MXPA05001992A

MXPA05001992A - Expansion ex-vivo de poblaciones de celulas de tallo, hematopoyeticas, en cultivos de celulas mononucleares.

Expansion ex-vivo de poblaciones de celulas de tallo, hematopoyeticas, en cultivos de celulas mononucleares.

Info

Publication number: MXPA05001992A
Authority: MX; Mexico
Prior art keywords: cells; hematopoietic; mononuclear cells; nicotinamide; stem cells
Prior art date: 2002-08-19

Application number

MXPA05001992A

Other languages

English (en)

Spanish (es)

Inventor

Oren Rosen

Original Assignee

Gamida Cell Ltd

Priority date

2002-08-19

Filing date

2003-08-17

Publication date

2005-08-03

2002-11-17 Priority claimed from IL15290402A external-priority patent/IL152904A0/xx

2003-01-23 Priority claimed from PCT/IL2003/000062 external-priority patent/WO2003062404A1/en

2003-08-17 Application filed by Gamida Cell Ltd filed Critical Gamida Cell Ltd

2005-08-03 Publication of MXPA05001992A publication Critical patent/MXPA05001992A/es

Links

210000005087 mononuclear cell Anatomy 0.000 title claims abstract description 249
210000003958 hematopoietic stem cell Anatomy 0.000 title claims abstract description 245
238000004113 cell culture Methods 0.000 title description 8
210000004027 cell Anatomy 0.000 claims abstract description 368
230000003394 haemopoietic effect Effects 0.000 claims abstract description 322
210000000130 stem cell Anatomy 0.000 claims abstract description 194
238000000034 method Methods 0.000 claims abstract description 173
-1 nicotinatioamide Chemical compound 0.000 claims description 134
230000014509 gene expression Effects 0.000 claims description 97
239000003795 chemical substances by application Substances 0.000 claims description 96
230000004069 differentiation Effects 0.000 claims description 94
DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical class NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 claims description 91
102100031585 ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1 Human genes 0.000 claims description 85
101000777636 Homo sapiens ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1 Proteins 0.000 claims description 85
108090000623 proteins and genes Proteins 0.000 claims description 83
239000010949 copper Substances 0.000 claims description 75
230000000694 effects Effects 0.000 claims description 75
150000005480 nicotinamides Chemical class 0.000 claims description 73
229910052802 copper Inorganic materials 0.000 claims description 72
RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 71
239000002738 chelating agent Substances 0.000 claims description 70
230000001010 compromised effect Effects 0.000 claims description 57
102000039446 nucleic acids Human genes 0.000 claims description 51
108020004707 nucleic acids Proteins 0.000 claims description 51
150000007523 nucleic acids Chemical class 0.000 claims description 51
230000004663 cell proliferation Effects 0.000 claims description 47
235000005152 nicotinamide Nutrition 0.000 claims description 47
238000011124 ex vivo culture Methods 0.000 claims description 46
229960003966 nicotinamide Drugs 0.000 claims description 46
239000011570 nicotinamide Substances 0.000 claims description 46
102000004127 Cytokines Human genes 0.000 claims description 42
108090000695 Cytokines Proteins 0.000 claims description 42
239000013522 chelant Substances 0.000 claims description 38
102000003702 retinoic acid receptors Human genes 0.000 claims description 36
108090000064 retinoic acid receptors Proteins 0.000 claims description 36
108090000430 Phosphatidylinositol 3-kinases Proteins 0.000 claims description 35
102000003993 Phosphatidylinositol 3-kinases Human genes 0.000 claims description 35
239000005557 antagonist Substances 0.000 claims description 30
102000009310 vitamin D receptors Human genes 0.000 claims description 30
108050000156 vitamin D receptors Proteins 0.000 claims description 30
102000040430 polynucleotide Human genes 0.000 claims description 27
108091033319 polynucleotide Proteins 0.000 claims description 27
239000002157 polynucleotide Substances 0.000 claims description 27
102000005962 receptors Human genes 0.000 claims description 27
108020003175 receptors Proteins 0.000 claims description 25
239000011710 vitamin D Substances 0.000 claims description 25
229940046008 vitamin d Drugs 0.000 claims description 25
230000019491 signal transduction Effects 0.000 claims description 24
102000034527 Retinoid X Receptors Human genes 0.000 claims description 23
108010038912 Retinoid X Receptors Proteins 0.000 claims description 23
229930003316 Vitamin D Natural products 0.000 claims description 23
QYSXJUFSXHHAJI-XFEUOLMDSA-N Vitamin D3 Natural products C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)CCCC(C)C)=C/C=C1\C[C@@H](O)CCC1=C QYSXJUFSXHHAJI-XFEUOLMDSA-N 0.000 claims description 23
235000019166 vitamin D Nutrition 0.000 claims description 23
150000003710 vitamin D derivatives Chemical class 0.000 claims description 23
239000013598 vector Substances 0.000 claims description 21
239000002207 metabolite Substances 0.000 claims description 20
238000002360 preparation method Methods 0.000 claims description 20
DFPAKSUCGFBDDF-ZQBYOMGUSA-N [14c]-nicotinamide Chemical compound N[14C](=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-ZQBYOMGUSA-N 0.000 claims description 19
238000012258 culturing Methods 0.000 claims description 18
229930002330 retinoic acid Natural products 0.000 claims description 18
229960001727 tretinoin Drugs 0.000 claims description 18
230000001965 increasing effect Effects 0.000 claims description 17
210000001185 bone marrow Anatomy 0.000 claims description 16
229940044551 receptor antagonist Drugs 0.000 claims description 16
239000002464 receptor antagonist Substances 0.000 claims description 16
230000024245 cell differentiation Effects 0.000 claims description 15
210000004700 fetal blood Anatomy 0.000 claims description 15
229940122756 Retinoic acid receptor antagonist Drugs 0.000 claims description 14
108091027757 Deoxyribozyme Proteins 0.000 claims description 13
230000000692 anti-sense effect Effects 0.000 claims description 12
230000002222 downregulating effect Effects 0.000 claims description 12
210000005259 peripheral blood Anatomy 0.000 claims description 12
239000011886 peripheral blood Substances 0.000 claims description 12
238000003556 assay Methods 0.000 claims description 11
239000003937 drug carrier Substances 0.000 claims description 11
230000003834 intracellular effect Effects 0.000 claims description 11
230000000644 propagated effect Effects 0.000 claims description 11
229910052723 transition metal Inorganic materials 0.000 claims description 11
150000003624 transition metals Chemical class 0.000 claims description 11
239000013603 viral vector Substances 0.000 claims description 11
229940116327 Retinoid X receptor antagonist Drugs 0.000 claims description 10
102000036693 Thrombopoietin Human genes 0.000 claims description 10
108010041111 Thrombopoietin Proteins 0.000 claims description 10
108090001005 Interleukin-6 Proteins 0.000 claims description 9
102000004889 Interleukin-6 Human genes 0.000 claims description 9
229940100601 interleukin-6 Drugs 0.000 claims description 9
230000000638 stimulation Effects 0.000 claims description 9
KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 8
PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 claims description 8
238000009169 immunotherapy Methods 0.000 claims description 8
150000004492 retinoid derivatives Chemical class 0.000 claims description 8
230000015556 catabolic process Effects 0.000 claims description 7
150000001875 compounds Chemical class 0.000 claims description 7
238000006731 degradation reaction Methods 0.000 claims description 7
230000009368 gene silencing by RNA Effects 0.000 claims description 7
210000003714 granulocyte Anatomy 0.000 claims description 7
102000053642 Catalytic RNA Human genes 0.000 claims description 6
108090000994 Catalytic RNA Proteins 0.000 claims description 6
102000000646 Interleukin-3 Human genes 0.000 claims description 6
108010002386 Interleukin-3 Proteins 0.000 claims description 6
230000010261 cell growth Effects 0.000 claims description 6
230000002401 inhibitory effect Effects 0.000 claims description 6
210000002540 macrophage Anatomy 0.000 claims description 6
235000015097 nutrients Nutrition 0.000 claims description 6
108091092562 ribozyme Proteins 0.000 claims description 6
230000003247 decreasing effect Effects 0.000 claims description 5
108010002350 Interleukin-2 Proteins 0.000 claims description 4
102000000588 Interleukin-2 Human genes 0.000 claims description 4
230000003167 anti-vitamin Effects 0.000 claims description 4
108700014844 flt3 ligand Proteins 0.000 claims description 4
238000012239 gene modification Methods 0.000 claims description 4
230000005017 genetic modification Effects 0.000 claims description 4
235000013617 genetically modified food Nutrition 0.000 claims description 4
230000005764 inhibitory process Effects 0.000 claims description 4
229940076264 interleukin-3 Drugs 0.000 claims description 4
108020004999 messenger RNA Proteins 0.000 claims description 4
QDLHCMPXEPAAMD-QAIWCSMKSA-N wortmannin Chemical compound C1([C@]2(C)C3=C(C4=O)OC=C3C(=O)O[C@@H]2COC)=C4[C@@H]2CCC(=O)[C@@]2(C)C[C@H]1OC(C)=O QDLHCMPXEPAAMD-QAIWCSMKSA-N 0.000 claims description 4
102000003951 Erythropoietin Human genes 0.000 claims description 3
108090000394 Erythropoietin Proteins 0.000 claims description 3
102000000589 Interleukin-1 Human genes 0.000 claims description 3
108010002352 Interleukin-1 Proteins 0.000 claims description 3
102000003814 Interleukin-10 Human genes 0.000 claims description 3
108090000174 Interleukin-10 Proteins 0.000 claims description 3
102000013462 Interleukin-12 Human genes 0.000 claims description 3
108010065805 Interleukin-12 Proteins 0.000 claims description 3
102000005789 Vascular Endothelial Growth Factors Human genes 0.000 claims description 3
108010019530 Vascular Endothelial Growth Factors Proteins 0.000 claims description 3
229940105423 erythropoietin Drugs 0.000 claims description 3
210000003494 hepatocyte Anatomy 0.000 claims description 3
229940076144 interleukin-10 Drugs 0.000 claims description 3
229940117681 interleukin-12 Drugs 0.000 claims description 3
229960003512 nicotinic acid Drugs 0.000 claims description 3
235000001968 nicotinic acid Nutrition 0.000 claims description 3
239000011664 nicotinic acid Substances 0.000 claims description 3
OXCMYAYHXIHQOA-UHFFFAOYSA-N potassium;[2-butyl-5-chloro-3-[[4-[2-(1,2,4-triaza-3-azanidacyclopenta-1,4-dien-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol Chemical compound [K+].CCCCC1=NC(Cl)=C(CO)N1CC1=CC=C(C=2C(=CC=CC=2)C2=N[N-]N=N2)C=C1 OXCMYAYHXIHQOA-UHFFFAOYSA-N 0.000 claims description 3
206010054094 Tumour necrosis Diseases 0.000 claims description 2
230000006698 induction Effects 0.000 claims description 2
SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 claims 6
108091030071 RNAI Proteins 0.000 claims 1
230000003292 diminished effect Effects 0.000 claims 1
239000003102 growth factor Substances 0.000 claims 1
102100031573 Hematopoietic progenitor cell antigen CD34 Human genes 0.000 description 114
101000777663 Homo sapiens Hematopoietic progenitor cell antigen CD34 Proteins 0.000 description 114
229920000768 polyamine Polymers 0.000 description 69
125000002947 alkylene group Chemical group 0.000 description 57
125000000217 alkyl group Chemical group 0.000 description 48
108091034117 Oligonucleotide Proteins 0.000 description 41
125000004432 carbon atom Chemical group C* 0.000 description 40
239000000047 product Substances 0.000 description 40
239000002253 acid Substances 0.000 description 36
125000003118 aryl group Chemical group 0.000 description 36
210000004369 blood Anatomy 0.000 description 30
239000008280 blood Substances 0.000 description 29
108020004414 DNA Proteins 0.000 description 27
125000004122 cyclic group Chemical group 0.000 description 27
230000007774 longterm Effects 0.000 description 26
WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 25
JLCPHMBAVCMARE-UHFFFAOYSA-N [3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl [5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate Polymers Cc1cn(C2CC(OP(O)(=O)OCC3OC(CC3OP(O)(=O)OCC3OC(CC3O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c3nc(N)[nH]c4=O)C(COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3CO)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cc(C)c(=O)[nH]c3=O)n3cc(C)c(=O)[nH]c3=O)n3ccc(N)nc3=O)n3cc(C)c(=O)[nH]c3=O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)O2)c(=O)[nH]c1=O JLCPHMBAVCMARE-UHFFFAOYSA-N 0.000 description 22
230000001105 regulatory effect Effects 0.000 description 22
238000002054 transplantation Methods 0.000 description 21
XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 20
102000004169 proteins and genes Human genes 0.000 description 20
108091032973 (ribonucleotides)n+m Proteins 0.000 description 19
125000003277 amino group Chemical group 0.000 description 19
125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 18
125000000753 cycloalkyl group Chemical group 0.000 description 18
239000012634 fragment Substances 0.000 description 18
238000000338 in vitro Methods 0.000 description 18
238000001727 in vivo Methods 0.000 description 18
108090000765 processed proteins & peptides Proteins 0.000 description 18
239000002585 base Substances 0.000 description 17
238000001415 gene therapy Methods 0.000 description 16
125000001072 heteroaryl group Chemical group 0.000 description 16
125000005842 heteroatom Chemical group 0.000 description 16
230000035755 proliferation Effects 0.000 description 16
125000001424 substituent group Chemical group 0.000 description 15
229910052717 sulfur Inorganic materials 0.000 description 15
239000005711 Benzoic acid Substances 0.000 description 14
OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 14
239000002935 phosphatidylinositol 3 kinase inhibitor Substances 0.000 description 14
150000001412 amines Chemical class 0.000 description 13
108091007433 antigens Proteins 0.000 description 13
102000036639 antigens Human genes 0.000 description 13
235000010233 benzoic acid Nutrition 0.000 description 13
229910052799 carbon Inorganic materials 0.000 description 13
230000001404 mediated effect Effects 0.000 description 13
RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
229940116355 PI3 kinase inhibitor Drugs 0.000 description 12
SHGAZHPCJJPHSC-NWVFGJFESA-N Tretinoin Chemical compound OC(=O)/C=C(\C)/C=C/C=C(C)C=CC1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-NWVFGJFESA-N 0.000 description 12
UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 12
239000003112 inhibitor Substances 0.000 description 12
230000004048 modification Effects 0.000 description 12
238000012986 modification Methods 0.000 description 12
230000009467 reduction Effects 0.000 description 12
UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 12
JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 11
239000000427 antigen Substances 0.000 description 11
150000002430 hydrocarbons Chemical group 0.000 description 11
239000001257 hydrogen Substances 0.000 description 11
229910052739 hydrogen Inorganic materials 0.000 description 11
125000005647 linker group Chemical group 0.000 description 11
230000008569 process Effects 0.000 description 11
238000001890 transfection Methods 0.000 description 11
150000001721 carbon Chemical group 0.000 description 10
230000001413 cellular effect Effects 0.000 description 10
229910001431 copper ion Inorganic materials 0.000 description 10
OPTASPLRGRRNAP-UHFFFAOYSA-N cytosine Chemical compound NC=1C=CNC(=O)N=1 OPTASPLRGRRNAP-UHFFFAOYSA-N 0.000 description 10
125000004435 hydrogen atom Chemical class [H]* 0.000 description 10
239000003446 ligand Substances 0.000 description 10
125000004430 oxygen atom Chemical group O* 0.000 description 10
125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 10
108091008679 retinoid hormone receptors Proteins 0.000 description 10
125000004434 sulfur atom Chemical group 0.000 description 10
125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 10
238000011282 treatment Methods 0.000 description 10
230000003612 virological effect Effects 0.000 description 10
BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 9
241000700605 Viruses Species 0.000 description 9
150000001408 amides Chemical class 0.000 description 9
150000001413 amino acids Chemical class 0.000 description 9
230000002950 deficient Effects 0.000 description 9
238000005516 engineering process Methods 0.000 description 9
238000004519 manufacturing process Methods 0.000 description 9
102000004196 processed proteins & peptides Human genes 0.000 description 9
230000001177 retroviral effect Effects 0.000 description 9
230000011664 signaling Effects 0.000 description 9
125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 9
125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 9
108060003951 Immunoglobulin Proteins 0.000 description 8
125000003545 alkoxy group Chemical group 0.000 description 8
125000004104 aryloxy group Chemical group 0.000 description 8
125000005843 halogen group Chemical group 0.000 description 8
125000002887 hydroxy group Chemical group [H]O* 0.000 description 8
102000018358 immunoglobulin Human genes 0.000 description 8
102000027483 retinoid hormone receptors Human genes 0.000 description 8
125000005190 thiohydroxy group Chemical group 0.000 description 8
125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 8
102000008394 Immunoglobulin Fragments Human genes 0.000 description 7
108010021625 Immunoglobulin Fragments Proteins 0.000 description 7
206010028980 Neoplasm Diseases 0.000 description 7
150000004660 O-thiocarbamates Chemical class 0.000 description 7
230000015572 biosynthetic process Effects 0.000 description 7
210000000601 blood cell Anatomy 0.000 description 7
239000004202 carbamide Substances 0.000 description 7
125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 7
VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
125000002950 monocyclic group Chemical group 0.000 description 7
125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 7
238000000746 purification Methods 0.000 description 7
229940124530 sulfonamide Drugs 0.000 description 7
150000003568 thioethers Chemical class 0.000 description 7
KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 6
CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 6
IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
229940126634 CD38 inhibitor Drugs 0.000 description 6
VJQALSOBHVEJQM-UHFFFAOYSA-N COCCOC1CCC(CC1)Nc1cc(=O)n(C)c2ccc(cc12)-c1cncs1 Chemical compound COCCOC1CCC(CC1)Nc1cc(=O)n(C)c2ccc(cc12)-c1cncs1 VJQALSOBHVEJQM-UHFFFAOYSA-N 0.000 description 6
XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 6
RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 6
XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 6
238000012228 RNA interference-mediated gene silencing Methods 0.000 description 6
108700019146 Transgenes Proteins 0.000 description 6
238000004458 analytical method Methods 0.000 description 6
125000004429 atom Chemical group 0.000 description 6
229910000085 borane Inorganic materials 0.000 description 6
125000004093 cyano group Chemical group *C#N 0.000 description 6
239000012990 dithiocarbamate Substances 0.000 description 6
UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 description 6
230000011132 hemopoiesis Effects 0.000 description 6
DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 6
125000000623 heterocyclic group Chemical group 0.000 description 6
WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 6
RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
230000001939 inductive effect Effects 0.000 description 6
230000000670 limiting effect Effects 0.000 description 6
239000002609 medium Substances 0.000 description 6
125000005328 phosphinyl group Chemical group [PH2](=O)* 0.000 description 6
XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 6
125000005499 phosphonyl group Chemical group 0.000 description 6
BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 6
125000004469 siloxy group Chemical group [SiH3]O* 0.000 description 6
MDDUHVRJJAFRAU-YZNNVMRBSA-N tert-butyl-[(1r,3s,5z)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-diphenylphosphorylethylidene)-4-methylidenecyclohexyl]oxy-dimethylsilane Chemical compound C1[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C(=C)\C1=C/CP(=O)(C=1C=CC=CC=1)C1=CC=CC=C1 MDDUHVRJJAFRAU-YZNNVMRBSA-N 0.000 description 6
125000005309 thioalkoxy group Chemical group 0.000 description 6
125000005296 thioaryloxy group Chemical group 0.000 description 6
210000001519 tissue Anatomy 0.000 description 6
IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 6
241000701161 unidentified adenovirus Species 0.000 description 6
241001430294 unidentified retrovirus Species 0.000 description 6
VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 5
QADGBOQVBUXZKO-UHFFFAOYSA-N 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)benzoic acid Chemical compound CC1=CC(C(CCC2(C)C)(C)C)=C2C=C1C(=O)C1=CC=C(C(O)=O)C=C1 QADGBOQVBUXZKO-UHFFFAOYSA-N 0.000 description 5
OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
229920002307 Dextran Polymers 0.000 description 5
238000012413 Fluorescence activated cell sorting analysis Methods 0.000 description 5
241001465754 Metazoa Species 0.000 description 5
102000057297 Pepsin A Human genes 0.000 description 5
108090000284 Pepsin A Proteins 0.000 description 5
XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Natural products P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 5
150000001336 alkenes Chemical class 0.000 description 5
201000011510 cancer Diseases 0.000 description 5
239000006143 cell culture medium Substances 0.000 description 5
238000003776 cleavage reaction Methods 0.000 description 5
230000001186 cumulative effect Effects 0.000 description 5
229940104302 cytosine Drugs 0.000 description 5
239000003814 drug Substances 0.000 description 5
150000002148 esters Chemical class 0.000 description 5
238000001476 gene delivery Methods 0.000 description 5
239000002502 liposome Substances 0.000 description 5
239000000463 material Substances 0.000 description 5
229910000073 phosphorus hydride Inorganic materials 0.000 description 5
230000010076 replication Effects 0.000 description 5
230000007017 scission Effects 0.000 description 5
238000003786 synthesis reaction Methods 0.000 description 5
FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 5
RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 5
229960001124 trientine Drugs 0.000 description 5
229910052727 yttrium Inorganic materials 0.000 description 5
FZWGECJQACGGTI-UHFFFAOYSA-N 2-amino-7-methyl-1,7-dihydro-6H-purin-6-one Chemical compound NC1=NC(O)=C2N(C)C=NC2=N1 FZWGECJQACGGTI-UHFFFAOYSA-N 0.000 description 4
LHUPKWKWYWOMSK-UHFFFAOYSA-N 4-[2-[4-(4-ethylphenyl)-2,2-dimethylthiochromen-6-yl]ethynyl]benzoic acid Chemical compound C1=CC(CC)=CC=C1C1=CC(C)(C)SC2=CC=C(C#CC=3C=CC(=CC=3)C(O)=O)C=C12 LHUPKWKWYWOMSK-UHFFFAOYSA-N 0.000 description 4
IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 4
QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
108091003079 Bovine Serum Albumin Proteins 0.000 description 4
BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 4
IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 4
PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
229910019142 PO4 Inorganic materials 0.000 description 4
KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 4
SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
108020004459 Small interfering RNA Proteins 0.000 description 4
NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 4
210000001744 T-lymphocyte Anatomy 0.000 description 4
YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 4
SPARTCPUGRJFRS-PBDCIXLPSA-N ZK 159222 Chemical compound CCCCOC(=O)C1([C@H](O)\C=C\[C@@H](C)[C@@H]2[C@]3(CCCC(/[C@@H]3CC2)=C\C=C\2C([C@@H](O)C[C@H](O)C/2)=C)C)CC1 SPARTCPUGRJFRS-PBDCIXLPSA-N 0.000 description 4
HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 4
ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical compound C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 description 4
125000003342 alkenyl group Chemical group 0.000 description 4
125000002877 alkyl aryl group Chemical group 0.000 description 4
125000000304 alkynyl group Chemical group 0.000 description 4
125000000751 azo group Chemical group [*]N=N[*] 0.000 description 4
230000008901 benefit Effects 0.000 description 4
230000033228 biological regulation Effects 0.000 description 4
DKSMCEUSSQTGBK-UHFFFAOYSA-M bromite Chemical compound [O-]Br=O DKSMCEUSSQTGBK-UHFFFAOYSA-M 0.000 description 4
239000011203 carbon fibre reinforced carbon Substances 0.000 description 4
230000003197 catalytic effect Effects 0.000 description 4
238000002512 chemotherapy Methods 0.000 description 4
210000004748 cultured cell Anatomy 0.000 description 4
MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 4
LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 4
230000002255 enzymatic effect Effects 0.000 description 4
238000002474 experimental method Methods 0.000 description 4
210000004524 haematopoietic cell Anatomy 0.000 description 4
125000005446 heptyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 4
JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Chemical compound Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 4
150000002466 imines Chemical class 0.000 description 4
230000000977 initiatory effect Effects 0.000 description 4
NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 4
238000002955 isolation Methods 0.000 description 4
AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 4
210000000265 leukocyte Anatomy 0.000 description 4
210000004698 lymphocyte Anatomy 0.000 description 4
239000000203 mixture Substances 0.000 description 4
229910052757 nitrogen Inorganic materials 0.000 description 4
229910052760 oxygen Inorganic materials 0.000 description 4
229940111202 pepsin Drugs 0.000 description 4
125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
239000010452 phosphate Substances 0.000 description 4
NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 4
239000002953 phosphate buffered saline Substances 0.000 description 4
229920001184 polypeptide Polymers 0.000 description 4
239000002243 precursor Substances 0.000 description 4
230000002035 prolonged effect Effects 0.000 description 4
230000002441 reversible effect Effects 0.000 description 4
238000012552 review Methods 0.000 description 4
150000003456 sulfonamides Chemical class 0.000 description 4
239000011593 sulfur Substances 0.000 description 4
150000007970 thio esters Chemical class 0.000 description 4
238000012546 transfer Methods 0.000 description 4
229910052725 zinc Inorganic materials 0.000 description 4
239000011701 zinc Substances 0.000 description 4
MVEZDCCYKRPTNZ-NBNZOSCDSA-N (2e,4e)-5-[2-(2-butoxy-3,5-ditert-butylphenyl)cyclopropyl]-3-methylpenta-2,4-dienoic acid Chemical compound C1=C(C(C)(C)C)C=C(C(C)(C)C)C(OCCCC)=C1C1C(\C=C\C(\C)=C\C(O)=O)C1 MVEZDCCYKRPTNZ-NBNZOSCDSA-N 0.000 description 3
125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 3
125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 3
BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 3
KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
206010009944 Colon cancer Diseases 0.000 description 3
FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 3
RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 3
LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 3
PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
108010017080 Granulocyte Colony-Stimulating Factor Proteins 0.000 description 3
102000004269 Granulocyte Colony-Stimulating Factor Human genes 0.000 description 3
108010017213 Granulocyte-Macrophage Colony-Stimulating Factor Proteins 0.000 description 3
102100039620 Granulocyte-macrophage colony-stimulating factor Human genes 0.000 description 3
241000282412 Homo Species 0.000 description 3
IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 3
NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 3
ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 3
239000004952 Polyamide Substances 0.000 description 3
102000001253 Protein Kinase Human genes 0.000 description 3
108700008625 Reporter Genes Proteins 0.000 description 3
QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 3
ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 3
ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 3
125000004450 alkenylene group Chemical group 0.000 description 3
125000003282 alkyl amino group Chemical group 0.000 description 3
125000005360 alkyl sulfoxide group Chemical group 0.000 description 3
125000004419 alkynylene group Chemical group 0.000 description 3
230000000735 allogeneic effect Effects 0.000 description 3
HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 3
LHIJANUOQQMGNT-UHFFFAOYSA-N aminoethylethanolamine Chemical compound NCCNCCO LHIJANUOQQMGNT-UHFFFAOYSA-N 0.000 description 3
125000001769 aryl amino group Chemical group 0.000 description 3
125000005361 aryl sulfoxide group Chemical group 0.000 description 3
229940072107 ascorbate Drugs 0.000 description 3
235000010323 ascorbic acid Nutrition 0.000 description 3
239000011668 ascorbic acid Substances 0.000 description 3
QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 3
125000001246 bromo group Chemical group Br* 0.000 description 3
GMRQFYUYWCNGIN-NKMMMXOESA-N calcitriol Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@@H](CCCC(C)(C)O)C)=C\C=C1\C[C@@H](O)C[C@H](O)C1=C GMRQFYUYWCNGIN-NKMMMXOESA-N 0.000 description 3
150000001720 carbohydrates Chemical class 0.000 description 3
150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
230000032823 cell division Effects 0.000 description 3
229910001919 chlorite Inorganic materials 0.000 description 3
229910052619 chlorite group Inorganic materials 0.000 description 3
QBWCMBCROVPCKQ-UHFFFAOYSA-N chlorous acid Chemical compound OCl=O QBWCMBCROVPCKQ-UHFFFAOYSA-N 0.000 description 3
238000010367 cloning Methods 0.000 description 3
230000001332 colony forming effect Effects 0.000 description 3
230000000295 complement effect Effects 0.000 description 3
XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 3
125000002993 cycloalkylene group Chemical group 0.000 description 3
210000004443 dendritic cell Anatomy 0.000 description 3
NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 3
229940079593 drug Drugs 0.000 description 3
238000004520 electroporation Methods 0.000 description 3
210000002308 embryonic cell Anatomy 0.000 description 3
125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 3
239000013604 expression vector Substances 0.000 description 3
238000001943 fluorescence-activated cell sorting Methods 0.000 description 3
230000002068 genetic effect Effects 0.000 description 3
238000003306 harvesting Methods 0.000 description 3
125000005241 heteroarylamino group Chemical group 0.000 description 3
AXEYWFGSQDLHDX-UHFFFAOYSA-N hexane-1,3,6-triamine Chemical compound NCCCC(N)CCN AXEYWFGSQDLHDX-UHFFFAOYSA-N 0.000 description 3
ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 3
239000007943 implant Substances 0.000 description 3
230000002452 interceptive effect Effects 0.000 description 3
ICIWUVCWSCSTAQ-UHFFFAOYSA-M iodate Chemical compound [O-]I(=O)=O ICIWUVCWSCSTAQ-UHFFFAOYSA-M 0.000 description 3
239000012948 isocyanate Substances 0.000 description 3
150000002513 isocyanates Chemical class 0.000 description 3
150000002540 isothiocyanates Chemical class 0.000 description 3
208000032839 leukemia Diseases 0.000 description 3
210000004185 liver Anatomy 0.000 description 3
238000010369 molecular cloning Methods 0.000 description 3
230000000877 morphologic effect Effects 0.000 description 3
LSHROXHEILXKHM-UHFFFAOYSA-N n'-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]ethane-1,2-diamine Chemical compound NCCNCCNCCNCCNCCN LSHROXHEILXKHM-UHFFFAOYSA-N 0.000 description 3
239000002777 nucleoside Substances 0.000 description 3
150000003833 nucleoside derivatives Chemical group 0.000 description 3
239000001301 oxygen Substances 0.000 description 3
VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 3
VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 3
239000012071 phase Substances 0.000 description 3
239000013612 plasmid Substances 0.000 description 3
229910052697 platinum Inorganic materials 0.000 description 3
210000001778 pluripotent stem cell Anatomy 0.000 description 3
229920002647 polyamide Polymers 0.000 description 3
239000013641 positive control Substances 0.000 description 3
239000002244 precipitate Substances 0.000 description 3
238000003793 prenatal diagnosis Methods 0.000 description 3
238000012545 processing Methods 0.000 description 3
125000004368 propenyl group Chemical group C(=CC)* 0.000 description 3
108060006633 protein kinase Proteins 0.000 description 3
238000011084 recovery Methods 0.000 description 3
229960001860 salicylate Drugs 0.000 description 3
YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 3
238000000926 separation method Methods 0.000 description 3
239000000243 solution Substances 0.000 description 3
238000010561 standard procedure Methods 0.000 description 3
239000000758 substrate Substances 0.000 description 3
KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 3
BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 3
DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 3
230000001225 therapeutic effect Effects 0.000 description 3
238000002560 therapeutic procedure Methods 0.000 description 3
238000013518 transcription Methods 0.000 description 3
230000035897 transcription Effects 0.000 description 3
210000004881 tumor cell Anatomy 0.000 description 3
229940035893 uracil Drugs 0.000 description 3
239000003981 vehicle Substances 0.000 description 3
LJRDOKAZOAKLDU-UDXJMMFXSA-N (2s,3s,4r,5r,6r)-5-amino-2-(aminomethyl)-6-[(2r,3s,4r,5s)-5-[(1r,2r,3s,5r,6s)-3,5-diamino-2-[(2s,3r,4r,5s,6r)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-hydroxycyclohexyl]oxy-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxyoxane-3,4-diol;sulfuric ac Chemical compound OS(O)(=O)=O.N[C@@H]1[C@@H](O)[C@H](O)[C@H](CN)O[C@@H]1O[C@H]1[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](N)C[C@@H](N)[C@@H]2O)O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)N)O[C@@H]1CO LJRDOKAZOAKLDU-UDXJMMFXSA-N 0.000 description 2
102000040650 (ribonucleotides)n+m Human genes 0.000 description 2
GMRQFYUYWCNGIN-UHFFFAOYSA-N 1,25-Dihydroxy-vitamin D3' Natural products C1CCC2(C)C(C(CCCC(C)(C)O)C)CCC2C1=CC=C1CC(O)CC(O)C1=C GMRQFYUYWCNGIN-UHFFFAOYSA-N 0.000 description 2
QBPPRVHXOZRESW-UHFFFAOYSA-N 1,4,7,10-tetraazacyclododecane Chemical compound C1CNCCNCCNCCN1 QBPPRVHXOZRESW-UHFFFAOYSA-N 0.000 description 2
ITWBWJFEJCHKSN-UHFFFAOYSA-N 1,4,7-triazonane Chemical compound C1CNCCNCCN1 ITWBWJFEJCHKSN-UHFFFAOYSA-N 0.000 description 2
MDAXKAUIABOHTD-UHFFFAOYSA-N 1,4,8,11-tetraazacyclotetradecane Chemical compound C1CNCCNCCCNCCNC1 MDAXKAUIABOHTD-UHFFFAOYSA-N 0.000 description 2
KUFDRRWNPNXBRF-UHFFFAOYSA-N 1,4,8,12-tetrazacyclopentadecane Chemical compound C1CNCCCNCCNCCCNC1 KUFDRRWNPNXBRF-UHFFFAOYSA-N 0.000 description 2
KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
OYIFNHCXNCRBQI-UHFFFAOYSA-N 2-aminoadipic acid Chemical compound OC(=O)C(N)CCCC(O)=O OYIFNHCXNCRBQI-UHFFFAOYSA-N 0.000 description 2
QIPXHRQAYOQRDT-UHFFFAOYSA-N 3-methylocta-2,4,6-trienoic acid Chemical compound CC=CC=CC(C)=CC(O)=O QIPXHRQAYOQRDT-UHFFFAOYSA-N 0.000 description 2
SZWKGOZKRMMLAJ-UHFFFAOYSA-N 4-{[(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)carbonyl]amino}benzoic acid Chemical compound C=1C=C2C(C)(C)CCC(C)(C)C2=CC=1C(=O)NC1=CC=C(C(O)=O)C=C1 SZWKGOZKRMMLAJ-UHFFFAOYSA-N 0.000 description 2
RYVNIFSIEDRLSJ-UHFFFAOYSA-N 5-(hydroxymethyl)cytosine Chemical compound NC=1NC(=O)N=CC=1CO RYVNIFSIEDRLSJ-UHFFFAOYSA-N 0.000 description 2
LRSASMSXMSNRBT-UHFFFAOYSA-N 5-methylcytosine Chemical compound CC1=CNC(=O)N=C1N LRSASMSXMSNRBT-UHFFFAOYSA-N 0.000 description 2
UJBCLAXPPIDQEE-UHFFFAOYSA-N 5-prop-1-ynyl-1h-pyrimidine-2,4-dione Chemical compound CC#CC1=CNC(=O)NC1=O UJBCLAXPPIDQEE-UHFFFAOYSA-N 0.000 description 2
SLXTWXQUEZSSTJ-UHFFFAOYSA-N 6-[1-(3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydronaphthalen-2-yl)cyclopropyl]pyridine-3-carboxylic acid Chemical compound CC1=CC(C(CCC2(C)C)(C)C)=C2C=C1C1(C=2N=CC(=CC=2)C(O)=O)CC1 SLXTWXQUEZSSTJ-UHFFFAOYSA-N 0.000 description 2
BLDKYBCSARSGBR-UHFFFAOYSA-N 6-methoxy-2,2-dimethyl-3h-thiochromen-4-one Chemical compound S1C(C)(C)CC(=O)C2=CC(OC)=CC=C21 BLDKYBCSARSGBR-UHFFFAOYSA-N 0.000 description 2
PEHVGBZKEYRQSX-UHFFFAOYSA-N 7-deaza-adenine Chemical compound NC1=NC=NC2=C1C=CN2 PEHVGBZKEYRQSX-UHFFFAOYSA-N 0.000 description 2
HCGHYQLFMPXSDU-UHFFFAOYSA-N 7-methyladenine Chemical compound C1=NC(N)=C2N(C)C=NC2=N1 HCGHYQLFMPXSDU-UHFFFAOYSA-N 0.000 description 2
LRFVTYWOQMYALW-UHFFFAOYSA-N 9H-xanthine Chemical compound O=C1NC(=O)NC2=C1NC=N2 LRFVTYWOQMYALW-UHFFFAOYSA-N 0.000 description 2
239000013607 AAV vector Substances 0.000 description 2
GFFGJBXGBJISGV-UHFFFAOYSA-N Adenine Chemical compound NC1=NC=NC2=C1N=CN2 GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 description 2
229930024421 Adenine Natural products 0.000 description 2
239000004382 Amylase Substances 0.000 description 2
102000013142 Amylases Human genes 0.000 description 2
108010065511 Amylases Proteins 0.000 description 2
XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
206010006187 Breast cancer Diseases 0.000 description 2
208000026310 Breast neoplasm Diseases 0.000 description 2
WEURAOUUQWPMQE-UHFFFAOYSA-N CC1(CC(=O)C2=C(S1)C=CC(=C2)C(F)(F)F)C Chemical compound CC1(CC(=O)C2=C(S1)C=CC(=C2)C(F)(F)F)C WEURAOUUQWPMQE-UHFFFAOYSA-N 0.000 description 2
KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 2
PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 description 2
XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
108010069091 Dystrophin Proteins 0.000 description 2
102000004190 Enzymes Human genes 0.000 description 2
108090000790 Enzymes Proteins 0.000 description 2
102000009024 Epidermal Growth Factor Human genes 0.000 description 2
108091029865 Exogenous DNA Proteins 0.000 description 2
208000009329 Graft vs Host Disease Diseases 0.000 description 2
241000711549 Hepacivirus C Species 0.000 description 2
108090000100 Hepatocyte Growth Factor Proteins 0.000 description 2
102100021866 Hepatocyte growth factor Human genes 0.000 description 2
101100220044 Homo sapiens CD34 gene Proteins 0.000 description 2
101001078143 Homo sapiens Integrin alpha-IIb Proteins 0.000 description 2
101000934338 Homo sapiens Myeloid cell surface antigen CD33 Proteins 0.000 description 2
108091006905 Human Serum Albumin Proteins 0.000 description 2
102000008100 Human Serum Albumin Human genes 0.000 description 2
UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
VSNHCAURESNICA-UHFFFAOYSA-N Hydroxyurea Chemical compound NC(=O)NO VSNHCAURESNICA-UHFFFAOYSA-N 0.000 description 2
102000017727 Immunoglobulin Variable Region Human genes 0.000 description 2
108010067060 Immunoglobulin Variable Region Proteins 0.000 description 2
208000026350 Inborn Genetic disease Diseases 0.000 description 2
108090001061 Insulin Proteins 0.000 description 2
102000004877 Insulin Human genes 0.000 description 2
102100034343 Integrase Human genes 0.000 description 2
101710203526 Integrase Proteins 0.000 description 2
102100025306 Integrin alpha-IIb Human genes 0.000 description 2
AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 2
102100032352 Leukemia inhibitory factor Human genes 0.000 description 2
108090000581 Leukemia inhibitory factor Proteins 0.000 description 2
108090001060 Lipase Proteins 0.000 description 2
239000004367 Lipase Substances 0.000 description 2
102000004882 Lipase Human genes 0.000 description 2
241000699670 Mus sp. Species 0.000 description 2
102100025243 Myeloid cell surface antigen CD33 Human genes 0.000 description 2
CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 2
229910002651 NO3 Inorganic materials 0.000 description 2
102000015336 Nerve Growth Factor Human genes 0.000 description 2
108010025020 Nerve Growth Factor Proteins 0.000 description 2
NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
108091028043 Nucleic acid sequence Proteins 0.000 description 2
108700020796 Oncogene Proteins 0.000 description 2
102000043276 Oncogene Human genes 0.000 description 2
AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 2
UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 2
101710160107 Outer membrane protein A Proteins 0.000 description 2
ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 2
108090000526 Papain Proteins 0.000 description 2
108091000080 Phosphotransferase Proteins 0.000 description 2
239000004365 Protease Substances 0.000 description 2
WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
238000010240 RT-PCR analysis Methods 0.000 description 2
102000006382 Ribonucleases Human genes 0.000 description 2
108010083644 Ribonucleases Proteins 0.000 description 2
241000283984 Rodentia Species 0.000 description 2
KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 2
PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
NAVMQTYZDKMPEU-UHFFFAOYSA-N Targretin Chemical compound CC1=CC(C(CCC2(C)C)(C)C)=C2C=C1C(=C)C1=CC=C(C(O)=O)C=C1 NAVMQTYZDKMPEU-UHFFFAOYSA-N 0.000 description 2
FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 2
RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical class OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 2
102000040945 Transcription factor Human genes 0.000 description 2
108091023040 Transcription factor Proteins 0.000 description 2
108091008605 VEGF receptors Proteins 0.000 description 2
102000009484 Vascular Endothelial Growth Factor Receptors Human genes 0.000 description 2
230000009471 action Effects 0.000 description 2
229960000643 adenine Drugs 0.000 description 2
OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 2
210000004504 adult stem cell Anatomy 0.000 description 2
150000004789 alkyl aryl sulfoxides Chemical class 0.000 description 2
150000001356 alkyl thiols Chemical class 0.000 description 2
125000000539 amino acid group Chemical group 0.000 description 2
IMUDHTPIFIBORV-UHFFFAOYSA-N aminoethylpiperazine Chemical compound NCCN1CCNCC1 IMUDHTPIFIBORV-UHFFFAOYSA-N 0.000 description 2
230000003321 amplification Effects 0.000 description 2
235000019418 amylase Nutrition 0.000 description 2
125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 2
210000000612 antigen-presenting cell Anatomy 0.000 description 2
150000001504 aryl thiols Chemical class 0.000 description 2
125000000732 arylene group Chemical group 0.000 description 2
239000012298 atmosphere Substances 0.000 description 2
239000003114 blood coagulation factor Substances 0.000 description 2
229940098773 bovine serum albumin Drugs 0.000 description 2
SXDBWCPKPHAZSM-UHFFFAOYSA-M bromate Inorganic materials [O-]Br(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-M 0.000 description 2
SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 2
GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
239000000872 buffer Substances 0.000 description 2
239000001506 calcium phosphate Substances 0.000 description 2
229910000389 calcium phosphate Inorganic materials 0.000 description 2
235000011010 calcium phosphates Nutrition 0.000 description 2
FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 description 2
229960000830 captopril Drugs 0.000 description 2
238000005119 centrifugation Methods 0.000 description 2
238000012512 characterization method Methods 0.000 description 2
HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
229910017052 cobalt Inorganic materials 0.000 description 2
239000010941 cobalt Substances 0.000 description 2
GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
230000005757 colony formation Effects 0.000 description 2
239000002299 complementary DNA Substances 0.000 description 2
238000010276 construction Methods 0.000 description 2
125000006310 cycloalkyl amino group Chemical group 0.000 description 2
CHVJITGCYZJHLR-UHFFFAOYSA-N cyclohepta-1,3,5-triene Chemical compound C1C=CC=CC=C1 CHVJITGCYZJHLR-UHFFFAOYSA-N 0.000 description 2
230000007423 decrease Effects 0.000 description 2
230000003111 delayed effect Effects 0.000 description 2
239000005547 deoxyribonucleotide Substances 0.000 description 2
125000002637 deoxyribonucleotide group Chemical group 0.000 description 2
238000011161 development Methods 0.000 description 2
230000018109 developmental process Effects 0.000 description 2
230000029087 digestion Effects 0.000 description 2
SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 2
201000010099 disease Diseases 0.000 description 2
208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
230000003828 downregulation Effects 0.000 description 2
210000002889 endothelial cell Anatomy 0.000 description 2
229940088598 enzyme Drugs 0.000 description 2
210000003743 erythrocyte Anatomy 0.000 description 2
239000012091 fetal bovine serum Substances 0.000 description 2
MHMNJMPURVTYEJ-UHFFFAOYSA-N fluorescein-5-isothiocyanate Chemical compound O1C(=O)C2=CC(N=C=S)=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 MHMNJMPURVTYEJ-UHFFFAOYSA-N 0.000 description 2
230000006870 function Effects 0.000 description 2
230000009395 genetic defect Effects 0.000 description 2
208000016361 genetic disease Diseases 0.000 description 2
238000010353 genetic engineering Methods 0.000 description 2
208000024908 graft versus host disease Diseases 0.000 description 2
230000012010 growth Effects 0.000 description 2
125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 2
210000000777 hematopoietic system Anatomy 0.000 description 2
125000005549 heteroarylene group Chemical group 0.000 description 2
229940088597 hormone Drugs 0.000 description 2
239000005556 hormone Substances 0.000 description 2
FDGQSTZJBFJUBT-UHFFFAOYSA-N hypoxanthine Chemical compound O=C1NC=NC2=C1NC=N2 FDGQSTZJBFJUBT-UHFFFAOYSA-N 0.000 description 2
238000002513 implantation Methods 0.000 description 2
230000008676 import Effects 0.000 description 2
238000011534 incubation Methods 0.000 description 2
208000015181 infectious disease Diseases 0.000 description 2
238000002347 injection Methods 0.000 description 2
239000007924 injection Substances 0.000 description 2
238000007689 inspection Methods 0.000 description 2
229940125396 insulin Drugs 0.000 description 2
230000010354 integration Effects 0.000 description 2
230000003993 interaction Effects 0.000 description 2
229910052742 iron Inorganic materials 0.000 description 2
150000002596 lactones Chemical class 0.000 description 2
235000019421 lipase Nutrition 0.000 description 2
238000012423 maintenance Methods 0.000 description 2
230000036210 malignancy Effects 0.000 description 2
239000003550 marker Substances 0.000 description 2
230000007246 mechanism Effects 0.000 description 2
229910052751 metal Inorganic materials 0.000 description 2
239000002184 metal Substances 0.000 description 2
150000002739 metals Chemical class 0.000 description 2
238000000520 microinjection Methods 0.000 description 2
210000003205 muscle Anatomy 0.000 description 2
210000000066 myeloid cell Anatomy 0.000 description 2
210000003098 myoblast Anatomy 0.000 description 2
125000001624 naphthyl group Chemical group 0.000 description 2
229910052759 nickel Inorganic materials 0.000 description 2
229930027945 nicotinamide-adenine dinucleotide Natural products 0.000 description 2
125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
238000003199 nucleic acid amplification method Methods 0.000 description 2
239000002773 nucleotide Substances 0.000 description 2
125000003729 nucleotide group Chemical group 0.000 description 2
210000000287 oocyte Anatomy 0.000 description 2
210000000056 organ Anatomy 0.000 description 2
125000002524 organometallic group Chemical group 0.000 description 2
229960003104 ornithine Drugs 0.000 description 2
238000004806 packaging method and process Methods 0.000 description 2
229910052763 palladium Inorganic materials 0.000 description 2
230000037361 pathway Effects 0.000 description 2
229960001639 penicillamine Drugs 0.000 description 2
LLYCMZGLHLKPPU-UHFFFAOYSA-M perbromate Chemical compound [O-]Br(=O)(=O)=O LLYCMZGLHLKPPU-UHFFFAOYSA-M 0.000 description 2
230000010412 perfusion Effects 0.000 description 2
125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 2
ACVYVLVWPXVTIT-UHFFFAOYSA-M phosphinate Chemical compound [O-][PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-M 0.000 description 2
125000004437 phosphorous atom Chemical group 0.000 description 2
229910052698 phosphorus Inorganic materials 0.000 description 2
102000020233 phosphotransferase Human genes 0.000 description 2
SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 2
125000003367 polycyclic group Chemical group 0.000 description 2
230000009696 proliferative response Effects 0.000 description 2
150000003212 purines Chemical class 0.000 description 2
UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
125000000168 pyrrolyl group Chemical group 0.000 description 2
230000010837 receptor-mediated endocytosis Effects 0.000 description 2
230000002829 reductive effect Effects 0.000 description 2
238000011160 research Methods 0.000 description 2
229910052703 rhodium Inorganic materials 0.000 description 2
239000010948 rhodium Substances 0.000 description 2
MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 2
229910052707 ruthenium Inorganic materials 0.000 description 2
150000003839 salts Chemical class 0.000 description 2
229920006395 saturated elastomer Polymers 0.000 description 2
230000011218 segmentation Effects 0.000 description 2
QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 2
210000002966 serum Anatomy 0.000 description 2
230000035939 shock Effects 0.000 description 2
238000004904 shortening Methods 0.000 description 2
239000004055 small Interfering RNA Substances 0.000 description 2
238000010532 solid phase synthesis reaction Methods 0.000 description 2
230000007480 spreading Effects 0.000 description 2
238000003892 spreading Methods 0.000 description 2
238000011476 stem cell transplantation Methods 0.000 description 2
239000000126 substance Substances 0.000 description 2
238000006467 substitution reaction Methods 0.000 description 2
OKQKDCXVLPGWPO-UHFFFAOYSA-N sulfanylidenephosphane Chemical compound S=P OKQKDCXVLPGWPO-UHFFFAOYSA-N 0.000 description 2
125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
238000012360 testing method Methods 0.000 description 2
229930192474 thiophene Natural products 0.000 description 2
RWQNBRDOKXIBIV-UHFFFAOYSA-N thymine Chemical compound CC1=CNC(=O)NC1=O RWQNBRDOKXIBIV-UHFFFAOYSA-N 0.000 description 2
238000010361 transduction Methods 0.000 description 2
230000026683 transduction Effects 0.000 description 2
230000009261 transgenic effect Effects 0.000 description 2
230000032258 transport Effects 0.000 description 2
QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
239000001226 triphosphate Substances 0.000 description 2
235000011178 triphosphate Nutrition 0.000 description 2
UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 2
229940124676 vascular endothelial growth factor receptor Drugs 0.000 description 2
230000003442 weekly effect Effects 0.000 description 2
QDZOEBFLNHCSSF-PFFBOGFISA-N (2S)-2-[[(2R)-2-[[(2S)-1-[(2S)-6-amino-2-[[(2S)-1-[(2R)-2-amino-5-carbamimidamidopentanoyl]pyrrolidine-2-carbonyl]amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-N-[(2R)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]pentanediamide Chemical compound C([C@@H](C(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(N)=O)NC(=O)[C@@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](N)CCCNC(N)=N)C1=CC=CC=C1 QDZOEBFLNHCSSF-PFFBOGFISA-N 0.000 description 1
VHHHBYLYCQPSGC-NJLIKGMNSA-N (2e,4e)-5-[2-(3,5-ditert-butyl-2-ethoxyphenyl)cyclopropyl]-3-methylpenta-2,4-dienoic acid Chemical compound C1=C(C(C)(C)C)C=C(C(C)(C)C)C(OCC)=C1C1C(\C=C\C(\C)=C\C(O)=O)C1 VHHHBYLYCQPSGC-NJLIKGMNSA-N 0.000 description 1
ZKCLTMKNJCSCFH-QWHMLTOOSA-N (2e,4e,6z)-7-(2-butoxy-3,5-ditert-butylphenyl)-3-methylocta-2,4,6-trienoic acid Chemical compound CCCCOC1=C(C(\C)=C/C=C/C(/C)=C/C(O)=O)C=C(C(C)(C)C)C=C1C(C)(C)C ZKCLTMKNJCSCFH-QWHMLTOOSA-N 0.000 description 1
UDGIIBLSAWJGEA-HNKNLTESSA-N (2e,4e,6z)-7-(3,5-ditert-butyl-2-ethoxyphenyl)-3-methylocta-2,4,6-trienoic acid Chemical compound CCOC1=C(C(\C)=C/C=C/C(/C)=C/C(O)=O)C=C(C(C)(C)C)C=C1C(C)(C)C UDGIIBLSAWJGEA-HNKNLTESSA-N 0.000 description 1
KDLMAQQTAVFIHC-LMQKFCQMSA-N (2e,4e,6z)-7-(3,5-ditert-butyl-2-hexoxyphenyl)-3-methylocta-2,4,6-trienoic acid Chemical compound CCCCCCOC1=C(C(\C)=C/C=C/C(/C)=C/C(O)=O)C=C(C(C)(C)C)C=C1C(C)(C)C KDLMAQQTAVFIHC-LMQKFCQMSA-N 0.000 description 1
BHQCQFFYRZLCQQ-UHFFFAOYSA-N (3alpha,5alpha,7alpha,12alpha)-3,7,12-trihydroxy-cholan-24-oic acid Natural products OC1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(O)=O)C)C1(C)C(O)C2 BHQCQFFYRZLCQQ-UHFFFAOYSA-N 0.000 description 1
QGVQZRDQPDLHHV-DPAQBDIFSA-N (3s,8s,9s,10r,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1h-cyclopenta[a]phenanthrene-3-thiol Chemical compound C1C=C2C[C@@H](S)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 QGVQZRDQPDLHHV-DPAQBDIFSA-N 0.000 description 1
WHTVZRBIWZFKQO-AWEZNQCLSA-N (S)-chloroquine Chemical compound ClC1=CC=C2C(N[C@@H](C)CCCN(CC)CC)=CC=NC2=C1 WHTVZRBIWZFKQO-AWEZNQCLSA-N 0.000 description 1
UTZAFOQPCXRRFF-RKBILKOESA-N (beta-D-glucosyl)-O-mycofactocinone Chemical compound CC1(C(NC(=O)C1=O)CC2=CC=C(C=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C UTZAFOQPCXRRFF-RKBILKOESA-N 0.000 description 1
FYADHXFMURLYQI-UHFFFAOYSA-N 1,2,4-triazine Chemical class C1=CN=NC=N1 FYADHXFMURLYQI-UHFFFAOYSA-N 0.000 description 1
BGVLBVASHIQNIO-UHFFFAOYSA-N 1,4,8,11-tetrazacyclotetradecane-5,7-dione Chemical compound O=C1CC(=O)NCCNCCCNCCN1 BGVLBVASHIQNIO-UHFFFAOYSA-N 0.000 description 1
PWJHXHMUGFXPSN-UHFFFAOYSA-N 1,7-dioxa-4,10-diazacyclododecane Chemical compound C1COCCNCCOCCN1 PWJHXHMUGFXPSN-UHFFFAOYSA-N 0.000 description 1
IFHMELMOPNZNGD-UHFFFAOYSA-N 1-(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethanone Chemical compound CC1(C)CCC(C)(C)C2=C1C=C(O)C(C(=O)C)=C2 IFHMELMOPNZNGD-UHFFFAOYSA-N 0.000 description 1
UHUHBFMZVCOEOV-UHFFFAOYSA-N 1h-imidazo[4,5-c]pyridin-4-amine Chemical compound NC1=NC=CC2=C1N=CN2 UHUHBFMZVCOEOV-UHFFFAOYSA-N 0.000 description 1
VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical group CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 description 1
AOTQGWFNFTVXNQ-UHFFFAOYSA-N 2-(1-adamantyl)acetic acid Chemical compound C1C(C2)CC3CC2CC1(CC(=O)O)C3 AOTQGWFNFTVXNQ-UHFFFAOYSA-N 0.000 description 1
QSHACTSJHMKXTE-UHFFFAOYSA-N 2-(2-aminopropyl)-7h-purin-6-amine Chemical compound CC(N)CC1=NC(N)=C2NC=NC2=N1 QSHACTSJHMKXTE-UHFFFAOYSA-N 0.000 description 1
PIINGYXNCHTJTF-UHFFFAOYSA-N 2-(2-azaniumylethylamino)acetate Chemical group NCCNCC(O)=O PIINGYXNCHTJTF-UHFFFAOYSA-N 0.000 description 1
QBUSWXYMJGAUMO-UHFFFAOYSA-N 2-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]pyridine Chemical compound CC1=CC(C(CCC2(C)C)(C)C)=C2C=C1C1(C=2N=CC=CC=2)CC1 QBUSWXYMJGAUMO-UHFFFAOYSA-N 0.000 description 1
JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
FSPQCTGGIANIJZ-UHFFFAOYSA-N 2-[[(3,4-dimethoxyphenyl)-oxomethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)NC1=C(C(N)=O)C(CCCC2)=C2S1 FSPQCTGGIANIJZ-UHFFFAOYSA-N 0.000 description 1
FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical group FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 1
IOSGANIYBODQTB-UHFFFAOYSA-N 2-ethynylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C#C IOSGANIYBODQTB-UHFFFAOYSA-N 0.000 description 1
NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 1
BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical group CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 description 1
GOLXRNDWAUTYKT-UHFFFAOYSA-N 3-(1H-indol-3-yl)propanoic acid Chemical compound C1=CC=C2C(CCC(=O)O)=CNC2=C1 GOLXRNDWAUTYKT-UHFFFAOYSA-N 0.000 description 1
QRPOZDMXOXTFSH-UHFFFAOYSA-N 3-(4-methoxyphenyl)sulfanyl-3-methylbutanoic acid Chemical compound COC1=CC=C(SC(C)(C)CC(O)=O)C=C1 QRPOZDMXOXTFSH-UHFFFAOYSA-N 0.000 description 1
PLRKLUBDNPSNCP-UHFFFAOYSA-N 3-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)but-2-enal Chemical compound CC1(C)CCC(C)(C)C2=C1C=C(C(C)=CC=O)C(OCCC)=C2 PLRKLUBDNPSNCP-UHFFFAOYSA-N 0.000 description 1
RTXITYKPQXMDII-UHFFFAOYSA-N 3-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)but-2-enenitrile Chemical compound CC1(C)CCC(C)(C)C2=C1C=C(C(C)=CC#N)C(OCCC)=C2 RTXITYKPQXMDII-UHFFFAOYSA-N 0.000 description 1
WEVYNIUIFUYDGI-UHFFFAOYSA-N 3-[6-[4-(trifluoromethoxy)anilino]-4-pyrimidinyl]benzamide Chemical compound NC(=O)C1=CC=CC(C=2N=CN=C(NC=3C=CC(OC(F)(F)F)=CC=3)C=2)=C1 WEVYNIUIFUYDGI-UHFFFAOYSA-N 0.000 description 1
GIFNPEOPKKBNNQ-UHFFFAOYSA-N 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)-n-propoxybenzamide Chemical compound C1=CC(C(O)=NOCCC)=CC=C1C(=O)C1=CC(C(CCC2(C)C)(C)C)=C2C=C1C GIFNPEOPKKBNNQ-UHFFFAOYSA-N 0.000 description 1
NCEQLLNVRRTCKJ-UHFFFAOYSA-N 4-[2-[5,5-dimethyl-8-(4-methylphenyl)-6h-naphthalen-2-yl]ethynyl]benzoic acid Chemical compound C1=CC(C)=CC=C1C1=CCC(C)(C)C2=CC=C(C#CC=3C=CC(=CC=3)C(O)=O)C=C12 NCEQLLNVRRTCKJ-UHFFFAOYSA-N 0.000 description 1
UUTBVRWXRIDYBT-UHFFFAOYSA-N 4-[7,7,10,10-tetramethyl-1-(pyridin-3-ylmethyl)-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl]benzoic acid Chemical compound C1CC=2C=C3C(C)(C)CCC(C)(C)C3=CC=2C2=C1C(C=1C=CC(=CC=1)C(O)=O)=CN2CC1=CC=CN=C1 UUTBVRWXRIDYBT-UHFFFAOYSA-N 0.000 description 1
125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
OVONXEQGWXGFJD-UHFFFAOYSA-N 4-sulfanylidene-1h-pyrimidin-2-one Chemical compound SC=1C=CNC(=O)N=1 OVONXEQGWXGFJD-UHFFFAOYSA-N 0.000 description 1
101710169336 5'-deoxyadenosine deaminase Proteins 0.000 description 1
ACEMKCOYIINOHN-UHFFFAOYSA-N 5-methyl-1h-pyrimidine-2,4-dione;pyrimidine Chemical compound C1=CN=CN=C1.CC1=CNC(=O)NC1=O ACEMKCOYIINOHN-UHFFFAOYSA-N 0.000 description 1
108091027075 5S-rRNA precursor Proteins 0.000 description 1
ALRYLNXZUBATMZ-UHFFFAOYSA-N 6-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]pyridine-3-carboxylic acid Chemical compound CC1=CC(C(CCC2(C)C)(C)C)=C2C=C1C(=C)C1=CC=C(C(O)=O)C=N1 ALRYLNXZUBATMZ-UHFFFAOYSA-N 0.000 description 1
KGBIPJPRSGFZRG-UHFFFAOYSA-N 6-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]pyridine-3-carboxylic acid Chemical compound C=1C(C(CCC2(C)C)(C)C)=C2C=C(C)C=1C(C)C1=CC=C(C(O)=O)C=N1 KGBIPJPRSGFZRG-UHFFFAOYSA-N 0.000 description 1
DDGWTCVFQWFIAH-UHFFFAOYSA-N 6-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]pyridine-3-carboxylic acid Chemical compound C=1C=C2C(C)(C)CCC(C)(C)C2=CC=1C(=C)C1=CC=C(C(O)=O)C=N1 DDGWTCVFQWFIAH-UHFFFAOYSA-N 0.000 description 1
KXBCLNRMQPRVTP-UHFFFAOYSA-N 6-amino-1,5-dihydroimidazo[4,5-c]pyridin-4-one Chemical compound O=C1NC(N)=CC2=C1N=CN2 KXBCLNRMQPRVTP-UHFFFAOYSA-N 0.000 description 1
DCPSTSVLRXOYGS-UHFFFAOYSA-N 6-amino-1h-pyrimidine-2-thione Chemical compound NC1=CC=NC(S)=N1 DCPSTSVLRXOYGS-UHFFFAOYSA-N 0.000 description 1
QNNARSZPGNJZIX-UHFFFAOYSA-N 6-amino-5-prop-1-ynyl-1h-pyrimidin-2-one Chemical compound CC#CC1=CNC(=O)N=C1N QNNARSZPGNJZIX-UHFFFAOYSA-N 0.000 description 1
NALREUIWICQLPS-UHFFFAOYSA-N 7-imino-n,n-dimethylphenothiazin-3-amine;hydrochloride Chemical compound [Cl-].C1=C(N)C=C2SC3=CC(=[N+](C)C)C=CC3=NC2=C1 NALREUIWICQLPS-UHFFFAOYSA-N 0.000 description 1
ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
AXXVSCRPHPIDIW-UHFFFAOYSA-N 7h-purin-6-amine;7h-purine Chemical compound C1=NC=C2NC=NC2=N1.NC1=NC=NC2=C1NC=N2 AXXVSCRPHPIDIW-UHFFFAOYSA-N 0.000 description 1
HRYKDUPGBWLLHO-UHFFFAOYSA-N 8-azaadenine Chemical compound NC1=NC=NC2=NNN=C12 HRYKDUPGBWLLHO-UHFFFAOYSA-N 0.000 description 1
LPXQRXLUHJKZIE-UHFFFAOYSA-N 8-azaguanine Chemical compound NC1=NC(O)=C2NN=NC2=N1 LPXQRXLUHJKZIE-UHFFFAOYSA-N 0.000 description 1
229960005508 8-azaguanine Drugs 0.000 description 1
MSSXOMSJDRHRMC-UHFFFAOYSA-N 9H-purine-2,6-diamine Chemical compound NC1=NC(N)=C2NC=NC2=N1 MSSXOMSJDRHRMC-UHFFFAOYSA-N 0.000 description 1
102000055025 Adenosine deaminases Human genes 0.000 description 1
108010088751 Albumins Proteins 0.000 description 1
102000009027 Albumins Human genes 0.000 description 1
108020000948 Antisense Oligonucleotides Proteins 0.000 description 1
102000005427 Asialoglycoprotein Receptor Human genes 0.000 description 1
102100024222 B-lymphocyte antigen CD19 Human genes 0.000 description 1
108010039209 Blood Coagulation Factors Proteins 0.000 description 1
102000015081 Blood Coagulation Factors Human genes 0.000 description 1
239000002126 C01EB10 - Adenosine Substances 0.000 description 1
NCXQVDXCRLWWEM-UHFFFAOYSA-N CCCCONC(=O)C1=CN=CC=C1 Chemical compound CCCCONC(=O)C1=CN=CC=C1 NCXQVDXCRLWWEM-UHFFFAOYSA-N 0.000 description 1
QCMYYKRYFNMIEC-UHFFFAOYSA-N COP(O)=O Chemical class COP(O)=O QCMYYKRYFNMIEC-UHFFFAOYSA-N 0.000 description 1
101100297347 Caenorhabditis elegans pgl-3 gene Proteins 0.000 description 1
101100258233 Caenorhabditis elegans sun-1 gene Proteins 0.000 description 1
UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
239000004215 Carbon black (E152) Substances 0.000 description 1
108010006303 Carboxypeptidases Proteins 0.000 description 1
102000005367 Carboxypeptidases Human genes 0.000 description 1
102000014914 Carrier Proteins Human genes 0.000 description 1
108010035563 Chloramphenicol O-acetyltransferase Proteins 0.000 description 1
KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
101800001982 Cholecystokinin Proteins 0.000 description 1
102100025841 Cholecystokinin Human genes 0.000 description 1
239000004380 Cholic acid Substances 0.000 description 1
108010038061 Chymotrypsinogen Proteins 0.000 description 1
108010003422 Circulating Thymic Factor Proteins 0.000 description 1
102100022641 Coagulation factor IX Human genes 0.000 description 1
102000007644 Colony-Stimulating Factors Human genes 0.000 description 1
108010071942 Colony-Stimulating Factors Proteins 0.000 description 1
102100030886 Complement receptor type 1 Human genes 0.000 description 1
108010042126 Creatine kinase Proteins 0.000 description 1
BQOHYSXSASDCEA-KEOHHSTQSA-N Cyclic ADP-Ribose Chemical compound C([C@@H]1[C@H]([C@H]([C@@H](O1)N1C=2N=CN3C(C=2N=C1)=N)O)O)OP(O)(=O)OP(O)(=O)OC[C@@H]1[C@@H](O)[C@@H](O)[C@H]3O1 BQOHYSXSASDCEA-KEOHHSTQSA-N 0.000 description 1
102000002004 Cytochrome P-450 Enzyme System Human genes 0.000 description 1
108010015742 Cytochrome P-450 Enzyme System Proteins 0.000 description 1
241000701022 Cytomegalovirus Species 0.000 description 1
108010053770 Deoxyribonucleases Proteins 0.000 description 1
102000016911 Deoxyribonucleases Human genes 0.000 description 1
241000702421 Dependoparvovirus Species 0.000 description 1
102000001039 Dystrophin Human genes 0.000 description 1
241000196324 Embryophyta Species 0.000 description 1
102100031780 Endonuclease Human genes 0.000 description 1
108010042407 Endonucleases Proteins 0.000 description 1
YQYJSBFKSSDGFO-UHFFFAOYSA-N Epihygromycin Natural products OC1C(O)C(C(=O)C)OC1OC(C(=C1)O)=CC=C1C=C(C)C(=O)NC1C(O)C(O)C2OCOC2C1O YQYJSBFKSSDGFO-UHFFFAOYSA-N 0.000 description 1
108010074604 Epoetin Alfa Proteins 0.000 description 1
206010015108 Epstein-Barr virus infection Diseases 0.000 description 1
241000588724 Escherichia coli Species 0.000 description 1
241000490229 Eucephalus Species 0.000 description 1
101150021185 FGF gene Proteins 0.000 description 1
108010076282 Factor IX Proteins 0.000 description 1
PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
102100028652 Gamma-enolase Human genes 0.000 description 1
101710191797 Gamma-enolase Proteins 0.000 description 1
102400000921 Gastrin Human genes 0.000 description 1
108010052343 Gastrins Proteins 0.000 description 1
108700028146 Genetic Enhancer Elements Proteins 0.000 description 1
102000016354 Glucuronosyltransferase Human genes 0.000 description 1
108010092364 Glucuronosyltransferase Proteins 0.000 description 1
SXRSQZLOMIGNAQ-UHFFFAOYSA-N Glutaraldehyde Chemical compound O=CCCCC=O SXRSQZLOMIGNAQ-UHFFFAOYSA-N 0.000 description 1
102000003886 Glycoproteins Human genes 0.000 description 1
108090000288 Glycoproteins Proteins 0.000 description 1
239000007995 HEPES buffer Substances 0.000 description 1
101000980825 Homo sapiens B-lymphocyte antigen CD19 Proteins 0.000 description 1
101000980898 Homo sapiens Cell division cycle-associated protein 4 Proteins 0.000 description 1
101000727061 Homo sapiens Complement receptor type 1 Proteins 0.000 description 1
101000716729 Homo sapiens Kit ligand Proteins 0.000 description 1
102000002265 Human Growth Hormone Human genes 0.000 description 1
108010000521 Human Growth Hormone Proteins 0.000 description 1
239000000854 Human Growth Hormone Substances 0.000 description 1
241000701109 Human adenovirus 2 Species 0.000 description 1
LCWXJXMHJVIJFK-UHFFFAOYSA-N Hydroxylysine Natural products NCC(O)CC(N)CC(O)=O LCWXJXMHJVIJFK-UHFFFAOYSA-N 0.000 description 1
PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 description 1
UGQMRVRMYYASKQ-UHFFFAOYSA-N Hypoxanthine nucleoside Natural products OC1C(O)C(CO)OC1N1C(NC=NC2=O)=C2N=C1 UGQMRVRMYYASKQ-UHFFFAOYSA-N 0.000 description 1
206010061598 Immunodeficiency Diseases 0.000 description 1
208000029462 Immunodeficiency disease Diseases 0.000 description 1
102000009786 Immunoglobulin Constant Regions Human genes 0.000 description 1
108010009817 Immunoglobulin Constant Regions Proteins 0.000 description 1
102000001706 Immunoglobulin Fab Fragments Human genes 0.000 description 1
108010054477 Immunoglobulin Fab Fragments Proteins 0.000 description 1
108700005091 Immunoglobulin Genes Proteins 0.000 description 1
102000012745 Immunoglobulin Subunits Human genes 0.000 description 1
108010079585 Immunoglobulin Subunits Proteins 0.000 description 1
102000003777 Interleukin-1 beta Human genes 0.000 description 1
108090000193 Interleukin-1 beta Proteins 0.000 description 1
102000015696 Interleukins Human genes 0.000 description 1
108010063738 Interleukins Proteins 0.000 description 1
102100020880 Kit ligand Human genes 0.000 description 1
SNDPXSYFESPGGJ-BYPYZUCNSA-N L-2-aminopentanoic acid Chemical compound CCC[C@H](N)C(O)=O SNDPXSYFESPGGJ-BYPYZUCNSA-N 0.000 description 1
150000008575 L-amino acids Chemical class 0.000 description 1
FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 1
SNDPXSYFESPGGJ-UHFFFAOYSA-N L-norVal-OH Natural products CCCC(N)C(O)=O SNDPXSYFESPGGJ-UHFFFAOYSA-N 0.000 description 1
LRQKBLKVPFOOQJ-YFKPBYRVSA-N L-norleucine Chemical compound CCCC[C@H]([NH3+])C([O-])=O LRQKBLKVPFOOQJ-YFKPBYRVSA-N 0.000 description 1
102000007330 LDL Lipoproteins Human genes 0.000 description 1
108010007622 LDL Lipoproteins Proteins 0.000 description 1
108090001030 Lipoproteins Proteins 0.000 description 1
102000004895 Lipoproteins Human genes 0.000 description 1
108060001084 Luciferase Proteins 0.000 description 1
239000005089 Luciferase Substances 0.000 description 1
241000829100 Macaca mulatta polyomavirus 1 Species 0.000 description 1
108090000157 Metallothionein Proteins 0.000 description 1
206010027476 Metastases Diseases 0.000 description 1
101150076359 Mhc gene Proteins 0.000 description 1
241001529936 Murinae Species 0.000 description 1
241000699666 Mus <mouse, genus> Species 0.000 description 1
101100335081 Mus musculus Flt3 gene Proteins 0.000 description 1
101100024583 Mus musculus Mtf1 gene Proteins 0.000 description 1
210000004460 N cell Anatomy 0.000 description 1
BAWFJGJZGIEFAR-NNYOXOHSSA-N NAD zwitterion Chemical compound NC(=O)C1=CC=C[N+]([C@H]2[C@@H]([C@H](O)[C@@H](COP([O-])(=O)OP(O)(=O)OC[C@@H]3[C@H]([C@@H](O)[C@@H](O3)N3C4=NC=NC(N)=C4N=C3)O)O2)O)=C1 BAWFJGJZGIEFAR-NNYOXOHSSA-N 0.000 description 1
ABDMQSFNJPYOLA-UHFFFAOYSA-N NS(=O)(=O)[N+]([O-])=O Chemical compound NS(=O)(=O)[N+]([O-])=O ABDMQSFNJPYOLA-UHFFFAOYSA-N 0.000 description 1
238000000636 Northern blotting Methods 0.000 description 1
108020005497 Nuclear hormone receptor Proteins 0.000 description 1
101710163270 Nuclease Proteins 0.000 description 1
BZQFBWGGLXLEPQ-UHFFFAOYSA-N O-phosphoryl-L-serine Natural products OC(=O)C(N)COP(O)(O)=O BZQFBWGGLXLEPQ-UHFFFAOYSA-N 0.000 description 1
REYJJPSVUYRZGE-UHFFFAOYSA-N Octadecylamine Chemical compound CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 1
241000283973 Oryctolagus cuniculus Species 0.000 description 1
108091007960 PI3Ks Proteins 0.000 description 1
102000016387 Pancreatic elastase Human genes 0.000 description 1
108010067372 Pancreatic elastase Proteins 0.000 description 1
206010033661 Pancytopenia Diseases 0.000 description 1
206010034016 Paronychia Diseases 0.000 description 1
108091005804 Peptidases Proteins 0.000 description 1
102100026918 Phospholipase A2 Human genes 0.000 description 1
108010058864 Phospholipases A2 Proteins 0.000 description 1
108010004729 Phycoerythrin Proteins 0.000 description 1
ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 1
239000002202 Polyethylene glycol Substances 0.000 description 1
108010039918 Polylysine Proteins 0.000 description 1
241001505332 Polyomavirus sp. Species 0.000 description 1
101710098940 Pro-epidermal growth factor Proteins 0.000 description 1
108010076504 Protein Sorting Signals Proteins 0.000 description 1
241000700159 Rattus Species 0.000 description 1
101710151245 Receptor-type tyrosine-protein kinase FLT3 Proteins 0.000 description 1
102100020718 Receptor-type tyrosine-protein kinase FLT3 Human genes 0.000 description 1
208000007660 Residual Neoplasm Diseases 0.000 description 1
102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 1
229930001406 Ryanodine Natural products 0.000 description 1
125000005631 S-sulfonamido group Chemical group 0.000 description 1
238000011579 SCID mouse model Methods 0.000 description 1
108010086019 Secretin Proteins 0.000 description 1
102100037505 Secretin Human genes 0.000 description 1
102000005157 Somatostatin Human genes 0.000 description 1
108010056088 Somatostatin Proteins 0.000 description 1
238000002105 Southern blotting Methods 0.000 description 1
108010039445 Stem Cell Factor Proteins 0.000 description 1
102400000096 Substance P Human genes 0.000 description 1
101800003906 Substance P Proteins 0.000 description 1
108010017842 Telomerase Proteins 0.000 description 1
108010046075 Thymosin Proteins 0.000 description 1
102000007501 Thymosin Human genes 0.000 description 1
102000007238 Transferrin Receptors Human genes 0.000 description 1
108010033576 Transferrin Receptors Proteins 0.000 description 1
108090001027 Troponin Proteins 0.000 description 1
GLNADSQYFUSGOU-GPTZEZBUSA-J Trypan blue Chemical compound [Na+].[Na+].[Na+].[Na+].C1=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(/N=N/C3=CC=C(C=C3C)C=3C=C(C(=CC=3)\N=N\C=3C(=CC4=CC(=CC(N)=C4C=3O)S([O-])(=O)=O)S([O-])(=O)=O)C)=C(O)C2=C1N GLNADSQYFUSGOU-GPTZEZBUSA-J 0.000 description 1
108010027252 Trypsinogen Proteins 0.000 description 1
102000018690 Trypsinogen Human genes 0.000 description 1
108060008682 Tumor Necrosis Factor Proteins 0.000 description 1
102000003990 Urokinase-type plasminogen activator Human genes 0.000 description 1
108090000435 Urokinase-type plasminogen activator Proteins 0.000 description 1
108700005077 Viral Genes Proteins 0.000 description 1
241001428384 Zamora Species 0.000 description 1
RLXCFCYWFYXTON-JTTSDREOSA-N [(3S,8S,9S,10R,13S,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] N-hexylcarbamate Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC(OC(=O)NCCCCCC)[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 RLXCFCYWFYXTON-JTTSDREOSA-N 0.000 description 1
XJLXINKUBYWONI-DQQFMEOOSA-N [[(2r,3r,4r,5r)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2s,3r,4s,5s)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate Chemical compound NC(=O)C1=CC=C[N+]([C@@H]2[C@H]([C@@H](O)[C@H](COP([O-])(=O)OP(O)(=O)OC[C@@H]3[C@H]([C@@H](OP(O)(O)=O)[C@@H](O3)N3C4=NC=NC(N)=C4N=C3)O)O2)O)=C1 XJLXINKUBYWONI-DQQFMEOOSA-N 0.000 description 1
USDJGQLNFPZEON-UHFFFAOYSA-N [[4,6-bis(hydroxymethylamino)-1,3,5-triazin-2-yl]amino]methanol Chemical compound OCNC1=NC(NCO)=NC(NCO)=N1 USDJGQLNFPZEON-UHFFFAOYSA-N 0.000 description 1
238000010521 absorption reaction Methods 0.000 description 1
208000037919 acquired disease Diseases 0.000 description 1
230000004913 activation Effects 0.000 description 1
229960005305 adenosine Drugs 0.000 description 1
238000013019 agitation Methods 0.000 description 1
239000000556 agonist Substances 0.000 description 1
125000003158 alcohol group Chemical group 0.000 description 1
125000001931 aliphatic group Chemical group 0.000 description 1
150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
125000005600 alkyl phosphonate group Chemical group 0.000 description 1
238000011316 allogeneic transplantation Methods 0.000 description 1
SJNALLRHIVGIBI-UHFFFAOYSA-N alpha-vinylacetonitrile Natural products C=CCC#N SJNALLRHIVGIBI-UHFFFAOYSA-N 0.000 description 1
125000004103 aminoalkyl group Chemical group 0.000 description 1
230000033115 angiogenesis Effects 0.000 description 1
238000011319 anticancer therapy Methods 0.000 description 1
229960002708 antigout preparations Drugs 0.000 description 1
239000000074 antisense oligonucleotide Substances 0.000 description 1
238000012230 antisense oligonucleotides Methods 0.000 description 1
230000006907 apoptotic process Effects 0.000 description 1
229910052786 argon Inorganic materials 0.000 description 1
108010006523 asialoglycoprotein receptor Proteins 0.000 description 1
210000003719 b-lymphocyte Anatomy 0.000 description 1
230000037429 base substitution Effects 0.000 description 1
238000007630 basic procedure Methods 0.000 description 1
229940054066 benzamide antipsychotics Drugs 0.000 description 1
150000003936 benzamides Chemical class 0.000 description 1
UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
102000005936 beta-Galactosidase Human genes 0.000 description 1
108010005774 beta-Galactosidase Proteins 0.000 description 1
108091008324 binding proteins Proteins 0.000 description 1
230000000740 bleeding effect Effects 0.000 description 1
230000000903 blocking effect Effects 0.000 description 1
239000010836 blood and blood product Substances 0.000 description 1
229940019700 blood coagulation factors Drugs 0.000 description 1
229940125691 blood product Drugs 0.000 description 1
210000002798 bone marrow cell Anatomy 0.000 description 1
238000010322 bone marrow transplantation Methods 0.000 description 1
229910052794 bromium Inorganic materials 0.000 description 1
239000001110 calcium chloride Substances 0.000 description 1
229910001628 calcium chloride Inorganic materials 0.000 description 1
238000004364 calculation method Methods 0.000 description 1
210000000234 capsid Anatomy 0.000 description 1
125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
125000002843 carboxylic acid group Chemical group 0.000 description 1
125000002091 cationic group Chemical group 0.000 description 1
150000001768 cations Chemical class 0.000 description 1
230000022534 cell killing Effects 0.000 description 1
210000000170 cell membrane Anatomy 0.000 description 1
230000005754 cellular signaling Effects 0.000 description 1
230000004700 cellular uptake Effects 0.000 description 1
230000009920 chelation Effects 0.000 description 1
AOXOCDRNSPFDPE-UKEONUMOSA-N chembl413654 Chemical compound C([C@H](C(=O)NCC(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@H](CCSC)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](C)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@@H](N)CCC(O)=O)C1=CC=C(O)C=C1 AOXOCDRNSPFDPE-UKEONUMOSA-N 0.000 description 1
239000013000 chemical inhibitor Substances 0.000 description 1
238000006243 chemical reaction Methods 0.000 description 1
239000003153 chemical reaction reagent Substances 0.000 description 1
239000003638 chemical reducing agent Substances 0.000 description 1
210000004978 chinese hamster ovary cell Anatomy 0.000 description 1
239000000460 chlorine Substances 0.000 description 1
229910052801 chlorine Inorganic materials 0.000 description 1
229960003677 chloroquine Drugs 0.000 description 1
WHTVZRBIWZFKQO-UHFFFAOYSA-N chloroquine Natural products ClC1=CC=C2C(NC(C)CCCN(CC)CC)=CC=NC2=C1 WHTVZRBIWZFKQO-UHFFFAOYSA-N 0.000 description 1
229940107137 cholecystokinin Drugs 0.000 description 1
235000012000 cholesterol Nutrition 0.000 description 1
BHQCQFFYRZLCQQ-OELDTZBJSA-N cholic acid Chemical compound C([C@H]1C[C@H]2O)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(O)=O)C)[C@@]2(C)[C@@H](O)C1 BHQCQFFYRZLCQQ-OELDTZBJSA-N 0.000 description 1
235000019416 cholic acid Nutrition 0.000 description 1
229960002471 cholic acid Drugs 0.000 description 1
229940001468 citrate Drugs 0.000 description 1
208000029742 colonic neoplasm Diseases 0.000 description 1
229940047120 colony stimulating factors Drugs 0.000 description 1
230000000052 comparative effect Effects 0.000 description 1
230000001276 controlling effect Effects 0.000 description 1
238000007796 conventional method Methods 0.000 description 1
MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 1
NKKMVIVFRUYPLQ-NSCUHMNNSA-N crotononitrile Chemical compound C\C=C\C#N NKKMVIVFRUYPLQ-NSCUHMNNSA-N 0.000 description 1
210000000805 cytoplasm Anatomy 0.000 description 1
230000007402 cytotoxic response Effects 0.000 description 1
230000034994 death Effects 0.000 description 1
230000007812 deficiency Effects 0.000 description 1
YSMODUONRAFBET-UHFFFAOYSA-N delta-DL-hydroxylysine Natural products NCC(O)CCC(N)C(O)=O YSMODUONRAFBET-UHFFFAOYSA-N 0.000 description 1
KXGVEGMKQFWNSR-UHFFFAOYSA-N deoxycholic acid Natural products C1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(O)=O)C)C1(C)C(O)C2 KXGVEGMKQFWNSR-UHFFFAOYSA-N 0.000 description 1
238000013461 design Methods 0.000 description 1
238000001514 detection method Methods 0.000 description 1
230000006866 deterioration Effects 0.000 description 1
229950006137 dexfosfoserine Drugs 0.000 description 1
238000010790 dilution Methods 0.000 description 1
239000012895 dilution Substances 0.000 description 1
239000000539 dimer Substances 0.000 description 1
LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
238000009826 distribution Methods 0.000 description 1
NAGJZTKCGNOGPW-UHFFFAOYSA-N dithiophosphoric acid Chemical class OP(O)(S)=S NAGJZTKCGNOGPW-UHFFFAOYSA-N 0.000 description 1
PMMYEEVYMWASQN-UHFFFAOYSA-N dl-hydroxyproline Natural products OC1C[NH2+]C(C([O-])=O)C1 PMMYEEVYMWASQN-UHFFFAOYSA-N 0.000 description 1
GTZOYNFRVVHLDZ-UHFFFAOYSA-N dodecane-1,1-diol Chemical group CCCCCCCCCCCC(O)O GTZOYNFRVVHLDZ-UHFFFAOYSA-N 0.000 description 1
230000012202 endocytosis Effects 0.000 description 1
210000001163 endosome Anatomy 0.000 description 1
239000003623 enhancer Substances 0.000 description 1
238000007824 enzymatic assay Methods 0.000 description 1
210000002919 epithelial cell Anatomy 0.000 description 1
210000000981 epithelium Anatomy 0.000 description 1
YSMODUONRAFBET-UHNVWZDZSA-N erythro-5-hydroxy-L-lysine Chemical compound NC[C@H](O)CC[C@H](N)C(O)=O YSMODUONRAFBET-UHNVWZDZSA-N 0.000 description 1
ZFZSCWASFPMMOX-UHFFFAOYSA-N ethyl 4-[2-(2,2-dimethyl-4-oxo-3h-thiochromen-6-yl)ethynyl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1C#CC1=CC=C(SC(C)(C)CC2=O)C2=C1 ZFZSCWASFPMMOX-UHFFFAOYSA-N 0.000 description 1
125000004494 ethyl ester group Chemical group 0.000 description 1
125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
210000003527 eukaryotic cell Anatomy 0.000 description 1
238000011156 evaluation Methods 0.000 description 1
230000005284 excitation Effects 0.000 description 1
229960004222 factor ix Drugs 0.000 description 1
229960000301 factor viii Drugs 0.000 description 1
239000012894 fetal calf serum Substances 0.000 description 1
210000002950 fibroblast Anatomy 0.000 description 1
238000000684 flow cytometry Methods 0.000 description 1
239000012530 fluid Substances 0.000 description 1
239000011737 fluorine Substances 0.000 description 1
229910052731 fluorine Inorganic materials 0.000 description 1
239000012737 fresh medium Substances 0.000 description 1
230000005714 functional activity Effects 0.000 description 1
238000002825 functional assay Methods 0.000 description 1
125000000524 functional group Chemical group 0.000 description 1
210000001035 gastrointestinal tract Anatomy 0.000 description 1
238000001502 gel electrophoresis Methods 0.000 description 1
239000011521 glass Substances 0.000 description 1
125000003827 glycol group Chemical group 0.000 description 1
239000001963 growth medium Substances 0.000 description 1
125000001475 halogen functional group Chemical group 0.000 description 1
238000002744 homologous recombination Methods 0.000 description 1
230000006801 homologous recombination Effects 0.000 description 1
102000044493 human CDCA4 Human genes 0.000 description 1
102000055151 human KITLG Human genes 0.000 description 1
210000005260 human cell Anatomy 0.000 description 1
238000009396 hybridization Methods 0.000 description 1
229930195733 hydrocarbon Natural products 0.000 description 1
QJHBJHUKURJDLG-UHFFFAOYSA-N hydroxy-L-lysine Natural products NCCCCC(NO)C(O)=O QJHBJHUKURJDLG-UHFFFAOYSA-N 0.000 description 1
229960002591 hydroxyproline Drugs 0.000 description 1
230000001900 immune effect Effects 0.000 description 1
230000028993 immune response Effects 0.000 description 1
230000003053 immunization Effects 0.000 description 1
230000007813 immunodeficiency Effects 0.000 description 1
230000002055 immunohistochemical effect Effects 0.000 description 1
230000003308 immunostimulating effect Effects 0.000 description 1
230000001771 impaired effect Effects 0.000 description 1
238000011065 in-situ storage Methods 0.000 description 1
238000001802 infusion Methods 0.000 description 1
238000011081 inoculation Methods 0.000 description 1
238000002743 insertional mutagenesis Methods 0.000 description 1
238000009434 installation Methods 0.000 description 1
230000016507 interphase Effects 0.000 description 1
229910052740 iodine Inorganic materials 0.000 description 1
238000000050 ionisation spectroscopy Methods 0.000 description 1
230000005865 ionizing radiation Effects 0.000 description 1
230000002427 irreversible effect Effects 0.000 description 1
210000004153 islets of langerhan Anatomy 0.000 description 1
RGXCTRIQQODGIZ-UHFFFAOYSA-O isodesmosine Chemical compound OC(=O)C(N)CCCC[N+]1=CC(CCC(N)C(O)=O)=CC(CCC(N)C(O)=O)=C1CCCC(N)C(O)=O RGXCTRIQQODGIZ-UHFFFAOYSA-O 0.000 description 1
125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
150000002632 lipids Chemical class 0.000 description 1
238000001638 lipofection Methods 0.000 description 1
238000009630 liquid culture Methods 0.000 description 1
210000003712 lysosome Anatomy 0.000 description 1
230000001868 lysosomic effect Effects 0.000 description 1
238000007885 magnetic separation Methods 0.000 description 1
230000003211 malignant effect Effects 0.000 description 1
210000004962 mammalian cell Anatomy 0.000 description 1
230000008774 maternal effect Effects 0.000 description 1
230000035800 maturation Effects 0.000 description 1
238000005259 measurement Methods 0.000 description 1
210000003593 megakaryocyte Anatomy 0.000 description 1
201000001441 melanoma Diseases 0.000 description 1
230000009401 metastasis Effects 0.000 description 1
MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
229960000485 methotrexate Drugs 0.000 description 1
229920000609 methyl cellulose Polymers 0.000 description 1
239000001923 methylcellulose Substances 0.000 description 1
210000001616 monocyte Anatomy 0.000 description 1
125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
210000000663 muscle cell Anatomy 0.000 description 1
210000000107 myocyte Anatomy 0.000 description 1
HVHMXMSNIOHNTP-UHFFFAOYSA-N n-hydroxy-3-methylbut-2-enamide Chemical compound CC(C)=CC(=O)NO HVHMXMSNIOHNTP-UHFFFAOYSA-N 0.000 description 1
MSAHDRAAPGQPBL-UHFFFAOYSA-N n-hydroxy-3-methylbut-2-enamide;4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)benzoic acid Chemical compound CC(C)=CC(O)=NO.CC1=CC(C(CCC2(C)C)(C)C)=C2C=C1C(=O)C1=CC=C(C(O)=O)C=C1 MSAHDRAAPGQPBL-UHFFFAOYSA-N 0.000 description 1
210000003061 neural cell Anatomy 0.000 description 1
230000001537 neural effect Effects 0.000 description 1
210000000440 neutrophil Anatomy 0.000 description 1
230000003448 neutrophilic effect Effects 0.000 description 1
BOPGDPNILDQYTO-NNYOXOHSSA-N nicotinamide-adenine dinucleotide Chemical compound C1=CCC(C(=O)N)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2[C@H]([C@@H](O)[C@@H](O2)N2C3=NC=NC(N)=C3N=C2)O)O1 BOPGDPNILDQYTO-NNYOXOHSSA-N 0.000 description 1
102000006255 nuclear receptors Human genes 0.000 description 1
108020004017 nuclear receptors Proteins 0.000 description 1
238000010899 nucleation Methods 0.000 description 1
238000007899 nucleic acid hybridization Methods 0.000 description 1
238000002515 oligonucleotide synthesis Methods 0.000 description 1
238000011275 oncology therapy Methods 0.000 description 1
125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
210000000496 pancreas Anatomy 0.000 description 1
229940055729 papain Drugs 0.000 description 1
235000019834 papain Nutrition 0.000 description 1
230000036961 partial effect Effects 0.000 description 1
SCHTXWZFMCQMBH-UHFFFAOYSA-N pentane-1,3,5-triamine Chemical compound NCCC(N)CCN SCHTXWZFMCQMBH-UHFFFAOYSA-N 0.000 description 1
ONTNXMBMXUNDBF-UHFFFAOYSA-N pentatriacontane-17,18,19-triol Chemical compound CCCCCCCCCCCCCCCCC(O)C(O)C(O)CCCCCCCCCCCCCCCC ONTNXMBMXUNDBF-UHFFFAOYSA-N 0.000 description 1
KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
230000002093 peripheral effect Effects 0.000 description 1
238000002823 phage display Methods 0.000 description 1
150000004713 phosphodiesters Chemical class 0.000 description 1
150000003904 phospholipids Chemical class 0.000 description 1
UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
150000008298 phosphoramidates Chemical class 0.000 description 1
BZQFBWGGLXLEPQ-REOHCLBHSA-N phosphoserine Chemical compound OC(=O)[C@@H](N)COP(O)(O)=O BZQFBWGGLXLEPQ-REOHCLBHSA-N 0.000 description 1
USRGIUJOYOXOQJ-GBXIJSLDSA-N phosphothreonine Chemical compound OP(=O)(O)O[C@H](C)[C@H](N)C(O)=O USRGIUJOYOXOQJ-GBXIJSLDSA-N 0.000 description 1
230000004962 physiological condition Effects 0.000 description 1
210000004694 pigment cell Anatomy 0.000 description 1
239000013600 plasmid vector Substances 0.000 description 1
230000008488 polyadenylation Effects 0.000 description 1
229920001223 polyethylene glycol Polymers 0.000 description 1
229920000656 polylysine Polymers 0.000 description 1
229920000642 polymer Polymers 0.000 description 1
238000003752 polymerase chain reaction Methods 0.000 description 1
230000002062 proliferating effect Effects 0.000 description 1
235000019419 proteases Nutrition 0.000 description 1
125000006239 protecting group Chemical group 0.000 description 1
230000001681 protective effect Effects 0.000 description 1
238000010926 purge Methods 0.000 description 1
238000001959 radiotherapy Methods 0.000 description 1
230000008707 rearrangement Effects 0.000 description 1
230000014493 regulation of gene expression Effects 0.000 description 1
230000002629 repopulating effect Effects 0.000 description 1
230000000717 retained effect Effects 0.000 description 1
230000000979 retarding effect Effects 0.000 description 1
229920002477 rna polymer Polymers 0.000 description 1
JJSYXNQGLHBRRK-SFEDZAPPSA-N ryanodine Chemical compound O([C@@H]1[C@]([C@@]2([C@]3(O)[C@]45O[C@@]2(O)C[C@]([C@]4(CC[C@H](C)[C@H]5O)O)(C)[C@@]31O)C)(O)C(C)C)C(=O)C1=CC=CN1 JJSYXNQGLHBRRK-SFEDZAPPSA-N 0.000 description 1
229960002101 secretin Drugs 0.000 description 1
OWMZNFCDEHGFEP-NFBCVYDUSA-N secretin human Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(N)=O)[C@@H](C)O)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)C1=CC=CC=C1 OWMZNFCDEHGFEP-NFBCVYDUSA-N 0.000 description 1
230000028327 secretion Effects 0.000 description 1
229940076279 serotonin Drugs 0.000 description 1
230000007781 signaling event Effects 0.000 description 1
238000004088 simulation Methods 0.000 description 1
IZTQOLKUZKXIRV-YRVFCXMDSA-N sincalide Chemical compound C([C@@H](C(=O)N[C@@H](CCSC)C(=O)NCC(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](N)CC(O)=O)C1=CC=C(OS(O)(=O)=O)C=C1 IZTQOLKUZKXIRV-YRVFCXMDSA-N 0.000 description 1
239000011780 sodium chloride Substances 0.000 description 1
NHXLMOGPVYXJNR-ATOGVRKGSA-N somatostatin Chemical compound C([C@H]1C(=O)N[C@H](C(N[C@@H](CO)C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CC=2C3=CC=CC=C3NC=2)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N1)[C@@H](C)O)NC(=O)CNC(=O)[C@H](C)N)C(O)=O)=O)[C@H](O)C)C1=CC=CC=C1 NHXLMOGPVYXJNR-ATOGVRKGSA-N 0.000 description 1
229960000553 somatostatin Drugs 0.000 description 1
238000003860 storage Methods 0.000 description 1
229940086735 succinate Drugs 0.000 description 1
IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical group NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
150000003462 sulfoxides Chemical class 0.000 description 1
230000001502 supplementing effect Effects 0.000 description 1
230000004083 survival effect Effects 0.000 description 1
239000000725 suspension Substances 0.000 description 1
230000009044 synergistic interaction Effects 0.000 description 1
230000008685 targeting Effects 0.000 description 1
125000003396 thiol group Chemical group [H]S* 0.000 description 1
150000003573 thiols Chemical class 0.000 description 1
229950000329 thiouracil Drugs 0.000 description 1
230000002992 thymic effect Effects 0.000 description 1
229940113082 thymine Drugs 0.000 description 1
LCJVIYPJPCBWKS-NXPQJCNCSA-N thymosin Chemical compound SC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H](CC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@H]([C@H](C)O)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@H](CCC(O)=O)C(O)=O LCJVIYPJPCBWKS-NXPQJCNCSA-N 0.000 description 1
238000004448 titration Methods 0.000 description 1
FGMPLJWBKKVCDB-UHFFFAOYSA-N trans-L-hydroxy-proline Natural products ON1CCCC1C(O)=O FGMPLJWBKKVCDB-UHFFFAOYSA-N 0.000 description 1
238000000844 transformation Methods 0.000 description 1
230000009466 transformation Effects 0.000 description 1
238000013519 translation Methods 0.000 description 1
125000004953 trihalomethyl group Chemical group 0.000 description 1
102000003390 tumor necrosis factor Human genes 0.000 description 1
125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
241001529453 unidentified herpesvirus Species 0.000 description 1
238000011144 upstream manufacturing Methods 0.000 description 1
229960005356 urokinase Drugs 0.000 description 1
210000004291 uterus Anatomy 0.000 description 1
229910052720 vanadium Inorganic materials 0.000 description 1
230000017613 viral reproduction Effects 0.000 description 1
210000002845 virion Anatomy 0.000 description 1
229940088594 vitamin Drugs 0.000 description 1
229930003231 vitamin Natural products 0.000 description 1
235000013343 vitamin Nutrition 0.000 description 1
239000011782 vitamin Substances 0.000 description 1
150000003722 vitamin derivatives Chemical class 0.000 description 1
102000035029 vitamin receptors Human genes 0.000 description 1
108091005463 vitamin receptors Proteins 0.000 description 1
244000089052 wirilda Species 0.000 description 1
229940075420 xanthine Drugs 0.000 description 1