NO121664B - - Google Patents
Download PDFInfo
- Publication number
- NO121664B NO121664B NO1118/68A NO111868A NO121664B NO 121664 B NO121664 B NO 121664B NO 1118/68 A NO1118/68 A NO 1118/68A NO 111868 A NO111868 A NO 111868A NO 121664 B NO121664 B NO 121664B
- Authority
- NO
- Norway
- Prior art keywords
- imidazoline
- trichlorobenzyl
- acid
- hydrochloric acid
- physiologically acceptable
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 9
- ZUZLGSONCFESPE-UHFFFAOYSA-N 2-(2,3,6-trichlorophenyl)acetonitrile Chemical compound ClC1=CC=C(Cl)C(CC#N)=C1Cl ZUZLGSONCFESPE-UHFFFAOYSA-N 0.000 claims description 5
- HVCCFMAPGCBCHZ-UHFFFAOYSA-N 2-aminoethylazanium;4-methylbenzenesulfonate Chemical compound NCCN.CC1=CC=C(S(O)(=O)=O)C=C1 HVCCFMAPGCBCHZ-UHFFFAOYSA-N 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000001450 anions Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 47
- 241000699670 Mus sp. Species 0.000 description 17
- -1 2-(trichlorobenzyl)-2-imidazolines Chemical class 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- RZAARLYULZKCEK-UHFFFAOYSA-N 2-[(2,3,6-trichlorophenyl)methyl]-4,5-dihydro-1H-imidazole Chemical class ClC1=C(CC=2NCCN2)C(=CC=C1Cl)Cl RZAARLYULZKCEK-UHFFFAOYSA-N 0.000 description 13
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- AUSHSURJGODDIZ-UHFFFAOYSA-N 2-[(2,4,5-trichlorophenyl)methyl]-4,5-dihydro-1H-imidazole Chemical compound ClC1=C(CC=2NCCN2)C=C(C(=C1)Cl)Cl AUSHSURJGODDIZ-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 8
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 8
- 239000012458 free base Substances 0.000 description 7
- 239000003960 organic solvent Substances 0.000 description 7
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000012065 filter cake Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 208000011580 syndromic disease Diseases 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- VVVRSNXQGMSWSV-UHFFFAOYSA-N 2-[(2,3,6-trichlorophenyl)methyl]-4,5-dihydro-1H-imidazole hydrochloride Chemical compound Cl.ClC1=C(CC=2NCCN2)C(=CC=C1Cl)Cl VVVRSNXQGMSWSV-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 230000000202 analgesic effect Effects 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 150000002462 imidazolines Chemical class 0.000 description 5
- 239000007928 intraperitoneal injection Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- CYPFPSICESWOSR-UHFFFAOYSA-N 2-(2,4,5-trichlorophenyl)acetonitrile Chemical compound ClC1=CC(Cl)=C(CC#N)C=C1Cl CYPFPSICESWOSR-UHFFFAOYSA-N 0.000 description 4
- VFFKSHPDBRNFPW-UHFFFAOYSA-N 2-[(2,4,5-trichlorophenyl)methyl]-4,5-dihydro-1H-imidazole hydrochloride Chemical compound Cl.ClC1=C(CC=2NCCN2)C=C(C(=C1)Cl)Cl VFFKSHPDBRNFPW-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 238000007796 conventional method Methods 0.000 description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 4
- 239000011976 maleic acid Substances 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000001630 malic acid Substances 0.000 description 3
- 235000011090 malic acid Nutrition 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- KWTSXDURSIMDCE-QMMMGPOBSA-N (S)-amphetamine Chemical compound C[C@H](N)CC1=CC=CC=C1 KWTSXDURSIMDCE-QMMMGPOBSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 210000001015 abdomen Anatomy 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229940025084 amphetamine Drugs 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 229910001873 dinitrogen Inorganic materials 0.000 description 2
- 239000002934 diuretic Substances 0.000 description 2
- 230000001882 diuretic effect Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 210000004197 pelvis Anatomy 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000000932 sedative agent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000001384 succinic acid Substances 0.000 description 2
- VHBUHVHHNRJLAS-UHFFFAOYSA-N C(C=C/C(=O)O)(=O)O.ClC1=C(CC=2NCCN2)C(=CC=C1Cl)Cl Chemical compound C(C=C/C(=O)O)(=O)O.ClC1=C(CC=2NCCN2)C(=CC=C1Cl)Cl VHBUHVHHNRJLAS-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 206010044565 Tremor Diseases 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 235000020442 apple syrup Nutrition 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- UYXAWHWODHRRMR-UHFFFAOYSA-N hexobarbital Chemical compound O=C1N(C)C(=O)NC(=O)C1(C)C1=CCCCC1 UYXAWHWODHRRMR-UHFFFAOYSA-N 0.000 description 1
- 229960002456 hexobarbital Drugs 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- LZJLROCGDZZRMC-UHFFFAOYSA-N sulfuric acid 2-[(2,3,6-trichlorophenyl)methyl]-4,5-dihydro-1H-imidazole Chemical compound S(=O)(=O)(O)O.ClC1=C(CC=2NCCN2)C(=CC=C1Cl)Cl LZJLROCGDZZRMC-UHFFFAOYSA-N 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/20—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US62830567A | 1967-04-04 | 1967-04-04 | |
| US62829867A | 1967-04-04 | 1967-04-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO121664B true NO121664B (enExample) | 1971-03-29 |
Family
ID=27090673
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1118/68A NO121664B (enExample) | 1967-04-04 | 1968-03-22 |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US3423422A (enExample) |
| BE (1) | BE713193A (enExample) |
| CH (1) | CH515908A (enExample) |
| DE (1) | DE1770114A1 (enExample) |
| DK (1) | DK115776B (enExample) |
| FR (2) | FR1580194A (enExample) |
| GB (1) | GB1165099A (enExample) |
| NL (1) | NL6804671A (enExample) |
| NO (1) | NO121664B (enExample) |
| SE (1) | SE342452B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1417174A (en) * | 1972-11-30 | 1975-12-10 | Hexachimie | 1-2-delta2-imidazolinyl-2,2-diarylcoclopropanes |
| EP4204404A4 (en) * | 2020-08-27 | 2024-12-25 | Curasen Therapeutics, Inc. | Alpha1a-adrenergic receptor agonists and methods of use |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2919274A (en) * | 1957-09-17 | 1959-12-29 | Sahyun Melville | Amidines |
-
1967
- 1967-04-04 US US628298A patent/US3423422A/en not_active Expired - Lifetime
- 1967-04-04 US US628305A patent/US3423423A/en not_active Expired - Lifetime
-
1968
- 1968-03-22 NO NO1118/68A patent/NO121664B/no unknown
- 1968-03-29 FR FR1580194D patent/FR1580194A/fr not_active Expired
- 1968-04-01 SE SE4281/68A patent/SE342452B/xx unknown
- 1968-04-02 GB GB05809/68A patent/GB1165099A/en not_active Expired
- 1968-04-02 DE DE19681770114 patent/DE1770114A1/de active Pending
- 1968-04-03 NL NL6804671A patent/NL6804671A/xx unknown
- 1968-04-03 DK DK147368AA patent/DK115776B/da unknown
- 1968-04-03 BE BE713193D patent/BE713193A/xx unknown
- 1968-04-04 CH CH509468A patent/CH515908A/de not_active IP Right Cessation
- 1968-06-28 FR FR157206A patent/FR8077M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE342452B (enExample) | 1972-02-07 |
| FR1580194A (enExample) | 1969-09-05 |
| US3423423A (en) | 1969-01-21 |
| BE713193A (enExample) | 1968-10-03 |
| CH515908A (de) | 1971-11-30 |
| NL6804671A (enExample) | 1968-10-07 |
| GB1165099A (en) | 1969-09-24 |
| DE1770114A1 (de) | 1971-09-23 |
| FR8077M (enExample) | 1970-07-15 |
| US3423422A (en) | 1969-01-21 |
| DK115776B (da) | 1969-11-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3254088A (en) | Morphine derivative | |
| NO151320B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktiv pyrrolidylmetyl-2-metoksy-4-amino-5-isopropyl-sulfonylbenzamider | |
| DE2366106B1 (de) | 2-Amino-6,7-dimethoxy-4-(methoxysubstituierte-1,2,3,4-tetrahydroisochinolin-2-yl)-chinazolinderivate,Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2522553A1 (de) | Eckige klammer auf 1-hydroximino- 2,2-disubstituiert-5-indanyloxy(oder thio) eckige klammer zu alkansaeuren und verfahren zu ihrer herstellung | |
| US3910922A (en) | Novel trifluoromethyl-quinolines | |
| DE69313640T2 (de) | Zink-tranexamat derivat | |
| US3449355A (en) | 2-((3,4-dihalophenoxy)methyl)-2-imidazoline | |
| DE2429290A1 (de) | Tricyclische kondensierte imidazolderivate und verfahren zu ihrer herstellung | |
| NO121664B (enExample) | ||
| DE1470139C3 (de) | 5,11-Dihydrodibenz eckige Klammer auf b,e eckige Klammer zu-1,4-oxazepine und Verfahren zu ihrer Herstellung | |
| JPS6140268A (ja) | イミダゾリン、その付加塩及びその製造方法並びにイミダゾリン又はその付加塩を有効成分とする医薬 | |
| US3449357A (en) | 2-((2,6-substituted)phenoxymethyl)-2-imidazolines | |
| DE2117358A1 (de) | 4-Aminomethyl-spiro eckige Klammer auf dibenzo eckige Klammer auf a,d eckige Klammer zu cycloheptadi-(oder tri) en-5,2-(1,3-dioxolan) eckige Klammer zu -Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittelwirkstoff | |
| US3449356A (en) | 2-((halophenoxy)methyl)-2-imidazolines | |
| US3923996A (en) | 3-Substituted-oxindoles in compositions and methods of treating obesity | |
| US2727041A (en) | Isonicotinyl hydrazone of m-formyl-benzene sulfonic acid | |
| DE2439284C2 (de) | 2-Phenyl-3-amino-4-acetyl-5-methylpyrrol, dessen Salze und diese Verbindungen enthaltende pharmazeutische Zubereitung | |
| US3534142A (en) | Methods of treating tapeworm infections with naphthamidines | |
| US3423425A (en) | 11-aminoaliphatic - 5,10 - methanodibenzo(a,d)(1,4)cycloheptadienes and the salts thereof | |
| DE2542791A1 (de) | N,n'-disubstituierte naphthylacetamidine | |
| US3449354A (en) | 2-((2-trifluoromethylphenoxy)methyl)-2-imidazoline | |
| US3520920A (en) | Amine salts of nopinic acid | |
| US3971798A (en) | Pyridine derivative, processes of preparation and pharmaceutical compositions | |
| US3910898A (en) | Novel trifluoromethyl-quinolines | |
| US3459750A (en) | Asymmetrical triazines |