NO118909B - - Google Patents
Download PDFInfo
- Publication number
- NO118909B NO118909B NO161707A NO16170766A NO118909B NO 118909 B NO118909 B NO 118909B NO 161707 A NO161707 A NO 161707A NO 16170766 A NO16170766 A NO 16170766A NO 118909 B NO118909 B NO 118909B
- Authority
- NO
- Norway
- Prior art keywords
- compounds
- formula
- compound
- general formula
- oxygen
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 52
- 238000000034 method Methods 0.000 claims description 12
- 229910052760 oxygen Inorganic materials 0.000 claims description 10
- 239000001301 oxygen Substances 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- UXPPDBVMSPAPCL-UHFFFAOYSA-N 1-prop-1-ynoxyprop-1-yne Chemical class CC#COC#CC UXPPDBVMSPAPCL-UHFFFAOYSA-N 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- UMPSXRYVXUPCOS-UHFFFAOYSA-N 2,3-dichlorophenol Chemical compound OC1=CC=CC(Cl)=C1Cl UMPSXRYVXUPCOS-UHFFFAOYSA-N 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 1
- 125000004434 sulfur atom Chemical group 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- 238000002844 melting Methods 0.000 description 16
- 230000008018 melting Effects 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 8
- 239000011630 iodine Substances 0.000 description 8
- 229910052740 iodine Inorganic materials 0.000 description 8
- 239000003208 petroleum Substances 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 150000002367 halogens Chemical group 0.000 description 7
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 241000894006 Bacteria Species 0.000 description 6
- 239000006071 cream Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 241000233866 Fungi Species 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 230000000844 anti-bacterial effect Effects 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 230000026030 halogenation Effects 0.000 description 4
- 238000005658 halogenation reaction Methods 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- 229920001817 Agar Polymers 0.000 description 3
- 241000222122 Candida albicans Species 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241001045770 Trichophyton mentagrophytes Species 0.000 description 3
- 239000008272 agar Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 150000001879 copper Chemical class 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- 238000011081 inoculation Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- -1 propargyl halide Chemical class 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- 241000195493 Cryptophyta Species 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 229940095731 candida albicans Drugs 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000645 desinfectant Substances 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 230000000855 fungicidal effect Effects 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 230000026045 iodination Effects 0.000 description 2
- 238000006192 iodination reaction Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 230000007306 turnover Effects 0.000 description 2
- QGRKONUHHGBHRB-UHFFFAOYSA-N 2,3-dichlorobenzenethiol Chemical compound SC1=CC=CC(Cl)=C1Cl QGRKONUHHGBHRB-UHFFFAOYSA-N 0.000 description 1
- UFBJCMHMOXMLKC-UHFFFAOYSA-N 2,4-dinitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O UFBJCMHMOXMLKC-UHFFFAOYSA-N 0.000 description 1
- HRDCVMSNCBAMAM-UHFFFAOYSA-N 3-prop-2-ynoxyprop-1-yne Chemical class C#CCOCC#C HRDCVMSNCBAMAM-UHFFFAOYSA-N 0.000 description 1
- XPTMJJIPRSWBDK-UHFFFAOYSA-N 3-prop-2-ynylsulfanylprop-1-yne Chemical class C#CCSCC#C XPTMJJIPRSWBDK-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical group CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- 241001480043 Arthrodermataceae Species 0.000 description 1
- 241000228197 Aspergillus flavus Species 0.000 description 1
- 241000228245 Aspergillus niger Species 0.000 description 1
- 240000006439 Aspergillus oryzae Species 0.000 description 1
- 235000002247 Aspergillus oryzae Nutrition 0.000 description 1
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 240000009108 Chlorella vulgaris Species 0.000 description 1
- 235000007089 Chlorella vulgaris Nutrition 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001480037 Microsporum Species 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 241000228153 Penicillium citrinum Species 0.000 description 1
- 239000006159 Sabouraud's agar Substances 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- 241000004512 Vulpicida viridis Species 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- QKSIFUGZHOUETI-UHFFFAOYSA-N copper;azane Chemical compound N.N.N.N.[Cu+2] QKSIFUGZHOUETI-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000037304 dermatophytes Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- AAUNBWYUJICUKP-UHFFFAOYSA-N hypoiodite Chemical compound I[O-] AAUNBWYUJICUKP-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 230000007721 medicinal effect Effects 0.000 description 1
- 238000012009 microbiological test Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012226 modified Czapek's media Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 239000012449 sabouraud dextrose agar Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/64—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO120169A NO119636B (enFirst) | 1965-02-16 | 1969-03-21 |
Applications Claiming Priority (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US43320965A | 1965-02-16 | 1965-02-16 | |
| US48591165A | 1965-09-08 | 1965-09-08 | |
| US48592265A | 1965-09-08 | 1965-09-08 | |
| US48595165A | 1965-09-08 | 1965-09-08 | |
| US48593465A | 1965-09-08 | 1965-09-08 | |
| US48590865A | 1965-09-08 | 1965-09-08 | |
| US48594765A | 1965-09-08 | 1965-09-08 | |
| US48590465A | 1965-09-08 | 1965-09-08 | |
| US486545A US3362871A (en) | 1965-02-16 | 1965-09-10 | Novel insecticidal carbamate-propar-gylaryl ether compositions |
| US53137166A | 1966-03-03 | 1966-03-03 | |
| DEH0060346 | 1966-08-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO118909B true NO118909B (enFirst) | 1970-03-02 |
Family
ID=27581505
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO161707A NO118909B (enFirst) | 1965-02-16 | 1966-02-15 | |
| NO66164608A NO116567B (enFirst) | 1965-02-16 | 1966-09-07 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO66164608A NO116567B (enFirst) | 1965-02-16 | 1966-09-07 |
Country Status (17)
| Country | Link |
|---|---|
| US (3) | US3489805A (enFirst) |
| AT (1) | AT276852B (enFirst) |
| BE (4) | BE676476A (enFirst) |
| BR (2) | BR6677162D0 (enFirst) |
| CH (2) | CH464600A (enFirst) |
| DE (3) | DE1568744A1 (enFirst) |
| DK (3) | DK123165B (enFirst) |
| ES (1) | ES337469A1 (enFirst) |
| FI (2) | FI45951C (enFirst) |
| FR (4) | FR5407M (enFirst) |
| GB (3) | GB1069350A (enFirst) |
| IL (2) | IL25076A (enFirst) |
| IT (3) | IT1053658B (enFirst) |
| MY (2) | MY6800052A (enFirst) |
| NL (5) | NL6601926A (enFirst) |
| NO (2) | NO118909B (enFirst) |
| SE (2) | SE346985B (enFirst) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3524915A (en) * | 1968-09-16 | 1970-08-18 | Hoffmann La Roche | Synergistic insecticidal carbamates with 3,4 - methylenedioxyphenyl-3- halo-2-propynyl ethers |
| BE758735A (fr) * | 1969-11-14 | 1971-05-10 | Hoffmann La Roche | Composes acetyleniques |
| US3946040A (en) * | 1971-03-19 | 1976-03-23 | Hoffmann-La Roche Inc. | Propynyl benzyl ethers |
| US3880999A (en) * | 1971-07-20 | 1975-04-29 | Douglas J Hennessy | Synergistic insecticidal compositions containing benzyl 2-propynyl ethers |
| US3879421A (en) * | 1972-01-17 | 1975-04-22 | Stauffer Chemical Co | Certain methylenedioxyphenyl propynes |
| US4141921A (en) | 1972-02-09 | 1979-02-27 | Ciba-Geigy Corporation | Phenoxyphenyl- and phenoxybenzyl-alkynyl ethers |
| US4153731A (en) | 1973-04-18 | 1979-05-08 | Ciba-Geigy Corporation | Phenoxy (benzyloxy/benzylthio) benzene derivatives |
| US4020111A (en) * | 1973-09-13 | 1977-04-26 | Hennessy Douglas J | Propynyloxy alkyl arene insecticides |
| IT1059127B (it) * | 1976-04-15 | 1982-05-31 | Montedison Spa | Eteri e tioeteri benzilici o feni lici a catena alifatica lineare con terminale alogenato ad attivi ta ormonica giovanile e acaric/da |
| US4191773A (en) * | 1977-11-25 | 1980-03-04 | Hoffmann-La Roche Inc. | Synergistic insecticidal composition |
| JPH0749379B2 (ja) * | 1985-12-27 | 1995-05-31 | 住友化学工業株式会社 | 置換ベンゼン誘導体およびそれを有効成分とする農園芸用殺菌剤 |
| DE3800306A1 (de) * | 1988-01-08 | 1989-07-20 | Basf Ag | Tert.-butylalkinole, verfahren zu ihrer herstellung und deren verwendung |
| EP2289889A1 (en) | 2009-08-18 | 2011-03-02 | Endura S.p.a. | Substituted alkynyl phenoxy compounds and their uses |
| EP3141115A1 (en) | 2015-09-09 | 2017-03-15 | Endura S.p.a. | Substituted methylenedioxybenzyl compounds and their uses as synergists |
| CA3167415A1 (en) * | 2020-02-10 | 2021-08-19 | Bruce Roger Debruin | Particulate plastic solids handling apparatus and methods |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2942014A (en) * | 1955-12-07 | 1960-06-21 | Monsanto Chemicals | Oxidative coupling process |
| US2993934A (en) * | 1956-08-08 | 1961-07-25 | Diamond Alkali Co | Derivatives of pentachlorophenol |
| US3009855A (en) * | 1958-08-07 | 1961-11-21 | Union Carbide Corp | Method and composition of destroying insects employing 1-naphthyl n-methyl carbamate |
| US3322813A (en) * | 1962-06-30 | 1967-05-30 | Meiji Seika Kaisha | Halopropargyl aryl ether compounds |
-
1965
- 1965-09-08 US US485904A patent/US3489805A/en not_active Expired - Lifetime
- 1965-09-10 US US486545A patent/US3362871A/en not_active Expired - Lifetime
-
1966
- 1966-01-27 CH CH1146567A patent/CH464600A/de unknown
- 1966-01-29 DE DE19661568744 patent/DE1568744A1/de active Pending
- 1966-01-31 IL IL25076A patent/IL25076A/xx unknown
- 1966-02-11 GB GB6018/66A patent/GB1069350A/en not_active Expired
- 1966-02-14 FR FR49431A patent/FR5407M/fr not_active Expired
- 1966-02-15 NO NO161707A patent/NO118909B/no unknown
- 1966-02-15 BE BE676476D patent/BE676476A/xx unknown
- 1966-02-15 NL NL6601926A patent/NL6601926A/xx unknown
- 1966-02-16 SE SE02009/66A patent/SE346985B/xx unknown
- 1966-02-16 IT IT3414/66A patent/IT1053658B/it active
- 1966-02-16 DK DK81166AA patent/DK123165B/da unknown
- 1966-02-16 FI FI660383A patent/FI45951C/fi active
- 1966-02-16 BR BR177162/66A patent/BR6677162D0/pt unknown
- 1966-03-03 US US531371A patent/US3423428A/en not_active Expired - Lifetime
- 1966-08-23 DE DE19661568780 patent/DE1568780A1/de active Pending
- 1966-08-24 CH CH1223566A patent/CH477815A/de not_active IP Right Cessation
- 1966-08-26 DE DE19661542909 patent/DE1542909A1/de active Pending
- 1966-08-26 AT AT809466A patent/AT276852B/de not_active IP Right Cessation
- 1966-08-29 FR FR74427A patent/FR5694M/fr not_active Expired
- 1966-08-29 IL IL26400A patent/IL26400A/en unknown
- 1966-09-01 BR BR182528/66A patent/BR6682528D0/pt unknown
- 1966-09-02 FR FR75009A patent/FR1510861A/fr not_active Expired
- 1966-09-05 BE BE686415D patent/BE686415A/xx unknown
- 1966-09-05 BE BE686416D patent/BE686416A/xx unknown
- 1966-09-06 GB GB39689/66A patent/GB1102639A/en not_active Expired
- 1966-09-07 NO NO66164608A patent/NO116567B/no unknown
- 1966-09-08 SE SE12097/66A patent/SE360002B/xx unknown
- 1966-09-08 NL NL6612646A patent/NL6612646A/xx unknown
- 1966-09-08 DK DK462366AA patent/DK116481B/da unknown
- 1966-09-08 NL NL6612647A patent/NL6612647A/xx unknown
- 1966-09-08 IT IT20649/66A patent/IT947002B/it active
- 1966-09-08 IT IT20643/66A patent/IT986752B/it active
- 1966-09-08 FI FI2343/66A patent/FI43797B/fi active
- 1966-09-08 NL NL6612645A patent/NL6612645A/xx unknown
-
1967
- 1967-02-13 NL NL6702139A patent/NL6702139A/xx unknown
- 1967-02-22 GB GB8393/67A patent/GB1105848A/en not_active Expired
- 1967-02-28 BE BE694744D patent/BE694744A/xx unknown
- 1967-03-01 FR FR96924A patent/FR1512869A/fr not_active Expired
- 1967-03-02 ES ES337469A patent/ES337469A1/es not_active Expired
-
1968
- 1968-12-31 MY MY196852A patent/MY6800052A/xx unknown
-
1969
- 1969-06-06 DK DK306369AA patent/DK125239B/da unknown
- 1969-12-31 MY MY196968A patent/MY6900068A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO118909B (enFirst) | ||
| NO147598B (no) | Analogifremgangsmaate for fremstilling av nye fysiologisk aktive fluoracylresorcinoler | |
| US3957812A (en) | Derivatives of 2-phenoxyacetamido-5-nitro-thiazole | |
| US3338950A (en) | Iodopropargyl aralkyl ether compounds | |
| NO763440L (enFirst) | ||
| HU195666B (en) | Process for producing new hydroxylamine derivatives and plant growth increasing compositions comprising these derivatives as active ingredient | |
| US3686331A (en) | Anti-microbial phenyl 3-halopropargyl ethers | |
| US3932405A (en) | Phenylpyridazines | |
| US4808210A (en) | Herbicidal method of using 5-pyrazolones | |
| US2763692A (en) | Alpha-halogenated alkylsulfonylacetophenones | |
| US3207660A (en) | Process for inhibiting growth of microorganisms | |
| CN106008653B (zh) | 甘草次酸酰腙类衍生物及其制备方法和用途 | |
| NO119636B (enFirst) | ||
| US2591589A (en) | Gamma-nitroalkyl-alpha,beta-dichloro-gamma-crotonolactones | |
| US3541158A (en) | 1-(di(lower alkoxy)-4-alkylphenyl)-2-nitropropenes | |
| CN106243000B (zh) | 一种含炔丙氧基的缬氨酸酰胺氨基甲酸酯衍生物及应用 | |
| US3452016A (en) | Substituted trihalopyrazines | |
| US2887495A (en) | 7-chloro coumarins | |
| US2952673A (en) | 5-arylazorhodanines | |
| US2831864A (en) | 1-p-alkoxyphenyl-1-alkyl-3-piperidino-1-propenes | |
| CN116178359B (zh) | 一种基于杂环取代的二硫化物衍生物、其制备方法和用途 | |
| US2030373A (en) | Derivatives of thiazole and process of preparing the same | |
| CS220783B2 (en) | Bactericide and fungicide means and method of making the active agent | |
| RU2786532C1 (ru) | Способ получения малотоксичного n-2-гидроксифенилметил-41-(7-циклогепта-1,3,5-триенил)анилина, проявляющего антимикробную активность | |
| RU2032662C1 (ru) | Способ получения производных ациламинобензамидов |