NO116773B - - Google Patents
Download PDFInfo
- Publication number
- NO116773B NO116773B NO164959A NO16495966A NO116773B NO 116773 B NO116773 B NO 116773B NO 164959 A NO164959 A NO 164959A NO 16495966 A NO16495966 A NO 16495966A NO 116773 B NO116773 B NO 116773B
- Authority
- NO
- Norway
- Prior art keywords
- oil
- naphthylamine
- phenyl
- stated
- copper
- Prior art date
Links
- 239000003921 oil Substances 0.000 claims description 39
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical group NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 claims description 16
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical compound C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 claims description 10
- 239000003963 antioxidant agent Substances 0.000 claims description 10
- 235000006708 antioxidants Nutrition 0.000 claims description 10
- 239000006078 metal deactivator Substances 0.000 claims description 10
- 230000003078 antioxidant effect Effects 0.000 claims description 7
- 239000002480 mineral oil Substances 0.000 claims description 7
- 235000010446 mineral oil Nutrition 0.000 claims description 6
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical group NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 claims description 5
- XQVWYOYUZDUNRW-UHFFFAOYSA-N N-Phenyl-1-naphthylamine Chemical compound C=1C=CC2=CC=CC=C2C=1NC1=CC=CC=C1 XQVWYOYUZDUNRW-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 2
- 238000009413 insulation Methods 0.000 claims 4
- 150000004982 aromatic amines Chemical class 0.000 claims 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 17
- 229910052802 copper Inorganic materials 0.000 description 17
- 239000010949 copper Substances 0.000 description 17
- 230000003647 oxidation Effects 0.000 description 8
- 238000007254 oxidation reaction Methods 0.000 description 8
- 239000002253 acid Substances 0.000 description 5
- 238000007792 addition Methods 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 230000006378 damage Effects 0.000 description 4
- 238000004090 dissolution Methods 0.000 description 4
- 239000010802 sludge Substances 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- -1 aromatic primary amine Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000004035 construction material Substances 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- XMFRQHDPDGAVEW-UHFFFAOYSA-L zinc;hexylsulfanyl-dioxido-sulfanylidene-$l^{5}-phosphane Chemical compound [Zn+2].CCCCCCSP([O-])([O-])=S XMFRQHDPDGAVEW-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A45—HAND OR TRAVELLING ARTICLES
- A45B—WALKING STICKS; UMBRELLAS; LADIES' OR LIKE FANS
- A45B19/00—Special folding or telescoping of umbrellas
- A45B19/10—Special folding or telescoping of umbrellas with collapsible ribs
Landscapes
- Tents Or Canopies (AREA)
- Anti-Oxidant Or Stabilizer Compositions (AREA)
- Walking Sticks, Umbrellas, And Fans (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB83971A DE1254832B (de) | 1965-10-02 | 1965-10-02 | Verkuerzbarer Schirm |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO116773B true NO116773B (en:Method) | 1969-05-19 |
Family
ID=6982212
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO164959A NO116773B (en:Method) | 1965-10-02 | 1966-09-30 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3439690A (en:Method) |
| AT (1) | AT281337B (en:Method) |
| BE (1) | BE687697A (en:Method) |
| CH (1) | CH438601A (en:Method) |
| DE (1) | DE1254832B (en:Method) |
| ES (1) | ES331781A1 (en:Method) |
| GB (1) | GB1087538A (en:Method) |
| NL (1) | NL6613741A (en:Method) |
| NO (1) | NO116773B (en:Method) |
| SE (1) | SE310045B (en:Method) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9174711B2 (en) | 2008-07-11 | 2015-11-03 | Mpi Trond Sivertsen | Device and system for manoeuvring cleaning apparatuses |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1805643B1 (de) * | 1968-10-28 | 1970-11-26 | Bremshey & Co | Laengenverkuerzbarer Schirm |
| US3658076A (en) * | 1969-06-30 | 1972-04-25 | Ideal Shoji Kk | Collapsible umbrella of the automatic opening type |
| US3831614A (en) * | 1969-09-24 | 1974-08-27 | Bremshey Ag | Collapsible umbrella |
| USD898341S1 (en) * | 2018-02-12 | 2020-10-13 | Ching-Chuan You | Umbrella frame |
| USD879460S1 (en) * | 2018-09-04 | 2020-03-31 | Hao-ming Liu | Umbrella rib |
| USD880842S1 (en) * | 2018-09-13 | 2020-04-14 | Ching-Chuan You | Umbrella frame |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US838895A (en) * | 1906-09-06 | 1906-12-18 | Fortunato A Pelusi | Folding umbrella. |
| US929498A (en) * | 1909-04-10 | 1909-07-27 | James Rose | Umbrella-frame. |
| DE737841C (de) * | 1939-01-20 | 1943-07-26 | Brueder Wuester | Verkuerzbares Schirmgestell |
| DE708581C (de) * | 1939-01-20 | 1941-07-24 | Brueder Wuester | Verkuerzbares Schirmgestell |
| US3135276A (en) * | 1960-04-06 | 1964-06-02 | Fritz Bremshey | Collapsible umbrellas |
-
1965
- 1965-10-02 DE DEB83971A patent/DE1254832B/de active Pending
-
1966
- 1966-09-21 AT AT888366A patent/AT281337B/de not_active IP Right Cessation
- 1966-09-26 SE SE12935/66A patent/SE310045B/xx unknown
- 1966-09-28 CH CH1401766A patent/CH438601A/de unknown
- 1966-09-29 NL NL6613741A patent/NL6613741A/xx unknown
- 1966-09-29 US US582928A patent/US3439690A/en not_active Expired - Lifetime
- 1966-09-29 GB GB43529/66A patent/GB1087538A/en not_active Expired
- 1966-09-30 NO NO164959A patent/NO116773B/no unknown
- 1966-09-30 BE BE687697D patent/BE687697A/xx unknown
- 1966-09-30 ES ES0331781A patent/ES331781A1/es not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9174711B2 (en) | 2008-07-11 | 2015-11-03 | Mpi Trond Sivertsen | Device and system for manoeuvring cleaning apparatuses |
Also Published As
| Publication number | Publication date |
|---|---|
| BE687697A (en:Method) | 1967-03-01 |
| US3439690A (en) | 1969-04-22 |
| CH438601A (de) | 1967-06-30 |
| ES331781A1 (es) | 1967-09-16 |
| NL6613741A (en:Method) | 1967-04-03 |
| GB1087538A (en) | 1967-10-18 |
| SE310045B (en:Method) | 1969-04-14 |
| AT281337B (de) | 1970-05-11 |
| DE1254832B (de) | 1967-11-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Banias et al. | The effect of primary antioxidants and synergists on the activity of plant extracts in lard | |
| US2282513A (en) | Stabilization of viscous petroleum oils | |
| NO116773B (en:Method) | ||
| US4539125A (en) | Water-based metal-working fluid | |
| US2868730A (en) | Insulating oils | |
| US6315920B1 (en) | Electrical insulating oil with reduced gassing tendency | |
| US2249340A (en) | Method of decreasing metal corrosion | |
| US3625894A (en) | Anticorrosive for lubricants | |
| Wall et al. | Corrosion control in a water cooled stator | |
| US2373021A (en) | Stabilization of petroleum hydrocarbons | |
| NO931202L (no) | Forbedrede smoerende sammensetninger og additiver som er nyttige i disse | |
| JPS60156788A (ja) | 安定剤およびそれを含有するポリアルキレングリコール組成物 | |
| US2688597A (en) | Process for preparing insulating oil composition | |
| US2257870A (en) | Insulating oil | |
| US2257869A (en) | Insulating oil compositions | |
| CN113549489A (zh) | 铜拉丝退火液及其使用方法 | |
| US2311505A (en) | Copper corrosion inhibitor | |
| DE1031919B (de) | Isolier- und Schmieroele | |
| SU1682326A1 (ru) | Состав дл борьбы с сульфатвосстанавливающими бактери ми | |
| US2425791A (en) | Electrical oil | |
| US2990368A (en) | Lubricating grease compositions containing an alkylaminocarbazole | |
| US3591512A (en) | Corrosion inhibitor | |
| US4305833A (en) | Lubricating oils containing acetoacetanilides as antioxidants | |
| US3788989A (en) | Microbiocidal naphthenyl imidazolines | |
| SU785345A1 (ru) | Защитна присадка дл минеральных масел |