NL8000869A - Cyanoguanidine-derivaten en werkwijze voor de bereiding daarvan. - Google Patents
Cyanoguanidine-derivaten en werkwijze voor de bereiding daarvan. Download PDFInfo
- Publication number
- NL8000869A NL8000869A NL8000869A NL8000869A NL8000869A NL 8000869 A NL8000869 A NL 8000869A NL 8000869 A NL8000869 A NL 8000869A NL 8000869 A NL8000869 A NL 8000869A NL 8000869 A NL8000869 A NL 8000869A
- Authority
- NL
- Netherlands
- Prior art keywords
- group
- formula
- carbon atoms
- addition salt
- acid addition
- Prior art date
Links
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical class NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 title claims description 23
- 238000000034 method Methods 0.000 title claims description 21
- 238000002360 preparation method Methods 0.000 title claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 46
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 23
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- 150000003839 salts Chemical class 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 17
- 125000004076 pyridyl group Chemical group 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 14
- -1 amine compound Chemical class 0.000 claims description 13
- 125000002947 alkylene group Chemical group 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000004414 alkyl thio group Chemical group 0.000 claims description 8
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 150000002541 isothioureas Chemical class 0.000 claims description 6
- 150000002542 isoureas Chemical class 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 125000004434 sulfur atom Chemical group 0.000 claims description 5
- 125000002541 furyl group Chemical group 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 4
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical group [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 claims 4
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 claims 1
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 64
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 32
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 32
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 22
- 230000000694 effects Effects 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 101000986989 Naja kaouthia Acidic phospholipase A2 CM-II Proteins 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 230000009471 action Effects 0.000 description 5
- 230000001430 anti-depressive effect Effects 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 238000000921 elemental analysis Methods 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 230000000144 pharmacologic effect Effects 0.000 description 5
- 239000003814 drug Substances 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 239000003589 local anesthetic agent Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- 230000003444 anaesthetic effect Effects 0.000 description 3
- 230000001142 anti-diarrhea Effects 0.000 description 3
- 230000003501 anti-edematous effect Effects 0.000 description 3
- 239000000935 antidepressant agent Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 230000001882 diuretic effect Effects 0.000 description 3
- 210000004051 gastric juice Anatomy 0.000 description 3
- 230000028327 secretion Effects 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 101150048593 Mdmd gene Proteins 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- YASIJBZPJZUSNT-UHFFFAOYSA-N (2-methylphenyl)-pyridin-2-ylmethanamine Chemical compound CC1=CC=CC=C1C(N)C1=CC=CC=N1 YASIJBZPJZUSNT-UHFFFAOYSA-N 0.000 description 1
- VTVUQEWMHOAHTC-UHFFFAOYSA-N 1-cyano-2-methyl-1-[(2-methylphenyl)-pyridin-2-ylmethyl]guanidine Chemical compound C=1C=CC=C(C)C=1C(N(C#N)C(=N)NC)C1=CC=CC=N1 VTVUQEWMHOAHTC-UHFFFAOYSA-N 0.000 description 1
- LHEZQHBWIMRZBM-UHFFFAOYSA-N 1-cyano-2-methyl-1-[phenyl(pyridin-2-yl)methyl]guanidine Chemical compound C=1C=CC=NC=1C(N(C#N)C(N)=NC)C1=CC=CC=C1 LHEZQHBWIMRZBM-UHFFFAOYSA-N 0.000 description 1
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical compound CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 229930003347 Atropine Natural products 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 1
- CGIGDMFJXJATDK-UHFFFAOYSA-N Indomethacin Natural products CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 1
- 101100412856 Mus musculus Rhod gene Proteins 0.000 description 1
- 101100263202 Mus musculus Usp9x gene Proteins 0.000 description 1
- KUGRPPRAQNPSQD-UHFFFAOYSA-N OOOOO Chemical compound OOOOO KUGRPPRAQNPSQD-UHFFFAOYSA-N 0.000 description 1
- OZBZONOEYUBXTD-UHFFFAOYSA-N OOOOOOOOO Chemical compound OOOOOOOOO OZBZONOEYUBXTD-UHFFFAOYSA-N 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 208000007107 Stomach Ulcer Diseases 0.000 description 1
- 101100242191 Tetraodon nigroviridis rho gene Proteins 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 1
- 230000003266 anti-allergic effect Effects 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000001262 anti-secretory effect Effects 0.000 description 1
- 230000000794 anti-serotonin Effects 0.000 description 1
- 239000003416 antiarrhythmic agent Substances 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000003420 antiserotonin agent Substances 0.000 description 1
- 229960000396 atropine Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- IULFXBLVJIPESI-UHFFFAOYSA-N bis(methylsulfanyl)methylidenecyanamide Chemical compound CSC(SC)=NC#N IULFXBLVJIPESI-UHFFFAOYSA-N 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 230000004531 blood pressure lowering effect Effects 0.000 description 1
- 230000036471 bradycardia Effects 0.000 description 1
- 208000006218 bradycardia Diseases 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- CCGSUNCLSOWKJO-UHFFFAOYSA-N cimetidine Chemical compound N#CNC(=N/C)\NCCSCC1=NC=N[C]1C CCGSUNCLSOWKJO-UHFFFAOYSA-N 0.000 description 1
- 229960001380 cimetidine Drugs 0.000 description 1
- 229960001747 cinchocaine Drugs 0.000 description 1
- 239000003218 coronary vasodilator agent Substances 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229960004801 imipramine Drugs 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000007721 medicinal effect Effects 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- SDDKIZNHOCEXTF-UHFFFAOYSA-N methyl carbamimidothioate Chemical compound CSC(N)=N SDDKIZNHOCEXTF-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- SDAMIPBBMOPXRJ-UHFFFAOYSA-N methyl n-cyano-n-[(2-methylphenyl)-pyridin-2-ylmethyl]carbamimidothioate Chemical compound C=1C=CC=C(C)C=1C(N(C#N)C(=N)SC)C1=CC=CC=N1 SDAMIPBBMOPXRJ-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229940035363 muscle relaxants Drugs 0.000 description 1
- 239000003158 myorelaxant agent Substances 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 1
- 239000005526 vasoconstrictor agent Substances 0.000 description 1
- 239000011800 void material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/40—Acylated substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/28—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of guanidine groups bound to cyano groups, e.g. cyanoguanidines, dicyandiamides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/89—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1598979 | 1979-02-16 | ||
| JP1598979A JPS568357A (en) | 1979-02-16 | 1979-02-16 | Cyanoguanidine derivative and its production |
| JP54015990A JPS6016940B2 (ja) | 1979-02-16 | 1979-02-16 | シアノグアニジン誘導体およびその製造法 |
| JP1599079 | 1979-02-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL8000869A true NL8000869A (nl) | 1980-08-19 |
Family
ID=26352224
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8000869A NL8000869A (nl) | 1979-02-16 | 1980-02-12 | Cyanoguanidine-derivaten en werkwijze voor de bereiding daarvan. |
Country Status (9)
| Country | Link |
|---|---|
| US (5) | US4287346A (Direct) |
| CA (1) | CA1145751A (Direct) |
| CH (1) | CH641772A5 (Direct) |
| DE (1) | DE3005786A1 (Direct) |
| FR (1) | FR2453155A1 (Direct) |
| GB (2) | GB2046736B (Direct) |
| IT (1) | IT1141214B (Direct) |
| NL (1) | NL8000869A (Direct) |
| SE (2) | SE8001216L (Direct) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4287346A (en) * | 1979-02-16 | 1981-09-01 | Eisai Co., Ltd. | Cyanoguanidine derivatives |
| EP0072926B1 (de) * | 1981-08-19 | 1986-09-24 | MERCK PATENT GmbH | 2-Aryl-imidazopyridine |
| IE54196B1 (en) * | 1981-09-10 | 1989-07-19 | Leo Pharm Prod Ltd | Chemical compounds |
| IT1190793B (it) * | 1982-04-27 | 1988-02-24 | Magis Farmaceutici | Composti attivi nel trattamento dell'ulcera e sintomi allergici della pelle |
| US4496573A (en) * | 1982-08-24 | 1985-01-29 | William H. Rorer, Inc. | 1-Pyridylmethyl-3-acyl guanidines |
| US4529723A (en) * | 1983-04-29 | 1985-07-16 | William H. Rorer, Inc. | Bicyclic benzenoid aminoalkylene ethers and thioethers, pharmaceutical compositions and use |
| US4689348A (en) * | 1984-08-17 | 1987-08-25 | Dow Chemical Company | Cyanoguanidines useful as animal growth promoting agents |
| US4661520A (en) * | 1984-08-17 | 1987-04-28 | The Dow Chemical Company | Cyanoguanidine useful as an animal growth promoting agent |
| US4921939A (en) * | 1985-03-19 | 1990-05-01 | Universite Claude Bernard -Lyon 1 | Sweetening agents |
| FR2579201B1 (fr) * | 1985-03-19 | 1987-05-07 | Bernard Lyon I Universite Clau | Composes chimiques perfectionnes, utilisation comme agents edulcorants et compositions contenant de tels agents |
| FR2579202B1 (fr) * | 1985-03-19 | 1988-04-29 | Univ Claude Bernard Lyon | Nouveaux composes chimiques, utilisation comme agents edulcorants et compositions contenant de tels agents |
| US4746671A (en) * | 1985-11-04 | 1988-05-24 | Janssen Pharmaceutica N.V. | Pharmaceutical use of [[[(3-pyridinyl)methylen]amino]oxy]alkanoic acids and esters |
| US4963573A (en) * | 1985-11-04 | 1990-10-16 | Janssen Pharmaceutica N.V. | [[[(3-pyridinyl)methylen]amino]oxy]alkanoic acids and esters |
| US4895840A (en) * | 1987-06-10 | 1990-01-23 | A. H. Robins Company, Incorporated | N-(aryl-,aryloxy-,arylthio-arylsulfinyl-and arylsulfonyl-)alkyl-N,N'-(or n'n')alkylaminoalkyl ureas and cyanoguanidines |
| GB8722776D0 (en) * | 1987-09-28 | 1987-11-04 | Smith Kline French Lab | Chemical compounds |
| US4900740A (en) * | 1987-10-02 | 1990-02-13 | The Nutrasweet Company | N,N'-disubstituted guanidines containing a carboxyl or a tetrazolyl moiety |
| FR2624699B1 (fr) * | 1987-12-18 | 1990-04-13 | Bernard Lyon I Universite Clau | Derives heterocycliques de n-carbamoyl-, n-thiocarbamoyl- ou n-amidino-glycine ou beta-alanine utiles comme agents edulcorants |
| JPH0662567B2 (ja) * | 1988-12-27 | 1994-08-17 | 麒麟麦酒株式会社 | ピリジンカルボキシイミダミド誘導体、その製造中間体、製造法および用途 |
| US5272164A (en) * | 1988-12-27 | 1993-12-21 | Kirin Beer Kabushiki Kaisha | Carboximidamide derivatives |
| FI95244C (fi) * | 1988-12-27 | 1996-01-10 | Kirin Brewery | Analogiamenetelmä valmistaa lääkeaineina käyttökelpoisia uusia karboksimidiamidijohdannaisia tai niiden farmaseuttisesti sopivia happoadditiosuoloja |
| IE911168A1 (en) * | 1990-04-13 | 1991-10-23 | Takeda Chemical Industries Ltd | Novel intermediates for preparing guanidine derivatives,¹their preparation and use |
| WO1994004499A1 (en) * | 1992-08-13 | 1994-03-03 | The Upjohn Company | Cyanoguanidines as potassium channel blockers |
| DE69323633T2 (de) * | 1993-06-11 | 1999-07-08 | Pharmacia & Upjohn Co., Kalamazoo, Mich. | Pyrimidine-cyanoguanidine als kaliumkanalblocker |
| US6022984A (en) * | 1998-07-27 | 2000-02-08 | Pfizer Inc. | Efficient synthesis of furan sulfonamide compounds useful in the synthesis of new IL-1 inhibitors |
| US7700561B2 (en) * | 2002-02-22 | 2010-04-20 | Shire Llc | Abuse-resistant amphetamine prodrugs |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3128280A (en) * | 1959-10-23 | 1964-04-07 | Searle & Co | 1-(alkoxylated/halogenated phenyl)-3-pyridylmethylureas |
| US3028391A (en) * | 1960-03-30 | 1962-04-03 | Searle & Co | 1-alkyl-3-(alpha-phenyl-4-pyridylmethyl) ureas and thioureas |
| GB1397436A (en) * | 1972-09-05 | 1975-06-11 | Smith Kline French Lab | Heterocyclic n-cyanoguinidines |
| GB1421792A (en) * | 1973-05-17 | 1976-01-21 | Smith Kline French Lab | Heterocyclic substituted-1, 1-diamino-ethylene derivatives methods for their preparation and compositions containing them |
| GB1564502A (en) * | 1975-07-31 | 1980-04-10 | Smith Kline French Lab | Guanidines thioureas and 1,1-diamino-2-nitroethylene derivatives |
| US4156727A (en) * | 1975-07-31 | 1979-05-29 | Smith Kline & French Laboratories Limited | Alkoxy pyridine compounds |
| JPS5444660A (en) * | 1977-08-29 | 1979-04-09 | Yamanouchi Pharmaceut Co Ltd | Heterocyclic compound and its preparation |
| US4287346A (en) | 1979-02-16 | 1981-09-01 | Eisai Co., Ltd. | Cyanoguanidine derivatives |
-
1980
- 1980-02-12 US US06/120,876 patent/US4287346A/en not_active Expired - Lifetime
- 1980-02-12 NL NL8000869A patent/NL8000869A/nl not_active Application Discontinuation
- 1980-02-14 CH CH123280A patent/CH641772A5/de not_active IP Right Cessation
- 1980-02-15 CA CA000345777A patent/CA1145751A/en not_active Expired
- 1980-02-15 IT IT19938/80A patent/IT1141214B/it active
- 1980-02-15 SE SE8001216A patent/SE8001216L/xx not_active Application Discontinuation
- 1980-02-15 DE DE19803005786 patent/DE3005786A1/de not_active Withdrawn
- 1980-02-18 GB GB8005465A patent/GB2046736B/en not_active Expired
- 1980-02-18 FR FR8003470A patent/FR2453155A1/fr active Granted
- 1980-02-18 GB GB08211155A patent/GB2107306B/en not_active Expired
- 1980-08-13 US US06/178,017 patent/US4327217A/en not_active Expired - Lifetime
-
1981
- 1981-04-13 US US06/253,276 patent/US4363921A/en not_active Expired - Fee Related
- 1981-09-15 US US06/302,360 patent/US4396764A/en not_active Expired - Fee Related
-
1982
- 1982-01-28 US US06/344,079 patent/US4426521A/en not_active Expired - Fee Related
-
1984
- 1984-07-26 SE SE8403871A patent/SE8403871D0/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| US4327217A (en) | 1982-04-27 |
| US4287346A (en) | 1981-09-01 |
| US4426521A (en) | 1984-01-17 |
| US4363921A (en) | 1982-12-14 |
| FR2453155A1 (fr) | 1980-10-31 |
| IT1141214B (it) | 1986-10-01 |
| SE8001216L (sv) | 1980-08-17 |
| DE3005786A1 (de) | 1980-08-28 |
| CA1145751A (en) | 1983-05-03 |
| FR2453155B1 (Direct) | 1983-07-08 |
| SE8403871L (sv) | 1984-07-26 |
| CH641772A5 (de) | 1984-03-15 |
| GB2046736B (en) | 1983-05-18 |
| GB2107306B (en) | 1983-09-01 |
| GB2107306A (en) | 1983-04-27 |
| IT8019938A0 (it) | 1980-02-15 |
| GB2046736A (en) | 1980-11-19 |
| US4396764A (en) | 1983-08-02 |
| SE8403871D0 (sv) | 1984-07-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL8000869A (nl) | Cyanoguanidine-derivaten en werkwijze voor de bereiding daarvan. | |
| RU2171252C2 (ru) | Аминосоединение для получения новых производных пиридонкарбоновой кислоты или их солей | |
| NZ248543A (en) | 5-(2-(4-(1,2-benzisothiazol-3-yl)-1-piperazinyl)ethyl)-6-chloro- 1,3-dihydro-2h-indol-2-one, pharmaceutical compositions | |
| EP0049173B1 (en) | Pyrimidone derivatives, processes for their preparation and pharmaceutical derivatives containing them | |
| CN110590749B (zh) | 吡啶胺基嘧啶衍生物甲磺酸盐的结晶形式及其制备和应用 | |
| HUT58275A (en) | Process for producing amines and pharmaceutical compositions containing them | |
| US4287338A (en) | Sulfooxy-pyrimidinium, -pyridinium, and -triazinium hydroxide inner salts | |
| KR20020025217A (ko) | 토르세미드 동질이상 | |
| KR20060035636A (ko) | 신규한 결정형의 페린도프릴 에르부민 | |
| RU94040854A (ru) | Триазолопиримидиновые производные как антагонисты рецепторов ангиотензина 11, способ их получения, фармацевтическая композиция | |
| US4463008A (en) | 2-Alkoxy-5-(pyridinyl)pyridines and cardiotonic use thereof | |
| DK169520B1 (da) | 5-fluoruracilderivater, fremgangsmåde til deres fremstilling, anticancerpræparat indeholdende et sådant derivat og anvendelse af et sådant derivat til fremstilling af et præparat til behandling af cancer | |
| US3818050A (en) | Process for the manufacture of dimethylmaleic anhydride | |
| EP0034495B1 (en) | Hypoglycemic guanylamidines, processes for their preparation, and pharmaceutical compositions containing them | |
| Das et al. | Palladium-catalysed synthesis of some biologically active 5, 6-disubstituted uracils | |
| JP4723090B2 (ja) | ヘテロ芳香族アルデヒド類の製造方法 | |
| US2786846A (en) | Process of alkylating pyridines | |
| JP4161119B2 (ja) | アルキルピリジンの酸化アンモノリシス | |
| IE33470B1 (en) | Process for preparing 1-azacyclo-4-imino-1,4-dihydro-pyridines and product | |
| US4363911A (en) | 1,2-Dihydro-6-[2-(dimethylamino)ethenyl]-2-oxo-5-(pyridinyl) nicotinonitriles | |
| JPH07215924A (ja) | ピバロイルヒドラジドの製造 | |
| US4361569A (en) | 3-(Hydroxy or hydroxymethyl)-6-methyl-5-(4-pyridinyl)-2(1H)-pyridinone and cardiotonic use thereof | |
| EP0415498A2 (en) | Fluorination with hydrogen fluoride | |
| Selvakumar et al. | Synthesis of non-glutamate-type pyrrolo [2, 3-d] pyrimidines via direct aminocarbonylation of aryl halides using solid Co2 (CO) 8 as a CO source and their antibacterial activity | |
| Shvekhgeimer et al. | Halogen-substituted pyridines. 3. Cyclization of adducts of α, α-dichloropropionitrile with acrylic derivatives to chloropyridines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A85 | Still pending on 85-01-01 | ||
| BV | The patent application has lapsed |