NO122753B - - Google Patents
Download PDFInfo
- Publication number
- NO122753B NO122753B NO2125/69A NO212569A NO122753B NO 122753 B NO122753 B NO 122753B NO 2125/69 A NO2125/69 A NO 2125/69A NO 212569 A NO212569 A NO 212569A NO 122753 B NO122753 B NO 122753B
- Authority
- NO
- Norway
- Prior art keywords
- carboxylic acid
- dihydro
- benzofuran
- methyl
- acid
- Prior art date
Links
- -1 heterocyclic carboxylic acids Chemical class 0.000 claims description 37
- 150000001875 compounds Chemical class 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 150000007529 inorganic bases Chemical class 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 150000007530 organic bases Chemical class 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 238000005727 Friedel-Crafts reaction Methods 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 239000005864 Sulphur Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 51
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 48
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 42
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 40
- 239000000243 solution Substances 0.000 description 28
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 17
- 239000007858 starting material Substances 0.000 description 16
- 239000000203 mixture Substances 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 13
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- OALGDQAPRDHTMA-UHFFFAOYSA-N 6-methyl-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC=C2CC(C(O)=O)OC2=C1 OALGDQAPRDHTMA-UHFFFAOYSA-N 0.000 description 11
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 8
- 229910001023 sodium amalgam Inorganic materials 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- LJOODBDWMQKMFB-UHFFFAOYSA-N cyclohexylacetic acid Chemical compound OC(=O)CC1CCCCC1 LJOODBDWMQKMFB-UHFFFAOYSA-N 0.000 description 6
- 239000000155 melt Substances 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 239000012259 ether extract Substances 0.000 description 5
- WEVFUSSJCGAVOH-UHFFFAOYSA-N 2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound C1=CC=C2OC(C(=O)O)CC2=C1 WEVFUSSJCGAVOH-UHFFFAOYSA-N 0.000 description 4
- ADCSXAUMFOOIRE-UHFFFAOYSA-N 6-chloro-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound C1=C(Cl)C=C2OC(C(=O)O)CC2=C1 ADCSXAUMFOOIRE-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 230000001882 diuretic effect Effects 0.000 description 4
- 230000029142 excretion Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- WEVPVZMJEYAFKM-UHFFFAOYSA-N (6-chloro-2,3-dihydro-1-benzofuran-2-yl)methanol Chemical compound C1=C(Cl)C=C2OC(CO)CC2=C1 WEVPVZMJEYAFKM-UHFFFAOYSA-N 0.000 description 3
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 3
- DYSJMQABFPKAQM-UHFFFAOYSA-N 1-benzothiophene-2-carboxylic acid Chemical class C1=CC=C2SC(C(=O)O)=CC2=C1 DYSJMQABFPKAQM-UHFFFAOYSA-N 0.000 description 3
- ANDNWVFDPXBDQS-UHFFFAOYSA-N 5-butanoyl-6-methyl-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound C(CCC)(=O)C=1C(=CC2=C(CC(O2)C(=O)O)C1)C ANDNWVFDPXBDQS-UHFFFAOYSA-N 0.000 description 3
- PQRVGXBBBUGWBY-UHFFFAOYSA-N 6-chloro-7-methyl-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound C1=C(Cl)C(C)=C2OC(C(O)=O)CC2=C1 PQRVGXBBBUGWBY-UHFFFAOYSA-N 0.000 description 3
- AUSRBNPHZKIVHR-UHFFFAOYSA-N 7-methoxy-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound COC1=CC=CC2=C1OC(C(O)=O)C2 AUSRBNPHZKIVHR-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000001630 malic acid Substances 0.000 description 3
- 235000011090 malic acid Nutrition 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000012286 potassium permanganate Substances 0.000 description 3
- 230000000894 saliuretic effect Effects 0.000 description 3
- 210000002700 urine Anatomy 0.000 description 3
- HDILUVUJBIHXQV-UHFFFAOYSA-N (7-chloro-2,3-dihydro-1-benzofuran-2-yl)methanol Chemical compound C1=CC(Cl)=C2OC(CO)CC2=C1 HDILUVUJBIHXQV-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- QWBBPBRQALCEIZ-UHFFFAOYSA-N 2,3-dimethylphenol Chemical compound CC1=CC=CC(O)=C1C QWBBPBRQALCEIZ-UHFFFAOYSA-N 0.000 description 2
- YSFBEAASFUWWHU-UHFFFAOYSA-N 2,4-dichlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C(Cl)=C1 YSFBEAASFUWWHU-UHFFFAOYSA-N 0.000 description 2
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 2
- HMNKTRSOROOSPP-UHFFFAOYSA-N 3-Ethylphenol Chemical compound CCC1=CC=CC(O)=C1 HMNKTRSOROOSPP-UHFFFAOYSA-N 0.000 description 2
- UZAUVYXZMKQBEH-UHFFFAOYSA-N 5-butanoyl-6,7-dimethyl-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound C(CCC)(=O)C=1C(=C(C2=C(CC(O2)C(=O)O)C1)C)C UZAUVYXZMKQBEH-UHFFFAOYSA-N 0.000 description 2
- CWEMEMQGPCUERS-UHFFFAOYSA-N 5-chloro-2-prop-2-enylphenol Chemical compound OC1=CC(Cl)=CC=C1CC=C CWEMEMQGPCUERS-UHFFFAOYSA-N 0.000 description 2
- ZQWOLTVJEJDOFX-UHFFFAOYSA-N 6,7-dimethyl-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC=C2C=C(C(O)=O)OC2=C1C ZQWOLTVJEJDOFX-UHFFFAOYSA-N 0.000 description 2
- MXSSAVDQXFOUOF-UHFFFAOYSA-N 6,7-dimethyl-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC=C2CC(C(O)=O)OC2=C1C MXSSAVDQXFOUOF-UHFFFAOYSA-N 0.000 description 2
- AAOIETLWISYSNR-UHFFFAOYSA-N 6-chloro-7-methyl-1-benzofuran-2-carboxylic acid Chemical compound CC1=C(Cl)C=CC2=C1OC(C(O)=O)=C2 AAOIETLWISYSNR-UHFFFAOYSA-N 0.000 description 2
- CTZIOFMIHKGJHZ-UHFFFAOYSA-N 6-ethoxy-1-benzothiophene Chemical compound CCOC1=CC=C2C=CSC2=C1 CTZIOFMIHKGJHZ-UHFFFAOYSA-N 0.000 description 2
- GWBDBIRTRPIXJV-UHFFFAOYSA-N 6-fluoro-1-benzofuran-2-carboxylic acid Chemical compound C1=C(F)C=C2OC(C(=O)O)=CC2=C1 GWBDBIRTRPIXJV-UHFFFAOYSA-N 0.000 description 2
- ZYQCKPKFAFHUSJ-UHFFFAOYSA-N 6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound COC1=CC=C2CC(C(O)=O)OC2=C1 ZYQCKPKFAFHUSJ-UHFFFAOYSA-N 0.000 description 2
- STGSJLZWQHRTGE-UHFFFAOYSA-N 6-methyl-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC=C2C=C(C(O)=O)OC2=C1 STGSJLZWQHRTGE-UHFFFAOYSA-N 0.000 description 2
- KQRBOHOKLNORTA-UHFFFAOYSA-N 6-methyl-1-benzothiophene-2-carboxylic acid Chemical compound CC1=CC=C2C=C(C(O)=O)SC2=C1 KQRBOHOKLNORTA-UHFFFAOYSA-N 0.000 description 2
- XTRJFBANXKEVBM-UHFFFAOYSA-N 6-methyl-2,3-dihydro-1-benzothiophene-2-carboxylic acid Chemical compound CC1=CC=C2CC(C(O)=O)SC2=C1 XTRJFBANXKEVBM-UHFFFAOYSA-N 0.000 description 2
- QXBQJXVMLMPNHS-UHFFFAOYSA-N 7,8-dimethylchromen-2-one Chemical compound C1=CC(=O)OC2=C(C)C(C)=CC=C21 QXBQJXVMLMPNHS-UHFFFAOYSA-N 0.000 description 2
- VHOAUUCXGIKDJV-UHFFFAOYSA-N 7-chloro-8-methylchromen-2-one Chemical compound ClC1=CC=C2C=CC(OC2=C1C)=O VHOAUUCXGIKDJV-UHFFFAOYSA-N 0.000 description 2
- OJBJSQSBMJPVBA-UHFFFAOYSA-N 7-ethylchromen-2-one Chemical compound C1=CC(=O)OC2=CC(CC)=CC=C21 OJBJSQSBMJPVBA-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- IMJYHGNVZNJZCZ-UHFFFAOYSA-N C(C)OC=1C=CC2=C(SC(C2)C(=O)O)C1 Chemical compound C(C)OC=1C=CC2=C(SC(C2)C(=O)O)C1 IMJYHGNVZNJZCZ-UHFFFAOYSA-N 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 230000007059 acute toxicity Effects 0.000 description 2
- 231100000403 acute toxicity Toxicity 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- DLTWLXUYSLIIQN-UHFFFAOYSA-N furacrinic acid Chemical compound C1=C(C)C(C(=O)C(=C)CC)=CC2=C1OC(C(O)=O)=C2 DLTWLXUYSLIIQN-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- KIWUVOGUEXMXSV-UHFFFAOYSA-N rhodanine Chemical compound O=C1CSC(=S)N1 KIWUVOGUEXMXSV-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- 229910001415 sodium ion Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- VYLJTMRMHUANLT-UHFFFAOYSA-N (4-chloro-2,3-dihydro-1-benzofuran-2-yl)methanol Chemical compound OCC1OC2=C(C1)C(=CC=C2)Cl VYLJTMRMHUANLT-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- OFFSPAZVIVZPHU-UHFFFAOYSA-N 1-benzofuran-2-carboxylic acid Chemical class C1=CC=C2OC(C(=O)O)=CC2=C1 OFFSPAZVIVZPHU-UHFFFAOYSA-N 0.000 description 1
- ITMGMSZDAOAVNO-UHFFFAOYSA-N 2,3-dihydro-1-benzofuran-2-ylmethanol Chemical class C1=CC=C2OC(CO)CC2=C1 ITMGMSZDAOAVNO-UHFFFAOYSA-N 0.000 description 1
- DMIYKWPEFRFTPY-UHFFFAOYSA-N 2,6-dichlorobenzaldehyde Chemical compound ClC1=CC=CC(Cl)=C1C=O DMIYKWPEFRFTPY-UHFFFAOYSA-N 0.000 description 1
- RZWGTXHSYZGXKF-UHFFFAOYSA-N 2-(2-methylphenyl)acetic acid Chemical compound CC1=CC=CC=C1CC(O)=O RZWGTXHSYZGXKF-UHFFFAOYSA-N 0.000 description 1
- RUALOJPMDIKFQU-UHFFFAOYSA-N 2-(oxiran-2-ylmethyl)phenol Chemical class OC1=CC=CC=C1CC1OC1 RUALOJPMDIKFQU-UHFFFAOYSA-N 0.000 description 1
- ITZMIRCWGDWDCI-UHFFFAOYSA-N 2-chloro-6-(oxiran-2-ylmethyl)phenol Chemical compound OC1=C(Cl)C=CC=C1CC1OC1 ITZMIRCWGDWDCI-UHFFFAOYSA-N 0.000 description 1
- UPEBXJHGPMUFKU-UHFFFAOYSA-N 2-chloro-6-prop-2-enylphenol Chemical compound OC1=C(Cl)C=CC=C1CC=C UPEBXJHGPMUFKU-UHFFFAOYSA-N 0.000 description 1
- SMUKODJVMQOSAB-UHFFFAOYSA-N 2-ethylbutanoyl chloride Chemical compound CCC(CC)C(Cl)=O SMUKODJVMQOSAB-UHFFFAOYSA-N 0.000 description 1
- WADQOGCINABPRT-UHFFFAOYSA-N 3-chloro-2-methylphenol Chemical compound CC1=C(O)C=CC=C1Cl WADQOGCINABPRT-UHFFFAOYSA-N 0.000 description 1
- YJXFVEWYNFGQAJ-UHFFFAOYSA-N 3-chloro-2-prop-2-enylphenol Chemical compound OC1=CC=CC(Cl)=C1CC=C YJXFVEWYNFGQAJ-UHFFFAOYSA-N 0.000 description 1
- ISULZYQDGYXDFW-UHFFFAOYSA-N 3-methylbutanoyl chloride Chemical compound CC(C)CC(Cl)=O ISULZYQDGYXDFW-UHFFFAOYSA-N 0.000 description 1
- IPAXPERGAMNMIJ-UHFFFAOYSA-N 4-chloro-1-benzothiophene-2-carboxylic acid Chemical compound C1=CC=C2SC(C(=O)O)=CC2=C1Cl IPAXPERGAMNMIJ-UHFFFAOYSA-N 0.000 description 1
- DEXIXUHOXHEGAO-UHFFFAOYSA-N 4-chloro-2,3-dihydro-1-benzothiophene-2-carboxylic acid Chemical compound C1=CC=C(Cl)C2=C1SC(C(=O)O)C2 DEXIXUHOXHEGAO-UHFFFAOYSA-N 0.000 description 1
- GBJJCODOZGPTBC-UHFFFAOYSA-N 4-fluoro-2-hydroxybenzaldehyde Chemical compound OC1=CC(F)=CC=C1C=O GBJJCODOZGPTBC-UHFFFAOYSA-N 0.000 description 1
- DUTNBAQMMZPIKM-UHFFFAOYSA-N 5-[(2,4-dichlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one Chemical compound ClC1=CC(Cl)=CC=C1C=C1C(=O)NC(=S)S1 DUTNBAQMMZPIKM-UHFFFAOYSA-N 0.000 description 1
- TYMFHCSSPRSNCE-UHFFFAOYSA-N 5-butanoyl-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound C(CCC)(=O)C=1C=CC2=C(CC(O2)C(=O)O)C1 TYMFHCSSPRSNCE-UHFFFAOYSA-N 0.000 description 1
- DQDCZFBXEHDCFX-UHFFFAOYSA-N 5-butanoyl-6-ethyl-1-benzofuran-2-carboxylic acid Chemical compound C(C)C1=CC2=C(C=C(O2)C(=O)O)C=C1C(CCC)=O DQDCZFBXEHDCFX-UHFFFAOYSA-N 0.000 description 1
- WPVBSBUSNBWWHS-UHFFFAOYSA-N 5-butanoyl-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound C(CCC)(=O)C=1C(=CC2=C(CC(O2)C(=O)O)C1)OC WPVBSBUSNBWWHS-UHFFFAOYSA-N 0.000 description 1
- XYZSWFFJRMCPJZ-UHFFFAOYSA-N 5-chloro-2-(oxiran-2-ylmethyl)phenol Chemical compound O1C(CC2=C(C=C(C=C2)Cl)O)C1 XYZSWFFJRMCPJZ-UHFFFAOYSA-N 0.000 description 1
- AVAGKGZNBMZOLD-UHFFFAOYSA-N 6-chloro-1-benzothiophene-2-carboxylic acid Chemical compound C1=C(Cl)C=C2SC(C(=O)O)=CC2=C1 AVAGKGZNBMZOLD-UHFFFAOYSA-N 0.000 description 1
- CDZHZOSUCIBINM-UHFFFAOYSA-N 6-chloro-2,3-dihydro-1-benzothiophene-2-carboxylic acid Chemical compound C1=C(Cl)C=C2SC(C(=O)O)CC2=C1 CDZHZOSUCIBINM-UHFFFAOYSA-N 0.000 description 1
- WYNACKHHQNKNFI-UHFFFAOYSA-N 6-ethoxy-1-benzothiophen-3-one Chemical compound CCOC1=CC=C2C(=O)CSC2=C1 WYNACKHHQNKNFI-UHFFFAOYSA-N 0.000 description 1
- CYSOQVHPWPQGAD-UHFFFAOYSA-N 6-ethoxy-1-benzothiophene-2-carboxylic acid Chemical compound CCOC1=CC=C2C=C(C(O)=O)SC2=C1 CYSOQVHPWPQGAD-UHFFFAOYSA-N 0.000 description 1
- FECWAUVNWRDABN-UHFFFAOYSA-N 6-ethyl-1-benzofuran-2-carboxylic acid Chemical compound CCC1=CC=C2C=C(C(O)=O)OC2=C1 FECWAUVNWRDABN-UHFFFAOYSA-N 0.000 description 1
- KSSRTMJGUNWSTN-UHFFFAOYSA-N 7-chloro-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound C1=CC(Cl)=C2OC(C(=O)O)CC2=C1 KSSRTMJGUNWSTN-UHFFFAOYSA-N 0.000 description 1
- UOCNTRAAJNWDND-UHFFFAOYSA-N 7-methoxy-1-benzofuran-2-carboxylic acid Chemical compound COC1=CC=CC2=C1OC(C(O)=O)=C2 UOCNTRAAJNWDND-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- NYTOAKDBDTVUBX-UHFFFAOYSA-N CC(CC(=O)C=1C(=CC2=C(CC(O2)C(=O)O)C1)C)C Chemical compound CC(CC(=O)C=1C(=CC2=C(CC(O2)C(=O)O)C1)C)C NYTOAKDBDTVUBX-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 208000004880 Polyuria Diseases 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- GJEAMHAFPYZYDE-UHFFFAOYSA-N [C].[S] Chemical compound [C].[S] GJEAMHAFPYZYDE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 1
- HAJXNVWQYIKNQT-UHFFFAOYSA-N benzene;tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl.C1=CC=CC=C1 HAJXNVWQYIKNQT-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- QAWBXZYPFCFQLA-UHFFFAOYSA-N butanoyl bromide Chemical compound CCCC(Br)=O QAWBXZYPFCFQLA-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- FNJVDWXUKLTFFL-UHFFFAOYSA-N diethyl 2-bromopropanedioate Chemical compound CCOC(=O)C(Br)C(=O)OCC FNJVDWXUKLTFFL-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 235000019439 ethyl acetate Nutrition 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- YWGHUJQYGPDNKT-UHFFFAOYSA-N hexanoyl chloride Chemical compound CCCCCC(Cl)=O YWGHUJQYGPDNKT-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- NJNQUTDUIPVROZ-UHFFFAOYSA-N nitrocyclohexane Chemical compound [O-][N+](=O)C1CCCCC1 NJNQUTDUIPVROZ-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- REEZZSHJLXOIHL-UHFFFAOYSA-N octanoyl chloride Chemical compound CCCCCCCC(Cl)=O REEZZSHJLXOIHL-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 229940005657 pyrophosphoric acid Drugs 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Inorganic materials O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/82—Benzo [b] furans; Hydrogenated benzo [b] furans with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D307/84—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D307/85—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/06—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2
- C07D311/08—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring
- C07D311/16—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring substituted in position 7
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/62—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D333/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D333/70—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH803068A CH508615A (de) | 1968-05-30 | 1968-05-30 | Verfahren zur Herstellung von neuen heterocyclischen Carbonsäuren |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO122753B true NO122753B (ru) | 1971-08-09 |
Family
ID=4334080
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO2125/69A NO122753B (ru) | 1968-05-30 | 1969-05-23 |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US3651094A (ru) |
| AT (1) | AT284835B (ru) |
| BE (1) | BE733768A (ru) |
| CH (1) | CH508615A (ru) |
| DE (1) | DE1927393A1 (ru) |
| DK (1) | DK124129B (ru) |
| ES (1) | ES367837A1 (ru) |
| FR (1) | FR2009652A1 (ru) |
| GB (1) | GB1265882A (ru) |
| IE (1) | IE33124B1 (ru) |
| IL (1) | IL32310A (ru) |
| NL (1) | NL6907966A (ru) |
| NO (1) | NO122753B (ru) |
| SE (1) | SE360359B (ru) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3954748A (en) * | 1968-07-29 | 1976-05-04 | Societe D'etudes Scientifiques Et Industrielles De L'ile-De-France | 3-Alkoxy-thianapthene-2-carboxamides |
| US3969529A (en) * | 1969-10-10 | 1976-07-13 | C.E.R.P.H.A. | Phenoxyacetic acid derivatives as diuretic agents |
| USB353986I5 (ru) * | 1969-10-10 | 1975-01-28 | ||
| US4181727A (en) * | 1975-07-09 | 1980-01-01 | Merck & Co., Inc. | 2,3-Dihydro-6,7-disubstituted-5-acyl benzofuran-2-carboxylic acids |
| US4296122A (en) * | 1975-07-09 | 1981-10-20 | Merck & Co., Inc. | 2,3-Dihydro-6,7-disubstituted-5-(acyl)benzofuran-2-carboxylic acids |
| US4087542A (en) * | 1975-07-09 | 1978-05-02 | Merck & Co., Inc. | 2,3-Dihydro-6,7-disubstituted-5-acyl benzofuran-2-carboxylic acids |
| US4401669A (en) * | 1978-01-27 | 1983-08-30 | Merck & Co., Inc. | 2,3-Dihydro-substituted-5-benzoyl benzofuran-2-carboxylic acids and their use in treating hypertension |
| US4213998A (en) * | 1979-06-07 | 1980-07-22 | Shell Oil Company | Inhibition of lipogenesis |
| US4213999A (en) * | 1979-06-07 | 1980-07-22 | Shell Oil Company | Inhibition of lipogenesis |
| US4237144A (en) * | 1979-06-21 | 1980-12-02 | Merck & Co., Inc. | 2,3-Dihydro-2,6,7-trisubstituted-5-acylbenzofurans |
| US4552891A (en) * | 1983-09-13 | 1985-11-12 | Eli Lilly And Company | Benzothiophene derivatives |
| US4822803A (en) * | 1983-10-31 | 1989-04-18 | Merck Frosst Canada, Inc. | Benzofuran 2-carboxylic acid hydrazides useful as inhibitors of leukotriene biosynthesis |
| US4933351A (en) * | 1983-10-31 | 1990-06-12 | Merck Frosst Canada, Inc. | Benzofuran 2-carbox amides useful as inhibitors of leukoriene biosynthesis |
| US4654365A (en) * | 1985-09-26 | 1987-03-31 | Merck & Co., Inc. | 2,3-dihydro-5-(3-oxo-2-cyclohexen-1-yl)-2-benzofurancarboxylic acids, and their salts useful in the treatment of brain injury |
| US5703116A (en) * | 1995-04-18 | 1997-12-30 | Geron Corporation | Telomerase Inhibitors |
| US5863936A (en) * | 1995-04-18 | 1999-01-26 | Geron Corporation | Telomerase inhibitors |
| US5760062A (en) * | 1995-04-18 | 1998-06-02 | Geron Corporation | Telomerase inhibitors |
| US5770613A (en) * | 1995-09-29 | 1998-06-23 | Geron Corporation | Telomerase inhibitors |
| US5767278A (en) * | 1995-10-06 | 1998-06-16 | Geron Corporation | Telomerase inhibitors |
| US20040071797A1 (en) * | 2002-10-09 | 2004-04-15 | Dennis Donald P. | Method and formulation for suppressing mold |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3255241A (en) * | 1961-01-19 | 1966-06-07 | Merck & Co Inc | (2-alkylidene acyl)phenoxy-and (2-alkylidene acyl)phenylmercaptocarboxylic acids |
-
1968
- 1968-05-30 CH CH803068A patent/CH508615A/de not_active IP Right Cessation
-
1969
- 1969-05-23 DK DK283069AA patent/DK124129B/da unknown
- 1969-05-23 NO NO2125/69A patent/NO122753B/no unknown
- 1969-05-23 NL NL6907966A patent/NL6907966A/xx unknown
- 1969-05-23 SE SE07336/69A patent/SE360359B/xx unknown
- 1969-05-26 US US827941A patent/US3651094A/en not_active Expired - Lifetime
- 1969-05-29 DE DE19691927393 patent/DE1927393A1/de active Pending
- 1969-05-29 AT AT511669A patent/AT284835B/de not_active IP Right Cessation
- 1969-05-29 IE IE731/69A patent/IE33124B1/xx unknown
- 1969-05-29 GB GB1265882D patent/GB1265882A/en not_active Expired
- 1969-05-29 ES ES367837A patent/ES367837A1/es not_active Expired
- 1969-05-29 BE BE733768D patent/BE733768A/xx unknown
- 1969-05-29 IL IL32310A patent/IL32310A/xx unknown
- 1969-05-29 FR FR6917584A patent/FR2009652A1/fr active Pending
-
1971
- 1971-09-20 US US00182164A patent/US3751430A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IL32310A (en) | 1972-12-29 |
| US3751430A (en) | 1973-08-07 |
| IE33124B1 (en) | 1974-03-20 |
| ES367837A1 (es) | 1971-12-01 |
| AT284835B (de) | 1970-09-25 |
| BE733768A (ru) | 1969-12-01 |
| DE1927393A1 (de) | 1969-12-04 |
| NL6907966A (ru) | 1969-12-02 |
| FR2009652A1 (ru) | 1970-02-06 |
| US3651094A (en) | 1972-03-21 |
| CH508615A (de) | 1971-06-15 |
| SE360359B (ru) | 1973-09-24 |
| IE33124L (en) | 1969-11-30 |
| IL32310A0 (en) | 1969-07-30 |
| GB1265882A (ru) | 1972-03-08 |
| DK124129B (da) | 1972-09-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO122753B (ru) | ||
| Roomi et al. | The Hantzsch pyrrole synthesis | |
| IE43079B1 (en) | Quinolone derivatives | |
| NO154346B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive ftalazin-4-yl-eddiksyrederivater. | |
| EP0146243A1 (en) | Lipoxygenase inhibitors | |
| NO844957L (no) | Benzo(b)tiofener | |
| KR970011580B1 (ko) | 항알레르기 활성을 갖는 신규의 벤조티오펜 | |
| US3580931A (en) | 5-(2-methylenealkanoyl)-benzofuran 7-carboxylic acids | |
| SU1409130A3 (ru) | Способ получени производных ароилбензофуран/тиофенил/уксусной или пропионовой кислоты или их сложных эфиров, или их фармацевтически приемлемых солей | |
| US5102905A (en) | Thienyl benzothienyl and dibenzothienyl compounds as inhibitors of aldose reductase | |
| NO122754B (ru) | ||
| IE49658B1 (en) | 6-substituted pyranone compounds and their use as pharmaceuticals | |
| US4666928A (en) | Propylphenoxy pyridine carboxylates as leukotriene antagonists | |
| US3674810A (en) | 4-chloro-5-(2-methylene-butyryl)-benzo(6)thiophene-2-carboxylic acids | |
| US3301859A (en) | Cinchoninic acids and use in process for quinolinols | |
| Werner | A new synthesis of benzo (b) thiophanthrene | |
| NO125384B (ru) | ||
| NO137597B (no) | Xantonderivater for bruk som mellomprodukter ved fremstilling av terapeutisk virksomme forbindelser | |
| NO792828L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive benzotienotiazin-derivater | |
| US3843797A (en) | Saluretic and diuretic compositions and method with 2,3-dihydro-5-(2-nitro-1-alkenylbenzofuran-2-carboxylic acids and pharmaceutically acceptable salts | |
| US3682961A (en) | 4-chloro-5-(2-methylene-butryl)-indole carboxylic acid | |
| NO176277B (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive 3,4-dihydro-2-alkyl-3-okso-N-aryl-2H-[1Åbenzotieno[3,2-eÅ-1,2-tiazin-4-karboksamid-1,1-dioksyder | |
| NO823586L (no) | Fenolderivater. | |
| NO122657B (ru) | ||
| NO124483B (ru) |