MA19085A1 - Associations synergiques renfermant une phosphinothricine . - Google Patents
Associations synergiques renfermant une phosphinothricine .Info
- Publication number
- MA19085A1 MA19085A1 MA19289A MA19289A MA19085A1 MA 19085 A1 MA19085 A1 MA 19085A1 MA 19289 A MA19289 A MA 19289A MA 19289 A MA19289 A MA 19289A MA 19085 A1 MA19085 A1 MA 19085A1
- Authority
- MA
- Morocco
- Prior art keywords
- phosphinothricin
- associations containing
- synergistic associations
- synergistic
- associations
- Prior art date
Links
- IAJOBQBIJHVGMQ-UHFFFAOYSA-N Phosphinothricin Natural products CP(O)(=O)CCC(N)C(O)=O IAJOBQBIJHVGMQ-UHFFFAOYSA-N 0.000 title 1
- IAJOBQBIJHVGMQ-BYPYZUCNSA-N glufosinate-P Chemical compound CP(O)(=O)CC[C@H](N)C(O)=O IAJOBQBIJHVGMQ-BYPYZUCNSA-N 0.000 title 1
- 230000002195 synergetic effect Effects 0.000 title 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N57/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds
- A01N57/18—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds having phosphorus-to-carbon bonds
- A01N57/20—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds having phosphorus-to-carbon bonds containing acyclic or cycloaliphatic radicals
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803008186 DE3008186A1 (de) | 1980-03-04 | 1980-03-04 | Synergistische kombinationen von phosphinothricin |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| MA19085A1 true MA19085A1 (fr) | 1981-10-01 |
Family
ID=6096186
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MA19289A MA19085A1 (fr) | 1980-03-04 | 1981-02-27 | Associations synergiques renfermant une phosphinothricine . |
Country Status (20)
| Country | Link |
|---|---|
| EP (1) | EP0036106B1 (index.php) |
| JP (1) | JPS56135409A (index.php) |
| AU (1) | AU539256B2 (index.php) |
| BR (1) | BR8101233A (index.php) |
| CA (1) | CA1162071A (index.php) |
| CS (1) | CS221287B2 (index.php) |
| DD (1) | DD156892A5 (index.php) |
| DE (2) | DE3008186A1 (index.php) |
| DK (1) | DK95981A (index.php) |
| ES (1) | ES8201001A1 (index.php) |
| GR (1) | GR74156B (index.php) |
| HU (1) | HU186384B (index.php) |
| IL (1) | IL62241A0 (index.php) |
| MA (1) | MA19085A1 (index.php) |
| NZ (1) | NZ196380A (index.php) |
| OA (1) | OA06759A (index.php) |
| PH (1) | PH19742A (index.php) |
| PL (1) | PL229976A1 (index.php) |
| PT (1) | PT72607B (index.php) |
| ZA (1) | ZA811397B (index.php) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS58110510A (ja) * | 1981-12-24 | 1983-07-01 | Meiji Seika Kaisha Ltd | 除草剤組成物 |
| BR8600462A (pt) * | 1986-02-04 | 1987-09-01 | Monsanto Brasil | Formulacao herbicida |
| US5491125A (en) * | 1988-03-18 | 1996-02-13 | Hoechst Aktiengesellschaft | Liquid herbicidal formulations of glufosinate |
| DE3902884A1 (de) * | 1989-02-01 | 1990-08-02 | Riedel De Haen Ag | Fluessige algizid wirkende zubereitung |
| US5364832A (en) * | 1990-08-10 | 1994-11-15 | Hoechst Aktiengesellschaft | Water-dispersible granules comprising fenoxaprop-ethyl and/or fenchlorazole |
| DE3926800A1 (de) * | 1989-08-14 | 1991-02-21 | Hoechst Ag | Wasserdispergierbare granulate zur anwendung im pflanzenschutz |
| ES2050643T1 (es) * | 1992-08-24 | 1994-06-01 | Monsanto Co | Composiciones herbicidas. |
| DE69429336T2 (de) * | 1993-02-26 | 2002-08-22 | Zeon Corp., Tokio | Zusammensetzung von Pflanzenwachstums-Beschleuniger |
| BR9406470A (pt) * | 1993-12-28 | 1996-01-23 | Kao Corp | Composição e processo para aperfeiçoar produtos quimicos aplicáveis na agricultura e composição quimica aplicável na agricultura |
| US5622911A (en) * | 1994-02-14 | 1997-04-22 | Kao Corporation | Method for enhancing the efficacy of agricultural chemical with alkoxylated fatty acid amides |
| US5849663A (en) * | 1994-06-02 | 1998-12-15 | Kao Corporation | Enhancer for agricultural chemicals, enhancer composition for agricultural chemicals and method for enhancing the efficacy of agricultural chemical |
| WO1995033379A2 (en) * | 1994-06-02 | 1995-12-14 | Kao Corporation | Enhancer composition for agricultural chemicals and method for enhancing the efficacy of agricultural chemical |
| US6020287A (en) * | 1997-01-31 | 2000-02-01 | Monsanto Company | Process and compositions for enhancing reliability of exogenous chemical substances applied to plants |
| GB0328529D0 (en) * | 2003-12-09 | 2004-01-14 | Syngenta Ltd | Agrochemical composition |
| US20070082819A1 (en) * | 2003-12-09 | 2007-04-12 | Perry Richard B | Agrochemical compositions |
| DE102005059471A1 (de) | 2005-12-13 | 2007-07-12 | Bayer Cropscience Ag | Herbizide Zusammensetzungen mit verbesserter Wirkung |
| DE102005059469A1 (de) | 2005-12-13 | 2007-06-14 | Bayer Cropscience Ag | Insektizide Zusammensetzungen mit verbesserter Wirkung |
| DE102005059891A1 (de) | 2005-12-15 | 2007-06-28 | Bayer Cropscience Ag | 3'-Alkoxy-spirocyclopentyl substituierte Tetram- und Tetronsäuren |
| DE102006007882A1 (de) | 2006-02-21 | 2007-08-30 | Bayer Cropscience Ag | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
| DE102006018828A1 (de) | 2006-04-22 | 2007-10-25 | Bayer Cropscience Ag | Alkoxyalkyl-substituierte cyclische Ketoenole |
| DE102006025874A1 (de) | 2006-06-02 | 2007-12-06 | Bayer Cropscience Ag | Alkoxyalkyl-substituierte cyclische Ketoenole |
| DE102006050148A1 (de) | 2006-10-25 | 2008-04-30 | Bayer Cropscience Ag | Trifluormethoxy-phenylsubstituierte Tetramsäure-Derivate |
| DE102006057037A1 (de) | 2006-12-04 | 2008-06-05 | Bayer Cropscience Ag | cis-Alkoxyspirocyclische biphenylsubstituierte Tetramsäure-Derivate |
| DE102006057036A1 (de) | 2006-12-04 | 2008-06-05 | Bayer Cropscience Ag | Biphenylsubstituierte spirocyclische Ketoenole |
| DE102007024575A1 (de) | 2007-05-25 | 2008-11-27 | Bayer Cropscience Ag | Insektizide Zusammensetzungen von 2-Cyanobenzolsulfonamidverbindungen und ihrer isomeren Formen mit verbesserter Wirkung |
| EP2020413A1 (de) | 2007-08-02 | 2009-02-04 | Bayer CropScience AG | Oxaspirocyclische-spiro-substituierte Tetram- und Tetronsäure-Derivate |
| EP2045240A1 (de) | 2007-09-25 | 2009-04-08 | Bayer CropScience AG | Halogenalkoxyspirocyclische Tetram- und Tetronsäure-Derivate |
| EP2092824A1 (de) | 2008-02-25 | 2009-08-26 | Bayer CropScience AG | Heterocyclyl-Pyrimidine |
| EP2103615A1 (de) | 2008-03-19 | 2009-09-23 | Bayer CropScience AG | 4'4'-Dioxaspiro-spirocyclisch substituierte Tetramate |
| EP2123159A1 (de) | 2008-05-21 | 2009-11-25 | Bayer CropScience AG | (1,2-Benzisothiazol-3-yl)(thio)carbamate und (1,2-Benzisothiazol-3-yl)(thio)oxamate und deren Oxidationsformen als Pestizide |
| US8367873B2 (en) | 2008-10-10 | 2013-02-05 | Bayer Cropscience Ag | Phenyl-substituted bicyclooctane-1,3-dione derivatives |
| US8389443B2 (en) | 2008-12-02 | 2013-03-05 | Bayer Cropscience Ag | Geminal alkoxy/alkylspirocyclic substituted tetramate derivatives |
| US8846946B2 (en) | 2008-12-02 | 2014-09-30 | Bayer Cropscience Ag | Germinal alkoxy/alkylspirocyclic substituted tetramate derivatives |
| EP2196461A1 (de) | 2008-12-15 | 2010-06-16 | Bayer CropScience AG | 4-Amino-1,2,3-benzoxathiazin-Derivate als Pestizide |
| PT2484676E (pt) | 2008-12-18 | 2015-05-18 | Bayer Cropscience Ag | Amidas de ácido antranílico substituídas por tetrazol como pesticidas |
| EP2223598A1 (de) | 2009-02-23 | 2010-09-01 | Bayer CropScience AG | Insektizide Zusammensetzungen mit verbesserter Wirkung |
| KR101703633B1 (ko) | 2009-03-11 | 2017-02-07 | 바이엘 인텔렉쳐 프로퍼티 게엠베하 | 할로겐알킬메틸렌옥시페닐-치환된 케토에놀 |
| ES2525014T3 (es) | 2009-05-19 | 2014-12-17 | Bayer Cropscience Ag | Derivados de ácido tetrónico espiroheterocíclicos herbicidas |
| WO2011098440A2 (de) | 2010-02-10 | 2011-08-18 | Bayer Cropscience Ag | Biphenylsubstituierte cyclische ketoenole |
| WO2011098443A1 (de) | 2010-02-10 | 2011-08-18 | Bayer Cropscience Ag | Spiroheterocyclisch-substituierte tetramsäure-derivate |
| EP2560487A1 (de) | 2010-04-20 | 2013-02-27 | Bayer Intellectual Property GmbH | Insektizide und/oder herbizide zusammensetzung mit verbesserter wirkung auf basis von spiroheterocyclisch-substituierten tetramsäure-derivaten |
| MX2013000193A (es) | 2010-06-29 | 2013-01-28 | Bayer Ip Gmbh | Composiciones insecticidas mejoradas que comprenden carbonilamidinas ciclicas. |
| WO2012059436A2 (de) | 2010-11-02 | 2012-05-10 | Bayer Cropscience Ag | Phenylsubstituierte bicyclooktan-1,3-dion-derivate |
| CN103492367B (zh) | 2011-02-17 | 2015-04-01 | 拜耳知识产权有限责任公司 | 用于治疗的取代的3-(联苯-3-基)-8,8-二氟-4-羟基-1-氮杂螺[4.5]癸-3-烯-2-酮 |
| EP2505061A1 (en) * | 2011-03-30 | 2012-10-03 | Rhodia Opérations | New uses of choline chloride in agrochemical formulations |
| CA2828639C (en) | 2011-03-01 | 2019-02-12 | Bayer Intellectual Property Gmbh | 2-acyloxypyrrolin-4-ones |
| WO2016001129A1 (de) | 2014-07-01 | 2016-01-07 | Bayer Cropscience Aktiengesellschaft | Verbesserte insektizide zusammensetzungen |
| US20210144992A1 (en) | 2018-04-13 | 2021-05-20 | Bayer Cropscience Aktiengesellschaft | Oil-based suspension concentrates |
| WO2019197619A1 (de) | 2018-04-13 | 2019-10-17 | Bayer Cropscience Aktiengesellschaft | Suspensionskonzentrate auf ölbasis |
| CN109369712B (zh) * | 2018-12-12 | 2019-10-29 | 浙江大学 | 一种用钙盐分离提纯草铵膦的方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3231509A (en) * | 1964-06-11 | 1966-01-25 | Betz Laboratories | Slimicidal composition and method |
| DE2717440C2 (de) * | 1976-05-17 | 1984-04-05 | Hoechst Ag, 6230 Frankfurt | Unkrautbekämpfung mit [(3-Amino-3-carboxy)-propyl-1]-methylphosphinsäure-Derivaten |
| CA1120280A (en) * | 1977-11-08 | 1982-03-23 | Makoto Konnai | Herbicidal compositions and herbicidal processes |
| JPS5484529A (en) * | 1977-12-19 | 1979-07-05 | Meiji Seika Kaisha Ltd | Production of d,l-2-amino-4-methylphosphinobutyric acid |
| US4226610A (en) * | 1978-04-15 | 1980-10-07 | Meiji Selka Kaisha, Ltd. | Herbicidal compounds, preparation thereof and herbicides containing the same |
-
1980
- 1980-03-04 DE DE19803008186 patent/DE3008186A1/de not_active Withdrawn
-
1981
- 1981-02-23 EP EP81101282A patent/EP0036106B1/de not_active Expired
- 1981-02-23 DE DE8181101282T patent/DE3160991D1/de not_active Expired
- 1981-02-26 ES ES499839A patent/ES8201001A1/es not_active Expired
- 1981-02-27 BR BR8101233A patent/BR8101233A/pt unknown
- 1981-02-27 DD DD81227943A patent/DD156892A5/de unknown
- 1981-02-27 MA MA19289A patent/MA19085A1/fr unknown
- 1981-03-02 NZ NZ196380A patent/NZ196380A/xx unknown
- 1981-03-02 PH PH25291A patent/PH19742A/en unknown
- 1981-03-02 GR GR64267A patent/GR74156B/el unknown
- 1981-03-02 PT PT72607A patent/PT72607B/pt not_active IP Right Cessation
- 1981-03-02 IL IL62241A patent/IL62241A0/xx unknown
- 1981-03-03 AU AU68018/81A patent/AU539256B2/en not_active Ceased
- 1981-03-03 PL PL22997681A patent/PL229976A1/xx unknown
- 1981-03-03 ZA ZA00811397A patent/ZA811397B/xx unknown
- 1981-03-03 HU HU81523A patent/HU186384B/hu not_active IP Right Cessation
- 1981-03-03 JP JP2947781A patent/JPS56135409A/ja active Granted
- 1981-03-03 CA CA000372216A patent/CA1162071A/en not_active Expired
- 1981-03-03 DK DK95981A patent/DK95981A/da not_active Application Discontinuation
- 1981-03-04 CS CS811548A patent/CS221287B2/cs unknown
- 1981-03-04 OA OA57344A patent/OA06759A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NZ196380A (en) | 1983-05-10 |
| GR74156B (index.php) | 1984-06-06 |
| PT72607A (en) | 1981-04-01 |
| IL62241A0 (en) | 1981-05-20 |
| PH19742A (en) | 1986-06-23 |
| EP0036106B1 (de) | 1983-09-28 |
| ES499839A0 (es) | 1981-12-16 |
| CS221287B2 (en) | 1983-04-29 |
| AU539256B2 (en) | 1984-09-20 |
| BR8101233A (pt) | 1981-09-08 |
| ES8201001A1 (es) | 1981-12-16 |
| CA1162071A (en) | 1984-02-14 |
| DD156892A5 (de) | 1982-09-29 |
| EP0036106A3 (en) | 1981-09-30 |
| HU186384B (en) | 1985-07-29 |
| DK95981A (da) | 1981-09-05 |
| JPS56135409A (en) | 1981-10-22 |
| DE3160991D1 (en) | 1983-11-03 |
| ZA811397B (en) | 1982-03-31 |
| EP0036106A2 (de) | 1981-09-23 |
| OA06759A (fr) | 1982-06-30 |
| PT72607B (en) | 1982-07-13 |
| AU6801881A (en) | 1981-09-10 |
| JPH0124125B2 (index.php) | 1989-05-10 |
| DE3008186A1 (de) | 1981-10-15 |
| PL229976A1 (index.php) | 1981-10-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| MA19085A1 (fr) | Associations synergiques renfermant une phosphinothricine . | |
| ATE6381T1 (de) | Dichtungsanordnung. | |
| FI813734A7 (fi) | Farmaseuttiset koostumukset. | |
| FI841480A0 (fi) | Anvaendning av klordioxidgas som ett kemiskt steriliseringsmedel. | |
| FI830723A7 (fi) | N-fosfonometyyliglysiinijohdannaiset. | |
| FI834621A7 (fi) | Riktningsaendare vid foergreningspunkten foer ett transportsystem. | |
| ES264808Y (es) | Embalaje. | |
| NL192168B (nl) | Referentie-keten. | |
| IT8119688A0 (it) | Convogliatore. | |
| NL192902B (nl) | Beschermingsketen. | |
| DE3177214D1 (de) | Verschluss. | |
| NO157572C (no) | Ombindingsanordning. | |
| NO832096L (no) | Tetning for undervannskopling. | |
| FI73925B (fi) | Styrsystem foer fordon. | |
| FI833371A7 (fi) | Pakkaus. | |
| EP0098308A4 (en) | SWITCH. | |
| IT8121847A0 (it) | Agenti antidiarroici. | |
| IT8021537A0 (it) | Composizioni fungicibe. | |
| IT8125025A0 (it) | Connettori. | |
| DE3381587D1 (de) | Verpackungsmaschine. | |
| DE3382440D1 (de) | Schalter. | |
| NL191887C (nl) | Aviobrugafdichting. | |
| NO156959B (no) | Kartong. | |
| NL190168C (nl) | Graafwielzuiger. | |
| IT8026921A0 (it) | Copiatrice. |