NO127537B - - Google Patents
Download PDFInfo
- Publication number
- NO127537B NO127537B NO473470A NO473470A NO127537B NO 127537 B NO127537 B NO 127537B NO 473470 A NO473470 A NO 473470A NO 473470 A NO473470 A NO 473470A NO 127537 B NO127537 B NO 127537B
- Authority
- NO
- Norway
- Prior art keywords
- acid
- derivative
- solution
- dissolved
- acetonitrile
- Prior art date
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- 150000004826 dibenzofurans Chemical class 0.000 claims description 8
- -1 phenylacetyl group Chemical group 0.000 claims description 8
- 125000002252 acyl group Chemical group 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 3
- RDMHXWZYVFGYSF-LNTINUHCSA-N (z)-4-hydroxypent-3-en-2-one;manganese Chemical compound [Mn].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O RDMHXWZYVFGYSF-LNTINUHCSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000002444 phloroglucinyl group Chemical class [H]OC1=C([H])C(O[H])=C(*)C(O[H])=C1[H] 0.000 claims 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 23
- CUCUKLJLRRAKFN-UHFFFAOYSA-N 7-Hydroxy-(S)-usnate Chemical compound CC12C(=O)C(C(=O)C)C(=O)C=C1OC1=C2C(O)=C(C)C(O)=C1C(C)=O CUCUKLJLRRAKFN-UHFFFAOYSA-N 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 229940004858 usnic acid Drugs 0.000 description 12
- ICTZCAHDGHPRQR-UHFFFAOYSA-N usnic acid Natural products OC1=C(C)C(O)=C(C(C)=O)C2=C1C1(C)C(O)=C(C(=O)C)C(=O)C=C1O2 ICTZCAHDGHPRQR-UHFFFAOYSA-N 0.000 description 12
- WEYVVCKOOFYHRW-UHFFFAOYSA-N usninic acid Natural products CC12C(=O)C(C(=O)C)=C(O)C=C1OC1=C2C(O)=C(C)C(O)=C1C(C)=O WEYVVCKOOFYHRW-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 230000003647 oxidation Effects 0.000 description 8
- 238000007254 oxidation reaction Methods 0.000 description 8
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 8
- 230000003115 biocidal effect Effects 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 239000000539 dimer Substances 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000011572 manganese Substances 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 150000003000 phloroglucinols Chemical class 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- WGJIVPZLBPWKET-UHFFFAOYSA-N 1-(2,4,6-trihydroxyphenyl)heptan-1-one Chemical compound CCCCCCC(=O)C1=C(O)C=C(O)C=C1O WGJIVPZLBPWKET-UHFFFAOYSA-N 0.000 description 2
- HPBAQDWUBZVAMF-UHFFFAOYSA-N 1-(2,4,6-trihydroxyphenyl)pentan-1-one Chemical compound CCCCC(=O)C1=C(O)C=C(O)C=C1O HPBAQDWUBZVAMF-UHFFFAOYSA-N 0.000 description 2
- 244000063299 Bacillus subtilis Species 0.000 description 2
- 235000014469 Bacillus subtilis Nutrition 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241000192125 Firmicutes Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- GRIDHCOCFJSWSY-SFHVURJKSA-N Isousnic acid Chemical compound O=C([C@@]12C)C(C(=O)C)=C(O)C=C1OC1=C2C(O)=C(C(C)=O)C(O)=C1C GRIDHCOCFJSWSY-SFHVURJKSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- RGMMTOZHCJCZRW-UHFFFAOYSA-N 2,4,6-trihydroxyphenylhexan-1-one Chemical compound CCCCCC(=O)C1=C(O)C=C(O)C=C1O RGMMTOZHCJCZRW-UHFFFAOYSA-N 0.000 description 1
- WKBVIHZEQWUCAW-UHFFFAOYSA-N 2-phenyl-1-(2,4,6-trihydroxy-3-methylphenyl)ethanone Chemical compound CC1=C(O)C=C(O)C(C(=O)CC=2C=CC=CC=2)=C1O WKBVIHZEQWUCAW-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000194032 Enterococcus faecalis Species 0.000 description 1
- PTHLEKANMPKYDB-UHFFFAOYSA-N Flopropione Chemical compound CCC(=O)C1=C(O)C=C(O)C=C1O PTHLEKANMPKYDB-UHFFFAOYSA-N 0.000 description 1
- 241000515012 Micrococcus flavus Species 0.000 description 1
- 241000191938 Micrococcus luteus Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 241000186359 Mycobacterium Species 0.000 description 1
- 238000011785 NMRI mouse Methods 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- AHLYXGYSBJNLAA-UHFFFAOYSA-N [K].N#C[Fe](C#N)C#N Chemical compound [K].N#C[Fe](C#N)C#N AHLYXGYSBJNLAA-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000001907 coumarones Chemical class 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229940124606 potential therapeutic agent Drugs 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/91—Dibenzofurans; Hydrogenated dibenzofurans
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI358069A FI44240B (member.php) | 1969-12-10 | 1969-12-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO127537B true NO127537B (member.php) | 1973-07-09 |
Family
ID=8508580
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO473470A NO127537B (member.php) | 1969-12-10 | 1970-12-09 |
Country Status (8)
| Country | Link |
|---|---|
| AT (1) | AT298483B (member.php) |
| DE (1) | DE2060205A1 (member.php) |
| DK (1) | DK127925B (member.php) |
| FI (1) | FI44240B (member.php) |
| FR (1) | FR2081338B1 (member.php) |
| GB (1) | GB1329848A (member.php) |
| NO (1) | NO127537B (member.php) |
| SE (1) | SE375309B (member.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1204901B (it) * | 1986-06-25 | 1989-03-10 | Iscofar Sas | Composizioni contenenti acido usnico o suoi derivati atte all'impiego nel trattamento della carie dentaria |
| DE3825840A1 (de) * | 1988-07-29 | 1990-02-01 | Basf Ag | Dihydrodibenzofuranderivate und diese verbindungen enthaltende fungizide |
| EP1770089A1 (en) * | 2005-10-03 | 2007-04-04 | Institut Pasteur | Pyranodibenzofuran derivatives with antifungal and antibacterial activity |
| GB2579600B (en) | 2018-12-05 | 2023-07-05 | Byotrol Plc | Anti-viral composition |
-
1969
- 1969-12-10 FI FI358069A patent/FI44240B/fi active
-
1970
- 1970-12-01 GB GB5703370A patent/GB1329848A/en not_active Expired
- 1970-12-08 SE SE1658570A patent/SE375309B/xx unknown
- 1970-12-08 DK DK623370A patent/DK127925B/da unknown
- 1970-12-08 DE DE19702060205 patent/DE2060205A1/de active Pending
- 1970-12-09 NO NO473470A patent/NO127537B/no unknown
- 1970-12-10 FR FR7044481A patent/FR2081338B1/fr not_active Expired
- 1970-12-10 AT AT1109770A patent/AT298483B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SE375309B (member.php) | 1975-04-14 |
| FR2081338B1 (member.php) | 1974-10-11 |
| FR2081338A1 (member.php) | 1971-12-03 |
| AT298483B (de) | 1972-05-10 |
| GB1329848A (en) | 1973-09-12 |
| DK127925B (da) | 1974-02-04 |
| FI44240B (member.php) | 1971-06-30 |
| DE2060205A1 (de) | 1971-06-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4007169A (en) | Method of preparing derivatives of rifamycin S | |
| JPH0261476B2 (member.php) | ||
| JPH04112877A (ja) | 新規シアノピラジン誘導体及びその製造方法 | |
| NO127537B (member.php) | ||
| SK283649B6 (sk) | Spôsob izomerizácie metylovej skupiny v polohe 10 erytromycínových derivátov | |
| JPS5929050B2 (ja) | シクロヘキサンジオン−(1,3)の製法 | |
| US3420844A (en) | Pyrrole-2-carboxamido-propionamidines | |
| US3998807A (en) | Arabinofuranosyl cytosines and methods of making | |
| US3349095A (en) | 1-(5'-nitrofuryl)-1, 3-diketopropane derivatives and their preparation | |
| US3998999A (en) | Process for preparing pyrazomycin and pyrazomycin B | |
| US3583992A (en) | 1-methyl-d-lysergic acid-dihydroxy-alkyl-amides | |
| Sugihara et al. | Esterification kinetics of 5-hydroxy-1, 3-dioxane derivatives with acid anhydrides and acid chlorides in pyridine | |
| SU786902A3 (ru) | Способ получени 6-амино-2,3,5,6-тетрагидро-спиро /пенам-2,4-(4н)(тио)пиран/-3карбоновой кислоты или ее сложного эфира | |
| Nabeya et al. | Heterocyclic studies. 31. Preparation of 3-diazoacetylpyrazolines and conversion into diazabicyclo [3.2. 0] heptenones and 1, 2-diazepinones | |
| US4730059A (en) | 6'-thiomethylsubstituted spectinomycins | |
| US3382251A (en) | Benzylidenic derivatives of substituted gamma-lactones and their process of preparation | |
| FR2492828A1 (fr) | Derives d'aprosamine a activite antimicrobienne contre les bacteries gram-positives et gram-negatives | |
| FI61193C (fi) | Analogifoerfarande foer framstaellning av farmaceutiskt anvaendbara 2-deoxi-2-nikotinamido-1-0-nikotinoyl-glukopyranos-derivat | |
| US4876245A (en) | Fluorine-containing macrolide compounds and their use | |
| JPH04164093A (ja) | 新タイロシン誘導体 | |
| US4590185A (en) | 3-azinomethyl rifamycins | |
| Shneshil et al. | Synthesis of some saccharin derivatives containing 1, 2, 3-triazoline ring | |
| US4243596A (en) | (5-Nitro-2-furyl)vinylene-2-trimethylammonium bromide and method of preparing same | |
| Padmavathi et al. | A new class of sulfur‐linked bis‐1, 2, 3‐selenadiazoles, 1, 2, 3‐thiadiazoles, and 2H‐diazaphospholes | |
| HU182583B (en) | Process for preparing prostacyclin and analogues thereof |