LU88284I2 - Dopacard - Google Patents
DopacardInfo
- Publication number
- LU88284I2 LU88284I2 LU88284C LU88284C LU88284I2 LU 88284 I2 LU88284 I2 LU 88284I2 LU 88284 C LU88284 C LU 88284C LU 88284 C LU88284 C LU 88284C LU 88284 I2 LU88284 I2 LU 88284I2
- Authority
- LU
- Luxembourg
- Prior art keywords
- dopacard
- Prior art date
Links
- VPDULUNRSQWWJB-UHFFFAOYSA-N hydron;4-[2-[6-(2-phenylethylamino)hexylamino]ethyl]benzene-1,2-diol;dichloride Chemical compound Cl.Cl.C1=C(O)C(O)=CC=C1CCNCCCCCCNCCC1=CC=CC=C1 VPDULUNRSQWWJB-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/14—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D223/16—Benzazepines; Hydrogenated benzazepines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/26—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D307/30—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/32—Oxygen atoms
- C07D307/33—Oxygen atoms in position 2, the oxygen atom being in its keto or unsubstituted enol form
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8123962 | 1981-08-05 | ||
| GB8130595 | 1981-10-09 | ||
| GB8130594 | 1981-10-09 | ||
| GB8134551 | 1981-11-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| LU88284I2 true LU88284I2 (fr) | 1994-05-04 |
Family
ID=27449264
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| LU88284C LU88284I2 (fr) | 1981-08-05 | 1993-06-03 | Dopacard |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US5013760A (index.php) |
| EP (1) | EP0072061B1 (index.php) |
| AU (1) | AU538078B2 (index.php) |
| CA (1) | CA1191846A (index.php) |
| CY (1) | CY1428A (index.php) |
| DE (1) | DE3263531D1 (index.php) |
| DK (1) | DK163181C (index.php) |
| ES (1) | ES514725A0 (index.php) |
| FI (1) | FI82238C (index.php) |
| GR (1) | GR77995B (index.php) |
| HK (1) | HK41388A (index.php) |
| IE (1) | IE53827B1 (index.php) |
| IL (1) | IL66449A (index.php) |
| LU (1) | LU88284I2 (index.php) |
| MY (1) | MY8700459A (index.php) |
| NL (1) | NL930078I2 (index.php) |
| NO (1) | NO154492C (index.php) |
| NZ (1) | NZ201479A (index.php) |
| PT (1) | PT75380B (index.php) |
| SG (1) | SG46287G (index.php) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8301754D0 (en) * | 1983-01-21 | 1983-02-23 | Fisons Plc | Formulation |
| FI843507L (fi) * | 1983-01-21 | 1984-09-07 | Fisons Plc | Aromatiska aminer. |
| DE3484048D1 (de) * | 1983-10-25 | 1991-03-07 | Fisons Plc | Phenylethylamine, verfahren zu deren herstellung und diese enthaltende zusammensetzungen. |
| US4720586A (en) * | 1983-12-06 | 1988-01-19 | Fisons, Plc | Substituted 3,4-dihydroxy-phenylethylamino compounds |
| IL77594A (en) * | 1985-01-15 | 1989-12-15 | Glaxo Group Ltd | 2-substituted-3,4-dihydroxyphenethylamine derivatives,their preparation and pharmaceutical compositions containing them |
| ATE64369T1 (de) * | 1985-11-20 | 1991-06-15 | Fisons Plc | Catecholamin-derivate, verfahren zu deren herstellung und deren pharmazeutische zusammensetzungen. |
| US5602174A (en) * | 1986-02-15 | 1997-02-11 | Beecham Wuefling Gmbh & Co. | Treatment |
| GB8603765D0 (en) * | 1986-02-15 | 1986-03-19 | Beecham Wuelfung Gmbh & Co Kg | Compounds |
| GB2192394A (en) * | 1986-07-11 | 1988-01-13 | Glaxo Group Ltd | Amine derivatives |
| US5753714A (en) * | 1987-02-03 | 1998-05-19 | Merrell Pharmaceuticals Inc. | Polyamine derivatives |
| AU614749B2 (en) * | 1987-05-19 | 1991-09-12 | Fisons Plc | 2-(3,4-dihydroxyphenyl)ethylamines, and their use pharmaceutical compositions |
| IT1254521B (it) * | 1992-03-17 | 1995-09-25 | Zambon Spa | Derivati della 2-ammino-tetralina attivi sul sistema cardiovascolare |
| IT1271411B (it) * | 1993-09-14 | 1997-05-28 | Zambon Spa | Derivati del 2-ammino-1,2,3,4-tetraidro-naftalene attivi sul sistema cardiovascolare |
| IT1271008B (it) * | 1994-09-13 | 1997-05-26 | Zambon Spa | Derivati del 2-ammino-1,2,3,4-tetraidro-naftalene attivi sul sistema cardiovascolare |
| IT1271007B (it) * | 1994-09-13 | 1997-05-26 | Zambon Spa | Derivati del 2-ammino-1,2,3,4-tetraidronaftalene attivi sul sistema cardiovascolare |
| FR2870537A1 (fr) * | 2004-05-19 | 2005-11-25 | Servier Lab | Nouveau procede de synthese du (1s)-4,5-dimethoxy-1-(methyl aminomethyl-)-benzocyclobutane et de ses sels d'addition, et application a la synthese de l'ivabradine et de ses sels d'addition a un acide pharmaceutiquement acceptable |
| CA2740947A1 (en) | 2008-10-21 | 2010-04-29 | Johnson & Johnson Pharmaceutical Research & Development, Llc | Animal model for evaluating vasomotor response in vivo |
| CN105001103B (zh) * | 2015-05-31 | 2017-11-03 | 江苏同禾药业有限公司 | 一种盐酸多培沙明中间体的合成方法 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2653977A (en) * | 1953-09-29 | Chxnx | ||
| US2739981A (en) * | 1952-08-26 | 1956-03-27 | American Home Prod | Diamines and salts thereof |
| US2937185A (en) * | 1956-08-13 | 1960-05-17 | Lakeside Lab Inc | Diamino alkanols and alkanones |
| US3013020A (en) * | 1958-01-24 | 1961-12-12 | Miles Lab | N,n'-bis-phenyl-alkylene-diamines |
| GB1004071A (en) * | 1961-07-03 | 1965-09-08 | Council Scient Ind Res | Substituted ª‰-phenethylamines and a process for the production thereof |
| GB1025699A (en) * | 1965-01-08 | 1966-04-14 | Boehringer & Soehne Gmbh | New n,n-diphenyl-alkylene-ª‡,ªÏ-diamines |
| DE1768297B1 (de) * | 1968-04-26 | 1971-12-16 | Beiersdorf Ag | Substituierte Alkylendiamine und deren Salze |
| US3867454A (en) * | 1971-03-10 | 1975-02-18 | Sterling Drug Inc | 1,1-BRIDGED-BIS(N-aralkyl-2-aminoethanols) |
| US3933913A (en) * | 1971-06-01 | 1976-01-20 | Smithkline Corporation | N,N'-bis[3-substituted-4-hydroxypheyl)-2-hydroxyethyl)]-polymethylenediamines |
| GB1440440A (en) * | 1972-10-06 | 1976-06-23 | Manuf Prod Pharma | Tetrahydronaphthalene derivatives |
| DK449974A (index.php) * | 1973-08-31 | 1975-04-28 | Sandoz Ag | |
| US3928323A (en) * | 1973-12-18 | 1975-12-23 | Millmaster Onyx Corp | Anti-microbial quaternary ammonium co-polymers |
| US3960959A (en) * | 1973-12-19 | 1976-06-01 | Sandoz Ltd. | N,N'-bis{6-[(3,4-dihydroxyphenyl)alkylamino]-hexyl}hexamethylenediamines and the salts thereof |
| US4210749A (en) * | 1974-11-12 | 1980-07-01 | Pennwalt Corporation | Substituted 1,2,4,5-tetrahydro-3H,3 benzazepines |
| US4163063A (en) * | 1976-01-02 | 1979-07-31 | University Of Iowa Research Foundation | Aminotetralin adrenergic β-agonists |
| GB8301754D0 (en) * | 1983-01-21 | 1983-02-23 | Fisons Plc | Formulation |
-
1982
- 1982-07-22 EP EP82200930A patent/EP0072061B1/en not_active Expired
- 1982-07-22 DE DE8282200930T patent/DE3263531D1/de not_active Expired
- 1982-07-28 FI FI822630A patent/FI82238C/fi not_active IP Right Cessation
- 1982-08-02 IL IL66449A patent/IL66449A/xx not_active IP Right Cessation
- 1982-08-03 CA CA000408660A patent/CA1191846A/en not_active Expired
- 1982-08-03 NZ NZ201479A patent/NZ201479A/en unknown
- 1982-08-03 AU AU86702/82A patent/AU538078B2/en not_active Expired
- 1982-08-04 NO NO82822671A patent/NO154492C/no not_active IP Right Cessation
- 1982-08-04 DK DK349582A patent/DK163181C/da active
- 1982-08-04 GR GR68959A patent/GR77995B/el unknown
- 1982-08-04 IE IE1872/82A patent/IE53827B1/en not_active IP Right Cessation
- 1982-08-04 ES ES514725A patent/ES514725A0/es active Granted
- 1982-08-04 PT PT75380A patent/PT75380B/pt unknown
-
1986
- 1986-04-01 US US06/846,846 patent/US5013760A/en not_active Expired - Lifetime
-
1987
- 1987-05-21 SG SG46287A patent/SG46287G/en unknown
- 1987-12-30 MY MY459/87A patent/MY8700459A/xx unknown
-
1988
- 1988-06-02 HK HK413/88A patent/HK41388A/en not_active IP Right Cessation
- 1988-09-02 CY CY1428A patent/CY1428A/xx unknown
-
1993
- 1993-06-03 LU LU88284C patent/LU88284I2/fr unknown
- 1993-06-17 NL NL930078C patent/NL930078I2/nl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PT75380A (en) | 1982-09-01 |
| IL66449A0 (en) | 1982-12-31 |
| NZ201479A (en) | 1986-07-11 |
| DE3263531D1 (en) | 1985-06-20 |
| IE821872L (en) | 1983-02-05 |
| FI82238B (fi) | 1990-10-31 |
| FI822630A0 (fi) | 1982-07-28 |
| IL66449A (en) | 1986-12-31 |
| AU538078B2 (en) | 1984-07-26 |
| EP0072061A1 (en) | 1983-02-16 |
| GR77995B (index.php) | 1984-09-26 |
| DK163181B (da) | 1992-02-03 |
| PT75380B (en) | 1986-02-12 |
| SG46287G (en) | 1987-11-13 |
| AU8670282A (en) | 1983-02-10 |
| DK163181C (da) | 1992-06-22 |
| DK349582A (da) | 1983-02-06 |
| CA1191846A (en) | 1985-08-13 |
| ES8405757A1 (es) | 1984-06-16 |
| US5013760A (en) | 1991-05-07 |
| NO154492B (no) | 1986-06-23 |
| IE53827B1 (en) | 1989-03-15 |
| FI822630L (fi) | 1983-02-06 |
| NO154492C (no) | 1986-10-01 |
| MY8700459A (en) | 1987-12-31 |
| FI82238C (fi) | 1991-02-11 |
| NL930078I2 (nl) | 1993-11-16 |
| NO822671L (no) | 1983-02-07 |
| ES514725A0 (es) | 1984-06-16 |
| EP0072061B1 (en) | 1985-05-15 |
| HK41388A (en) | 1988-06-10 |
| CY1428A (en) | 1988-09-02 |
| NL930078I1 (nl) | 1993-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI824278A0 (fi) | Skoerdeanordning | |
| AR228298A1 (es) | Cubo-rompecabezas | |
| ATA202182A (de) | Geraeuschgedaempftes schienenrad | |
| AT372860B (de) | Schipaar | |
| BE889765A (fr) | Stijgerelement | |
| LU88284I2 (fr) | Dopacard | |
| FI823741L (fi) | Digitalt behandlingssystem foer televisiossignal | |
| BE894481A (fr) | Stromingsmeter | |
| AT384100B (de) | Drehrohrofen | |
| FI823480A0 (fi) | Oxazolidindionderivat | |
| BE891918A (fr) | Draaibare schoorsteenkap | |
| BE891837A (fr) | Anthracycline-glycosides | |
| FI820940L (fi) | Snoekedja | |
| AT385733B (de) | Skibob | |
| ATA183681A (de) | Blockhaus | |
| ATA461081A (de) | Hoergeraet | |
| AT374656B (de) | Maishaecksler | |
| ATA243482A (de) | Mauerstein | |
| AT371306B (de) | Hoergeraet | |
| BE893123A (fr) | Thienyl- et benzothienyl-t-butylamino-phenoxypropanols | |
| FI814184L (fi) | Kryostat | |
| BR8103754A (pt) | Morfoplastia | |
| ATA492281A (de) | Karniese | |
| AR225979A1 (es) | Tablestacado rompeolas | |
| AR222933A1 (es) | Secador-escurridor |