NO119204B - - Google Patents
Download PDFInfo
- Publication number
- NO119204B NO119204B NO16154066A NO16154066A NO119204B NO 119204 B NO119204 B NO 119204B NO 16154066 A NO16154066 A NO 16154066A NO 16154066 A NO16154066 A NO 16154066A NO 119204 B NO119204 B NO 119204B
- Authority
- NO
- Norway
- Prior art keywords
- bath
- salts
- residue
- acids
- acid
- Prior art date
Links
- 238000000576 coating method Methods 0.000 claims description 13
- 125000005842 heteroatom Chemical group 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 150000007513 acids Chemical class 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000003460 sulfonic acids Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 239000000758 substrate Substances 0.000 claims 1
- 239000011593 sulfur Substances 0.000 claims 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 12
- 239000011248 coating agent Substances 0.000 description 9
- 229910052759 nickel Inorganic materials 0.000 description 6
- 150000008053 sultones Chemical class 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 238000007747 plating Methods 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 125000000542 sulfonic acid group Chemical group 0.000 description 4
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- FSSPGSAQUIYDCN-UHFFFAOYSA-N 1,3-Propane sultone Chemical compound O=S1(=O)CCCO1 FSSPGSAQUIYDCN-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000005282 brightening Methods 0.000 description 2
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical class NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical class NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- OUQMXTJYCAJLGO-UHFFFAOYSA-N 4-methyl-1,3-thiazol-2-amine Chemical compound CC1=CSC(N)=N1 OUQMXTJYCAJLGO-UHFFFAOYSA-N 0.000 description 1
- DZWTXWPRWRLHIL-UHFFFAOYSA-N 6-methyl-1,3-benzothiazol-2-amine Chemical compound CC1=CC=C2N=C(N)SC2=C1 DZWTXWPRWRLHIL-UHFFFAOYSA-N 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- 229910000906 Bronze Inorganic materials 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- PFRUBEOIWWEFOL-UHFFFAOYSA-N [N].[S] Chemical compound [N].[S] PFRUBEOIWWEFOL-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 239000010974 bronze Substances 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000009499 grossing Methods 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- LGQLOGILCSXPEA-UHFFFAOYSA-L nickel sulfate Chemical compound [Ni+2].[O-]S([O-])(=O)=O LGQLOGILCSXPEA-UHFFFAOYSA-L 0.000 description 1
- 229910000363 nickel(II) sulfate Inorganic materials 0.000 description 1
- MHYFEEDKONKGEB-UHFFFAOYSA-N oxathiane 2,2-dioxide Chemical compound O=S1(=O)CCCCO1 MHYFEEDKONKGEB-UHFFFAOYSA-N 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical class NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical group OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
- 235000009529 zinc sulphate Nutrition 0.000 description 1
- 239000011686 zinc sulphate Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21C—PRODUCTION OF CELLULOSE BY REMOVING NON-CELLULOSE SUBSTANCES FROM CELLULOSE-CONTAINING MATERIALS; REGENERATION OF PULPING LIQUORS; APPARATUS THEREFOR
- D21C1/00—Pretreatment of the finely-divided materials before digesting
- D21C1/10—Physical methods for facilitating impregnation
Landscapes
- Paper (AREA)
- Electroplating And Plating Baths Therefor (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE180065A SE308443B (enExample) | 1965-02-11 | 1965-02-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO119204B true NO119204B (enExample) | 1970-04-06 |
Family
ID=20258861
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO16154066A NO119204B (enExample) | 1965-02-11 | 1966-02-02 |
Country Status (10)
| Country | Link |
|---|---|
| BE (1) | BE676193A (enExample) |
| CH (1) | CH442957A (enExample) |
| CS (1) | CS154213B2 (enExample) |
| DE (1) | DE1288418B (enExample) |
| FI (1) | FI44189C (enExample) |
| FR (1) | FR1467414A (enExample) |
| GB (1) | GB1133662A (enExample) |
| NL (1) | NL6601745A (enExample) |
| NO (1) | NO119204B (enExample) |
| SE (1) | SE308443B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2632782C2 (de) * | 1976-07-21 | 1982-12-30 | Hans Dipl.-Ing. 7758 Meersburg Knauth | Verfahren und Vorrichtung zum kontinuierlichen Imprägnieren von faserhaltigen Stoffen |
| US4632729A (en) * | 1984-05-01 | 1986-12-30 | Laakso Oliver A | Chip presteaming and air washing |
| MX2015002960A (es) | 2012-09-19 | 2015-06-02 | Andritz Inc | Metodo y aparato para agregar vapor para un proceso de pretratamiento de explosion de vapor. |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE304214C (enExample) * | 1916-10-19 | |||
| US2885317A (en) * | 1954-03-30 | 1959-05-05 | Stora Kopparbergs Bergslags Ab | Method in manufacturing chemical or semi-chemical pulp from heavily resinous wood |
-
1965
- 1965-02-11 SE SE180065A patent/SE308443B/xx unknown
-
1966
- 1966-02-02 NO NO16154066A patent/NO119204B/no unknown
- 1966-02-03 GB GB477366A patent/GB1133662A/en not_active Expired
- 1966-02-03 DE DE1966D0049281 patent/DE1288418B/de active Pending
- 1966-02-04 FR FR48436A patent/FR1467414A/fr not_active Expired
- 1966-02-08 BE BE676193D patent/BE676193A/xx unknown
- 1966-02-09 FI FI31566A patent/FI44189C/fi active
- 1966-02-10 CH CH188666A patent/CH442957A/de unknown
- 1966-02-10 CS CS85766A patent/CS154213B2/cs unknown
- 1966-02-11 NL NL6601745A patent/NL6601745A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI44189C (fi) | 1971-09-10 |
| DE1288418B (de) | 1969-01-30 |
| GB1133662A (en) | 1968-11-13 |
| NL6601745A (enExample) | 1966-08-12 |
| FI44189B (enExample) | 1971-06-01 |
| CH442957A (de) | 1967-08-31 |
| BE676193A (enExample) | 1966-08-08 |
| CS154213B2 (enExample) | 1974-03-29 |
| SE308443B (enExample) | 1969-02-10 |
| FR1467414A (fr) | 1967-01-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE969005C (de) | Verfahren zur Herstellung von hochglaenzenden Kupferueberzuegen auf unedlen Metallen | |
| NO131468B (enExample) | ||
| KR20080110989A (ko) | 이온성 액체를 사용하여 금속을 전착시키는 방법 | |
| DE1053274B (de) | Bad zur Herstellung von galvanischen Metallueberzuegen | |
| NO127437B (enExample) | ||
| GB868898A (en) | Electrolytic production of metal coatings | |
| GB806403A (en) | Process for the production of electrolytic metal coatings | |
| SE8201736L (sv) | Elektropleteringskomposition for avsettning av glensande metallisk tenn eller legeringar av tenn med koppar eller rodium | |
| GB1000669A (en) | Baths for the production of electrolytic metal coatings | |
| US4127450A (en) | Method for pretreating surfaces of steel parts for electroplating with organic or inorganic coatings | |
| NO119204B (enExample) | ||
| US3183067A (en) | Metal having two coats of sulfurcontaining nickel and method of making same | |
| JPH0273990A (ja) | 電気メッキ用助剤としての2―置換エタンスルホン化合物の使用 | |
| JP2001507404A (ja) | 電着錫メッキのリフロー用フラックス剤 | |
| GB875846A (en) | Baths for the production of electrolytic metal coatings | |
| US3703448A (en) | Method of making composite nickel electroplate and electrolytes therefor | |
| US7300563B2 (en) | Use of N-alllyl substituted amines and their salts as brightening agents in nickel plating baths | |
| GB625041A (en) | Improvements in and relating to the production of corrosion resistant metal and alloy articles | |
| US3008883A (en) | Electrodeposition of bright nickel | |
| DE69909964D1 (de) | Mehrschichtenmaterial für Gleitelemente und Verfahren zur Herstellung | |
| US4411744A (en) | Bath and process for high speed nickel electroplating | |
| US5438140A (en) | Production of nickelized shaped articles | |
| US3245887A (en) | Electrodeposition of nickel | |
| US3432509A (en) | Certain quaternary n-propargyl pyridinium salts | |
| SU551415A1 (ru) | Водный электролит блест щего никелировани |