NO115499B - - Google Patents
Download PDFInfo
- Publication number
- NO115499B NO115499B NO148307A NO14830763A NO115499B NO 115499 B NO115499 B NO 115499B NO 148307 A NO148307 A NO 148307A NO 14830763 A NO14830763 A NO 14830763A NO 115499 B NO115499 B NO 115499B
- Authority
- NO
- Norway
- Prior art keywords
- ethylene
- propylene
- mixture
- heptane
- catalyst
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 85
- 239000003054 catalyst Substances 0.000 claims description 84
- 229910052782 aluminium Inorganic materials 0.000 claims description 37
- -1 ethylene, propylene Chemical group 0.000 claims description 36
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 25
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 14
- 238000004519 manufacturing process Methods 0.000 claims description 13
- 229910052720 vanadium Inorganic materials 0.000 claims description 11
- 150000001924 cycloalkanes Chemical class 0.000 claims description 8
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- 229910052744 lithium Inorganic materials 0.000 claims description 5
- 150000002902 organometallic compounds Chemical class 0.000 claims description 5
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 claims description 4
- 239000010936 titanium Substances 0.000 claims description 4
- 229910052719 titanium Inorganic materials 0.000 claims description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 229910052758 niobium Inorganic materials 0.000 claims description 2
- 239000010955 niobium Substances 0.000 claims description 2
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 2
- 229920000089 Cyclic olefin copolymer Polymers 0.000 claims 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims 1
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 128
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 87
- 239000005977 Ethylene Substances 0.000 description 78
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 77
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 67
- 239000000047 product Substances 0.000 description 67
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 65
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 65
- 238000006243 chemical reaction Methods 0.000 description 51
- 239000008246 gaseous mixture Substances 0.000 description 41
- 235000010210 aluminium Nutrition 0.000 description 36
- 229920001577 copolymer Polymers 0.000 description 35
- 229910052757 nitrogen Inorganic materials 0.000 description 34
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- 229920001971 elastomer Polymers 0.000 description 33
- 239000007789 gas Substances 0.000 description 33
- 239000000806 elastomer Substances 0.000 description 30
- 239000012299 nitrogen atmosphere Substances 0.000 description 30
- 238000001228 spectrum Methods 0.000 description 29
- 238000009835 boiling Methods 0.000 description 26
- 238000001035 drying Methods 0.000 description 24
- 239000012265 solid product Substances 0.000 description 24
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 23
- 229910021552 Vanadium(IV) chloride Inorganic materials 0.000 description 20
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 20
- JTJFQBNJBPPZRI-UHFFFAOYSA-J vanadium tetrachloride Chemical compound Cl[V](Cl)(Cl)Cl JTJFQBNJBPPZRI-UHFFFAOYSA-J 0.000 description 20
- UHHCYAAVGADGGP-HTQZYQBOSA-N (1s,2s)-1,2-bis(ethenyl)cyclobutane Chemical compound C=C[C@@H]1CC[C@H]1C=C UHHCYAAVGADGGP-HTQZYQBOSA-N 0.000 description 18
- 229920001897 terpolymer Polymers 0.000 description 13
- 239000000178 monomer Substances 0.000 description 12
- 229920002554 vinyl polymer Polymers 0.000 description 9
- 238000007334 copolymerization reaction Methods 0.000 description 8
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 8
- 125000005287 vanadyl group Chemical group 0.000 description 8
- 229910052790 beryllium Inorganic materials 0.000 description 7
- 125000003118 aryl group Chemical group 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 238000006116 polymerization reaction Methods 0.000 description 6
- 150000003682 vanadium compounds Chemical class 0.000 description 6
- KTRQRAQRHBLCSQ-UHFFFAOYSA-N 1,2,4-tris(ethenyl)cyclohexane Chemical compound C=CC1CCC(C=C)C(C=C)C1 KTRQRAQRHBLCSQ-UHFFFAOYSA-N 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 150000001993 dienes Chemical class 0.000 description 5
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 5
- 125000000962 organic group Chemical group 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 238000001291 vacuum drying Methods 0.000 description 5
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000006229 carbon black Substances 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- 239000007791 liquid phase Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 150000002736 metal compounds Chemical class 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 3
- 239000005864 Sulphur Substances 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 239000001273 butane Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 229920002521 macromolecule Polymers 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 230000002285 radioactive effect Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 229950011008 tetrachloroethylene Drugs 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000004711 α-olefin Substances 0.000 description 3
- UHHCYAAVGADGGP-OCAPTIKFSA-N (1r,2s)-1,2-bis(ethenyl)cyclobutane Chemical compound C=C[C@@H]1CC[C@@H]1C=C UHHCYAAVGADGGP-OCAPTIKFSA-N 0.000 description 2
- NWRZGFYWENINNX-UHFFFAOYSA-N 1,1,2-tris(ethenyl)cyclohexane Chemical compound C=CC1CCCCC1(C=C)C=C NWRZGFYWENINNX-UHFFFAOYSA-N 0.000 description 2
- ZCINTQHDIUHMKK-UHFFFAOYSA-N 1,1-bis(ethenyl)cyclobutane Chemical compound C=CC1(C=C)CCC1 ZCINTQHDIUHMKK-UHFFFAOYSA-N 0.000 description 2
- UHHCYAAVGADGGP-UHFFFAOYSA-N 1,2-bis(ethenyl)cyclobutane Chemical compound C=CC1CCC1C=C UHHCYAAVGADGGP-UHFFFAOYSA-N 0.000 description 2
- PWAIMHPLISOZSU-UHFFFAOYSA-N 1,3,5-tris(ethenyl)cyclohexane Chemical compound C=CC1CC(C=C)CC(C=C)C1 PWAIMHPLISOZSU-UHFFFAOYSA-N 0.000 description 2
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000007792 gaseous phase Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 229920005684 linear copolymer Polymers 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical class OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 2
- 150000004291 polyenes Chemical class 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical class C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 2
- 239000002453 shampoo Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- UJJLJRQIPMGXEZ-UHFFFAOYSA-N tetrahydro-2-furoic acid Chemical class OC(=O)C1CCCO1 UJJLJRQIPMGXEZ-UHFFFAOYSA-N 0.000 description 2
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 2
- 229960002447 thiram Drugs 0.000 description 2
- 150000003609 titanium compounds Chemical class 0.000 description 2
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- ORYGRKHDLWYTKX-UHFFFAOYSA-N trihexylalumane Chemical compound CCCCCC[Al](CCCCCC)CCCCCC ORYGRKHDLWYTKX-UHFFFAOYSA-N 0.000 description 2
- 238000004073 vulcanization Methods 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- ARKHCBWJALMQJO-NXEZZACHSA-N (1S,2S)-1,2-bis(ethenyl)cyclohexane Chemical compound C=C[C@@H]1CCCC[C@H]1C=C ARKHCBWJALMQJO-NXEZZACHSA-N 0.000 description 1
- UEYYOGFVPAORCH-RNFRBKRXSA-N (1s,2s)-1,2-bis(ethenyl)cyclopropane Chemical compound C=C[C@@H]1C[C@H]1C=C UEYYOGFVPAORCH-RNFRBKRXSA-N 0.000 description 1
- ARKHCBWJALMQJO-UHFFFAOYSA-N 1,2-bis(ethenyl)cyclohexane Chemical compound C=CC1CCCCC1C=C ARKHCBWJALMQJO-UHFFFAOYSA-N 0.000 description 1
- WXLZOYIBXBZXGD-UHFFFAOYSA-N 1,2-bis(ethenyl)cyclopentane Chemical compound C=CC1CCCC1C=C WXLZOYIBXBZXGD-UHFFFAOYSA-N 0.000 description 1
- MJIQRRZYLKKCFD-UHFFFAOYSA-N 1-ethenyl-2-prop-1-en-2-ylcyclobutane Chemical compound CC(=C)C1CCC1C=C MJIQRRZYLKKCFD-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical compound C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical class C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Natural products P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 229910003074 TiCl4 Inorganic materials 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 229910021551 Vanadium(III) chloride Inorganic materials 0.000 description 1
- HZPMQTGECAAKST-UHFFFAOYSA-K [V+3].CC([O-])=O.CC([O-])=O.CC([O-])=O Chemical compound [V+3].CC([O-])=O.CC([O-])=O.CC([O-])=O HZPMQTGECAAKST-UHFFFAOYSA-K 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000010692 aromatic oil Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- AZWXAPCAJCYGIA-UHFFFAOYSA-N bis(2-methylpropyl)alumane Chemical compound CC(C)C[AlH]CC(C)C AZWXAPCAJCYGIA-UHFFFAOYSA-N 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 229920005549 butyl rubber Polymers 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- UWNADWZGEHDQAB-UHFFFAOYSA-N i-Pr2C2H4i-Pr2 Natural products CC(C)CCC(C)C UWNADWZGEHDQAB-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002611 lead compounds Chemical class 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- XSHBHNKPJPTEJR-UHFFFAOYSA-N oxoniobium;trihydrochloride Chemical compound Cl.Cl.Cl.[Nb]=O XSHBHNKPJPTEJR-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- YHBDIEWMOMLKOO-UHFFFAOYSA-I pentachloroniobium Chemical compound Cl[Nb](Cl)(Cl)(Cl)Cl YHBDIEWMOMLKOO-UHFFFAOYSA-I 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- HTRWIXZSCVAIEC-UHFFFAOYSA-J pyridine-2-carboxylate vanadium(4+) trichloride Chemical compound N1=C(C=CC=C1)C(=O)[O-].[Cl-].[Cl-].[Cl-].[V+4] HTRWIXZSCVAIEC-UHFFFAOYSA-J 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 239000012763 reinforcing filler Substances 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000037307 sensitive skin Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- JQPMDTQDAXRDGS-UHFFFAOYSA-N triphenylalumane Chemical group C1=CC=CC=C1[Al](C=1C=CC=CC=1)C1=CC=CC=C1 JQPMDTQDAXRDGS-UHFFFAOYSA-N 0.000 description 1
- HQYCOEXWFMFWLR-UHFFFAOYSA-K vanadium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[V+3] HQYCOEXWFMFWLR-UHFFFAOYSA-K 0.000 description 1
- 239000004636 vulcanized rubber Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F210/00—Copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F236/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds
- C08F236/02—Copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds
- C08F236/04—Copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds conjugated
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT763962 | 1962-04-18 | ||
| IT2000662 | 1962-10-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO115499B true NO115499B (instruction) | 1968-10-14 |
Family
ID=26325913
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO148307A NO115499B (instruction) | 1962-04-18 | 1963-04-16 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3567699A (instruction) |
| BE (2) | BE631165A (instruction) |
| CH (1) | CH442759A (instruction) |
| DE (2) | DE1520295C3 (instruction) |
| FI (1) | FI40051C (instruction) |
| GB (2) | GB1022755A (instruction) |
| LU (1) | LU43572A1 (instruction) |
| NL (5) | NL145566B (instruction) |
| NO (1) | NO115499B (instruction) |
| SE (2) | SE310790B (instruction) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4645814A (en) * | 1985-10-07 | 1987-02-24 | California Institute Of Technology | Ring opening polymerization of 3,4-dimethylene cyclobutene and derivatives thereof |
-
0
- NL NL291206D patent/NL291206A/xx unknown
- BE BE638491D patent/BE638491A/xx unknown
- NL NL299010D patent/NL299010A/xx unknown
- BE BE631165D patent/BE631165A/xx unknown
- NL NL135329D patent/NL135329C/xx active
-
1963
- 1963-04-09 GB GB14144/63A patent/GB1022755A/en not_active Expired
- 1963-04-13 DE DE1520295A patent/DE1520295C3/de not_active Expired
- 1963-04-16 NO NO148307A patent/NO115499B/no unknown
- 1963-04-16 LU LU43572D patent/LU43572A1/xx unknown
- 1963-04-17 CH CH480663A patent/CH442759A/de unknown
- 1963-04-17 SE SE4213/63A patent/SE310790B/xx unknown
- 1963-10-09 NL NL63299010A patent/NL145566B/xx unknown
- 1963-10-10 GB GB40013/63A patent/GB1023285A/en not_active Expired
- 1963-10-10 DE DE1520341A patent/DE1520341C3/de not_active Expired
- 1963-10-11 SE SE11177/63A patent/SE310424B/xx unknown
-
1967
- 1967-02-10 FI FI39267A patent/FI40051C/fi active
-
1968
- 1968-05-20 NL NL6807128A patent/NL6807128A/xx unknown
-
1969
- 1969-10-22 US US868650A patent/US3567699A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FI40051B (instruction) | 1968-05-31 |
| SE310790B (instruction) | 1969-05-12 |
| DE1520341A1 (de) | 1969-04-17 |
| NL291206A (instruction) | |
| CH442759A (de) | 1967-08-31 |
| DE1520295A1 (de) | 1969-02-20 |
| DE1520295C3 (de) | 1974-03-21 |
| DE1520341B2 (de) | 1973-10-31 |
| NL145566B (nl) | 1975-04-15 |
| NL6807128A (instruction) | 1968-08-26 |
| GB1022755A (en) | 1966-03-16 |
| GB1023285A (en) | 1966-03-23 |
| NL299010A (instruction) | |
| BE631165A (instruction) | |
| US3567699A (en) | 1971-03-02 |
| DE1520295B2 (de) | 1973-08-02 |
| BE638491A (instruction) | |
| DE1520341C3 (de) | 1974-06-12 |
| NL135329C (instruction) | |
| SE310424B (instruction) | 1969-04-28 |
| LU43572A1 (instruction) | 1964-04-16 |
| FI40051C (fi) | 1968-09-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO148307B (no) | Prosjektil for glattloepet vaapen og fremgangsmaate for fremstilling av samme. | |
| US3260708A (en) | Elastomeric olefinic copolymers and process for producing the same | |
| US3093621A (en) | Sulfur-curable elastomeric copolymers of ethylene, alpha-olefins, and 5-methylene-2-norbornene | |
| US3093620A (en) | 5-alkenyl-2-norbornenes and sulfur-curable elastomeric copolymers thereof | |
| US3563964A (en) | High molecular weight ethylene copolymers produced by coordination catalysts containing anhydrous hydrogen halide | |
| US3489733A (en) | Binary copolymers of ethylene and an omega-alkenyl-polycycloalkene and ternary copolymers of ethylene,an omega-alkenyl-polycycloalkene,and an aliphatic monoolefin | |
| US3317496A (en) | Copolymers of diolefins and olefins and method of producing them | |
| US4506061A (en) | Process for producing olefin copolymer rubber | |
| SU428612A3 (ru) | Способ получения олефиновых сополимеров | |
| US3674754A (en) | Vulcanizable ethylene/propylene copolymers and process for their preparation | |
| US3658770A (en) | Unsaturated partially crystalline terpolymers of ethylene propylene and hydrocarbon dienes or polyenes and process for preparing said terpolymers | |
| US3880819A (en) | Copolymerizates of ethylene and/or higher alpha-olefins with non-conjugated diolefins and process for producing the same | |
| US3900452A (en) | Olefinic copolymers and process for the preparation thereof | |
| NO115499B (instruction) | ||
| US4025497A (en) | Ethylene-olefin-alkenyl norbornene elastomers | |
| US3838137A (en) | Branched ethylene/diene copolymer | |
| US3642730A (en) | Copolymers of olefine and n-unsaturated derivatives of carbazole | |
| US3483173A (en) | Vulcanizable olefinic copolymers and process for their preparation | |
| US3527739A (en) | Vulcanizable copolymers of ethylene,higher alpha-olefins and a 5-alkadienyl-2-norbornene,and process for producing same | |
| US3383371A (en) | Olefin-alkenyl cyclobutene copolymers and process for their preparation | |
| US3489729A (en) | Polymerization process for making vulcanizable rubbery polymer | |
| BR112020024506A2 (pt) | processo para preparar copolímeros de butadieno-isopreno aleatórios que têm um alto teor de unidades cis-1,4 | |
| US3453247A (en) | Amorphous,vulcanizable terpolymers of ethylene,aliphatic alpha-olefins,and alkenylmethylencycloalkanes or -cycloalkenes | |
| US3310537A (en) | Hydrocarbon polymers containing ethylene, a higher alpha-olefin and at least two non-conjugated dienes | |
| NO142116B (no) | Fremgangsmaate for aa forbinde en del av alkalimetalloksyd-beta-aluminiumoksyd med en del av alfa-aluminiumoksyd og sintringskamnmer til utfoerelse av fremgangsmaaten |