KR870000498B1 - 5, 6-디알콕시-4-알킬-2(1h)-퀴나졸리논의 제조 방법 - Google Patents
5, 6-디알콕시-4-알킬-2(1h)-퀴나졸리논의 제조 방법 Download PDFInfo
- Publication number
- KR870000498B1 KR870000498B1 KR1019850007044A KR850007044A KR870000498B1 KR 870000498 B1 KR870000498 B1 KR 870000498B1 KR 1019850007044 A KR1019850007044 A KR 1019850007044A KR 850007044 A KR850007044 A KR 850007044A KR 870000498 B1 KR870000498 B1 KR 870000498B1
- Authority
- KR
- South Korea
- Prior art keywords
- formula
- reacted
- alkyl
- ketone
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 238000000034 method Methods 0.000 claims description 29
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 20
- -1 arylsulfonyl chloride Chemical compound 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 19
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical group [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 16
- 150000002576 ketones Chemical class 0.000 claims description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical class C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 claims description 11
- 150000004820 halides Chemical class 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 9
- 239000003638 chemical reducing agent Substances 0.000 claims description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical group ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 8
- 239000012948 isocyanate Substances 0.000 claims description 6
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 5
- 239000002585 base Substances 0.000 claims description 5
- 150000005690 diesters Chemical class 0.000 claims description 5
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical group COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 claims description 5
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 claims description 4
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 claims description 4
- 239000005695 Ammonium acetate Substances 0.000 claims description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 4
- 229940043376 ammonium acetate Drugs 0.000 claims description 4
- 235000019257 ammonium acetate Nutrition 0.000 claims description 4
- 125000005228 aryl sulfonate group Chemical group 0.000 claims description 4
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 claims description 4
- 150000008050 dialkyl sulfates Chemical class 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 229910017604 nitric acid Inorganic materials 0.000 claims description 4
- 239000007800 oxidant agent Substances 0.000 claims description 4
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical group [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 claims description 4
- ZLYBFBAHAQEEQQ-UHFFFAOYSA-N 4-chlorobenzenesulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)C=C1 ZLYBFBAHAQEEQQ-UHFFFAOYSA-N 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical group CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 claims description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 3
- 150000002513 isocyanates Chemical class 0.000 claims description 3
- 239000011777 magnesium Substances 0.000 claims description 3
- 229910052749 magnesium Inorganic materials 0.000 claims description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 claims description 3
- 239000011707 mineral Substances 0.000 claims description 3
- 239000012286 potassium permanganate Substances 0.000 claims description 3
- 239000007818 Grignard reagent Substances 0.000 claims description 2
- 239000003153 chemical reaction reagent Substances 0.000 claims description 2
- 150000004795 grignard reagents Chemical class 0.000 claims description 2
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 claims 6
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims 5
- SLAMLWHELXOEJZ-UHFFFAOYSA-N 2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1[N+]([O-])=O SLAMLWHELXOEJZ-UHFFFAOYSA-N 0.000 claims 4
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 claims 4
- 125000001246 bromo group Chemical group Br* 0.000 claims 4
- 239000012320 chlorinating reagent Substances 0.000 claims 4
- 229910052783 alkali metal Inorganic materials 0.000 claims 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims 2
- 150000002431 hydrogen Chemical group 0.000 claims 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- 229910052700 potassium Inorganic materials 0.000 claims 2
- 239000011591 potassium Substances 0.000 claims 2
- 229910052708 sodium Inorganic materials 0.000 claims 2
- 239000011734 sodium Substances 0.000 claims 2
- 150000001266 acyl halides Chemical class 0.000 claims 1
- 150000001768 cations Chemical class 0.000 claims 1
- 229910021645 metal ion Inorganic materials 0.000 claims 1
- 230000001590 oxidative effect Effects 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- 238000010992 reflux Methods 0.000 description 14
- 239000007787 solid Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- 239000000539 dimer Substances 0.000 description 4
- WVNXGAOAWSQPAL-UHFFFAOYSA-N 5,6-dimethoxy-4-methyl-3h-quinazolin-2-one Chemical compound O=C1NC(C)=C2C(OC)=C(OC)C=CC2=N1 WVNXGAOAWSQPAL-UHFFFAOYSA-N 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- KWXFQMHMUVDCGC-UHFFFAOYSA-N 2,3-dimethoxy-6-nitrobenzaldehyde Chemical compound COC1=CC=C([N+]([O-])=O)C(C=O)=C1OC KWXFQMHMUVDCGC-UHFFFAOYSA-N 0.000 description 2
- MSEFOJHLQKTCGQ-UHFFFAOYSA-N 2,3-dimethoxy-6-nitrobenzoic acid Chemical compound COC1=CC=C([N+]([O-])=O)C(C(O)=O)=C1OC MSEFOJHLQKTCGQ-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- CXUCVTDINSGTCB-UHFFFAOYSA-N 2-ethyl-2-methoxycarbonylbutanoic acid Chemical compound CCC(CC)(C(O)=O)C(=O)OC CXUCVTDINSGTCB-UHFFFAOYSA-N 0.000 description 2
- ZEHAPDWJZZTSOT-UHFFFAOYSA-N 5,6-dimethoxy-4-methyl-3h-quinazolin-2-one;hydrochloride Chemical compound Cl.N1C(=O)N=C(C)C2=C(OC)C(OC)=CC=C21 ZEHAPDWJZZTSOT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- OKKJXQCMGYOARE-UHFFFAOYSA-N benzenesulfonic acid;2-hydroxy-3-methoxy-6-nitrobenzaldehyde Chemical compound OS(=O)(=O)C1=CC=CC=C1.COC1=CC=C([N+]([O-])=O)C(C=O)=C1O OKKJXQCMGYOARE-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- MKLDLMXFDMZYAD-UHFFFAOYSA-N 1h-quinazolin-2-one;hydrochloride Chemical compound Cl.C1=CC=C2NC(=O)N=CC2=C1 MKLDLMXFDMZYAD-UHFFFAOYSA-N 0.000 description 1
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 1
- ICUDZYGCLCHPOH-UHFFFAOYSA-N 2,3-dimethoxy-6-nitrobenzoyl chloride Chemical compound COC1=CC=C([N+]([O-])=O)C(C(Cl)=O)=C1OC ICUDZYGCLCHPOH-UHFFFAOYSA-N 0.000 description 1
- PPCSKPPPUIHHQZ-UHFFFAOYSA-N 2-hydroxy-3-methoxy-6-nitrobenzaldehyde;potassium Chemical compound [K].COC1=CC=C([N+]([O-])=O)C(C=O)=C1O PPCSKPPPUIHHQZ-UHFFFAOYSA-N 0.000 description 1
- MKOPTNNOWPZOKU-UHFFFAOYSA-N 5,6-dimethoxy-4-methyl-3h-quinazolin-2-one;hydrate;hydrochloride Chemical compound O.Cl.N1C(=O)N=C(C)C2=C(OC)C(OC)=CC=C21 MKOPTNNOWPZOKU-UHFFFAOYSA-N 0.000 description 1
- GKDYQYAVNWBJMU-UHFFFAOYSA-N CCCOC(=O)C(CC)(CC)C(O)=O Chemical compound CCCOC(=O)C(CC)(CC)C(O)=O GKDYQYAVNWBJMU-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- MHZGKXUYDGKKIU-UHFFFAOYSA-N Decylamine Chemical compound CCCCCCCCCCN MHZGKXUYDGKKIU-UHFFFAOYSA-N 0.000 description 1
- NTURVSFTOYPGON-UHFFFAOYSA-N Dihydroquinazoline Chemical compound C1=CC=C2C=NCNC2=C1 NTURVSFTOYPGON-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000005526 alkyl sulfate group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- CACNQBCAROJFBX-UHFFFAOYSA-N benzenesulfonic acid;2-hydroxy-3-methoxybenzaldehyde Chemical compound OS(=O)(=O)C1=CC=CC=C1.COC1=CC=CC(C=O)=C1O CACNQBCAROJFBX-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- NRDQFWXVTPZZAZ-UHFFFAOYSA-N butyl carbonochloridate Chemical compound CCCCOC(Cl)=O NRDQFWXVTPZZAZ-UHFFFAOYSA-N 0.000 description 1
- 239000002371 cardiac agent Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- LMEDOLJKVASKTP-UHFFFAOYSA-N dibutyl sulfate Chemical compound CCCCOS(=O)(=O)OCCCC LMEDOLJKVASKTP-UHFFFAOYSA-N 0.000 description 1
- GHHBKGZXAOSQNI-UHFFFAOYSA-N diethyl 2-(2,3-dimethoxy-6-nitrobenzoyl)propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)C(=O)C1=C(OC)C(OC)=CC=C1[N+]([O-])=O GHHBKGZXAOSQNI-UHFFFAOYSA-N 0.000 description 1
- VQAZCUCWHIIFGE-UHFFFAOYSA-N diethyl 2-ethylpropanedioate Chemical compound CCOC(=O)C(CC)C(=O)OCC VQAZCUCWHIIFGE-UHFFFAOYSA-N 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- UKFXDFUAPNAMPJ-UHFFFAOYSA-N ethylmalonic acid Chemical compound CCC(C(O)=O)C(O)=O UKFXDFUAPNAMPJ-UHFFFAOYSA-N 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- JJVNINGBHGBWJH-UHFFFAOYSA-N ortho-vanillin Chemical compound COC1=CC=CC(C=O)=C1O JJVNINGBHGBWJH-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/78—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 2
- C07D239/80—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/12—Preparation of nitro compounds by reactions not involving the formation of nitro groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C221/00—Preparation of compounds containing amino groups and doubly-bound oxygen atoms bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C269/00—Preparation of derivatives of carbamic acid, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C269/04—Preparation of derivatives of carbamic acid, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups from amines with formation of carbamate groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C303/00—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides
- C07C303/26—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of esters of sulfonic acids
- C07C303/28—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of esters of sulfonic acids by reaction of hydroxy compounds with sulfonic acids or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C303/00—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides
- C07C303/26—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of esters of sulfonic acids
- C07C303/30—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of esters of sulfonic acids by reactions not involving the formation of esterified sulfo groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US654,820 | 1984-09-26 | ||
| US06/654,820 US4751304A (en) | 1984-09-26 | 1984-09-26 | Process for preparing 5,6-dialkoxy-4-alkyl-2(1H)-quinazolinones |
| US654820 | 1984-09-26 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| KR860002477A KR860002477A (ko) | 1986-04-26 |
| KR870000498B1 true KR870000498B1 (ko) | 1987-03-12 |
Family
ID=24626374
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1019850007044A Expired KR870000498B1 (ko) | 1984-09-26 | 1985-09-25 | 5, 6-디알콕시-4-알킬-2(1h)-퀴나졸리논의 제조 방법 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4751304A (https=) |
| EP (1) | EP0177256A3 (https=) |
| KR (1) | KR870000498B1 (https=) |
| AU (1) | AU574841B2 (https=) |
| DK (1) | DK435085A (https=) |
| ES (3) | ES8700852A1 (https=) |
| FI (1) | FI853679A7 (https=) |
| GR (1) | GR852323B (https=) |
| HU (1) | HU196380B (https=) |
| IL (1) | IL76489A0 (https=) |
| NO (1) | NO853767L (https=) |
| NZ (1) | NZ213472A (https=) |
| PL (3) | PL261847A1 (https=) |
| PT (1) | PT81197B (https=) |
| RO (1) | RO92582B (https=) |
| YU (1) | YU149985A (https=) |
| ZA (1) | ZA857399B (https=) |
| ZW (1) | ZW17285A1 (https=) |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3759920A (en) * | 1971-06-24 | 1973-09-18 | Sandoz Ag | Process for the preparation of 1-substituted-phenyl-2(1h)-quinazolinones |
| AU533427B2 (en) * | 1978-12-07 | 1983-11-24 | Ortho Pharmaceutical Corporation | Substituted 2(1h) quinazolinones |
| US4656267A (en) * | 1983-09-29 | 1987-04-07 | Ortho Pharmaceutical Corporation | Substituted 2(1H)-quinazolinone-1-alkanoic acids and esters |
-
1984
- 1984-09-26 US US06/654,820 patent/US4751304A/en not_active Expired - Lifetime
-
1985
- 1985-09-13 NZ NZ213472A patent/NZ213472A/xx unknown
- 1985-09-23 RO RO120182A patent/RO92582B/ro unknown
- 1985-09-23 YU YU01499/85A patent/YU149985A/xx unknown
- 1985-09-23 GR GR852323A patent/GR852323B/el unknown
- 1985-09-24 IL IL76489A patent/IL76489A0/xx unknown
- 1985-09-25 NO NO853767A patent/NO853767L/no unknown
- 1985-09-25 KR KR1019850007044A patent/KR870000498B1/ko not_active Expired
- 1985-09-25 ZA ZA857399A patent/ZA857399B/xx unknown
- 1985-09-25 HU HU853641A patent/HU196380B/hu unknown
- 1985-09-25 AU AU47897/85A patent/AU574841B2/en not_active Ceased
- 1985-09-25 ZW ZW172/85A patent/ZW17285A1/xx unknown
- 1985-09-25 FI FI853679A patent/FI853679A7/fi not_active IP Right Cessation
- 1985-09-25 ES ES547266A patent/ES8700852A1/es not_active Expired
- 1985-09-25 DK DK435085A patent/DK435085A/da not_active Application Discontinuation
- 1985-09-25 EP EP85306811A patent/EP0177256A3/en not_active Withdrawn
- 1985-09-26 PT PT81197A patent/PT81197B/pt unknown
- 1985-09-26 PL PL1985261847A patent/PL261847A1/xx unknown
- 1985-09-26 PL PL25552685A patent/PL255526A1/xx unknown
- 1985-09-26 PL PL1985261848A patent/PL261848A1/xx unknown
-
1986
- 1986-04-30 ES ES554607A patent/ES8801640A1/es not_active Expired
- 1986-04-30 ES ES554608A patent/ES8707722A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| EP0177256A2 (en) | 1986-04-09 |
| FI853679L (fi) | 1986-03-27 |
| ES554607A0 (es) | 1988-01-01 |
| KR860002477A (ko) | 1986-04-26 |
| PT81197A (en) | 1985-10-01 |
| AU4789785A (en) | 1986-04-10 |
| FI853679A7 (fi) | 1986-03-27 |
| ES8801640A1 (es) | 1988-01-01 |
| NZ213472A (en) | 1988-06-30 |
| RO92582A (ro) | 1987-11-30 |
| US4751304A (en) | 1988-06-14 |
| DK435085A (da) | 1986-03-27 |
| ZA857399B (en) | 1987-05-27 |
| FI853679A0 (fi) | 1985-09-25 |
| NO853767L (no) | 1986-04-01 |
| RO92582B (ro) | 1987-12-01 |
| ZW17285A1 (en) | 1987-04-15 |
| PL261847A1 (en) | 1987-09-07 |
| ES547266A0 (es) | 1986-11-16 |
| ES8707722A1 (es) | 1987-08-16 |
| ES8700852A1 (es) | 1986-11-16 |
| YU149985A (en) | 1988-04-30 |
| PL261848A1 (en) | 1987-09-07 |
| DK435085D0 (da) | 1985-09-25 |
| ES554608A0 (es) | 1987-08-16 |
| IL76489A0 (en) | 1986-01-31 |
| PL255526A1 (en) | 1987-02-09 |
| EP0177256A3 (en) | 1987-04-15 |
| AU574841B2 (en) | 1988-07-14 |
| PT81197B (en) | 1987-03-30 |
| HU196380B (en) | 1988-11-28 |
| HUT40086A (en) | 1986-11-28 |
| GR852323B (https=) | 1986-01-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100669823B1 (ko) | 2-(4-클로로벤조일아미노)-3-[2(1h)-퀴놀리논-4-일]프로피온산의 제조방법 및 그 중간체 | |
| KR870000498B1 (ko) | 5, 6-디알콕시-4-알킬-2(1h)-퀴나졸리논의 제조 방법 | |
| JP3500660B2 (ja) | 2−置換−5−クロロイミダゾール−4−カルブァルデヒドの製造方法 | |
| US4634769A (en) | Process for the preparation of 8-halo-5,6-dialkoxyquinazoline-2,4-diones and their salts | |
| EP0634409A1 (en) | Process of producing 2-cyano-4-oxo-4H-benzopyran compounds | |
| KR100399854B1 (ko) | 살절지동물성옥사디아진중간체 | |
| US4804756A (en) | Process for preparing 5,6-dialkoxy-4-alkyl-2(1H)-quinazolinones | |
| US4528371A (en) | Process for preparing 6-(2-hydroxyphenyl)-3-pyridazinone | |
| KR910003630B1 (ko) | 벤조일 아세틱 에스테르 유도체 및 그 제조방법 | |
| US4731480A (en) | Process for preparing 2-acyl-3,4-dialkoxyanilines | |
| US4617417A (en) | Alkyl 2-carboalkoxy-3,4-dialkoxybenzenecarbamates and process for their preparation | |
| US4814458A (en) | Process for preparing 4-acetyl isoquinolinone compounds | |
| CZ282906B6 (cs) | Způsob přípravy kyseliny 2,2-dimethyl-5-(2,5-di methyl-phenoxy)pentanové, meziprodukty a způsob přípravy meziproduktů | |
| JPH0522709B2 (https=) | ||
| US4883787A (en) | Process for preparing 2-acyl-3, 4-dialkoxyanilines | |
| JP3224577B2 (ja) | 1,2,3,4−テトラヒドロキノリン及びその製造方法 | |
| US4267388A (en) | Process for producing ethynylbenzenes | |
| KR870001043B1 (ko) | 2-아닐리노니코틴산의 아실옥시알킬 에스테르의 제조방법 | |
| EP0212868B1 (en) | Process for preparing 2-acyl-3,4-dialkoxyanilines | |
| KR860000591B1 (ko) | 피리딘 카복실산 유도체의 제조방법 | |
| KR830002721B1 (ko) | 퀴놀린 카복실산 유도체의 제조방법 | |
| JPS59148770A (ja) | 2,4−ジクロロ−5−チアゾ−ルカルボキサルデヒドとその製造方法 | |
| KR930011037B1 (ko) | 퀴놀린 카르본산 유도체의 제조방법 | |
| KR920005417B1 (ko) | 디벤조티에핀 유도체의 제조방법 | |
| KR910002282B1 (ko) | 인덴 아세틱산 유도체의 제조방법 |