2 (fi) |
| DE (1) | DE1926075C3 (fi) |
| ES (2) | ES379869A1 (fi) |
| FI (1) | FI50241C (fi) |
| FR (1) | FR2051552B1 (fi) |
| GB (1) | GB1280942A (fi) |
| IE (1) | IE34167B1 (fi) |
| IL (1) | IL34508A (fi) |
| NL (1) | NL7006791A (fi) |
| NO (1) | NO127582B (fi) |
| PL (1) | PL80853B1 (fi) |
| RO (2) | RO57511A (fi) |
| ZA (1) | ZA703463B (fi) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4680293A (en) * | 1986-03-03 | 1987-07-14 | American Cyanamid Company | 3-imidazolylalkyl-, triazolylalkyl-, pyridinylalkyl-1,2,3-benzotriazin-4(3H)-ones and derivatives thereof |
| CN104530037B (zh) * | 2015-01-21 | 2020-12-18 | 华东理工大学 | 一种具有杀线虫活性的三嗪杂环化合物及其制法和用途 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR51163E (fr) * | 1940-04-29 | 1941-09-30 | Lampe électrique mobile pouvant être facilement placée sur un lit, un fauteuil et sur d'autres meubles ou d'autres supports | |
| DE1259349B (de) * | 1964-10-17 | 1968-01-25 | Cassella Farbwerke Mainkur Ag | Verfahren zur Herstellung von Derivaten des 7-Oxycumarins |
| US3534085A (en) * | 1968-10-16 | 1970-10-13 | Squibb & Sons Inc | 5,8-dihydronaphthloxy-aminopropanols and related compounds |
-
1969
- 1969-05-22 DE DE1926075A patent/DE1926075C3/de not_active Expired
- 1969-12-19 BR BR215398/69A patent/BR6915398D0/pt unknown
-
1970
- 1970-05-11 NL NL7006791A patent/NL7006791A/xx unknown
- 1970-05-12 IL IL34508A patent/IL34508A/en unknown
- 1970-05-15 IE IE636/70A patent/IE34167B1/xx unknown
- 1970-05-18 US US38544A patent/US3706739A/en not_active Expired - Lifetime
- 1970-05-20 RO RO63406A patent/RO57511A/ro unknown
- 1970-05-20 RO RO71242A patent/RO57941A/ro unknown
- 1970-05-21 FR FR7018462A patent/FR2051552B1/fr not_active Expired
- 1970-05-21 FI FI701432A patent/FI50241C/fi active
- 1970-05-21 GB GB24680/70A patent/GB1280942A/en not_active Expired
- 1970-05-21 ZA ZA703463A patent/ZA703463B/xx unknown
- 1970-05-21 ES ES379869A patent/ES379869A1/es not_active Expired
- 1970-05-21 CA CA083,279A patent/CA972371A/en not_active Expired
- 1970-05-21 NO NO01941/70A patent/NO127582B/no unknown
- 1970-05-21 AT AT454270A patent/AT297721B/de not_active IP Right Cessation
- 1970-05-21 ES ES379868A patent/ES379868A1/es not_active Expired
- 1970-05-21 PL PL1970140773A patent/PL80853B1/pl unknown
- 1970-05-21 AT AT454170A patent/AT297720B/de not_active IP Right Cessation
- 1970-05-22 CS CS360170A patent/CS155240B2/cs unknown
- 1970-05-22 BE BE750841D patent/BE750841A/xx unknown
- 1970-05-22 CH CH551988D patent/CH551988A/xx not_active IP Right Cessation
- 1970-05-22 CS CS360270A patent/CS155241B2/cs unknown
- 1970-05-22 CH CH763070A patent/CH535774A/de not_active IP Right Cessation
-
1972
- 1972-06-22 US US00265225A patent/US3759907A/en not_active Expired - Lifetime
- 1972-06-22 US US00265249A patent/US3757019A/en not_active Expired - Lifetime
- 1972-06-22 US US00265221A patent/US3751413A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US3751413A (en) | 1973-08-07 |
| RO57941A (fi) | 1975-04-15 |
| CS155240B2 (fi) | 1974-05-30 |
| CS155241B2 (fi) | 1974-05-30 |
| ES379868A1 (es) | 1973-04-01 |
| US3759907A (en) | 1973-09-18 |
| AT297721B (de) | 1972-04-10 |
| AT297720B (de) | 1972-04-10 |
| IE34167B1 (en) | 1975-02-19 |
| FI50241C (fi) | 1976-01-12 |
| US3757019A (en) | 1973-09-04 |
| PL80853B1 (fi) | 1975-08-30 |
| RO57511A (fi) | 1975-03-15 |
| DE1926075B2 (de) | 1979-11-22 |
| ES379869A1 (es) | 1973-04-01 |
| CA972371A (en) | 1975-08-05 |
| BR6915398D0 (pt) | 1973-01-04 |
| CH551988A (de) | 1974-07-31 |
| GB1280942A (en) | 1972-07-12 |
| DE1926075C3 (de) | 1980-07-31 |
| IL34508A (en) | 1973-07-30 |
| ZA703463B (en) | 1971-01-27 |
| IL34508A0 (en) | 1970-07-19 |
| US3706739A (en) | 1972-12-19 |
| BE750841A (fr) | 1970-11-23 |
| DE1926075A1 (de) | 1970-11-26 |
| CH535774A (de) | 1973-04-15 |
| FR2051552B1 (fi) | 1974-04-12 |
| IE34167L (en) | 1970-11-22 |
| NL7006791A (fi) | 1970-11-24 |
| FI50241B (fi) | 1975-09-30 |
| FR2051552A1 (fi) | 1971-04-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3636039A (en) | Substituted benzylimidazolidinones | |
| FI69066C (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefulla 1-aryloxi-2-hydroxi-3-alkylenaminopropaner samt deras fysiologiskt laempliga syraadditionssalter | |
| EP0045094B1 (en) | Intermediates for the preparation of therapeutically active xanthine derivatives | |
| JP2562503B2 (ja) | プロペノンオキシムエーテル類、その製造方法、並びにこれを含有する調剤組成物 | |
| CA1086735A (en) | Piperidino-quinazolines | |
| JP2637737B2 (ja) | 新規な薬剤 | |
| CA1296011C (en) | ¬(phenyl-sulphamoyl or sulphonamido)- 1,2,3,4-tetrahydroisoquinoline-2-yl| alkyl acid | |
| US3923833A (en) | N-{8 (1-cyano-2-phenyl)ethyl{9 carbamates | |
| NO158432B (no) | Anordning for feste til gulv. | |
| US3796719A (en) | Substituted sulfonylureas | |
| NO820476L (no) | Fremgangsmaate til fremstilling av substituerte 3-amino-sydnoniminer | |
| DK147795B (da) | Analogifremgangsmaade til fremstilling af xanthinderivater | |
| NO127582B (fi) | ||
| EP0625511B1 (en) | Heterocyclic compounds and their use in pharmaceutical | |
| JPS62267250A (ja) | 抗不整脈剤 | |
| US4147805A (en) | Alkylthiophenoxyalkylamines and the pharmaceutical use thereof | |
| US3959281A (en) | Piperazino substituted coumarin derivatives | |
| NO814468L (no) | Tiazolinderivater, fremgangsmaate til deres fremstilling, deres anvendelse samt farmasoeytiske preparater paa basis av disse forbindelser | |
| US2738349A (en) | Processes | |
| IL34741A (en) | Basically substituted 2,4-(1h,3h)-quinazolinedione derivatives,their preparation and pharmaceutical compositions containing them | |
| US3120541A (en) | 1-carboxy or carbalkoxy-alkylene-4-phenyl-4-carbethoxy-piperidines | |
| US3726902A (en) | Furfuryl amino-coumarins | |
| KR800000850B1 (ko) | 1,4-디하이드로 피리딘 카복실산 아르알킬 에스테르의 제조방법 | |
| JPS633866B2 (fi) | ||
| US3855225A (en) | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |