NO119121B - - Google Patents
Download PDFInfo
- Publication number
- NO119121B NO119121B NO16171965A NO16171965A NO119121B NO 119121 B NO119121 B NO 119121B NO 16171965 A NO16171965 A NO 16171965A NO 16171965 A NO16171965 A NO 16171965A NO 119121 B NO119121 B NO 119121B
- Authority
- NO
- Norway
- Prior art keywords
- phenyl
- dimethylureido
- alkyl
- compounds
- herbicidal
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 27
- 230000002363 herbicidal effect Effects 0.000 claims description 27
- 238000002360 preparation method Methods 0.000 claims description 23
- 239000004480 active ingredient Substances 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- BSCCSDNZEIHXOK-UHFFFAOYSA-N phenyl carbamate Chemical compound NC(=O)OC1=CC=CC=C1 BSCCSDNZEIHXOK-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 239000005864 Sulphur Chemical group 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims 1
- -1 N-mono-substituted-carbamic acid Chemical class 0.000 description 37
- 241000196324 Embryophyta Species 0.000 description 17
- 239000000203 mixture Substances 0.000 description 11
- 230000000694 effects Effects 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 230000006378 damage Effects 0.000 description 6
- 239000002270 dispersing agent Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- VTDPFMZYQCJTNK-UHFFFAOYSA-N [3-(dimethylcarbamoylamino)phenyl]-methylcarbamic acid Chemical compound CN(C)C(NC1=CC=CC(N(C)C(O)=O)=C1)=O VTDPFMZYQCJTNK-UHFFFAOYSA-N 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 240000008415 Lactuca sativa Species 0.000 description 4
- 235000003228 Lactuca sativa Nutrition 0.000 description 4
- 240000006240 Linum usitatissimum Species 0.000 description 4
- 235000004431 Linum usitatissimum Nutrition 0.000 description 4
- 244000062793 Sorghum vulgare Species 0.000 description 4
- 239000004927 clay Substances 0.000 description 4
- 239000004009 herbicide Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 235000019713 millet Nutrition 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000003053 toxin Substances 0.000 description 4
- 231100000765 toxin Toxicity 0.000 description 4
- IPRCBIWIPMJXIK-UHFFFAOYSA-N (3-hydroxyphenyl)urea Chemical compound NC(=O)NC1=CC=CC(O)=C1 IPRCBIWIPMJXIK-UHFFFAOYSA-N 0.000 description 3
- HQSQPMWCWCOTBH-UHFFFAOYSA-N 3-(3-hydroxyphenyl)-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=CC(O)=C1 HQSQPMWCWCOTBH-UHFFFAOYSA-N 0.000 description 3
- 229940018563 3-aminophenol Drugs 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- LDGGJRNNHKPEOF-UHFFFAOYSA-N NC(NC1=CC=CC(NC(O)=O)=C1)=O Chemical compound NC(NC1=CC=CC(NC(O)=O)=C1)=O LDGGJRNNHKPEOF-UHFFFAOYSA-N 0.000 description 3
- SFLPXHOPMULQFJ-UHFFFAOYSA-N [3-(carbamoylamino)phenyl] carbamate Chemical class NC(=O)NC1=CC=CC(OC(N)=O)=C1 SFLPXHOPMULQFJ-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 3
- 230000008635 plant growth Effects 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 2
- 240000001592 Amaranthus caudatus Species 0.000 description 2
- 244000237956 Amaranthus retroflexus Species 0.000 description 2
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- 241000219198 Brassica Species 0.000 description 2
- 235000003351 Brassica cretica Nutrition 0.000 description 2
- 244000178993 Brassica juncea Species 0.000 description 2
- 235000011332 Brassica juncea Nutrition 0.000 description 2
- 235000014700 Brassica juncea var napiformis Nutrition 0.000 description 2
- 235000003343 Brassica rupestris Nutrition 0.000 description 2
- 244000000626 Daucus carota Species 0.000 description 2
- 235000002767 Daucus carota Nutrition 0.000 description 2
- 244000152970 Digitaria sanguinalis Species 0.000 description 2
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 244000299507 Gossypium hirsutum Species 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical class O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 238000000889 atomisation Methods 0.000 description 2
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- AKTOECZHLOHWKT-UHFFFAOYSA-N boric acid chloric acid Chemical compound B(O)(O)O.Cl(=O)(=O)O AKTOECZHLOHWKT-UHFFFAOYSA-N 0.000 description 2
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 235000004426 flaxseed Nutrition 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 235000010460 mustard Nutrition 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- SCWKRWCUMCMVPW-UHFFFAOYSA-N phenyl n-methylcarbamate Chemical compound CNC(=O)OC1=CC=CC=C1 SCWKRWCUMCMVPW-UHFFFAOYSA-N 0.000 description 2
- 231100000614 poison Toxicity 0.000 description 2
- 239000002574 poison Substances 0.000 description 2
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- PTLRDCMBXHILCL-UHFFFAOYSA-M sodium arsenite Chemical compound [Na+].[O-][As]=O PTLRDCMBXHILCL-UHFFFAOYSA-M 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- CTSLUCNDVMMDHG-UHFFFAOYSA-N 5-bromo-3-(butan-2-yl)-6-methylpyrimidine-2,4(1H,3H)-dione Chemical compound CCC(C)N1C(=O)NC(C)=C(Br)C1=O CTSLUCNDVMMDHG-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- MKHZKTLDTRLHLC-UHFFFAOYSA-N CCCCNC(NC1=CC=CC(N(C)C(O)=O)=C1)=O Chemical compound CCCCNC(NC1=CC=CC(N(C)C(O)=O)=C1)=O MKHZKTLDTRLHLC-UHFFFAOYSA-N 0.000 description 1
- KLJFLFPFLSFCFL-UHFFFAOYSA-N CCCNC(NC1=CC=CC(N(C)C(O)=O)=C1)=O Chemical compound CCCNC(NC1=CC=CC(N(C)C(O)=O)=C1)=O KLJFLFPFLSFCFL-UHFFFAOYSA-N 0.000 description 1
- IJZGHRGCGOMWQO-UHFFFAOYSA-N CCN(C(O)=O)C1=CC(NC(N(C)C)=O)=CC=C1 Chemical compound CCN(C(O)=O)C1=CC(NC(N(C)C)=O)=CC=C1 IJZGHRGCGOMWQO-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 241000421334 Cerastium fontanum subsp. vulgare Species 0.000 description 1
- 240000006555 Chamaerops humilis Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 244000088461 Panicum crus-galli Species 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 240000005498 Setaria italica Species 0.000 description 1
- 235000007226 Setaria italica Nutrition 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- UTTSGXDQLUUBTQ-UHFFFAOYSA-N [3-(dimethylcarbamoylamino)phenyl]-(2-methylpropyl)carbamic acid Chemical compound CC(C)CN(C(O)=O)C1=CC(NC(N(C)C)=O)=CC=C1 UTTSGXDQLUUBTQ-UHFFFAOYSA-N 0.000 description 1
- VTDGOWYMEYTFNZ-UHFFFAOYSA-N [3-(dimethylcarbamoylamino)phenyl]-propan-2-ylcarbamic acid Chemical compound CC(C)N(C(O)=O)C1=CC(NC(N(C)C)=O)=CC=C1 VTDGOWYMEYTFNZ-UHFFFAOYSA-N 0.000 description 1
- GJRPDTPBYKXQMA-UHFFFAOYSA-N [3-(dimethylcarbamoylamino)phenyl]methyl-methylcarbamic acid Chemical compound CN(C)C(=O)NC1=CC=CC(=C1)CN(C)C(=O)O GJRPDTPBYKXQMA-UHFFFAOYSA-N 0.000 description 1
- ULMRXPZFCJPJPW-UHFFFAOYSA-N [3-(methylcarbamoylamino)phenyl]-propan-2-ylcarbamic acid Chemical compound CC(C)N(C(O)=O)C1=CC(NC(NC)=O)=CC=C1 ULMRXPZFCJPJPW-UHFFFAOYSA-N 0.000 description 1
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229920003232 aliphatic polyester Polymers 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 235000012735 amaranth Nutrition 0.000 description 1
- 239000004178 amaranth Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000011362 coarse particle Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- PKKGKUDPKRTKLJ-UHFFFAOYSA-L dichloro(dimethyl)stannane Chemical compound C[Sn](C)(Cl)Cl PKKGKUDPKRTKLJ-UHFFFAOYSA-L 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- FGBMXRACGFZLOQ-UHFFFAOYSA-N hexyl-[3-(methylcarbamoylamino)phenyl]carbamic acid Chemical compound CCCCCCN(C(O)=O)C1=CC(NC(NC)=O)=CC=C1 FGBMXRACGFZLOQ-UHFFFAOYSA-N 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- UKRYHACTHFDUQV-UHFFFAOYSA-N methyl-[3-(methylcarbamothioylamino)phenyl]carbamic acid Chemical compound CNC(=S)NC1=CC(=CC=C1)N(C)C(=O)O UKRYHACTHFDUQV-UHFFFAOYSA-N 0.000 description 1
- BPWVAMSYZZOMDL-UHFFFAOYSA-N methyl-[3-[methyl(methylcarbamoyl)amino]phenyl]carbamic acid Chemical compound CNC(=O)N(C)C1=CC=CC(N(C)C(O)=O)=C1 BPWVAMSYZZOMDL-UHFFFAOYSA-N 0.000 description 1
- UXQTZLNCAAZUAZ-UHFFFAOYSA-N methyl-[[3-(methylcarbamoylamino)phenyl]methyl]carbamic acid Chemical compound CNC(NC1=CC=CC(CN(C)C(O)=O)=C1)=O UXQTZLNCAAZUAZ-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical class OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 1
- BKVUXKJWTVANMM-UHFFFAOYSA-N phenyl n-tert-butylcarbamate Chemical compound CC(C)(C)NC(=O)OC1=CC=CC=C1 BKVUXKJWTVANMM-UHFFFAOYSA-N 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Chemical class [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- NVRGZOVGYJMDPQ-UHFFFAOYSA-N tert-butyl-[3-(dimethylcarbamoylamino)phenyl]carbamic acid Chemical compound CN(C)C(=O)NC1=CC=CC(N(C(O)=O)C(C)(C)C)=C1 NVRGZOVGYJMDPQ-UHFFFAOYSA-N 0.000 description 1
- 231100000167 toxic agent Toxicity 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US35415364A | 1964-03-23 | 1964-03-23 | |
| US43315765A | 1965-02-16 | 1965-02-16 | |
| NO159956A NO118324B (OSRAM) | 1964-03-23 | 1965-10-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO119121B true NO119121B (OSRAM) | 1970-03-23 |
Family
ID=27353340
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO16171965A NO119121B (OSRAM) | 1964-03-23 | 1965-10-05 |
Country Status (1)
| Country | Link |
|---|---|
| NO (1) | NO119121B (OSRAM) |
-
1965
- 1965-10-05 NO NO16171965A patent/NO119121B/no unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO118324B (OSRAM) | ||
| KR900006130B1 (ko) | 살충성 n'-치환-n,n'-디아실히드라진 | |
| EP0096003B1 (de) | Neue Sulfonyl(thio)harnstoffe, Verfahren zu deren Herstellung und deren Verwendung als Herbizide und/oder Wachstumsregulatoren | |
| HU186379B (en) | Compoisitons for kiling tree-louse, containing new sulphonyl derivatives as active substances and process for preparing the active substance | |
| CA1084529A (en) | N'- 4-(substituted phenethyloxy)-phenyl -n-methyl-n- methoxyurea | |
| KR910000856B1 (ko) | 살충제 n'-치환-n-알킬카르보닐-n-아실히드라진 | |
| EP0103537B1 (de) | N-Arylsulfonyl-N'-triazolylharnstoffe | |
| DE68908789T2 (de) | Insectizide N'-substituierte-N-alkylcarbonyl-N'-acylhydrazine und N'-substituierte-N-acyl-N'-alkylcarbonyl hydrazine. | |
| US3639633A (en) | Substituted o-carbamylhydroxamate pesticides | |
| JPS60112704A (ja) | 除草剤組成物及びその使用法 | |
| JPH0421672B2 (OSRAM) | ||
| NO159956B (no) | Fjellarmeringsbolt. | |
| NO161719B (no) | Fremgangsmaate og anlegg for fremstilling av en fortynnet slurry inneholdende sinkstoev. | |
| US4626273A (en) | Herbicidal novel 2-alkoxyaminosulfonyl-benzene-sulfonylureas | |
| US4531966A (en) | Herbicide compositions | |
| US4740524A (en) | Alpha-halopyruvate oxime | |
| EP0232012B1 (en) | Dihaloformaldoximes | |
| NO119121B (OSRAM) | ||
| JPS5857404B2 (ja) | 除草剤組成物 | |
| US4509974A (en) | S-n-Butyl-N,N-diisopropyl thiocarbamate as a selective herbicide in cotton | |
| US3824320A (en) | Substituted o-carbamylhydroxamate insecticides | |
| JPH03271207A (ja) | 殺虫殺菌剤組成物 | |
| US4406692A (en) | Meta-substituted dialkylaminooxanilide post-emergent herbicides | |
| US4106924A (en) | Pesticidal compositions | |
| US3984468A (en) | Herbicidal N-trifluoromethylmercaptophenyl ureas |