NO125971B - - Google Patents
Download PDFInfo
- Publication number
- NO125971B NO125971B NO210969A NO210969A NO125971B NO 125971 B NO125971 B NO 125971B NO 210969 A NO210969 A NO 210969A NO 210969 A NO210969 A NO 210969A NO 125971 B NO125971 B NO 125971B
- Authority
- NO
- Norway
- Prior art keywords
- naphthyl
- methoxy
- methyl
- compounds
- acid
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 39
- 238000000034 method Methods 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 230000003287 optical effect Effects 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- 239000003638 chemical reducing agent Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 28
- -1 methoxy, methyl Chemical group 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 230000001754 anti-pyretic effect Effects 0.000 description 10
- 239000007858 starting material Substances 0.000 description 8
- 206010061218 Inflammation Diseases 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 230000003110 anti-inflammatory effect Effects 0.000 description 7
- 230000004054 inflammatory process Effects 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- CMWTZPSULFXXJA-UHFFFAOYSA-N 2-(6-methoxy-2-naphthalenyl)propanoic acid Chemical compound C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- DZFJDDMBLJXLJL-UHFFFAOYSA-N 2-(6-methylsulfanylnaphthalen-2-yl)propanoic acid Chemical compound C1=C(C(C)C(O)=O)C=CC2=CC(SC)=CC=C21 DZFJDDMBLJXLJL-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N EtOH Substances CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 230000000202 analgesic effect Effects 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000012280 lithium aluminium hydride Substances 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 150000008046 alkali metal hydrides Chemical class 0.000 description 4
- 230000001139 anti-pruritic effect Effects 0.000 description 4
- 239000002221 antipyretic Substances 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 208000002193 Pain Diseases 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 208000003251 Pruritus Diseases 0.000 description 3
- 206010037660 Pyrexia Diseases 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 3
- 230000036760 body temperature Effects 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- LJRVHSWMFDDXLN-UHFFFAOYSA-N 2-(6-methylnaphthalen-2-yl)propanoic acid Chemical compound C1=C(C)C=CC2=CC(C(C(O)=O)C)=CC=C21 LJRVHSWMFDDXLN-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 208000034656 Contusions Diseases 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- 201000005569 Gout Diseases 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000008135 aqueous vehicle Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 2
- 235000010418 carrageenan Nutrition 0.000 description 2
- 229920001525 carrageenan Polymers 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000009519 contusion Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000027950 fever generation Effects 0.000 description 2
- 208000021760 high fever Diseases 0.000 description 2
- 210000000548 hind-foot Anatomy 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- NWIMPGMAVYLECN-UHFFFAOYSA-N methyl 2-(6-methoxynaphthalen-2-yl)acetate Chemical compound C1=C(OC)C=CC2=CC(CC(=O)OC)=CC=C21 NWIMPGMAVYLECN-UHFFFAOYSA-N 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229960002895 phenylbutazone Drugs 0.000 description 2
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 201000003068 rheumatic fever Diseases 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- ZNDAYUSMXBELKE-UHFFFAOYSA-N 2-(1-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid Chemical compound C1=CC=C2C(O)C(CC(O)=O)CCC2=C1 ZNDAYUSMXBELKE-UHFFFAOYSA-N 0.000 description 1
- LYIIAXBYAXXHTG-UHFFFAOYSA-N 2-(1-hydroxy-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid Chemical compound OC1C(CC(O)=O)CCC2=CC(OC)=CC=C21 LYIIAXBYAXXHTG-UHFFFAOYSA-N 0.000 description 1
- DRYXTNBSASTONM-UHFFFAOYSA-N 2-(1-oxo-3,4-dihydro-2h-naphthalen-2-yl)acetic acid Chemical compound C1=CC=C2C(=O)C(CC(=O)O)CCC2=C1 DRYXTNBSASTONM-UHFFFAOYSA-N 0.000 description 1
- HFCQYKCGYMWUAH-UHFFFAOYSA-N 2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid Chemical compound C1C(CC(O)=O)CCC2=CC(OC)=CC=C21 HFCQYKCGYMWUAH-UHFFFAOYSA-N 0.000 description 1
- SMXYHTZAHLNPIV-UHFFFAOYSA-N 2-(6-methoxy-1-oxo-3,4-dihydro-2h-naphthalen-2-yl)acetic acid Chemical compound O=C1C(CC(O)=O)CCC2=CC(OC)=CC=C21 SMXYHTZAHLNPIV-UHFFFAOYSA-N 0.000 description 1
- LOWWSYWGAKCKLG-UHFFFAOYSA-N 2-(6-methoxynaphthalen-1-yl)acetic acid Chemical compound OC(=O)CC1=CC=CC2=CC(OC)=CC=C21 LOWWSYWGAKCKLG-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- DKVIPUUJSKIQFZ-UHFFFAOYSA-N 2-naphthalen-2-ylpropanoic acid Chemical compound C1=CC=CC2=CC(C(C(O)=O)C)=CC=C21 DKVIPUUJSKIQFZ-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- MNALUTYMBUBKNX-UHFFFAOYSA-N 6-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(OC)=CC=C21 MNALUTYMBUBKNX-UHFFFAOYSA-N 0.000 description 1
- XZGVYHGIPAJECB-UHFFFAOYSA-N 6-methyl-3,4-dihydro-2h-naphthalene-1-thione Chemical compound S=C1CCCC2=CC(C)=CC=C21 XZGVYHGIPAJECB-UHFFFAOYSA-N 0.000 description 1
- 206010027654 Allergic conditions Diseases 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 206010012442 Dermatitis contact Diseases 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 208000005171 Dysmenorrhea Diseases 0.000 description 1
- 206010013935 Dysmenorrhoea Diseases 0.000 description 1
- 206010017076 Fracture Diseases 0.000 description 1
- 206010019233 Headaches Diseases 0.000 description 1
- 208000017604 Hodgkin disease Diseases 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical class CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 206010029240 Neuritis Diseases 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- 208000037386 Typhoid Diseases 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 150000003797 alkaloid derivatives Chemical class 0.000 description 1
- 125000005910 alkyl carbonate group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- KMPWYEUPVWOPIM-KODHJQJWSA-N cinchonidine Chemical compound C1=CC=C2C([C@H]([C@H]3[N@]4CC[C@H]([C@H](C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-KODHJQJWSA-N 0.000 description 1
- KMPWYEUPVWOPIM-UHFFFAOYSA-N cinchonidine Natural products C1=CC=C2C(C(C3N4CCC(C(C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 208000010247 contact dermatitis Diseases 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- GSAATXFTFSUBJM-UHFFFAOYSA-N ethyl 2-(2-ethoxy-2-oxoethyl)-6-methoxy-1-oxo-3,4-dihydronaphthalene-2-carboxylate Chemical compound COC1=CC=C2C(=O)C(CC(=O)OCC)(C(=O)OCC)CCC2=C1 GSAATXFTFSUBJM-UHFFFAOYSA-N 0.000 description 1
- URNAYRDBUUZOIU-UHFFFAOYSA-N ethyl 2-(6-methoxynaphthalen-2-yl)propanoate Chemical compound C1=C(OC)C=CC2=CC(C(C)C(=O)OCC)=CC=C21 URNAYRDBUUZOIU-UHFFFAOYSA-N 0.000 description 1
- UKGQINOQDPAYBX-UHFFFAOYSA-N ethyl 6-methoxy-1-oxo-3,4-dihydro-2h-naphthalene-2-carboxylate Chemical compound COC1=CC=C2C(=O)C(C(=O)OCC)CCC2=C1 UKGQINOQDPAYBX-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 210000002683 foot Anatomy 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000003304 gavage Methods 0.000 description 1
- 231100000869 headache Toxicity 0.000 description 1
- 230000035876 healing Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 210000001503 joint Anatomy 0.000 description 1
- ZFYFBPCRUQZGJE-UHFFFAOYSA-N methyl 2-(6-methoxynaphthalen-2-yl)propanoate Chemical compound C1=C(OC)C=CC2=CC(C(C)C(=O)OC)=CC=C21 ZFYFBPCRUQZGJE-UHFFFAOYSA-N 0.000 description 1
- TUHSYVVRJZWTKY-UHFFFAOYSA-N methyl 2-(6-methylnaphthalen-2-yl)propanoate Chemical compound C1=C(C)C=CC2=CC(C(C)C(=O)OC)=CC=C21 TUHSYVVRJZWTKY-UHFFFAOYSA-N 0.000 description 1
- IMXPVBWBIFOAPB-UHFFFAOYSA-N methyl 2-(6-methylsulfanylnaphthalen-2-yl)propanoate Chemical compound C1=C(SC)C=CC2=CC(C(C)C(=O)OC)=CC=C21 IMXPVBWBIFOAPB-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 210000002346 musculoskeletal system Anatomy 0.000 description 1
- 208000004296 neuralgia Diseases 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000000711 polarimetry Methods 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 229940068968 polysorbate 80 Drugs 0.000 description 1
- 230000002980 postoperative effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 201000000306 sarcoidosis Diseases 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 201000008297 typhoid fever Diseases 0.000 description 1
- 210000001835 viscera Anatomy 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO210969A NO125971B (enrdf_load_stackoverflow) | 1969-05-22 | 1969-05-22 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO210969A NO125971B (enrdf_load_stackoverflow) | 1969-05-22 | 1969-05-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO125971B true NO125971B (enrdf_load_stackoverflow) | 1972-12-04 |
Family
ID=19878649
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO210969A NO125971B (enrdf_load_stackoverflow) | 1969-05-22 | 1969-05-22 |
Country Status (1)
| Country | Link |
|---|---|
| NO (1) | NO125971B (enrdf_load_stackoverflow) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK156642B (da) * | 1973-09-11 | 1989-09-18 | Beecham Group Ltd | Analogifremgangsmaade til fremstilling af napthalenderivater |
-
1969
- 1969-05-22 NO NO210969A patent/NO125971B/no unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK156642B (da) * | 1973-09-11 | 1989-09-18 | Beecham Group Ltd | Analogifremgangsmaade til fremstilling af napthalenderivater |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1179368A (en) | Enkephalinase enzyme inhibiting compounds | |
| NO142441B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk virksomme karboksylsyrederivater | |
| US2489236A (en) | Synthesis of biotin and related compounds | |
| SU1053743A3 (ru) | Способ получени производных фенилуксусной кислоты или их солей | |
| US3468939A (en) | 4- and 5-aryl-1-naphthaleneacetic acid compounds | |
| NO138061B (no) | Analogifremgangsm}te for fremstilling av nye terapeutisk aktive substituerte difenylpropionsyrederivater | |
| IL32161A (en) | Beta-(2-naphyhyl)beta-methyl methanol derivatives and their preparation | |
| US3385887A (en) | 4-isobutylphenylacetic acid | |
| NO750819L (enrdf_load_stackoverflow) | ||
| US4337353A (en) | Novel carboxylic acids, benzoyl phenyl alkanoic acids and use thereof | |
| NO125971B (enrdf_load_stackoverflow) | ||
| NO131930B (enrdf_load_stackoverflow) | ||
| JPH0278675A (ja) | ベンゾフラニル酢酸誘導体、その製法、粘液調節剤および抗ヒスタミン剤 | |
| NO143402B (no) | Analogifremgangsmaate til fremstilling av et terapeutisk virksomt fenyleddiksyrederivat | |
| US4473583A (en) | Compositions containing certain derivatives of 4-phenyl-4-oxobuten-2-oic acid and methods of treatment using them | |
| US4116972A (en) | Anti-inflammatory 1-oxo-isoindoline derivatives and processes for their preparation | |
| US3906038A (en) | 2-(6-Sulfo-2-naphthyl)propionic acid | |
| US3792167A (en) | Naphthyl alkanols and derivatives thereof,methods of use thereof,and processes for the preparation thereof | |
| NO131507B (enrdf_load_stackoverflow) | ||
| US2930800A (en) | 4-thianaphtheneacetic acids and preparation thereof | |
| CS199550B2 (en) | Process for preparing derivatives of thianthrene,thioxanthene and phenoxathiine | |
| NO792589L (no) | Fremgangsmaate for fremstilling av et hydroksyeddiksyrederivat | |
| US4562287A (en) | 2-(4-Biphenylyl)-4-hexenoic acid and derivatives thereof having anti-inflammatory activity | |
| NO144852B (no) | Fremgangsmaate til fremstilling av polymer-dispersjoner som basis for lateksmaling med hoey vaatfesteevne, og lateksmaling som inneholder en slik dispersjon | |
| NO750175L (enrdf_load_stackoverflow) |