NL8003576A - Kauwgom, die een vervangingsmiddel voor suiker bevat. - Google Patents
Kauwgom, die een vervangingsmiddel voor suiker bevat. Download PDFInfo
- Publication number
- NL8003576A NL8003576A NL8003576A NL8003576A NL8003576A NL 8003576 A NL8003576 A NL 8003576A NL 8003576 A NL8003576 A NL 8003576A NL 8003576 A NL8003576 A NL 8003576A NL 8003576 A NL8003576 A NL 8003576A
- Authority
- NL
- Netherlands
- Prior art keywords
- weight
- chewing gum
- hydrogenated
- sugar
- starch hydrolyzate
- Prior art date
Links
- 235000015218 chewing gum Nutrition 0.000 title claims description 64
- 229940112822 chewing gum Drugs 0.000 title claims description 64
- 239000003765 sweetening agent Substances 0.000 title claims description 28
- 235000021092 sugar substitutes Nutrition 0.000 title claims description 7
- 229920002472 Starch Polymers 0.000 claims description 61
- 235000019698 starch Nutrition 0.000 claims description 61
- 239000008107 starch Substances 0.000 claims description 61
- 235000010356 sorbitol Nutrition 0.000 claims description 49
- 239000000600 sorbitol Substances 0.000 claims description 49
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 claims description 47
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 42
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 claims description 39
- 239000000203 mixture Substances 0.000 claims description 26
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 claims description 23
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 claims description 23
- 229930195725 Mannitol Natural products 0.000 claims description 23
- 239000000787 lecithin Substances 0.000 claims description 23
- 235000010445 lecithin Nutrition 0.000 claims description 23
- 229940067606 lecithin Drugs 0.000 claims description 23
- 239000000594 mannitol Substances 0.000 claims description 23
- 235000010355 mannitol Nutrition 0.000 claims description 23
- 239000000843 powder Substances 0.000 claims description 23
- 235000003599 food sweetener Nutrition 0.000 claims description 21
- 235000000346 sugar Nutrition 0.000 claims description 20
- 239000006188 syrup Substances 0.000 claims description 17
- 235000020357 syrup Nutrition 0.000 claims description 17
- 235000011187 glycerol Nutrition 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 12
- 150000001720 carbohydrates Chemical class 0.000 claims description 10
- 150000002016 disaccharides Chemical class 0.000 claims description 10
- 150000005846 sugar alcohols Chemical class 0.000 claims description 9
- 239000007787 solid Substances 0.000 claims description 8
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 claims description 6
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 claims description 5
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 claims description 4
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 claims description 4
- DLRVVLDZNNYCBX-UHFFFAOYSA-N Polydextrose Polymers OC1C(O)C(O)C(CO)OC1OCC1C(O)C(O)C(O)C(O)O1 DLRVVLDZNNYCBX-UHFFFAOYSA-N 0.000 claims description 4
- WINXNKPZLFISPD-UHFFFAOYSA-M Saccharin sodium Chemical compound [Na+].C1=CC=C2C(=O)[N-]S(=O)(=O)C2=C1 WINXNKPZLFISPD-UHFFFAOYSA-M 0.000 claims description 3
- TVXBFESIOXBWNM-UHFFFAOYSA-N Xylitol Natural products OCCC(O)C(O)C(O)CCO TVXBFESIOXBWNM-UHFFFAOYSA-N 0.000 claims description 3
- 239000008122 artificial sweetener Substances 0.000 claims description 3
- 235000021311 artificial sweeteners Nutrition 0.000 claims description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 3
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 claims description 3
- HEBKCHPVOIAQTA-UHFFFAOYSA-N meso ribitol Natural products OCC(O)C(O)C(O)CO HEBKCHPVOIAQTA-UHFFFAOYSA-N 0.000 claims description 3
- 239000000454 talc Substances 0.000 claims description 3
- 229910052623 talc Inorganic materials 0.000 claims description 3
- 239000000811 xylitol Substances 0.000 claims description 3
- 235000010447 xylitol Nutrition 0.000 claims description 3
- HEBKCHPVOIAQTA-SCDXWVJYSA-N xylitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)CO HEBKCHPVOIAQTA-SCDXWVJYSA-N 0.000 claims description 3
- 229960002675 xylitol Drugs 0.000 claims description 3
- OWEGMIWEEQEYGQ-UHFFFAOYSA-N 100676-05-9 Natural products OC1C(O)C(O)C(CO)OC1OCC1C(O)C(O)C(O)C(OC2C(OC(O)C(O)C2O)CO)O1 OWEGMIWEEQEYGQ-UHFFFAOYSA-N 0.000 claims description 2
- 229920001353 Dextrin Polymers 0.000 claims description 2
- 239000004375 Dextrin Substances 0.000 claims description 2
- GUBGYTABKSRVRQ-PICCSMPSSA-N Maltose Natural products O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-PICCSMPSSA-N 0.000 claims description 2
- 229920001100 Polydextrose Polymers 0.000 claims description 2
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 claims description 2
- 244000228451 Stevia rebaudiana Species 0.000 claims description 2
- 235000006092 Stevia rebaudiana Nutrition 0.000 claims description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 2
- IAOZJIPTCAWIRG-QWRGUYRKSA-N aspartame Chemical compound OC(=O)C[C@H](N)C(=O)N[C@H](C(=O)OC)CC1=CC=CC=C1 IAOZJIPTCAWIRG-QWRGUYRKSA-N 0.000 claims description 2
- XTPLQANXHDDXIH-UHFFFAOYSA-N azanium;1,1-dioxo-1,2-benzothiazol-3-olate Chemical compound N.C1=CC=C2C(=O)NS(=O)(=O)C2=C1 XTPLQANXHDDXIH-UHFFFAOYSA-N 0.000 claims description 2
- GUBGYTABKSRVRQ-QUYVBRFLSA-N beta-maltose Chemical compound OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O GUBGYTABKSRVRQ-QUYVBRFLSA-N 0.000 claims description 2
- 238000007664 blowing Methods 0.000 claims description 2
- 235000019425 dextrin Nutrition 0.000 claims description 2
- 239000008121 dextrose Substances 0.000 claims description 2
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 2
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical compound [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 239000000194 fatty acid Substances 0.000 claims description 2
- 229930195729 fatty acid Natural products 0.000 claims description 2
- 150000004665 fatty acids Chemical class 0.000 claims description 2
- 229940075507 glyceryl monostearate Drugs 0.000 claims description 2
- 239000008172 hydrogenated vegetable oil Substances 0.000 claims description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 claims description 2
- 235000013856 polydextrose Nutrition 0.000 claims description 2
- 239000001259 polydextrose Substances 0.000 claims description 2
- 229940035035 polydextrose Drugs 0.000 claims description 2
- 235000019204 saccharin Nutrition 0.000 claims description 2
- 239000001587 sorbitan monostearate Substances 0.000 claims description 2
- 235000011076 sorbitan monostearate Nutrition 0.000 claims description 2
- 229940035048 sorbitan monostearate Drugs 0.000 claims description 2
- 239000004378 Glycyrrhizin Substances 0.000 claims 2
- LPLVUJXQOOQHMX-UHFFFAOYSA-N glycyrrhetinic acid glycoside Natural products C1CC(C2C(C3(CCC4(C)CCC(C)(CC4C3=CC2=O)C(O)=O)C)(C)CC2)(C)C2C(C)(C)C1OC1OC(C(O)=O)C(O)C(O)C1OC1OC(C(O)=O)C(O)C(O)C1O LPLVUJXQOOQHMX-UHFFFAOYSA-N 0.000 claims 2
- 229960004949 glycyrrhizic acid Drugs 0.000 claims 2
- UYRUBYNTXSDKQT-UHFFFAOYSA-N glycyrrhizic acid Natural products CC1(C)C(CCC2(C)C1CCC3(C)C2C(=O)C=C4C5CC(C)(CCC5(C)CCC34C)C(=O)O)OC6OC(C(O)C(O)C6OC7OC(O)C(O)C(O)C7C(=O)O)C(=O)O UYRUBYNTXSDKQT-UHFFFAOYSA-N 0.000 claims 2
- 235000019410 glycyrrhizin Nutrition 0.000 claims 2
- LPLVUJXQOOQHMX-QWBHMCJMSA-N glycyrrhizinic acid Chemical compound O([C@@H]1[C@@H](O)[C@H](O)[C@H](O[C@@H]1O[C@@H]1C([C@H]2[C@]([C@@H]3[C@@]([C@@]4(CC[C@@]5(C)CC[C@@](C)(C[C@H]5C4=CC3=O)C(O)=O)C)(C)CC2)(C)CC1)(C)C)C(O)=O)[C@@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O LPLVUJXQOOQHMX-QWBHMCJMSA-N 0.000 claims 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 claims 2
- 150000003839 salts Chemical class 0.000 claims 2
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 claims 1
- DQFBYFPFKXHELB-UHFFFAOYSA-N Chalcone Natural products C=1C=CC=CC=1C(=O)C=CC1=CC=CC=C1 DQFBYFPFKXHELB-UHFFFAOYSA-N 0.000 claims 1
- 240000004015 Dioscoreophyllum cumminsii Species 0.000 claims 1
- 235000008764 Dioscoreophyllum cumminsii Nutrition 0.000 claims 1
- 244000179853 Sideroxylon dulcificum Species 0.000 claims 1
- 235000011341 Sideroxylon dulcificum Nutrition 0.000 claims 1
- 229940072056 alginate Drugs 0.000 claims 1
- 235000010443 alginic acid Nutrition 0.000 claims 1
- 229920000615 alginic acid Polymers 0.000 claims 1
- LNMAXKMUGYXKPJ-UHFFFAOYSA-L calcium;1,1-dioxo-1,2-benzothiazol-2-id-3-one Chemical compound [Ca+2].C1=CC=C2C([O-])=NS(=O)(=O)C2=C1.C1=CC=C2C([O-])=NS(=O)(=O)C2=C1 LNMAXKMUGYXKPJ-UHFFFAOYSA-L 0.000 claims 1
- 235000005513 chalcones Nutrition 0.000 claims 1
- 239000000625 cyclamic acid and its Na and Ca salt Substances 0.000 claims 1
- 235000019359 magnesium stearate Nutrition 0.000 claims 1
- 229940057948 magnesium stearate Drugs 0.000 claims 1
- 229940081974 saccharin Drugs 0.000 claims 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 claims 1
- 150000008163 sugars Chemical class 0.000 claims 1
- 239000000230 xanthan gum Substances 0.000 claims 1
- 235000010493 xanthan gum Nutrition 0.000 claims 1
- 229920001285 xanthan gum Polymers 0.000 claims 1
- 229940082509 xanthan gum Drugs 0.000 claims 1
- 239000000243 solution Substances 0.000 description 14
- 244000215068 Acacia senegal Species 0.000 description 13
- 229920000084 Gum arabic Polymers 0.000 description 13
- 235000010489 acacia gum Nutrition 0.000 description 13
- 239000000205 acacia gum Substances 0.000 description 13
- 239000000796 flavoring agent Substances 0.000 description 12
- 235000019634 flavors Nutrition 0.000 description 12
- 239000003921 oil Substances 0.000 description 11
- 235000019198 oils Nutrition 0.000 description 11
- 239000004014 plasticizer Substances 0.000 description 10
- 239000004615 ingredient Substances 0.000 description 9
- 239000000686 essence Substances 0.000 description 8
- -1 mannitol or xylitol Chemical class 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000000975 dye Substances 0.000 description 6
- 238000001125 extrusion Methods 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 239000000126 substance Substances 0.000 description 5
- 229920001908 Hydrogenated starch hydrolysate Polymers 0.000 description 4
- 230000014759 maintenance of location Effects 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 210000003296 saliva Anatomy 0.000 description 4
- 229920001412 Chicle Polymers 0.000 description 3
- 240000000896 Dyera costulata Species 0.000 description 3
- 240000001794 Manilkara zapota Species 0.000 description 3
- 235000011339 Manilkara zapota Nutrition 0.000 description 3
- 235000006679 Mentha X verticillata Nutrition 0.000 description 3
- 235000002899 Mentha suaveolens Nutrition 0.000 description 3
- 235000001636 Mentha x rotundifolia Nutrition 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 235000005822 corn Nutrition 0.000 description 3
- MAEBCGDGGATMSC-OSHGGGOQSA-N cyclamine Chemical compound O([C@H]1CO[C@H]([C@@H]([C@H]1O[C@@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)O[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O[C@@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)O[C@H]1CC[C@]2(C)[C@H]3CCC45OCC6([C@@H](C[C@@]4(C)[C@]3(C)CCC2C1(C)C)O)CC[C@@](C[C@@H]65)(C)C=O)[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O MAEBCGDGGATMSC-OSHGGGOQSA-N 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 150000002303 glucose derivatives Chemical class 0.000 description 3
- 150000004676 glycans Chemical class 0.000 description 3
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 3
- 150000002772 monosaccharides Chemical class 0.000 description 3
- 229920001282 polysaccharide Polymers 0.000 description 3
- 239000005017 polysaccharide Substances 0.000 description 3
- 235000019605 sweet taste sensations Nutrition 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- SRBFZHDQGSBBOR-IOVATXLUSA-N D-xylopyranose Chemical compound O[C@@H]1COC(O)[C@H](O)[C@H]1O SRBFZHDQGSBBOR-IOVATXLUSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 101000801619 Homo sapiens Long-chain-fatty-acid-CoA ligase ACSBG1 Proteins 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 102100033564 Long-chain-fatty-acid-CoA ligase ACSBG1 Human genes 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- PYMYPHUHKUWMLA-UHFFFAOYSA-N arabinose Natural products OCC(O)C(O)C(O)C=O PYMYPHUHKUWMLA-UHFFFAOYSA-N 0.000 description 2
- SRBFZHDQGSBBOR-UHFFFAOYSA-N beta-D-Pyranose-Lyxose Natural products OC1COC(O)C(O)C1O SRBFZHDQGSBBOR-UHFFFAOYSA-N 0.000 description 2
- 235000010634 bubble gum Nutrition 0.000 description 2
- 235000009508 confectionery Nutrition 0.000 description 2
- 235000013399 edible fruits Nutrition 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 239000008369 fruit flavor Substances 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 230000005923 long-lasting effect Effects 0.000 description 2
- 239000000845 maltitol Substances 0.000 description 2
- 235000010449 maltitol Nutrition 0.000 description 2
- VQHSOMBJVWLPSR-WUJBLJFYSA-N maltitol Chemical compound OC[C@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O VQHSOMBJVWLPSR-WUJBLJFYSA-N 0.000 description 2
- 229940035436 maltitol Drugs 0.000 description 2
- 239000001525 mentha piperita l. herb oil Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 235000019477 peppermint oil Nutrition 0.000 description 2
- 229960004793 sucrose Drugs 0.000 description 2
- 235000015260 sugar-free gum Nutrition 0.000 description 2
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- LPYUENQFPVNPHY-UHFFFAOYSA-N 3-methoxycatechol Chemical class COC1=CC=CC(O)=C1O LPYUENQFPVNPHY-UHFFFAOYSA-N 0.000 description 1
- SERLAGPUMNYUCK-YJOKQAJESA-N 6-O-alpha-D-glucopyranosyl-D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O SERLAGPUMNYUCK-YJOKQAJESA-N 0.000 description 1
- 244000144730 Amygdalus persica Species 0.000 description 1
- 244000099147 Ananas comosus Species 0.000 description 1
- 235000007119 Ananas comosus Nutrition 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282994 Cervidae Species 0.000 description 1
- 244000037364 Cinnamomum aromaticum Species 0.000 description 1
- 235000014489 Cinnamomum aromaticum Nutrition 0.000 description 1
- 235000019499 Citrus oil Nutrition 0.000 description 1
- GUBGYTABKSRVRQ-CUHNMECISA-N D-Cellobiose Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-CUHNMECISA-N 0.000 description 1
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 description 1
- HMFHBZSHGGEWLO-SOOFDHNKSA-N D-ribofuranose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H]1O HMFHBZSHGGEWLO-SOOFDHNKSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 206010013911 Dysgeusia Diseases 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 235000016623 Fragaria vesca Nutrition 0.000 description 1
- 240000009088 Fragaria x ananassa Species 0.000 description 1
- 235000011363 Fragaria x ananassa Nutrition 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- XINCECQTMHSORG-UHFFFAOYSA-N Isoamyl isovalerate Chemical compound CC(C)CCOC(=O)CC(C)C XINCECQTMHSORG-UHFFFAOYSA-N 0.000 description 1
- LKDRXBCSQODPBY-AMVSKUEXSA-N L-(-)-Sorbose Chemical compound OCC1(O)OC[C@H](O)[C@@H](O)[C@@H]1O LKDRXBCSQODPBY-AMVSKUEXSA-N 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 235000017858 Laurus nobilis Nutrition 0.000 description 1
- 235000019501 Lemon oil Nutrition 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- 235000009827 Prunus armeniaca Nutrition 0.000 description 1
- 244000018633 Prunus armeniaca Species 0.000 description 1
- 235000006040 Prunus persica var persica Nutrition 0.000 description 1
- 235000014443 Pyrus communis Nutrition 0.000 description 1
- PYMYPHUHKUWMLA-LMVFSUKVSA-N Ribose Natural products OC[C@@H](O)[C@@H](O)[C@@H](O)C=O PYMYPHUHKUWMLA-LMVFSUKVSA-N 0.000 description 1
- CZMRCDWAGMRECN-UHFFFAOYSA-N Rohrzucker Natural products OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2O)C(O)C1O CZMRCDWAGMRECN-UHFFFAOYSA-N 0.000 description 1
- 240000007651 Rubus glaucus Species 0.000 description 1
- 235000011034 Rubus glaucus Nutrition 0.000 description 1
- 235000009122 Rubus idaeus Nutrition 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 235000005212 Terminalia tomentosa Nutrition 0.000 description 1
- 244000125380 Terminalia tomentosa Species 0.000 description 1
- 241000219793 Trifolium Species 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- HMFHBZSHGGEWLO-UHFFFAOYSA-N alpha-D-Furanose-Ribose Natural products OCC1OC(O)C(O)C1O HMFHBZSHGGEWLO-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-PHYPRBDBSA-N alpha-D-galactose Chemical compound OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-PHYPRBDBSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000010617 anise oil Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- PYMYPHUHKUWMLA-WDCZJNDASA-N arabinose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)C=O PYMYPHUHKUWMLA-WDCZJNDASA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 229940119201 cedar leaf oil Drugs 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000001055 chewing effect Effects 0.000 description 1
- 239000010630 cinnamon oil Substances 0.000 description 1
- 239000010500 citrus oil Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000013270 controlled release Methods 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 208000002925 dental caries Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 239000010642 eucalyptus oil Substances 0.000 description 1
- 229940044949 eucalyptus oil Drugs 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 229930182830 galactose Natural products 0.000 description 1
- 125000002791 glucosyl group Chemical group C1([C@H](O)[C@@H](O)[C@H](O)[C@H](O1)CO)* 0.000 description 1
- 239000010651 grapefruit oil Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000010501 lemon oil Substances 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- 229960001047 methyl salicylate Drugs 0.000 description 1
- 239000008368 mint flavor Substances 0.000 description 1
- 239000001627 myristica fragrans houtt. fruit oil Substances 0.000 description 1
- 229920001206 natural gum Polymers 0.000 description 1
- 231100000957 no side effect Toxicity 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 235000019809 paraffin wax Nutrition 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 239000012169 petroleum derived wax Substances 0.000 description 1
- 235000019381 petroleum wax Nutrition 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920001290 polyvinyl ester Polymers 0.000 description 1
- 229940114930 potassium stearate Drugs 0.000 description 1
- ANBFRLKBEIFNQU-UHFFFAOYSA-M potassium;octadecanoate Chemical compound [K+].CCCCCCCCCCCCCCCCCC([O-])=O ANBFRLKBEIFNQU-UHFFFAOYSA-M 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000001327 prunus amygdalus amara l. extract Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 235000011888 snacks Nutrition 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical compound [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 1
- 229940080350 sodium stearate Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 229960004274 stearic acid Drugs 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000001789 thuja occidentalis l. leaf oil Substances 0.000 description 1
- 239000010678 thyme oil Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000000341 volatile oil Substances 0.000 description 1
- 229920003176 water-insoluble polymer Polymers 0.000 description 1
- 239000009637 wintergreen oil Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23G—COCOA; COCOA PRODUCTS, e.g. CHOCOLATE; SUBSTITUTES FOR COCOA OR COCOA PRODUCTS; CONFECTIONERY; CHEWING GUM; ICE-CREAM; PREPARATION THEREOF
- A23G4/00—Chewing gum
- A23G4/06—Chewing gum characterised by the composition containing organic or inorganic compounds
- A23G4/10—Chewing gum characterised by the composition containing organic or inorganic compounds characterised by the carbohydrates used, e.g. polysaccharides
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23G—COCOA; COCOA PRODUCTS, e.g. CHOCOLATE; SUBSTITUTES FOR COCOA OR COCOA PRODUCTS; CONFECTIONERY; CHEWING GUM; ICE-CREAM; PREPARATION THEREOF
- A23G4/00—Chewing gum
- A23G4/18—Chewing gum characterised by shape, structure or physical form, e.g. aerated products
- A23G4/20—Composite products, e.g. centre-filled, multi-layer, laminated
- A23G4/205—Hollow products, e.g. with inedible or edible filling, fixed or movable within the cavity
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Food Science & Technology (AREA)
- Polymers & Plastics (AREA)
- Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Inorganic Chemistry (AREA)
- Confectionery (AREA)
- Seasonings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/050,573 US4271197A (en) | 1979-06-21 | 1979-06-21 | Chewing gum containing sugar substitute |
| US5057379 | 1979-06-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL8003576A true NL8003576A (nl) | 1980-12-23 |
Family
ID=21966036
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8003576A NL8003576A (nl) | 1979-06-21 | 1980-06-20 | Kauwgom, die een vervangingsmiddel voor suiker bevat. |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4271197A (OSRAM) |
| JP (1) | JPS565053A (OSRAM) |
| AR (1) | AR225768A1 (OSRAM) |
| AU (1) | AU533000B2 (OSRAM) |
| BE (1) | BE883939A (OSRAM) |
| CA (1) | CA1162094A (OSRAM) |
| DE (1) | DE3023110A1 (OSRAM) |
| DK (1) | DK266080A (OSRAM) |
| FR (1) | FR2459004B1 (OSRAM) |
| GB (1) | GB2052946B (OSRAM) |
| IE (1) | IE49921B1 (OSRAM) |
| IT (1) | IT1145376B (OSRAM) |
| MX (1) | MX6669E (OSRAM) |
| NL (1) | NL8003576A (OSRAM) |
| NO (1) | NO157482C (OSRAM) |
| PH (1) | PH16049A (OSRAM) |
| SE (1) | SE8004541L (OSRAM) |
| ZA (1) | ZA803143B (OSRAM) |
Families Citing this family (105)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4352825A (en) * | 1981-02-23 | 1982-10-05 | Nabisco Brands, Inc. | Coextruded chewing gum containing a soft core portion |
| FR2502495B1 (fr) * | 1981-03-27 | 1987-04-30 | Nabisco Brands Inc | Composition a base d'hydrolysat d'amidon hydrogene en combinaison avec un sucre naturel pour inhiber ou prevenir la carie |
| US4352823A (en) * | 1981-04-13 | 1982-10-05 | Nabisco Brands, Inc. | Coextruded chewing gum containing a soft non-SBR gum core portion |
| US4382963A (en) * | 1981-11-09 | 1983-05-10 | General Foods Corporation | Low-calorie, sugar-free chewing gum containing polydextrose |
| FR2525868A1 (fr) * | 1982-04-30 | 1983-11-04 | Roquette Freres | Bonbon " sucre cuit " sans sucre |
| US4568537A (en) * | 1983-06-06 | 1986-02-04 | Wm. Wrigley Jr. Company | Dental health method employing chewing gum |
| US4556565A (en) * | 1983-11-04 | 1985-12-03 | Tetsuo Arima | Sweetener composition, process for making the same, and comestibles comprising said sweetener composition |
| JPS60102147A (ja) * | 1983-11-07 | 1985-06-06 | Ajinomoto General Food Kk | ノ−シユガ−チユ−インガム及びその製造方法 |
| JPS60114149A (ja) * | 1983-11-25 | 1985-06-20 | Lotte Co Ltd | 柔軟なチューインガム |
| US4597981A (en) * | 1983-12-20 | 1986-07-01 | Howard Kastin | Soft candy composition |
| US4528206A (en) * | 1983-12-20 | 1985-07-09 | Howard Kastin | Hard candy composition |
| US4671967A (en) * | 1984-05-18 | 1987-06-09 | Wm. Wrigley Jr. Company | Carbohydrate syrups and methods of preparation |
| US4671961A (en) * | 1984-05-18 | 1987-06-09 | Wm. Wrigley Jr. Company | Chewing gum compositions and methods of preparation |
| US4738854A (en) * | 1984-12-04 | 1988-04-19 | Nabisco Brands, Inc. | Comestible containing moisture and shelf storage stabilized L-aspartic acid derivative |
| US4582707A (en) * | 1984-12-26 | 1986-04-15 | Nabisco Brands, Inc. | Non-sticking chewing gum |
| AU586231B2 (en) * | 1985-03-29 | 1989-07-06 | Nabisco Brands Incorporated | Flexible sugarless chewing gum |
| US4774094A (en) * | 1985-03-29 | 1988-09-27 | Nabisco Brands, Inc. | Stabilized APM in comestibles |
| US4753806A (en) * | 1985-03-29 | 1988-06-28 | Nabisco Brands, Inc. | Flexible sugarless chewing gum |
| US4800095A (en) * | 1985-03-29 | 1989-01-24 | Nabisco Brands, Inc. | Stabilized APM in comestibles |
| US4675190A (en) * | 1985-12-03 | 1987-06-23 | Warner-Lambert Company | Dispensable chewing gum composition, and method of making same |
| US4726953A (en) * | 1986-10-01 | 1988-02-23 | Nabisco Brands, Inc. | Sweet flavorful soft flexible sugarless chewing gum |
| US4804543A (en) * | 1987-07-14 | 1989-02-14 | Warner-Lambert Company | Novel hydrophilic plasticizing system and chewing gum containing same |
| US4976972A (en) * | 1988-02-24 | 1990-12-11 | Wm. Wrigley Jr. Company | Chewing gum with improved sweetness employing xylitol rolling compound |
| US4931294A (en) * | 1988-03-21 | 1990-06-05 | Wm. Wrigley Jr. Company | Environmentally stable chewing gum composition containing xylitol |
| US4900563A (en) * | 1988-12-29 | 1990-02-13 | Warner-Lambert Company | Fructose sweetened chewing gum compositions |
| US5075118A (en) * | 1990-09-28 | 1991-12-24 | Wm. Wrigley Jr. Company | Method for making sugarless xylitol containing chewing gum |
| US5120551A (en) * | 1990-12-21 | 1992-06-09 | Wm. Wrigley Jr. Company | Low moisture sugarless syrups with maltitol for chewing gum |
| GB9302259D0 (en) * | 1993-02-05 | 1993-03-24 | Cerestar Holding Bv | Starch based material |
| DK0809444T3 (da) * | 1993-12-29 | 2005-12-05 | Wrigley W M Jun Co | Flydende sorbitol/mannitol/glycerin-blanding og præparater, som indeholder en sådan |
| US5651936A (en) * | 1993-12-29 | 1997-07-29 | Wm. Wrigley Jr. Company | Syrups containing sorbitol, a plasticizing agent and an anticrystallization agent and their use in chewing gum and other products |
| DK0758849T3 (da) * | 1994-05-06 | 2007-06-25 | Wrigley W M Jun Co | Fremgangsmåde til at fremstille tyggegummi indeholdende en flydende sorbitol/mannitol/glycerinblanding |
| US5538741A (en) * | 1994-12-22 | 1996-07-23 | Wm. Wrigley Jr. Company | Sugarless non-tack chewing gum |
| US5952019A (en) * | 1996-03-14 | 1999-09-14 | Wm. Wrigley Jr. Company | Chewing gum containing gum talha |
| US7588793B1 (en) | 1998-06-05 | 2009-09-15 | Cadbury Adams Usa, Llc | Enhanced flavoring compositions containing N-ethyl-p-menthane-3-carboxamide and method of making and using same |
| CA2391519A1 (en) * | 1999-12-16 | 2001-06-28 | Wm. Wrigley Jr. Company | Chewing gum products including hydrogenated starch hydrolysates |
| US20020113632A1 (en) * | 1999-12-16 | 2002-08-22 | Yatka Robert J. | Chewing gum products including hydrogenated starch hydrolysates |
| US6838098B2 (en) * | 2000-09-07 | 2005-01-04 | Cadbury Adams Usa, Llc | Continuous formation of center filled gum |
| US6623266B2 (en) * | 2001-01-19 | 2003-09-23 | Cadbury Adams Usa Llc | Apparatus for making a center-filled gum lollipop with hard candy shell |
| US7244455B2 (en) * | 2002-01-16 | 2007-07-17 | Warner-Lambert Company | Center-filled chewing gum containing a deliverable form of calcium |
| FR2855375B1 (fr) * | 2003-05-27 | 2006-08-11 | Roquette Freres | Comprime de chewing-gum sans sucre et son procede de fabrication |
| GB0326492D0 (en) * | 2003-11-14 | 2003-12-17 | Cadbury Schweppes Plc | Liquid-filled confectionery compositions |
| US20050112236A1 (en) | 2003-11-21 | 2005-05-26 | Navroz Boghani | Delivery system for active components as part of an edible composition having preselected tensile strength |
| US8591974B2 (en) * | 2003-11-21 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for two or more active components as part of an edible composition |
| US8597703B2 (en) | 2005-05-23 | 2013-12-03 | Kraft Foods Global Brands Llc | Delivery system for active components as part of an edible composition including a ratio of encapsulating material and active component |
| US8591973B2 (en) | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for active components and a material having preselected hydrophobicity as part of an edible composition |
| US8389032B2 (en) | 2005-05-23 | 2013-03-05 | Kraft Foods Global Brands Llc | Delivery system for active components as part of an edible composition having selected particle size |
| US8591968B2 (en) | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Edible composition including a delivery system for active components |
| US8591972B2 (en) | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for coated active components as part of an edible composition |
| BRPI0514283A (pt) * | 2004-08-11 | 2008-06-10 | Cadbury Adams Usa Llc | composições para aquecimento e sistemas de liberação para as mesmas |
| US7955630B2 (en) | 2004-09-30 | 2011-06-07 | Kraft Foods Global Brands Llc | Thermally stable, high tensile strength encapsulated actives |
| US20060280834A1 (en) * | 2004-08-25 | 2006-12-14 | Cadbury Adams Usa, Llc. | Center-filled chewing gum composition |
| US7727565B2 (en) * | 2004-08-25 | 2010-06-01 | Cadbury Adams Usa Llc | Liquid-filled chewing gum composition |
| US20060280837A1 (en) * | 2004-08-25 | 2006-12-14 | Cadbury Adams Usa Llc. | Multi-modality sensations in chewing gum compositions |
| US20080014302A1 (en) * | 2004-08-25 | 2008-01-17 | Cadbury Adams Usa Llc | Multi-region chewing gum composition including isomalt gum region |
| US7641926B2 (en) * | 2004-08-25 | 2010-01-05 | Cadbury Adams Usa, Llc | Liquid-filled chewing gum composition |
| US20060286201A1 (en) * | 2004-08-25 | 2006-12-21 | Cadbury Adams Usa Llc. | Multi-modality functional ingredients in chewing gum compositions |
| US20070148284A1 (en) * | 2004-08-25 | 2007-06-28 | Cadbury Adams Usa Llc. | Liquid-filled chewing gum |
| US20060263475A1 (en) * | 2004-08-25 | 2006-11-23 | Cadbury Adams Usa, Llc. | Center-filled chewing gum composition |
| US20100136164A1 (en) * | 2004-08-25 | 2010-06-03 | Cadbury Adams Usa Llc | Package assembly for multi-modality taste chewing gum compositions |
| US20060280836A1 (en) * | 2004-08-25 | 2006-12-14 | Cadbury Adams Usa Llc. | Multi-modality tastes in chewing gum compositions |
| US20070148286A1 (en) * | 2004-08-25 | 2007-06-28 | Cadbury Adams Usa Llc. | Liquid-filled chewing gum composition |
| WO2006026298A2 (en) * | 2004-08-25 | 2006-03-09 | Cadbury Adams Usa Llc | Liquid-filled chewing gum composition |
| US20060280835A1 (en) * | 2004-08-25 | 2006-12-14 | Cadbury Adams Usa Llc. | Multi-modality flavored chewing gum compositions |
| US20060153949A1 (en) * | 2005-01-11 | 2006-07-13 | Cadbury Adams Usa Llc. | Edible compositions containing swellable polymers |
| US20090150231A1 (en) * | 2005-05-23 | 2009-06-11 | Cadbury Adams Usa Llc | Package assembly for multi-modality functional ingredients in chewing gum compositions |
| CN101179943B (zh) | 2005-05-23 | 2013-06-26 | 卡夫食品环球品牌有限责任公司 | 填充液体的咀嚼型胶基糖组合物 |
| US20060280852A1 (en) * | 2005-05-27 | 2006-12-14 | Cadbury Adams Usa Llc. | Vanilla-flavored compositions and delivery systems therefor |
| MX2008001540A (es) * | 2005-08-12 | 2008-02-15 | Cadbury Adams Usa Llc | Composiciones para humectar la boca, sistemas para su administracion y metodos para fabricar las mismas. |
| US8282971B2 (en) * | 2005-08-22 | 2012-10-09 | Kraft Foods Global Brands Llc | Degradable chewing gum |
| US8263143B2 (en) * | 2005-08-22 | 2012-09-11 | Kraft Foods Global Brands Llc | Degradable chewing gum |
| US8268371B2 (en) * | 2005-08-22 | 2012-09-18 | Kraft Foods Global Brands Llc | Degradable chewing gum |
| US8287928B2 (en) * | 2005-08-22 | 2012-10-16 | Kraft Foods Global Brands Llc | Degradable chewing gum |
| US20070221236A1 (en) * | 2005-10-05 | 2007-09-27 | Cadbury Adams Usa Llc. | Cooling compositions including menthyl esters |
| US20070077331A1 (en) * | 2005-10-05 | 2007-04-05 | Cadbury Adams Usa Llc. | Cooling compositions |
| US20070148283A1 (en) | 2005-12-23 | 2007-06-28 | Cadbury Adams Usa Llc | Compositions providing a sensation substantially similar to that provided by menthol |
| WO2007126430A1 (en) * | 2005-12-23 | 2007-11-08 | Cadbury Adams Usa Llc | Compositions providing a heating sensation for oral or dermal delivery |
| AU2007214545B2 (en) * | 2006-02-15 | 2011-02-10 | Wm. Wrigley Jr. Company | Non-crystallizing syrups containing sorbitol and their use in chewing gum |
| EP2001436B1 (en) * | 2006-04-05 | 2017-01-04 | Intercontinental Great Brands LLC | Calcium phosphate complex and salts in oral delivery systems |
| ES2604657T3 (es) | 2006-04-05 | 2017-03-08 | Intercontinental Great Brands Llc | Complejo de fosfato de calcio en goma de mascar que contiene ácido |
| RU2437646C2 (ru) * | 2006-04-05 | 2011-12-27 | КЭДБЕРИ АДАМС ЮЭсЭй ЛЛС | Воздействие кальцийфосфатным комплексом на зубной кариес |
| US20070275129A1 (en) * | 2006-04-21 | 2007-11-29 | Cadbury Adams Usa Llc | Coating compositions, confectionery and chewing gum compositions and methods |
| WO2008003083A2 (en) * | 2006-06-29 | 2008-01-03 | Cadbury Adams Usa Llc | Improved chain cutter for continuously forming center-filled gum pieces |
| PL2056680T3 (pl) | 2006-08-29 | 2013-04-30 | Intercontinental Great Brands Llc | Wywołujące zadowolenie kompozycje gumowej bazy i zawierające je gumy do żucia |
| US20080063748A1 (en) * | 2006-09-08 | 2008-03-13 | Cadbury Adams Usa Llc. | Center-fill confectionery and chewing gum compositions containing suspended saccharide particles |
| US20080213440A1 (en) | 2007-03-01 | 2008-09-04 | Cadbury Adams Usa Llc | Non-Aldehyde Cinnamon Flavor and Delivery Systems Therefor |
| CA2687421A1 (en) * | 2007-06-01 | 2008-12-11 | Cadbury Adams Usa Llc | Center-fill gum compositions incorporating triacetin |
| ES2536513T3 (es) * | 2007-07-27 | 2015-05-26 | Intercontinental Great Brands Llc | Método y aparato para procesar cuerdas de confitería múltiples |
| GB0715226D0 (en) * | 2007-08-01 | 2007-09-12 | Cadbury Schweppes Plc | Sweetener compositions |
| GB0720516D0 (en) * | 2007-10-18 | 2007-11-28 | Cadbury Schweppes Plc | Comestible products |
| CN101883499A (zh) | 2007-11-29 | 2010-11-10 | 吉百利亚当斯美国有限责任公司 | 具有活性物的多区咀嚼型胶基糖 |
| CA2704267C (en) * | 2007-11-29 | 2015-01-20 | Cadbury Adams Usa Llc | Particulate coating processing |
| JP5462244B2 (ja) * | 2008-05-02 | 2014-04-02 | インターコンチネンタル グレート ブランズ エルエルシー | 無糖マンニトール菓子およびその製造方法 |
| EP2355665A1 (en) * | 2008-11-12 | 2011-08-17 | Kraft Foods Global Brands LLC | Sensate- plated sanding composition and products made therefrom |
| CN102438463A (zh) | 2009-01-22 | 2012-05-02 | 卡夫食品环球品牌有限责任公司 | 糖食加工 |
| GB0915264D0 (en) | 2009-09-02 | 2009-10-07 | Cadbury Adams Usa Llc | Gum base |
| US8920856B2 (en) | 2009-10-08 | 2014-12-30 | Intercontinental Great Brands Llc | Co-extruded layered candy and gum apparatus and methods |
| EP2316279B1 (en) * | 2009-10-30 | 2013-10-09 | Intercontinental Great Brands LLC | Sugar free confectionery; methods of making same; and use in preparing multilayered confectionery. |
| US20110144218A1 (en) * | 2009-12-11 | 2011-06-16 | David Posner | Taste-Modified Consumable Products And Methods Of Preparation |
| CN102970878B (zh) | 2010-05-03 | 2015-09-30 | 洲际大品牌有限责任公司 | 包括纤维素材料的天然咀嚼型胶基糖 |
| DE202014101882U1 (de) | 2014-04-22 | 2014-05-02 | Armin Armani | Orales Abgabesystem |
| WO2015195534A2 (en) | 2014-06-16 | 2015-12-23 | Intercontinental Great Brands Llc | Degradable chewing gum |
| JP6732421B2 (ja) * | 2015-09-30 | 2020-07-29 | 株式会社明治 | チューインガムの体積減少緩和剤、体積減少緩和方法 |
| ITUA20163230A1 (it) * | 2016-05-06 | 2017-11-06 | Perfetti Van Melle Spa | Gomma da masticare con stevia |
| FR3059521B1 (fr) * | 2016-12-01 | 2020-10-09 | Roquette Freres | Procede de fabrication d'une composition de chewing gum avec pates a macher sans cuisson |
| CN111867568A (zh) | 2018-01-18 | 2020-10-30 | C·阿尔诺德 | 包含聚已缩胍的口香糖组合物 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA899143A (en) * | 1972-05-02 | J. Smith Walton | Low fermentability food products | |
| NL137813C (OSRAM) | 1963-05-06 | 1900-01-01 | ||
| US3352689A (en) * | 1966-02-14 | 1967-11-14 | Warner Lambert Pharmaceutical | Sugarless gum |
| US3556811A (en) * | 1969-08-11 | 1971-01-19 | Walton J Smith | Low-fermentability hard candy |
| US3914434A (en) * | 1969-08-22 | 1975-10-21 | Hoffmann La Roche | Non-cariogenic foods and delicacies containing xylitol as a sugar substitute |
| US3655866A (en) * | 1970-01-26 | 1972-04-11 | Warner Lambert Co | Sugarless gum containing dicalcium phosphate dihydrate |
| US3666492A (en) * | 1970-04-06 | 1972-05-30 | Anheuser Busch | Chewing gum |
| JPS53127858A (en) * | 1977-03-16 | 1978-11-08 | Kanebo Ltd | Production of sugarless chewing gum |
| JPS545062A (en) * | 1977-06-11 | 1979-01-16 | Kanebo Ltd | Improved sugarless chewing gum |
| CA1110907A (en) * | 1977-07-08 | 1981-10-20 | Frank Witzel | Long-lasting chewing gum having good processibility and method |
| FR2459002A1 (fr) * | 1979-06-15 | 1981-01-09 | Roquette Freres | Chewing-gum perfectionne du type sans sucre |
-
1979
- 1979-06-21 US US06/050,573 patent/US4271197A/en not_active Expired - Lifetime
-
1980
- 1980-05-23 AU AU58724/80A patent/AU533000B2/en not_active Ceased
- 1980-05-26 ZA ZA00803143A patent/ZA803143B/xx unknown
- 1980-06-04 PH PH24111A patent/PH16049A/en unknown
- 1980-06-13 GB GB8019441A patent/GB2052946B/en not_active Expired
- 1980-06-16 CA CA000354107A patent/CA1162094A/en not_active Expired
- 1980-06-16 AR AR281418A patent/AR225768A1/es active
- 1980-06-18 SE SE8004541A patent/SE8004541L/ unknown
- 1980-06-19 MX MX808884U patent/MX6669E/es unknown
- 1980-06-19 IT IT49018/80A patent/IT1145376B/it active
- 1980-06-20 DE DE19803023110 patent/DE3023110A1/de active Granted
- 1980-06-20 IE IE1286/80A patent/IE49921B1/en unknown
- 1980-06-20 FR FR8013813A patent/FR2459004B1/fr not_active Expired
- 1980-06-20 NL NL8003576A patent/NL8003576A/nl not_active Application Discontinuation
- 1980-06-20 DK DK266080A patent/DK266080A/da not_active Application Discontinuation
- 1980-06-20 NO NO801849A patent/NO157482C/no unknown
- 1980-06-20 BE BE0/201121A patent/BE883939A/fr not_active IP Right Cessation
- 1980-06-21 JP JP8450280A patent/JPS565053A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| BE883939A (fr) | 1980-12-22 |
| NO801849L (no) | 1980-12-22 |
| AU5872480A (en) | 1981-01-08 |
| JPS565053A (en) | 1981-01-20 |
| DK266080A (da) | 1980-12-22 |
| GB2052946A (en) | 1981-02-04 |
| IE801286L (en) | 1980-12-21 |
| AU533000B2 (en) | 1983-10-27 |
| PH16049A (en) | 1983-06-02 |
| DE3023110C2 (OSRAM) | 1990-04-05 |
| MX6669E (es) | 1985-10-07 |
| FR2459004A1 (OSRAM) | 1981-01-09 |
| GB2052946B (en) | 1984-04-18 |
| IE49921B1 (en) | 1986-01-08 |
| IT1145376B (it) | 1986-11-05 |
| NO157482C (no) | 1988-04-06 |
| JPS6319141B2 (OSRAM) | 1988-04-21 |
| FR2459004B1 (OSRAM) | 1985-07-19 |
| NO157482B (no) | 1987-12-21 |
| AR225768A1 (es) | 1982-04-30 |
| DE3023110A1 (de) | 1981-01-08 |
| SE8004541L (sv) | 1980-12-22 |
| US4271197A (en) | 1981-06-02 |
| IT8049018A0 (it) | 1980-06-19 |
| ZA803143B (en) | 1981-05-27 |
| CA1162094A (en) | 1984-02-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL8003576A (nl) | Kauwgom, die een vervangingsmiddel voor suiker bevat. | |
| US4250196A (en) | Center-filled chewing gums | |
| US4316915A (en) | Center-filled chewing gums | |
| DE69118960T2 (de) | Stabilisierte Chlordeoxysaccharid-Typ Süssstoffe in Pulverform und Verfahren zu deren Herstellung | |
| DE69112241T2 (de) | Polydextrose und Chlordeoxysaccharid enthaltende synergistische Süsstoffzusammensetzungen und Verfahren zur Herstellung derselben. | |
| US4271199A (en) | Sugar-containing chewing gum having smooth texture and long-lasting sweetness | |
| US5093136A (en) | Dual gum base bubble gum | |
| US4248895A (en) | Dehydrated higher polyalcohols, comestibles and chewing gum containing same and method | |
| DE69230586T2 (de) | Kaugummi und andere lebensmittel, die unverdauliches dextrin enthalten | |
| EP0271445B1 (en) | Reduced calorie chewing gum base and compositions containing the same | |
| US4975270A (en) | Elastomer encased active ingredients | |
| EP0426428A1 (en) | Encapsulated sweetener-flavour delivery system, and its production | |
| DE3213591A1 (de) | Coextrudierter kaugummi enthaltend einen weichen, nicht-sbr-gummikern und verfahren zu dessen herstellung | |
| DE69330428T2 (de) | Verbesserter wachsfreier feuchtigkeitsarmer kaugummi | |
| DE3609471A1 (de) | Kaugummi und verfahren zu dessen herstellung | |
| EP0086856B1 (en) | Center-filled chewing gums, a sugarless liquid fill for same and a process for preparing them | |
| US4820528A (en) | Sweetener composition | |
| EP2309872B1 (en) | Powdered chewing gum compositions, the use thereof and a method of preparing such compositions | |
| US4493849A (en) | Process for preparing a non-chalky, organoleptically pleasing chewing gum composition | |
| EP2440071B1 (en) | Extruded particles | |
| DE69535417T2 (de) | Verfahren zur herstellung von kaugummi mit einem flüssigem sorbit/mannit/glycerin gemisch | |
| US6663849B1 (en) | Antacid chewing gum products coated with high viscosity materials | |
| DE69230807T2 (de) | Nichtklebender kaugummi mit hoher aromaintensität und verminderter plastifizierung | |
| JPH06141792A (ja) | 低カロリー低吸湿性バルク剤組成物およびその製造方法 | |
| DE3542905A1 (de) | Feuchtigkeits- und lagerstabilisierte l-asparaginsaeurederivate enthaltende nahrungsmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A85 | Still pending on 85-01-01 | ||
| BA | A request for search or an international-type search has been filed | ||
| BB | A search report has been drawn up | ||
| BC | A request for examination has been filed | ||
| BV | The patent application has lapsed |