JPWO2021102288A5 - - Google Patents
Download PDFInfo
- Publication number
- JPWO2021102288A5 JPWO2021102288A5 JP2022529544A JP2022529544A JPWO2021102288A5 JP WO2021102288 A5 JPWO2021102288 A5 JP WO2021102288A5 JP 2022529544 A JP2022529544 A JP 2022529544A JP 2022529544 A JP2022529544 A JP 2022529544A JP WO2021102288 A5 JPWO2021102288 A5 JP WO2021102288A5
- Authority
- JP
- Japan
- Prior art keywords
- pyrido
- pyridin
- pyrimidin
- trifluoromethyl
- hydroxypropan
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- QMOPAFMMLWUTKI-UHFFFAOYSA-N 1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1=CC=C2C(O)=NC=NC2=C1 QMOPAFMMLWUTKI-UHFFFAOYSA-N 0.000 claims description 151
- 150000003839 salts Chemical class 0.000 claims description 59
- 150000001875 compounds Chemical class 0.000 claims description 53
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 claims description 35
- 238000011374 additional therapy Methods 0.000 claims description 27
- 125000000217 alkyl group Chemical group 0.000 claims description 23
- 206010028980 Neoplasm Diseases 0.000 claims description 22
- 239000003112 inhibitor Substances 0.000 claims description 22
- 201000011510 cancer Diseases 0.000 claims description 20
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 20
- 125000003118 aryl group Chemical group 0.000 claims description 19
- -1 isothiazoyl Chemical group 0.000 claims description 19
- 230000011664 signaling Effects 0.000 claims description 18
- 125000001313 C5-C10 heteroaryl group Chemical group 0.000 claims description 16
- 125000001475 halogen functional group Chemical group 0.000 claims description 16
- 239000008194 pharmaceutical composition Substances 0.000 claims description 16
- 125000006584 (C3-C10) heterocycloalkyl group Chemical group 0.000 claims description 15
- 201000010099 disease Diseases 0.000 claims description 15
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 15
- 125000001188 haloalkyl group Chemical group 0.000 claims description 14
- 125000004404 heteroalkyl group Chemical group 0.000 claims description 14
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 14
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 230000001404 mediated effect Effects 0.000 claims description 13
- 208000000102 Squamous Cell Carcinoma of Head and Neck Diseases 0.000 claims description 12
- 125000001072 heteroaryl group Chemical group 0.000 claims description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 10
- 150000002431 hydrogen Chemical group 0.000 claims description 10
- 125000004076 pyridyl group Chemical group 0.000 claims description 10
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 9
- 230000037361 pathway Effects 0.000 claims description 9
- 206010006187 Breast cancer Diseases 0.000 claims description 8
- 208000026310 Breast neoplasm Diseases 0.000 claims description 8
- 108010021064 CTLA-4 Antigen Proteins 0.000 claims description 8
- 102100039498 Cytotoxic T-lymphocyte protein 4 Human genes 0.000 claims description 8
- 101000666896 Homo sapiens V-type immunoglobulin domain-containing suppressor of T-cell activation Proteins 0.000 claims description 8
- 102100038282 V-type immunoglobulin domain-containing suppressor of T-cell activation Human genes 0.000 claims description 8
- 201000000459 head and neck squamous cell carcinoma Diseases 0.000 claims description 8
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 8
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 8
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 8
- 125000003107 substituted aryl group Chemical group 0.000 claims description 8
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 8
- 125000001544 thienyl group Chemical group 0.000 claims description 8
- 101001137987 Homo sapiens Lymphocyte activation gene 3 protein Proteins 0.000 claims description 7
- 102100020862 Lymphocyte activation gene 3 protein Human genes 0.000 claims description 7
- 108010074708 B7-H1 Antigen Proteins 0.000 claims description 6
- 229940045513 CTLA4 antagonist Drugs 0.000 claims description 6
- 206010009944 Colon cancer Diseases 0.000 claims description 6
- 102100024216 Programmed cell death 1 ligand 1 Human genes 0.000 claims description 6
- 206010060862 Prostate cancer Diseases 0.000 claims description 6
- 208000000236 Prostatic Neoplasms Diseases 0.000 claims description 6
- 208000006265 Renal cell carcinoma Diseases 0.000 claims description 6
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 6
- 230000001394 metastastic effect Effects 0.000 claims description 6
- 206010061289 metastatic neoplasm Diseases 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 206010044412 transitional cell carcinoma Diseases 0.000 claims description 6
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 5
- 229940076838 Immune checkpoint inhibitor Drugs 0.000 claims description 5
- 206010027476 Metastases Diseases 0.000 claims description 5
- 101100519207 Mus musculus Pdcd1 gene Proteins 0.000 claims description 5
- 230000001594 aberrant effect Effects 0.000 claims description 5
- 230000009702 cancer cell proliferation Effects 0.000 claims description 5
- 239000012274 immune-checkpoint protein inhibitor Substances 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 108060003951 Immunoglobulin Proteins 0.000 claims description 4
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims description 4
- 206010027480 Metastatic malignant melanoma Diseases 0.000 claims description 4
- 206010061902 Pancreatic neoplasm Diseases 0.000 claims description 4
- 101710089372 Programmed cell death protein 1 Proteins 0.000 claims description 4
- 206010041067 Small cell lung cancer Diseases 0.000 claims description 4
- 208000005718 Stomach Neoplasms Diseases 0.000 claims description 4
- 210000001744 T-lymphocyte Anatomy 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 4
- 125000002047 benzodioxolyl group Chemical group O1OC(C2=C1C=CC=C2)* 0.000 claims description 4
- 208000029742 colonic neoplasm Diseases 0.000 claims description 4
- 210000003236 esophagogastric junction Anatomy 0.000 claims description 4
- 206010017758 gastric cancer Diseases 0.000 claims description 4
- 208000005017 glioblastoma Diseases 0.000 claims description 4
- 102000018358 immunoglobulin Human genes 0.000 claims description 4
- 230000002401 inhibitory effect Effects 0.000 claims description 4
- 201000007270 liver cancer Diseases 0.000 claims description 4
- 208000014018 liver neoplasm Diseases 0.000 claims description 4
- 201000005202 lung cancer Diseases 0.000 claims description 4
- 208000020816 lung neoplasm Diseases 0.000 claims description 4
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 claims description 4
- 201000001441 melanoma Diseases 0.000 claims description 4
- 230000009401 metastasis Effects 0.000 claims description 4
- 208000021039 metastatic melanoma Diseases 0.000 claims description 4
- 208000002154 non-small cell lung carcinoma Diseases 0.000 claims description 4
- 201000002528 pancreatic cancer Diseases 0.000 claims description 4
- 208000008443 pancreatic carcinoma Diseases 0.000 claims description 4
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 claims description 4
- PAQYIEZTLSDLQO-UHFFFAOYSA-N pyrido[3,4-d]pyrimidine Chemical compound N1=CN=C2C=NC=CC2=C1 PAQYIEZTLSDLQO-UHFFFAOYSA-N 0.000 claims description 4
- 230000000306 recurrent effect Effects 0.000 claims description 4
- 208000000587 small cell lung carcinoma Diseases 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 201000011549 stomach cancer Diseases 0.000 claims description 4
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 4
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 claims description 4
- 208000023747 urothelial carcinoma Diseases 0.000 claims description 4
- PYTATFJADVVUHB-UHFFFAOYSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)CC(C)(C)O)C(=N1)C=1C=NC=CC=1 Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)CC(C)(C)O)C(=N1)C=1C=NC=CC=1 PYTATFJADVVUHB-UHFFFAOYSA-N 0.000 claims description 3
- JYCPLOLTTJFQLT-NSHDSACASA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C1=NC=C(C=C1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C1=NC=C(C=C1)C(F)(F)F JYCPLOLTTJFQLT-NSHDSACASA-N 0.000 claims description 3
- 230000004709 cell invasion Effects 0.000 claims description 3
- 201000010536 head and neck cancer Diseases 0.000 claims description 3
- 208000014829 head and neck neoplasm Diseases 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 210000004881 tumor cell Anatomy 0.000 claims description 3
- 102100023990 60S ribosomal protein L17 Human genes 0.000 claims description 2
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 2
- 206010005003 Bladder cancer Diseases 0.000 claims description 2
- 208000003174 Brain Neoplasms Diseases 0.000 claims description 2
- VRQAUWNDPHNOKS-ZDUSSCGKSA-N C1(CC1)C1=CC=C(C=N1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NN(C=1)C Chemical compound C1(CC1)C1=CC=C(C=N1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NN(C=1)C VRQAUWNDPHNOKS-ZDUSSCGKSA-N 0.000 claims description 2
- VOACGOMONUQHSJ-UHFFFAOYSA-N CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CC=C(C=C1)OC(F)(F)F Chemical compound CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CC=C(C=C1)OC(F)(F)F VOACGOMONUQHSJ-UHFFFAOYSA-N 0.000 claims description 2
- XDCPLVBTWGNJDT-LBPRGKRZSA-N CNC([C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C(F)(F)F)=O Chemical compound CNC([C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C(F)(F)F)=O XDCPLVBTWGNJDT-LBPRGKRZSA-N 0.000 claims description 2
- NWYXTFPCUUYBCH-INIZCTEOSA-N COC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CC=C(C=C1)C Chemical compound COC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CC=C(C=C1)C NWYXTFPCUUYBCH-INIZCTEOSA-N 0.000 claims description 2
- POYKOMYXWGLYPB-VIFPVBQESA-N ClC1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=CC=1 Chemical compound ClC1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=CC=1 POYKOMYXWGLYPB-VIFPVBQESA-N 0.000 claims description 2
- VMQOLUFOSHDWIW-UHFFFAOYSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)C2CN(CC2O)C)C(=N1)C=1C=NC=CC=1 Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)C2CN(CC2O)C)C(=N1)C=1C=NC=CC=1 VMQOLUFOSHDWIW-UHFFFAOYSA-N 0.000 claims description 2
- NUGQYNKGLMZETO-UHFFFAOYSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)CC(C(F)(F)F)O)C(=N1)C=1C=NN(C=1)C Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)CC(C(F)(F)F)O)C(=N1)C=1C=NN(C=1)C NUGQYNKGLMZETO-UHFFFAOYSA-N 0.000 claims description 2
- ULUNEIBSJOXIBW-UHFFFAOYSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)CC(C)(C)O)C(=N1)C1=CC(=CC=C1)F Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)CC(C)(C)O)C(=N1)C1=CC(=CC=C1)F ULUNEIBSJOXIBW-UHFFFAOYSA-N 0.000 claims description 2
- UGTYBDNOPRQEOD-UHFFFAOYSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)CC(C)(C)O)C(=N1)C=1C=NN(C=1)C Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)CC(C)(C)O)C(=N1)C=1C=NN(C=1)C UGTYBDNOPRQEOD-UHFFFAOYSA-N 0.000 claims description 2
- YWGICZNSXDLGLI-SFHVURJKSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)C[C@@H](C(F)(F)F)O)C(=N1)C1=CC(=CC=C1)F Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)C[C@@H](C(F)(F)F)O)C(=N1)C1=CC(=CC=C1)F YWGICZNSXDLGLI-SFHVURJKSA-N 0.000 claims description 2
- WVTWDBLNVCUZRE-QGZVFWFLSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)C[C@H](C(F)(F)F)O)C(=N1)C=1C=NC=CC=1 Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)C[C@H](C(F)(F)F)O)C(=N1)C=1C=NC=CC=1 WVTWDBLNVCUZRE-QGZVFWFLSA-N 0.000 claims description 2
- KHOQDQWIQRUPND-AWEZNQCLSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@@H](C)C(C)(C)O)C(=N1)C=1C=NC=CC=1 Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@@H](C)C(C)(C)O)C(=N1)C=1C=NC=CC=1 KHOQDQWIQRUPND-AWEZNQCLSA-N 0.000 claims description 2
- ZGIZLUFDECRSSN-MOPGFXCFSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@@H]2COC[C@@H]2O)C(=N1)C=1C=NC=CC=1 Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@@H]2COC[C@@H]2O)C(=N1)C=1C=NC=CC=1 ZGIZLUFDECRSSN-MOPGFXCFSA-N 0.000 claims description 2
- ZGIZLUFDECRSSN-RTBURBONSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@@H]2COC[C@H]2O)C(=N1)C=1C=NC=CC=1 Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@@H]2COC[C@H]2O)C(=N1)C=1C=NC=CC=1 ZGIZLUFDECRSSN-RTBURBONSA-N 0.000 claims description 2
- SGTWSTPQNMBRMB-CQSZACIVSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](C)C(C)(C)O)C(=N1)C1=CC(=CC=C1)F Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](C)C(C)(C)O)C(=N1)C1=CC(=CC=C1)F SGTWSTPQNMBRMB-CQSZACIVSA-N 0.000 claims description 2
- KHOQDQWIQRUPND-CQSZACIVSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](C)C(C)(C)O)C(=N1)C=1C=NC=CC=1 Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](C)C(C)(C)O)C(=N1)C=1C=NC=CC=1 KHOQDQWIQRUPND-CQSZACIVSA-N 0.000 claims description 2
- CETZOEQEQVJOGR-ZDUSSCGKSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C1=CC(=CC=C1)F Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C1=CC(=CC=C1)F CETZOEQEQVJOGR-ZDUSSCGKSA-N 0.000 claims description 2
- WJOVCKUZECZPDV-LBPRGKRZSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C1=CNC(C=C1)=O Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C1=CNC(C=C1)=O WJOVCKUZECZPDV-LBPRGKRZSA-N 0.000 claims description 2
- LWHAHVXXEFEYSQ-ZDUSSCGKSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=CC=1 Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=CC=1 LWHAHVXXEFEYSQ-ZDUSSCGKSA-N 0.000 claims description 2
- QQXHKWTTYBEJAT-LBPRGKRZSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NN(C=1)C Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NN(C=1)C QQXHKWTTYBEJAT-LBPRGKRZSA-N 0.000 claims description 2
- 208000030808 Clear cell renal carcinoma Diseases 0.000 claims description 2
- 208000001333 Colorectal Neoplasms Diseases 0.000 claims description 2
- 208000000461 Esophageal Neoplasms Diseases 0.000 claims description 2
- OJSOLXBNGJNEEP-OAQYLSRUSA-N FC=1C=C(C=C(C=1)F)C1=CC2=C(N=CN(C2=O)[C@H](CO)C(C)C)C(=N1)C1=CC(=CC(=C1)F)F Chemical compound FC=1C=C(C=C(C=1)F)C1=CC2=C(N=CN(C2=O)[C@H](CO)C(C)C)C(=N1)C1=CC(=CC(=C1)F)F OJSOLXBNGJNEEP-OAQYLSRUSA-N 0.000 claims description 2
- ZYZNCJCMUXPQDT-JOCHJYFZSA-N FC=1C=C(C=C(C=1)F)C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C(C)C)C1=CC=C(C=C1)C Chemical compound FC=1C=C(C=C(C=1)F)C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C(C)C)C1=CC=C(C=C1)C ZYZNCJCMUXPQDT-JOCHJYFZSA-N 0.000 claims description 2
- HJPPIFGAYKWKHO-HNNXBMFYSA-N FC=1C=C(C=CC=1)C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C)C1=CC=C(C=C1)C Chemical compound FC=1C=C(C=CC=1)C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C)C1=CC=C(C=C1)C HJPPIFGAYKWKHO-HNNXBMFYSA-N 0.000 claims description 2
- PNDJERZLQOXHKT-LBPRGKRZSA-N FC=1C=C(C=CC=1)C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C)C1=NC=C(C=C1)C(F)(F)F Chemical compound FC=1C=C(C=CC=1)C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C)C1=NC=C(C=C1)C(F)(F)F PNDJERZLQOXHKT-LBPRGKRZSA-N 0.000 claims description 2
- XXJULHKPLQLSKO-LBPRGKRZSA-N FC=1C=C(C=CC=1)C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C)C=1C=NC(=CC=1)C(F)(F)F Chemical compound FC=1C=C(C=CC=1)C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C)C=1C=NC(=CC=1)C(F)(F)F XXJULHKPLQLSKO-LBPRGKRZSA-N 0.000 claims description 2
- OMZLRJPKALMAJR-LBPRGKRZSA-N FC=1C=C(C=NC=1)C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C)C1=CC=C(C=C1)OC(F)(F)F Chemical compound FC=1C=C(C=NC=1)C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C)C1=CC=C(C=C1)OC(F)(F)F OMZLRJPKALMAJR-LBPRGKRZSA-N 0.000 claims description 2
- 201000001342 Fallopian tube cancer Diseases 0.000 claims description 2
- 208000013452 Fallopian tube neoplasm Diseases 0.000 claims description 2
- 206010017993 Gastrointestinal neoplasms Diseases 0.000 claims description 2
- 208000017604 Hodgkin disease Diseases 0.000 claims description 2
- 208000021519 Hodgkin lymphoma Diseases 0.000 claims description 2
- 208000010747 Hodgkins lymphoma Diseases 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 208000031671 Large B-Cell Diffuse Lymphoma Diseases 0.000 claims description 2
- 206010023856 Laryngeal squamous cell carcinoma Diseases 0.000 claims description 2
- 206010025323 Lymphomas Diseases 0.000 claims description 2
- 206010027406 Mesothelioma Diseases 0.000 claims description 2
- 208000034578 Multiple myelomas Diseases 0.000 claims description 2
- AGDPFZYPEVOXAE-UHFFFAOYSA-N N1=CC(=CC=C1)C1=CC2=C(N=CN(C2=O)CC(C(F)(F)F)O)C(=N1)C=1C=NC=CC=1 Chemical compound N1=CC(=CC=C1)C1=CC2=C(N=CN(C2=O)CC(C(F)(F)F)O)C(=N1)C=1C=NC=CC=1 AGDPFZYPEVOXAE-UHFFFAOYSA-N 0.000 claims description 2
- QLIRADXBVRNIOV-UHFFFAOYSA-N N1=CC(=CC=C1)C1=NC(=CC2=C1N=CN(C2=O)CC(C(F)(F)F)O)C1=CC=C(C=C1)OC(F)(F)F Chemical compound N1=CC(=CC=C1)C1=NC(=CC2=C1N=CN(C2=O)CC(C(F)(F)F)O)C1=CC=C(C=C1)OC(F)(F)F QLIRADXBVRNIOV-UHFFFAOYSA-N 0.000 claims description 2
- QGBIRZIQRGMEEX-INIZCTEOSA-N N1=CC(=CC=C1)C1=NC(=CC2=C1N=CN(C2=O)C[C@@H](C(F)(F)F)O)C=1C=NC(=CC=1)C(F)(F)F Chemical compound N1=CC(=CC=C1)C1=NC(=CC2=C1N=CN(C2=O)C[C@@H](C(F)(F)F)O)C=1C=NC(=CC=1)C(F)(F)F QGBIRZIQRGMEEX-INIZCTEOSA-N 0.000 claims description 2
- SKIRJDVMIVBYGI-MRXNPFEDSA-N N1=CC(=CC=C1)C1=NC(=CC2=C1N=CN(C2=O)C[C@H](C(F)(F)F)O)C1=NC=C(C=C1)C(F)(F)F Chemical compound N1=CC(=CC=C1)C1=NC(=CC2=C1N=CN(C2=O)C[C@H](C(F)(F)F)O)C1=NC=C(C=C1)C(F)(F)F SKIRJDVMIVBYGI-MRXNPFEDSA-N 0.000 claims description 2
- 208000001894 Nasopharyngeal Neoplasms Diseases 0.000 claims description 2
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 claims description 2
- SQKLIAQJMSFDLZ-LBPRGKRZSA-N O=C1C2=C(N=CN1[C@H](C(=O)OC)C)C(=NC(=C2)C=1C=NC(=CC=1)C(F)(F)F)C=1C=NC=CC=1 Chemical compound O=C1C2=C(N=CN1[C@H](C(=O)OC)C)C(=NC(=C2)C=1C=NC(=CC=1)C(F)(F)F)C=1C=NC=CC=1 SQKLIAQJMSFDLZ-LBPRGKRZSA-N 0.000 claims description 2
- LCHJWYJFHMUKCY-UHFFFAOYSA-N OC(CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=C1)C(F)(F)F)(C)C Chemical compound OC(CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=C1)C(F)(F)F)(C)C LCHJWYJFHMUKCY-UHFFFAOYSA-N 0.000 claims description 2
- MVTUETRIPARLSG-UHFFFAOYSA-N OC(CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C(F)(F)F)(C)C Chemical compound OC(CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C(F)(F)F)(C)C MVTUETRIPARLSG-UHFFFAOYSA-N 0.000 claims description 2
- IKJLOQPRYCXMKY-UHFFFAOYSA-N OC(CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NN(C=1)C)(C)C Chemical compound OC(CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NN(C=1)C)(C)C IKJLOQPRYCXMKY-UHFFFAOYSA-N 0.000 claims description 2
- IANNQWYCDZKKHJ-AWEZNQCLSA-N OC([C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC=CC=1)(C)C Chemical compound OC([C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC=CC=1)(C)C IANNQWYCDZKKHJ-AWEZNQCLSA-N 0.000 claims description 2
- NAHFHGBNDQVBTB-ZDUSSCGKSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C1=CC=NC=C1)C1=CC=NC=C1 Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C1=CC=NC=C1)C1=CC=NC=C1 NAHFHGBNDQVBTB-ZDUSSCGKSA-N 0.000 claims description 2
- JZPODHXWNLGNNR-LBPRGKRZSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C1=CC=NC=C1)C=1C=NC(=CC=1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C1=CC=NC=C1)C=1C=NC(=CC=1)C(F)(F)F JZPODHXWNLGNNR-LBPRGKRZSA-N 0.000 claims description 2
- ARYPZCNFHHHBQI-NSHDSACASA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C(=O)N(C)C Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C(=O)N(C)C ARYPZCNFHHHBQI-NSHDSACASA-N 0.000 claims description 2
- OWTMEACUDNWFNH-HNNXBMFYSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CC=C(C=C1)C Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CC=C(C=C1)C OWTMEACUDNWFNH-HNNXBMFYSA-N 0.000 claims description 2
- SWIPNGBTNNNDHW-ZDUSSCGKSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CC=C(C=C1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CC=C(C=C1)C(F)(F)F SWIPNGBTNNNDHW-ZDUSSCGKSA-N 0.000 claims description 2
- PWQQOEUTYNQZKU-ZDUSSCGKSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CC=C(C=C1)OC(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CC=C(C=C1)OC(F)(F)F PWQQOEUTYNQZKU-ZDUSSCGKSA-N 0.000 claims description 2
- FOCVQPYRGPGAPS-ZDUSSCGKSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CN=C(S1)C(C)C Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CN=C(S1)C(C)C FOCVQPYRGPGAPS-ZDUSSCGKSA-N 0.000 claims description 2
- WHVOEIXWFWHEOC-AWEZNQCLSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=C1)C Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=C1)C WHVOEIXWFWHEOC-AWEZNQCLSA-N 0.000 claims description 2
- GQPGJGBNNFMATF-LBPRGKRZSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=C1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=C1)C(F)(F)F GQPGJGBNNFMATF-LBPRGKRZSA-N 0.000 claims description 2
- SUPLSGDJYPWMKX-AWEZNQCLSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C SUPLSGDJYPWMKX-AWEZNQCLSA-N 0.000 claims description 2
- MOXVTIXLQNQFHE-LBPRGKRZSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C(F)(F)F MOXVTIXLQNQFHE-LBPRGKRZSA-N 0.000 claims description 2
- DNPBWBDUIIQSQZ-ZDUSSCGKSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC=CC=1 Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC=CC=1 DNPBWBDUIIQSQZ-ZDUSSCGKSA-N 0.000 claims description 2
- UNEGAKJXERGACA-ZDUSSCGKSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)N1CCOCC1 Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)N1CCOCC1 UNEGAKJXERGACA-ZDUSSCGKSA-N 0.000 claims description 2
- LSHZNKKDUVBCLE-LBPRGKRZSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C1=CC=C(C=C1)OC(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C1=CC=C(C=C1)OC(F)(F)F LSHZNKKDUVBCLE-LBPRGKRZSA-N 0.000 claims description 2
- BETHLTJRRSJHLL-VIFPVBQESA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C1=CN=C(S1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C1=CN=C(S1)C(F)(F)F BETHLTJRRSJHLL-VIFPVBQESA-N 0.000 claims description 2
- SIRVPUDSHWRCOV-JTQLQIEISA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NNC=1)C1=NC=C(C=C1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NNC=1)C1=NC=C(C=C1)C(F)(F)F SIRVPUDSHWRCOV-JTQLQIEISA-N 0.000 claims description 2
- COGSJSQIDWSBJT-LBPRGKRZSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2N1CCOCC1)C=1C=NC(=CC=1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2N1CCOCC1)C=1C=NC(=CC=1)C(F)(F)F COGSJSQIDWSBJT-LBPRGKRZSA-N 0.000 claims description 2
- UTLUFWOEMRPHPA-HZPDHXFCSA-N O[C@H]1[C@@H](COC1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NC(=CC=1)C(F)(F)F Chemical compound O[C@H]1[C@@H](COC1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NC(=CC=1)C(F)(F)F UTLUFWOEMRPHPA-HZPDHXFCSA-N 0.000 claims description 2
- 206010061882 Oesophageal neoplasm Diseases 0.000 claims description 2
- 206010061534 Oesophageal squamous cell carcinoma Diseases 0.000 claims description 2
- 206010033128 Ovarian cancer Diseases 0.000 claims description 2
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 2
- 208000000821 Parathyroid Neoplasms Diseases 0.000 claims description 2
- 206010035226 Plasma cell myeloma Diseases 0.000 claims description 2
- 206010035603 Pleural mesothelioma Diseases 0.000 claims description 2
- 206010039491 Sarcoma Diseases 0.000 claims description 2
- 208000000453 Skin Neoplasms Diseases 0.000 claims description 2
- 208000036765 Squamous cell carcinoma of the esophagus Diseases 0.000 claims description 2
- 229940126547 T-cell immunoglobulin mucin-3 Drugs 0.000 claims description 2
- 229940125555 TIGIT inhibitor Drugs 0.000 claims description 2
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 claims description 2
- 208000006593 Urologic Neoplasms Diseases 0.000 claims description 2
- 208000020790 biliary tract neoplasm Diseases 0.000 claims description 2
- 206010012818 diffuse large B-cell lymphoma Diseases 0.000 claims description 2
- 208000007276 esophageal squamous cell carcinoma Diseases 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 208000024519 eye neoplasm Diseases 0.000 claims description 2
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 claims description 2
- 201000006585 gastric adenocarcinoma Diseases 0.000 claims description 2
- 230000002496 gastric effect Effects 0.000 claims description 2
- 206010073071 hepatocellular carcinoma Diseases 0.000 claims description 2
- 231100000844 hepatocellular carcinoma Toxicity 0.000 claims description 2
- 208000028654 hypopharynx squamous cell carcinoma Diseases 0.000 claims description 2
- 230000005764 inhibitory process Effects 0.000 claims description 2
- 229960005386 ipilimumab Drugs 0.000 claims description 2
- 208000032839 leukemia Diseases 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 201000005243 lung squamous cell carcinoma Diseases 0.000 claims description 2
- 208000026045 malignant tumor of parathyroid gland Diseases 0.000 claims description 2
- 208000037819 metastatic cancer Diseases 0.000 claims description 2
- 208000011575 metastatic malignant neoplasm Diseases 0.000 claims description 2
- 208000025402 neoplasm of esophagus Diseases 0.000 claims description 2
- 229960003301 nivolumab Drugs 0.000 claims description 2
- 208000016450 non-cutaneous melanoma Diseases 0.000 claims description 2
- 201000008106 ocular cancer Diseases 0.000 claims description 2
- 210000000056 organ Anatomy 0.000 claims description 2
- 208000010918 peritoneal neoplasm Diseases 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-M picolinate Chemical compound [O-]C(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-M 0.000 claims description 2
- 229940081066 picolinic acid Drugs 0.000 claims description 2
- 210000002345 respiratory system Anatomy 0.000 claims description 2
- 201000000849 skin cancer Diseases 0.000 claims description 2
- 206010041823 squamous cell carcinoma Diseases 0.000 claims description 2
- 201000005112 urinary bladder cancer Diseases 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims 8
- 125000000027 (C1-C10) alkoxy group Chemical group 0.000 claims 5
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims 2
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims 1
- DTNPTWIQRWDQNA-RTBURBONSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@@H]2CNC[C@H]2O)C(=N1)C=1C=NC=CC=1 Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@@H]2CNC[C@H]2O)C(=N1)C=1C=NC=CC=1 DTNPTWIQRWDQNA-RTBURBONSA-N 0.000 claims 1
- ZGIZLUFDECRSSN-OALUTQOASA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H]2COC[C@@H]2O)C(=N1)C=1C=NC=CC=1 Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H]2COC[C@@H]2O)C(=N1)C=1C=NC=CC=1 ZGIZLUFDECRSSN-OALUTQOASA-N 0.000 claims 1
- DFSDHYYPEUYCTH-UHFFFAOYSA-N N1=CC(=CC=C1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C(F)(F)F Chemical compound N1=CC(=CC=C1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C(F)(F)F DFSDHYYPEUYCTH-UHFFFAOYSA-N 0.000 claims 1
- YDWIEOSWIGHLRR-UHFFFAOYSA-N OC(CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NC(=NC=1)C(F)(F)F)(C)C Chemical compound OC(CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NC(=NC=1)C(F)(F)F)(C)C YDWIEOSWIGHLRR-UHFFFAOYSA-N 0.000 claims 1
- YKVSDQSXBIBIIS-LBPRGKRZSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)CCOC Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)CCOC YKVSDQSXBIBIIS-LBPRGKRZSA-N 0.000 claims 1
- OIWYCSHTKXNGCD-SJORKVTESA-N O[C@@H]1[C@@H](COC1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C(F)(F)F Chemical compound O[C@@H]1[C@@H](COC1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C(F)(F)F OIWYCSHTKXNGCD-SJORKVTESA-N 0.000 claims 1
- SLSPTSBOSBVXSA-ZWKOTPCHSA-N O[C@H]1[C@H](COC1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=C1)C(F)(F)F Chemical compound O[C@H]1[C@H](COC1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=C1)C(F)(F)F SLSPTSBOSBVXSA-ZWKOTPCHSA-N 0.000 claims 1
- UTLUFWOEMRPHPA-JKSUJKDBSA-N O[C@H]1[C@H](COC1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NC(=CC=1)C(F)(F)F Chemical compound O[C@H]1[C@H](COC1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NC(=CC=1)C(F)(F)F UTLUFWOEMRPHPA-JKSUJKDBSA-N 0.000 claims 1
- 208000024770 Thyroid neoplasm Diseases 0.000 claims 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims 1
- 210000004392 genitalia Anatomy 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 claims 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 claims 1
- 235000019260 propionic acid Nutrition 0.000 claims 1
- 230000004043 responsiveness Effects 0.000 claims 1
- 201000002510 thyroid cancer Diseases 0.000 claims 1
- 238000000034 method Methods 0.000 description 59
- 125000003545 alkoxy group Chemical group 0.000 description 5
- 125000003838 furazanyl group Chemical group 0.000 description 4
- 125000002541 furyl group Chemical group 0.000 description 4
- 125000002883 imidazolyl group Chemical group 0.000 description 4
- 125000001715 oxadiazolyl group Chemical group 0.000 description 4
- 125000002971 oxazolyl group Chemical group 0.000 description 4
- 125000003373 pyrazinyl group Chemical group 0.000 description 4
- 125000002098 pyridazinyl group Chemical group 0.000 description 4
- 125000000168 pyrrolyl group Chemical group 0.000 description 4
- 125000003831 tetrazolyl group Chemical group 0.000 description 4
- 125000000335 thiazolyl group Chemical group 0.000 description 4
- 125000001425 triazolyl group Chemical group 0.000 description 4
- 125000003386 piperidinyl group Chemical group 0.000 description 3
- JFHMGYQPQJYPCZ-UHFFFAOYSA-N 2-piperidin-1-ylethyl n-(2-decoxyphenyl)carbamate Chemical compound CCCCCCCCCCOC1=CC=CC=C1NC(=O)OCCN1CCCCC1 JFHMGYQPQJYPCZ-UHFFFAOYSA-N 0.000 description 2
- 125000000041 C6-C10 aryl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 230000008685 targeting Effects 0.000 description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- PXTORIVZUXMYOJ-LBPRGKRZSA-N C(C)N(C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C)C=1C=NC(=CC=1)C(F)(F)F)CC Chemical compound C(C)N(C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C)C=1C=NC(=CC=1)C(F)(F)F)CC PXTORIVZUXMYOJ-LBPRGKRZSA-N 0.000 description 1
- FLNGMWBWEIRWKS-AWEZNQCLSA-N C1(=CCCCC1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=CC=1 Chemical compound C1(=CCCCC1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=CC=1 FLNGMWBWEIRWKS-AWEZNQCLSA-N 0.000 description 1
- AGPWFCIOSDIVCN-AWEZNQCLSA-N C1(CC1)C1=CC=C(C=N1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=CC=1 Chemical compound C1(CC1)C1=CC=C(C=N1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=CC=1 AGPWFCIOSDIVCN-AWEZNQCLSA-N 0.000 description 1
- XISWQBRMSMSESZ-LBPRGKRZSA-N C1(CC1)C=1SC(=CN=1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=CC=1 Chemical compound C1(CC1)C=1SC(=CN=1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=CC=1 XISWQBRMSMSESZ-LBPRGKRZSA-N 0.000 description 1
- KOGLVSGFWCJXRQ-AWEZNQCLSA-N C1(CCCCC1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=CC=1 Chemical compound C1(CCCCC1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=CC=1 KOGLVSGFWCJXRQ-AWEZNQCLSA-N 0.000 description 1
- HHHXUJXXWCNRBY-ZDUSSCGKSA-N C1(CCCCC1)C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C)C1=NC=C(C=C1)C(F)(F)F Chemical compound C1(CCCCC1)C1=NC(=CC2=C1N=CN(C2=O)[C@H](CO)C)C1=NC=C(C=C1)C(F)(F)F HHHXUJXXWCNRBY-ZDUSSCGKSA-N 0.000 description 1
- CBLHBTJYWDAPLS-HNNXBMFYSA-N CN1N=CC(=C1)C1=NC(=CC2=C1N=CN(C2=O)C[C@@H](C(F)(F)F)O)C1=NC=C(C=C1)C(F)(F)F Chemical compound CN1N=CC(=C1)C1=NC(=CC2=C1N=CN(C2=O)C[C@@H](C(F)(F)F)O)C1=NC=C(C=C1)C(F)(F)F CBLHBTJYWDAPLS-HNNXBMFYSA-N 0.000 description 1
- GHUDDFGUPRHSFL-HNNXBMFYSA-N CN1N=CC(=C1)C1=NC(=CC2=C1N=CN(C2=O)C[C@@H](C(F)(F)F)O)C=1C=NC(=CC=1)C(F)(F)F Chemical compound CN1N=CC(=C1)C1=NC(=CC2=C1N=CN(C2=O)C[C@@H](C(F)(F)F)O)C=1C=NC(=CC=1)C(F)(F)F GHUDDFGUPRHSFL-HNNXBMFYSA-N 0.000 description 1
- FMNOTQYTVHXVBZ-ZDUSSCGKSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C1=CN(C(C=C1)=O)C Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C1=CN(C(C=C1)=O)C FMNOTQYTVHXVBZ-ZDUSSCGKSA-N 0.000 description 1
- LXKPXXVICSBORB-AWEZNQCLSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)N1CCCCC1 Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)N1CCCCC1 LXKPXXVICSBORB-AWEZNQCLSA-N 0.000 description 1
- WQAFGUCVFNLJCL-ROUUACIJSA-N ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H]2COC[C@@H]2O)C(=N1)C=1C=NN(C=1)C Chemical compound ClC1=CC=C(C=C1)C1=CC2=C(N=CN(C2=O)[C@H]2COC[C@@H]2O)C(=N1)C=1C=NN(C=1)C WQAFGUCVFNLJCL-ROUUACIJSA-N 0.000 description 1
- YJUAVNPTYGOQBT-NSHDSACASA-N FC=1C=C(C=NC=1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=C(C=1)F Chemical compound FC=1C=C(C=NC=1)C1=CC2=C(N=CN(C2=O)[C@H](CO)C)C(=N1)C=1C=NC=C(C=1)F YJUAVNPTYGOQBT-NSHDSACASA-N 0.000 description 1
- 229940125563 LAG3 inhibitor Drugs 0.000 description 1
- QLIRADXBVRNIOV-QGZVFWFLSA-N N1=CC(=CC=C1)C1=NC(=CC2=C1N=CN(C2=O)C[C@H](C(F)(F)F)O)C1=CC=C(C=C1)OC(F)(F)F Chemical compound N1=CC(=CC=C1)C1=NC(=CC2=C1N=CN(C2=O)C[C@H](C(F)(F)F)O)C1=CC=C(C=C1)OC(F)(F)F QLIRADXBVRNIOV-QGZVFWFLSA-N 0.000 description 1
- MLWKNHLZIYICOW-NSHDSACASA-N O=C1C2=C(N=CN1[C@H](C(=O)O)C)C(=NC(=C2)C=1C=NC(=CC=1)C(F)(F)F)C=1C=NC=CC=1 Chemical compound O=C1C2=C(N=CN1[C@H](C(=O)O)C)C(=NC(=C2)C=1C=NC(=CC=1)C(F)(F)F)C=1C=NC=CC=1 MLWKNHLZIYICOW-NSHDSACASA-N 0.000 description 1
- JKVONVOZDKYSEX-UHFFFAOYSA-N OC(CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NSC=1)C1=NC=C(C=C1)C(F)(F)F)(C)C Chemical compound OC(CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NSC=1)C1=NC=C(C=C1)C(F)(F)F)(C)C JKVONVOZDKYSEX-UHFFFAOYSA-N 0.000 description 1
- RURITXWVXFWJRH-UHFFFAOYSA-N OC(CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NSC=1)C=1C=NC(=CC=1)C(F)(F)F)(C)C Chemical compound OC(CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NSC=1)C=1C=NC(=CC=1)C(F)(F)F)(C)C RURITXWVXFWJRH-UHFFFAOYSA-N 0.000 description 1
- UIYMLDGYPVRKCY-LBPRGKRZSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C1=NC=CC=C1)C=1C=NC(=CC=1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C1=NC=CC=C1)C=1C=NC(=CC=1)C(F)(F)F UIYMLDGYPVRKCY-LBPRGKRZSA-N 0.000 description 1
- CZCVSOVKTKGLDO-LBPRGKRZSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C(=NC=CC=1)C)C=1C=NC(=CC=1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C(=NC=CC=1)C)C=1C=NC(=CC=1)C(F)(F)F CZCVSOVKTKGLDO-LBPRGKRZSA-N 0.000 description 1
- LQQIIJOJRMHUEO-NSHDSACASA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CN=C(S1)C Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CN=C(S1)C LQQIIJOJRMHUEO-NSHDSACASA-N 0.000 description 1
- JNQRUJHGMZQICB-NSHDSACASA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CN=CS1 Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CN=CS1 JNQRUJHGMZQICB-NSHDSACASA-N 0.000 description 1
- IYMBWIDBZBXGEA-NSHDSACASA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CN=NN1C Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=CN=NN1C IYMBWIDBZBXGEA-NSHDSACASA-N 0.000 description 1
- NNKUPXJCQJOBTM-ZDUSSCGKSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=N1)C Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=N1)C NNKUPXJCQJOBTM-ZDUSSCGKSA-N 0.000 description 1
- HMTQGWFMNDWZQA-NSHDSACASA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=NC=1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=NC=1)C(F)(F)F HMTQGWFMNDWZQA-NSHDSACASA-N 0.000 description 1
- CVCNXAFIIUQSHY-NSHDSACASA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NSC=1 Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NSC=1 CVCNXAFIIUQSHY-NSHDSACASA-N 0.000 description 1
- FNKXWWGSMNVBJA-NSHDSACASA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1N=C(SC=1)C Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1N=C(SC=1)C FNKXWWGSMNVBJA-NSHDSACASA-N 0.000 description 1
- QMTDHZWGVXRUJF-NSHDSACASA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NC(=CC=1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NC(=CC=1)C(F)(F)F QMTDHZWGVXRUJF-NSHDSACASA-N 0.000 description 1
- QQRSWRZPOLPHSS-JTQLQIEISA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NC(=NC=1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NC(=NC=1)C(F)(F)F QQRSWRZPOLPHSS-JTQLQIEISA-N 0.000 description 1
- NHGUZSWFVLYLEK-JTQLQIEISA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NSC=1)C1=NC=C(C=C1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NSC=1)C1=NC=C(C=C1)C(F)(F)F NHGUZSWFVLYLEK-JTQLQIEISA-N 0.000 description 1
- VFAUPQDBNFJHMD-ZDUSSCGKSA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2N1CCCCC1)C=1C=NC(=CC=1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2N1CCCCC1)C=1C=NC(=CC=1)C(F)(F)F VFAUPQDBNFJHMD-ZDUSSCGKSA-N 0.000 description 1
- VTBPNVPMBNXDRX-JTQLQIEISA-N OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2N1N=CN=C1)C=1C=NC(=CC=1)C(F)(F)F Chemical compound OC[C@H](C)N1C=NC2=C(C1=O)C=C(N=C2N1N=CN=C1)C=1C=NC(=CC=1)C(F)(F)F VTBPNVPMBNXDRX-JTQLQIEISA-N 0.000 description 1
- SKCOUQFFAYFCMC-GFCCVEGCSA-N O[C@@H](CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=C1)C(F)(F)F)C Chemical compound O[C@@H](CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=C1)C(F)(F)F)C SKCOUQFFAYFCMC-GFCCVEGCSA-N 0.000 description 1
- UTLUFWOEMRPHPA-HOTGVXAUSA-N O[C@@H]1[C@H](COC1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NC(=CC=1)C(F)(F)F Chemical compound O[C@@H]1[C@H](COC1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C=1C=NC(=CC=1)C(F)(F)F UTLUFWOEMRPHPA-HOTGVXAUSA-N 0.000 description 1
- SKCOUQFFAYFCMC-LBPRGKRZSA-N O[C@H](CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=C1)C(F)(F)F)C Chemical compound O[C@H](CN1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C1=NC=C(C=C1)C(F)(F)F)C SKCOUQFFAYFCMC-LBPRGKRZSA-N 0.000 description 1
- XBUBQGJJMAEUOQ-IAGOWNOFSA-N O[C@H]1[C@@H](COC1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C1=NC=C(C=C1)C(F)(F)F Chemical compound O[C@H]1[C@@H](COC1)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NN(C=1)C)C1=NC=C(C=C1)C(F)(F)F XBUBQGJJMAEUOQ-IAGOWNOFSA-N 0.000 description 1
- WBTSHDHMSZVFFN-MJXNMMHHSA-N O[C@H]1[C@@H](COC1)NC([C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C(F)(F)F)=O Chemical compound O[C@H]1[C@@H](COC1)NC([C@H](C)N1C=NC2=C(C1=O)C=C(N=C2C=1C=NC=CC=1)C=1C=NC(=CC=1)C(F)(F)F)=O WBTSHDHMSZVFFN-MJXNMMHHSA-N 0.000 description 1
- 229960003852 atezolizumab Drugs 0.000 description 1
- 229950002916 avelumab Drugs 0.000 description 1
- 229950007712 camrelizumab Drugs 0.000 description 1
- 229940121420 cemiplimab Drugs 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 229950009791 durvalumab Drugs 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 229960002621 pembrolizumab Drugs 0.000 description 1
- 125000004943 pyrimidin-6-yl group Chemical group N1=CN=CC=C1* 0.000 description 1
- 201000011453 reproductive organ cancer Diseases 0.000 description 1
- 208000015608 reproductive system cancer Diseases 0.000 description 1
- 229940121497 sintilimab Drugs 0.000 description 1
- 229950007213 spartalizumab Drugs 0.000 description 1
- 208000013077 thyroid gland carcinoma Diseases 0.000 description 1
- 229950007123 tislelizumab Drugs 0.000 description 1
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201962939377P | 2019-11-22 | 2019-11-22 | |
| US62/939,377 | 2019-11-22 | ||
| US202063050416P | 2020-07-10 | 2020-07-10 | |
| US63/050,416 | 2020-07-10 | ||
| US202063091192P | 2020-10-13 | 2020-10-13 | |
| US63/091,192 | 2020-10-13 | ||
| PCT/US2020/061548 WO2021102288A1 (en) | 2019-11-22 | 2020-11-20 | Pyridopyrimidinone derivatives as ahr antagonists |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2023502476A JP2023502476A (ja) | 2023-01-24 |
| JPWO2021102288A5 true JPWO2021102288A5 (es) | 2023-11-27 |
Family
ID=73854915
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2022529544A Pending JP2023502476A (ja) | 2019-11-22 | 2020-11-20 | Ａｈｒアンタゴニストとしてのピリドピリミジノン誘導体 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US20230295152A1 (es) |
| EP (1) | EP4061484A1 (es) |
| JP (1) | JP2023502476A (es) |
| KR (1) | KR20220119537A (es) |
| CN (1) | CN115397512A (es) |
| AU (1) | AU2020386967A1 (es) |
| BR (1) | BR112022009805A2 (es) |
| CA (1) | CA3162236A1 (es) |
| CL (1) | CL2022001337A1 (es) |
| CO (1) | CO2022008606A2 (es) |
| IL (1) | IL293103A (es) |
| MX (1) | MX2022006086A (es) |
| WO (1) | WO2021102288A1 (es) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20230147257A1 (en) * | 2020-04-17 | 2023-05-11 | Dong-A St Co., Ltd. | Pyridopyrimidinone derivatives and their use as aryl hydrocarbon receptor modulators |
| US20230381182A1 (en) | 2020-10-13 | 2023-11-30 | Senda Biosciences, Inc. | Biomarkers Related to Immune Checkpoint Inhibitor Therapy and Methods of Using the Same |
| CN114644627B (zh) * | 2020-12-18 | 2024-06-11 | 山东轩竹医药科技有限公司 | AhR抑制剂及其用途 |
| WO2022217042A1 (en) * | 2021-04-09 | 2022-10-13 | Ikena Oncology, Inc. | Naphthyl-substituted quinoline-4(1h)-ones and related compounds and their use in treating medical conditions |
| CN115093400B (zh) * | 2021-09-18 | 2023-09-05 | 北京华森英诺生物科技有限公司 | AhR抑制剂及其用途和制备方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2846657B1 (fr) * | 2002-11-05 | 2004-12-24 | Servier Lab | Nouveaux composes pyridopyrimidinone, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| MX2019012431A (es) * | 2017-04-21 | 2020-08-03 | Ikena Oncology Inc | Inhibidores del receptor de hidrocarburos de arilo (ahr) de indol y usos de los mismos. |
| EP3749669B1 (en) * | 2018-02-06 | 2023-03-08 | Ideaya Biosciences, Inc. | Ahr modulators |
| CN111961034A (zh) * | 2019-05-20 | 2020-11-20 | 浙江同源康医药股份有限公司 | 用作ret激酶抑制剂的化合物及其应用 |
| US20230147257A1 (en) * | 2020-04-17 | 2023-05-11 | Dong-A St Co., Ltd. | Pyridopyrimidinone derivatives and their use as aryl hydrocarbon receptor modulators |
-
2020
- 2020-11-20 WO PCT/US2020/061548 patent/WO2021102288A1/en unknown
- 2020-11-20 CN CN202080096897.6A patent/CN115397512A/zh active Pending
- 2020-11-20 CA CA3162236A patent/CA3162236A1/en active Pending
- 2020-11-20 JP JP2022529544A patent/JP2023502476A/ja active Pending
- 2020-11-20 AU AU2020386967A patent/AU2020386967A1/en active Pending
- 2020-11-20 US US17/756,243 patent/US20230295152A1/en active Pending
- 2020-11-20 IL IL293103A patent/IL293103A/en unknown
- 2020-11-20 KR KR1020227021077A patent/KR20220119537A/ko unknown
- 2020-11-20 BR BR112022009805A patent/BR112022009805A2/pt unknown
- 2020-11-20 MX MX2022006086A patent/MX2022006086A/es unknown
- 2020-11-20 EP EP20825321.1A patent/EP4061484A1/en active Pending
-
2022
- 2022-05-20 CL CL2022001337A patent/CL2022001337A1/es unknown
- 2022-06-17 CO CONC2022/0008606A patent/CO2022008606A2/es unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US10017493B2 (en) | 2-(2,4,5-substituted-anilino)pyrimidine compounds | |
| AU659235B2 (en) | Substituted biphenylpyridones | |
| JP2023502476A (ja) | Ａｈｒアンタゴニストとしてのピリドピリミジノン誘導体 | |
| KR101838093B1 (ko) | 1,2,4-트리아진-4-아민 유도체들 | |
| RU2749111C2 (ru) | Производные тиазолопиридина как агонисты gpr119 | |
| WO2010117425A1 (en) | Certain substituted pyrimidines, pharmaceutical compositions thereof, and methods for their use | |
| TW200813042A (en) | Six membered heteroaromatic inhibitors targeting resistant kinase mutations | |
| EP1147093A1 (en) | Substituted bicyclic derivatives useful as anticancer agents | |
| TW200413330A (en) | Compounds for the treatment of abnormal cell growth | |
| CN104582707B (zh) | 三嗪化合物 | |
| OA12291A (en) | Substituted bicyclic derivatives for the treatmentof abnormal cell growth. | |
| JP2000515114A (ja) | キナゾリン誘導体 | |
| WO2007013964A1 (en) | Pyrazolo pyrimidines useful as aurora kinase inhibitors | |
| NZ274978A (en) | 1n-alkyl-n-aryl pyrimidinamine derivatives and pharmaceutical compositions thereof | |
| JPWO2021102288A5 (es) | ||
| KR20150140688A (ko) | 치환된 인돌-5-올 유도체와 그들의 치료적 용도 | |
| JP2008502678A5 (es) | ||
| PL97040B1 (pl) | Sposob wytwarzania 3-fluorobenzodwuazepin-2-onow | |
| CA3149846A1 (en) | Quinoline derivatives as protein kinase inhibitors | |
| WO2024110608A1 (en) | Pyridine derivatives as protein kinase inhibitors | |
| Saleh | Common grammatical tools | |
| PL174330B1 (pl) | Nowe pochodne 3-oksadiazolilo-5,6,7,8-tetrahydro-1,6-naftyrydyny, nowe pochodne 5,6,7,8-tetrahydro-1,6-naftyrydyny oraz sposób otrzymywania pochodnych 1,6-naftyrydyny | |
| RU2022112049A (ru) | Производные 1,2,4-триазин-4-амина | |
| EP4228649A1 (en) | Biomarkers related to immune checkpoint inhibitor therapy and methods of using the same | |
| CA3211588A1 (en) | Novel pyrimidine derivative showing inhibition effect on growth of cancer cells |