JPWO2020113182A5 - - Google Patents
Download PDFInfo
- Publication number
- JPWO2020113182A5 JPWO2020113182A5 JP2021530785A JP2021530785A JPWO2020113182A5 JP WO2020113182 A5 JPWO2020113182 A5 JP WO2020113182A5 JP 2021530785 A JP2021530785 A JP 2021530785A JP 2021530785 A JP2021530785 A JP 2021530785A JP WO2020113182 A5 JPWO2020113182 A5 JP WO2020113182A5
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- substituted
- group
- unsubstituted
- haloalkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 125000000217 alkyl group Chemical group 0.000 claims description 186
- 238000000034 method Methods 0.000 claims description 114
- 210000004027 cell Anatomy 0.000 claims description 81
- 229910052739 hydrogen Inorganic materials 0.000 claims description 74
- 239000001257 hydrogen Substances 0.000 claims description 74
- 229910052757 nitrogen Inorganic materials 0.000 claims description 72
- 125000003118 aryl group Chemical group 0.000 claims description 70
- 125000004429 atom Chemical group 0.000 claims description 66
- 229910052760 oxygen Inorganic materials 0.000 claims description 66
- 229910052717 sulfur Inorganic materials 0.000 claims description 66
- 125000001313 C5-C10 heteroaryl group Chemical group 0.000 claims description 64
- 125000001424 substituent group Chemical group 0.000 claims description 46
- 125000005843 halogen group Chemical group 0.000 claims description 43
- 210000000822 natural killer cell Anatomy 0.000 claims description 43
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 42
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 40
- 210000000130 stem cell Anatomy 0.000 claims description 37
- 150000002431 hydrogen Chemical group 0.000 claims description 32
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 31
- 102000003812 Interleukin-15 Human genes 0.000 claims description 25
- 108090000172 Interleukin-15 Proteins 0.000 claims description 25
- 210000003958 hematopoietic stem cell Anatomy 0.000 claims description 25
- 239000003795 chemical substances by application Substances 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 17
- 230000001483 mobilizing effect Effects 0.000 claims description 17
- 210000004881 tumor cell Anatomy 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 16
- 238000012258 culturing Methods 0.000 claims description 15
- 125000004076 pyridyl group Chemical group 0.000 claims description 14
- 108010002350 Interleukin-2 Proteins 0.000 claims description 11
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- 125000001041 indolyl group Chemical group 0.000 claims description 10
- 239000003055 low molecular weight heparin Substances 0.000 claims description 9
- 229940127215 low-molecular weight heparin Drugs 0.000 claims description 9
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 8
- 101000581981 Homo sapiens Neural cell adhesion molecule 1 Proteins 0.000 claims description 6
- 102100027347 Neural cell adhesion molecule 1 Human genes 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 230000003169 placental effect Effects 0.000 claims description 6
- 102000036693 Thrombopoietin Human genes 0.000 claims description 5
- 108010041111 Thrombopoietin Proteins 0.000 claims description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 5
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 102100031573 Hematopoietic progenitor cell antigen CD34 Human genes 0.000 claims description 3
- 101000777663 Homo sapiens Hematopoietic progenitor cell antigen CD34 Proteins 0.000 claims description 3
- ABSAMUXAJIDSDV-UHFFFAOYSA-N 4-[2-[[2-(1-benzothiophen-3-yl)-6-(propan-2-ylamino)pyrimidin-4-yl]amino]ethyl]phenol Chemical compound S1C2=C(C(=C1)C1=NC(=CC(=N1)NCCC1=CC=C(C=C1)O)NC(C)C)C=CC=C2 ABSAMUXAJIDSDV-UHFFFAOYSA-N 0.000 claims description 2
- WXGBFZQQIJLBJB-UHFFFAOYSA-N 4-[2-[[2-(1-benzothiophen-3-yl)-7-propan-2-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]phenol Chemical compound S1C2=C(C(=C1)C=1N=C(C3=C(N=1)N(CC3)C(C)C)NCCC1=CC=C(C=C1)O)C=CC=C2 WXGBFZQQIJLBJB-UHFFFAOYSA-N 0.000 claims description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 2
- PRBDPDPBQUOWJI-UHFFFAOYSA-N 5-[6-(butan-2-ylamino)-2-[2-(1H-indol-3-yl)ethylamino]pyrimidin-4-yl]pyridine-3-carbonitrile Chemical compound N1C=C(C2=CC=CC=C12)CCNC1=NC(=CC(=N1)C=1C=NC=C(C#N)C=1)NC(C)CC PRBDPDPBQUOWJI-UHFFFAOYSA-N 0.000 claims description 2
- 108010017080 Granulocyte Colony-Stimulating Factor Proteins 0.000 claims description 2
- 102000004269 Granulocyte Colony-Stimulating Factor Human genes 0.000 claims description 2
- 108010017213 Granulocyte-Macrophage Colony-Stimulating Factor Proteins 0.000 claims description 2
- 108090001005 Interleukin-6 Proteins 0.000 claims description 2
- 102000004889 Interleukin-6 Human genes 0.000 claims description 2
- 108010002586 Interleukin-7 Proteins 0.000 claims description 2
- 102000000704 Interleukin-7 Human genes 0.000 claims description 2
- 238000001727 in vivo Methods 0.000 claims description 2
- 230000002401 inhibitory effect Effects 0.000 claims description 2
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims 22
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 claims 2
- 102000004457 Granulocyte-Macrophage Colony-Stimulating Factor Human genes 0.000 claims 1
- 102100020880 Kit ligand Human genes 0.000 claims 1
- 101710177504 Kit ligand Proteins 0.000 claims 1
- 230000004663 cell proliferation Effects 0.000 claims 1
- 125000001188 haloalkyl group Chemical group 0.000 description 52
- -1 SNHG9 Proteins 0.000 description 12
- 210000005259 peripheral blood Anatomy 0.000 description 6
- 239000011886 peripheral blood Substances 0.000 description 6
- 102100028467 Perforin-1 Human genes 0.000 description 5
- 239000003550 marker Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 102100022886 ADP-ribosylation factor-like protein 4C Human genes 0.000 description 3
- 102100038820 Actin-related protein 2/3 complex subunit 1B Human genes 0.000 description 3
- 102100033892 Actin-related protein 2/3 complex subunit 5 Human genes 0.000 description 3
- 102100038910 Alpha-enolase Human genes 0.000 description 3
- 102100034613 Annexin A2 Human genes 0.000 description 3
- 102100029647 Apoptosis-associated speck-like protein containing a CARD Human genes 0.000 description 3
- 102100023579 Autophagy-related protein 2 homolog A Human genes 0.000 description 3
- 102100034673 C-C motif chemokine 3-like 1 Human genes 0.000 description 3
- 102100031650 C-X-C chemokine receptor type 4 Human genes 0.000 description 3
- 102100031024 CCR4-NOT transcription complex subunit 1 Human genes 0.000 description 3
- 102100022002 CD59 glycoprotein Human genes 0.000 description 3
- 101100140896 Caenorhabditis elegans rgs-2 gene Proteins 0.000 description 3
- 102100033086 Calcium/calmodulin-dependent protein kinase type 1 Human genes 0.000 description 3
- 101001110283 Canis lupus familiaris Ras-related C3 botulinum toxin substrate 1 Proteins 0.000 description 3
- 102100023473 Cell growth-regulating nucleolar protein Human genes 0.000 description 3
- 102100031235 Chromodomain-helicase-DNA-binding protein 1 Human genes 0.000 description 3
- 102100031552 Coactosin-like protein Human genes 0.000 description 3
- 102100038390 Diphosphomevalonate decarboxylase Human genes 0.000 description 3
- 102100035425 DnaJ homolog subfamily B member 6 Human genes 0.000 description 3
- 102100040862 Dual specificity protein kinase CLK1 Human genes 0.000 description 3
- 102100037573 Dual specificity protein phosphatase 12 Human genes 0.000 description 3
- 102100028987 Dual specificity protein phosphatase 2 Human genes 0.000 description 3
- 102100027100 Echinoderm microtubule-associated protein-like 4 Human genes 0.000 description 3
- 102100027259 Ena/VASP-like protein Human genes 0.000 description 3
- 102100023882 Endoribonuclease ZC3H12A Human genes 0.000 description 3
- 102100031948 Enhancer of polycomb homolog 1 Human genes 0.000 description 3
- 102100023589 Fibroblast growth factor-binding protein 2 Human genes 0.000 description 3
- 102100024185 G1/S-specific cyclin-D2 Human genes 0.000 description 3
- 108010001498 Galectin 1 Proteins 0.000 description 3
- 102100021736 Galectin-1 Human genes 0.000 description 3
- 102100030385 Granzyme B Human genes 0.000 description 3
- 102100038393 Granzyme H Human genes 0.000 description 3
- 102100038395 Granzyme K Human genes 0.000 description 3
- 102100022087 Granzyme M Human genes 0.000 description 3
- 108010007707 Hepatitis A Virus Cellular Receptor 2 Proteins 0.000 description 3
- 102100034458 Hepatitis A virus cellular receptor 2 Human genes 0.000 description 3
- 102100022132 High affinity immunoglobulin epsilon receptor subunit gamma Human genes 0.000 description 3
- 101000974390 Homo sapiens ADP-ribosylation factor-like protein 4C Proteins 0.000 description 3
- 101000809459 Homo sapiens Actin-related protein 2/3 complex subunit 1B Proteins 0.000 description 3
- 101000925555 Homo sapiens Actin-related protein 2/3 complex subunit 5 Proteins 0.000 description 3
- 101000882335 Homo sapiens Alpha-enolase Proteins 0.000 description 3
- 101000924474 Homo sapiens Annexin A2 Proteins 0.000 description 3
- 101000728679 Homo sapiens Apoptosis-associated speck-like protein containing a CARD Proteins 0.000 description 3
- 101000905707 Homo sapiens Autophagy-related protein 2 homolog A Proteins 0.000 description 3
- 101000946370 Homo sapiens C-C motif chemokine 3-like 1 Proteins 0.000 description 3
- 101000922348 Homo sapiens C-X-C chemokine receptor type 4 Proteins 0.000 description 3
- 101000919672 Homo sapiens CCR4-NOT transcription complex subunit 1 Proteins 0.000 description 3
- 101000897400 Homo sapiens CD59 glycoprotein Proteins 0.000 description 3
- 101000944250 Homo sapiens Calcium/calmodulin-dependent protein kinase type 1 Proteins 0.000 description 3
- 101000622133 Homo sapiens Cell growth-regulating nucleolar protein Proteins 0.000 description 3
- 101000777047 Homo sapiens Chromodomain-helicase-DNA-binding protein 1 Proteins 0.000 description 3
- 101000940352 Homo sapiens Coactosin-like protein Proteins 0.000 description 3
- 101000958922 Homo sapiens Diphosphomevalonate decarboxylase Proteins 0.000 description 3
- 101000804112 Homo sapiens DnaJ homolog subfamily B member 6 Proteins 0.000 description 3
- 101000749294 Homo sapiens Dual specificity protein kinase CLK1 Proteins 0.000 description 3
- 101000924017 Homo sapiens Dual specificity protein phosphatase 1 Proteins 0.000 description 3
- 101000881110 Homo sapiens Dual specificity protein phosphatase 12 Proteins 0.000 description 3
- 101000838335 Homo sapiens Dual specificity protein phosphatase 2 Proteins 0.000 description 3
- 101001057929 Homo sapiens Echinoderm microtubule-associated protein-like 4 Proteins 0.000 description 3
- 101001057143 Homo sapiens Ena/VASP-like protein Proteins 0.000 description 3
- 101000976212 Homo sapiens Endoribonuclease ZC3H12A Proteins 0.000 description 3
- 101000920634 Homo sapiens Enhancer of polycomb homolog 1 Proteins 0.000 description 3
- 101000827770 Homo sapiens Fibroblast growth factor-binding protein 2 Proteins 0.000 description 3
- 101000980741 Homo sapiens G1/S-specific cyclin-D2 Proteins 0.000 description 3
- 101001009603 Homo sapiens Granzyme B Proteins 0.000 description 3
- 101001033000 Homo sapiens Granzyme H Proteins 0.000 description 3
- 101001033007 Homo sapiens Granzyme K Proteins 0.000 description 3
- 101000900697 Homo sapiens Granzyme M Proteins 0.000 description 3
- 101000824104 Homo sapiens High affinity immunoglobulin epsilon receptor subunit gamma Proteins 0.000 description 3
- 101000840540 Homo sapiens Iduronate 2-sulfatase Proteins 0.000 description 3
- 101001008896 Homo sapiens Inactive histone-lysine N-methyltransferase 2E Proteins 0.000 description 3
- 101001015037 Homo sapiens Integrin beta-7 Proteins 0.000 description 3
- 101000599940 Homo sapiens Interferon gamma Proteins 0.000 description 3
- 101000598002 Homo sapiens Interferon regulatory factor 1 Proteins 0.000 description 3
- 101001055145 Homo sapiens Interleukin-2 receptor subunit beta Proteins 0.000 description 3
- 101000998139 Homo sapiens Interleukin-32 Proteins 0.000 description 3
- 101000994167 Homo sapiens Iron-sulfur cluster assembly 1 homolog, mitochondrial Proteins 0.000 description 3
- 101001007027 Homo sapiens Keratin, type II cuticular Hb1 Proteins 0.000 description 3
- 101001026977 Homo sapiens Keratin, type II cuticular Hb6 Proteins 0.000 description 3
- 101001049181 Homo sapiens Killer cell lectin-like receptor subfamily B member 1 Proteins 0.000 description 3
- 101000971538 Homo sapiens Killer cell lectin-like receptor subfamily F member 1 Proteins 0.000 description 3
- 101001139146 Homo sapiens Krueppel-like factor 2 Proteins 0.000 description 3
- 101001004946 Homo sapiens Lactoylglutathione lyase Proteins 0.000 description 3
- 101001044093 Homo sapiens Lipopolysaccharide-induced tumor necrosis factor-alpha factor Proteins 0.000 description 3
- 101000764294 Homo sapiens Lymphotoxin-beta Proteins 0.000 description 3
- 101000760817 Homo sapiens Macrophage-capping protein Proteins 0.000 description 3
- 101000669513 Homo sapiens Metalloproteinase inhibitor 1 Proteins 0.000 description 3
- 101001014059 Homo sapiens Metallothionein-2 Proteins 0.000 description 3
- 101000979357 Homo sapiens NEDD4 family-interacting protein 2 Proteins 0.000 description 3
- 101001109508 Homo sapiens NKG2-A/NKG2-B type II integral membrane protein Proteins 0.000 description 3
- 101001109503 Homo sapiens NKG2-C type II integral membrane protein Proteins 0.000 description 3
- 101000589307 Homo sapiens Natural cytotoxicity triggering receptor 3 Proteins 0.000 description 3
- 101000972834 Homo sapiens Normal mucosa of esophagus-specific gene 1 protein Proteins 0.000 description 3
- 101001103036 Homo sapiens Nuclear receptor ROR-alpha Proteins 0.000 description 3
- 101001109698 Homo sapiens Nuclear receptor subfamily 4 group A member 2 Proteins 0.000 description 3
- 101001060744 Homo sapiens Peptidyl-prolyl cis-trans isomerase FKBP1A Proteins 0.000 description 3
- 101000987581 Homo sapiens Perforin-1 Proteins 0.000 description 3
- 101000733743 Homo sapiens Phorbol-12-myristate-13-acetate-induced protein 1 Proteins 0.000 description 3
- 101001120056 Homo sapiens Phosphatidylinositol 3-kinase regulatory subunit alpha Proteins 0.000 description 3
- 101000579123 Homo sapiens Phosphoglycerate kinase 1 Proteins 0.000 description 3
- 101000600387 Homo sapiens Phosphoglycerate mutase 1 Proteins 0.000 description 3
- 101000600395 Homo sapiens Probable phosphoglycerate mutase 4 Proteins 0.000 description 3
- 101000738940 Homo sapiens Proline-rich nuclear receptor coactivator 1 Proteins 0.000 description 3
- 101001117519 Homo sapiens Prostaglandin E2 receptor EP2 subtype Proteins 0.000 description 3
- 101000933604 Homo sapiens Protein BTG2 Proteins 0.000 description 3
- 101000653788 Homo sapiens Protein S100-A11 Proteins 0.000 description 3
- 101000786203 Homo sapiens Protein yippee-like 5 Proteins 0.000 description 3
- 101001091538 Homo sapiens Pyruvate kinase PKM Proteins 0.000 description 3
- 101100087590 Homo sapiens RICTOR gene Proteins 0.000 description 3
- 101001110313 Homo sapiens Ras-related C3 botulinum toxin substrate 2 Proteins 0.000 description 3
- 101000631899 Homo sapiens Ribosome maturation protein SBDS Proteins 0.000 description 3
- 101000873502 Homo sapiens S-adenosylmethionine decarboxylase proenzyme Proteins 0.000 description 3
- 101001077727 Homo sapiens Serine protease inhibitor Kazal-type 2 Proteins 0.000 description 3
- 101000783373 Homo sapiens Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform Proteins 0.000 description 3
- 101000831940 Homo sapiens Stathmin Proteins 0.000 description 3
- 101000914496 Homo sapiens T-cell antigen CD7 Proteins 0.000 description 3
- 101000596234 Homo sapiens T-cell surface protein tactile Proteins 0.000 description 3
- 101000596277 Homo sapiens TSC22 domain family protein 3 Proteins 0.000 description 3
- 101000658622 Homo sapiens Testis-specific Y-encoded-like protein 2 Proteins 0.000 description 3
- 101000838086 Homo sapiens Transaldolase Proteins 0.000 description 3
- 101001028730 Homo sapiens Transcription factor JunB Proteins 0.000 description 3
- 101000830565 Homo sapiens Tumor necrosis factor ligand superfamily member 10 Proteins 0.000 description 3
- 101000801234 Homo sapiens Tumor necrosis factor receptor superfamily member 18 Proteins 0.000 description 3
- 101000679851 Homo sapiens Tumor necrosis factor receptor superfamily member 4 Proteins 0.000 description 3
- 101000803343 Homo sapiens WASP homolog-associated protein with actin, membranes and microtubules Proteins 0.000 description 3
- 101000723833 Homo sapiens Zinc finger E-box-binding homeobox 2 Proteins 0.000 description 3
- 101000795753 Homo sapiens mRNA decay activator protein ZFP36 Proteins 0.000 description 3
- 101000802101 Homo sapiens mRNA decay activator protein ZFP36L2 Proteins 0.000 description 3
- 102100029199 Iduronate 2-sulfatase Human genes 0.000 description 3
- 102100027767 Inactive histone-lysine N-methyltransferase 2E Human genes 0.000 description 3
- 102100033016 Integrin beta-7 Human genes 0.000 description 3
- 102100037850 Interferon gamma Human genes 0.000 description 3
- 102100036981 Interferon regulatory factor 1 Human genes 0.000 description 3
- 102100026879 Interleukin-2 receptor subunit beta Human genes 0.000 description 3
- 102100033501 Interleukin-32 Human genes 0.000 description 3
- 102100031404 Iron-sulfur cluster assembly 1 homolog, mitochondrial Human genes 0.000 description 3
- 102100028340 Keratin, type II cuticular Hb1 Human genes 0.000 description 3
- 102100037382 Keratin, type II cuticular Hb6 Human genes 0.000 description 3
- 102100023678 Killer cell lectin-like receptor subfamily B member 1 Human genes 0.000 description 3
- 102100021458 Killer cell lectin-like receptor subfamily F member 1 Human genes 0.000 description 3
- 102100020675 Krueppel-like factor 2 Human genes 0.000 description 3
- 102100026004 Lactoylglutathione lyase Human genes 0.000 description 3
- 102100034238 Linker for activation of T-cells family member 2 Human genes 0.000 description 3
- 102100021607 Lipopolysaccharide-induced tumor necrosis factor-alpha factor Human genes 0.000 description 3
- 102100026894 Lymphotoxin-beta Human genes 0.000 description 3
- 102100024573 Macrophage-capping protein Human genes 0.000 description 3
- 101001066400 Mesocricetus auratus Homeodomain-interacting protein kinase 2 Proteins 0.000 description 3
- 102100039364 Metalloproteinase inhibitor 1 Human genes 0.000 description 3
- 102100031347 Metallothionein-2 Human genes 0.000 description 3
- 102100023052 NEDD4 family-interacting protein 2 Human genes 0.000 description 3
- 102100022682 NKG2-A/NKG2-B type II integral membrane protein Human genes 0.000 description 3
- 102100022683 NKG2-C type II integral membrane protein Human genes 0.000 description 3
- 102100032852 Natural cytotoxicity triggering receptor 3 Human genes 0.000 description 3
- 102100022646 Normal mucosa of esophagus-specific gene 1 protein Human genes 0.000 description 3
- 102100039614 Nuclear receptor ROR-alpha Human genes 0.000 description 3
- 102100022676 Nuclear receptor subfamily 4 group A member 2 Human genes 0.000 description 3
- KJWZYMMLVHIVSU-IYCNHOCDSA-N PGK1 Chemical compound CCCCC[C@H](O)\C=C\[C@@H]1[C@@H](CCCCCCC(O)=O)C(=O)CC1=O KJWZYMMLVHIVSU-IYCNHOCDSA-N 0.000 description 3
- 102100027913 Peptidyl-prolyl cis-trans isomerase FKBP1A Human genes 0.000 description 3
- 102100033716 Phorbol-12-myristate-13-acetate-induced protein 1 Human genes 0.000 description 3
- 102100026169 Phosphatidylinositol 3-kinase regulatory subunit alpha Human genes 0.000 description 3
- 102100028251 Phosphoglycerate kinase 1 Human genes 0.000 description 3
- 102100037389 Phosphoglycerate mutase 1 Human genes 0.000 description 3
- 102100037394 Proline-rich nuclear receptor coactivator 1 Human genes 0.000 description 3
- 102100024448 Prostaglandin E2 receptor EP2 subtype Human genes 0.000 description 3
- 102100026034 Protein BTG2 Human genes 0.000 description 3
- 102100029811 Protein S100-A11 Human genes 0.000 description 3
- 102100025821 Protein yippee-like 5 Human genes 0.000 description 3
- 102100034911 Pyruvate kinase PKM Human genes 0.000 description 3
- 102000046941 Rapamycin-Insensitive Companion of mTOR Human genes 0.000 description 3
- 108700019586 Rapamycin-Insensitive Companion of mTOR Proteins 0.000 description 3
- 102100022129 Ras-related C3 botulinum toxin substrate 2 Human genes 0.000 description 3
- 102100035773 Regulator of G-protein signaling 10 Human genes 0.000 description 3
- 101710148338 Regulator of G-protein signaling 10 Proteins 0.000 description 3
- 102100028750 Ribosome maturation protein SBDS Human genes 0.000 description 3
- 102100035914 S-adenosylmethionine decarboxylase proenzyme Human genes 0.000 description 3
- 108091006238 SLC7A8 Proteins 0.000 description 3
- 102100025419 Serine protease inhibitor Kazal-type 2 Human genes 0.000 description 3
- 102100036140 Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform Human genes 0.000 description 3
- 102100024237 Stathmin Human genes 0.000 description 3
- 102100027208 T-cell antigen CD7 Human genes 0.000 description 3
- 102100035268 T-cell surface protein tactile Human genes 0.000 description 3
- 102100035260 TSC22 domain family protein 3 Human genes 0.000 description 3
- 102100034917 Testis-specific Y-encoded-like protein 2 Human genes 0.000 description 3
- 102100028601 Transaldolase Human genes 0.000 description 3
- 102100037168 Transcription factor JunB Human genes 0.000 description 3
- 108010047933 Tumor Necrosis Factor alpha-Induced Protein 3 Proteins 0.000 description 3
- 102100024596 Tumor necrosis factor alpha-induced protein 3 Human genes 0.000 description 3
- 102100024598 Tumor necrosis factor ligand superfamily member 10 Human genes 0.000 description 3
- 102100033728 Tumor necrosis factor receptor superfamily member 18 Human genes 0.000 description 3
- 102100022153 Tumor necrosis factor receptor superfamily member 4 Human genes 0.000 description 3
- 102100036048 WASP homolog-associated protein with actin, membranes and microtubules Human genes 0.000 description 3
- 102100028458 Zinc finger E-box-binding homeobox 2 Human genes 0.000 description 3
- 102100035804 Zinc finger protein 823 Human genes 0.000 description 3
- 208000029742 colonic neoplasm Diseases 0.000 description 3
- VLMZMRDOMOGGFA-WDBKCZKBSA-N festuclavine Chemical compound C1=CC([C@H]2C[C@H](CN(C)[C@@H]2C2)C)=C3C2=CNC3=C1 VLMZMRDOMOGGFA-WDBKCZKBSA-N 0.000 description 3
- 125000001072 heteroaryl group Chemical group 0.000 description 3
- 102100034703 mRNA decay activator protein ZFP36L2 Human genes 0.000 description 3
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 2
- 102100030751 Eomesodermin homolog Human genes 0.000 description 2
- 101100172469 Escherichia coli (strain K12) envZ gene Proteins 0.000 description 2
- 201000010915 Glioblastoma multiforme Diseases 0.000 description 2
- 229920002683 Glycosaminoglycan Polymers 0.000 description 2
- 101001064167 Homo sapiens Eomesodermin homolog Proteins 0.000 description 2
- 101001076418 Homo sapiens Interleukin-1 receptor type 1 Proteins 0.000 description 2
- 101000917858 Homo sapiens Low affinity immunoglobulin gamma Fc region receptor III-A Proteins 0.000 description 2
- 101000917839 Homo sapiens Low affinity immunoglobulin gamma Fc region receptor III-B Proteins 0.000 description 2
- 101000971513 Homo sapiens Natural killer cells antigen CD94 Proteins 0.000 description 2
- 102100026016 Interleukin-1 receptor type 1 Human genes 0.000 description 2
- 102100029185 Low affinity immunoglobulin gamma Fc region receptor III-B Human genes 0.000 description 2
- 102100025276 Monocarboxylate transporter 4 Human genes 0.000 description 2
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 2
- 102100021462 Natural killer cells antigen CD94 Human genes 0.000 description 2
- 108010056995 Perforin Proteins 0.000 description 2
- KHGNFPUMBJSZSM-UHFFFAOYSA-N Perforine Natural products COC1=C2CCC(O)C(CCC(C)(C)O)(OC)C2=NC2=C1C=CO2 KHGNFPUMBJSZSM-UHFFFAOYSA-N 0.000 description 2
- 241000288906 Primates Species 0.000 description 2
- 108091008778 RORγ2 Proteins 0.000 description 2
- 241000283984 Rodentia Species 0.000 description 2
- 108091006601 SLC16A3 Proteins 0.000 description 2
- 101150077103 TPO gene Proteins 0.000 description 2
- 201000010897 colon adenocarcinoma Diseases 0.000 description 2
- 208000005017 glioblastoma Diseases 0.000 description 2
- 208000020816 lung neoplasm Diseases 0.000 description 2
- 238000013470 microfluidic resistive pulse sensing Methods 0.000 description 2
- 229930192851 perforin Natural products 0.000 description 2
- MLDPHVDRDPCVKC-UHFFFAOYSA-N 2-(1-benzothiophen-3-yl)-4-[2-(4-hydroxyphenyl)ethylamino]-7-propan-2-ylpyrrolo[2,3-d]pyrimidine-5-carbonitrile Chemical compound S1C2=C(C(=C1)C=1N=C(C3=C(N=1)N(C=C3C#N)C(C)C)NCCC1=CC=C(C=C1)O)C=CC=C2 MLDPHVDRDPCVKC-UHFFFAOYSA-N 0.000 description 1
- VBIMFDPTJKNRPS-UHFFFAOYSA-N 2-(5-fluoropyridin-3-yl)-N-[2-(1H-indol-3-yl)ethyl]-7-propan-2-ylthieno[3,2-d]pyrimidin-4-amine Chemical compound N1C=C(C2=CC=CC=C12)CCNC=1C2=C(N=C(N=1)C=1C=NC=C(C=1)F)C(=CS2)C(C)C VBIMFDPTJKNRPS-UHFFFAOYSA-N 0.000 description 1
- VCPIZTKNOAYOAV-UHFFFAOYSA-N 2-(5-fluoropyridin-3-yl)-N-[2-(1H-indol-3-yl)ethyl]furo[3,2-d]pyrimidin-4-amine Chemical compound N1C=C(C2=CC=CC=C12)CCNC=1C2=C(N=C(N=1)C=1C=NC=C(C=1)F)C=CO2 VCPIZTKNOAYOAV-UHFFFAOYSA-N 0.000 description 1
- FWVOHSVIAYQBSR-UHFFFAOYSA-N 2-(5-fluoropyridin-3-yl)-N-[2-(1H-indol-3-yl)ethyl]quinazolin-4-amine Chemical compound N1C=C(C2=CC=CC=C12)CCNC1=NC(=NC2=CC=CC=C12)C=1C=NC=C(C=1)F FWVOHSVIAYQBSR-UHFFFAOYSA-N 0.000 description 1
- 102100028831 28S ribosomal protein S6, mitochondrial Human genes 0.000 description 1
- DVQUPHPHIDOJAX-UHFFFAOYSA-N 3-[2-(1-benzothiophen-3-yl)-9-propan-2-ylpurin-6-yl]oxypropanamide Chemical compound S1C2=C(C(=C1)C1=NC(=C3N=CN(C3=N1)C(C)C)OCCC(=O)N)C=CC=C2 DVQUPHPHIDOJAX-UHFFFAOYSA-N 0.000 description 1
- ACVWFKDOJYRVDT-UHFFFAOYSA-N 4-[2-[[2-(1-benzothiophen-3-yl)-7-propan-2-ylthieno[3,2-d]pyrimidin-4-yl]amino]ethyl]phenol Chemical compound S1C2=C(C(=C1)C=1N=C(C3=C(N=1)C(=CS3)C(C)C)NCCC1=CC=C(C=C1)O)C=CC=C2 ACVWFKDOJYRVDT-UHFFFAOYSA-N 0.000 description 1
- VWUGRBOCTVDBSV-UHFFFAOYSA-N 4-[2-[[2-(1-benzothiophen-3-yl)-8-(dimethylamino)pyrimido[5,4-d]pyrimidin-4-yl]amino]ethyl]phenol Chemical compound S1C2=C(C(=C1)C=1N=C(C3=C(N=1)C(=NC=N3)N(C)C)NCCC1=CC=C(C=C1)O)C=CC=C2 VWUGRBOCTVDBSV-UHFFFAOYSA-N 0.000 description 1
- IFRIMZMPKZAKDB-UHFFFAOYSA-N 4-[2-[[6-(1-benzothiophen-3-yl)-3-propan-2-ylimidazo[1,5-a]pyrazin-8-yl]amino]ethyl]phenol Chemical compound S1C2=C(C(=C1)C=1N=C(C=3N(C=1)C(=NC=3)C(C)C)NCCC1=CC=C(C=C1)O)C=CC=C2 IFRIMZMPKZAKDB-UHFFFAOYSA-N 0.000 description 1
- WIMJLUROJKZYNV-UHFFFAOYSA-N 5-[4-[2-(1H-indol-3-yl)ethylamino]-7-propan-2-ylthieno[3,2-d]pyrimidin-2-yl]pyridine-3-carbonitrile Chemical compound N1C=C(C2=CC=CC=C12)CCNC=1C2=C(N=C(N=1)C=1C=NC=C(C#N)C=1)C(=CS2)C(C)C WIMJLUROJKZYNV-UHFFFAOYSA-N 0.000 description 1
- CVFDGHHBAWBWRT-UHFFFAOYSA-N 5-[4-[2-(1H-indol-3-yl)ethylamino]furo[3,2-d]pyrimidin-2-yl]pyridine-3-carbonitrile Chemical compound N1C=C(C2=CC=CC=C12)CCNC=1C2=C(N=C(N=1)C=1C=NC=C(C#N)C=1)C=CO2 CVFDGHHBAWBWRT-UHFFFAOYSA-N 0.000 description 1
- RTETWQXVTHCQCY-UHFFFAOYSA-N 5-[4-[2-(1H-indol-3-yl)ethylamino]quinazolin-2-yl]pyridine-3-carbonitrile Chemical compound N1C=C(C2=CC=CC=C12)CCNC1=NC(=NC2=CC=CC=C12)C=1C=NC=C(C#N)C=1 RTETWQXVTHCQCY-UHFFFAOYSA-N 0.000 description 1
- AMVHQYMQVINJIS-UHFFFAOYSA-N 6-(1-benzothiophen-3-yl)-N-[2-(1H-indol-3-yl)ethyl]-3-propan-2-ylimidazo[1,5-a]pyrazin-8-amine Chemical compound N1C=C(C2=CC=CC=C12)CCNC=1C=2N(C=C(N=1)C=1C3=C(SC=1)C=CC=C3)C(=NC=2)C(C)C AMVHQYMQVINJIS-UHFFFAOYSA-N 0.000 description 1
- PJBMKWZXEPGQEF-UHFFFAOYSA-N 6-(4-fluorophenyl)-N-[2-(1H-indol-3-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine Chemical compound N1C=C(C2=CC=CC=C12)CCNC=1C2=C(N=CN=1)SC(=C2)C1=CC=C(C=C1)F PJBMKWZXEPGQEF-UHFFFAOYSA-N 0.000 description 1
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 description 1
- 206010006187 Breast cancer Diseases 0.000 description 1
- 208000026310 Breast neoplasm Diseases 0.000 description 1
- FIXVTUBYLYGVLA-UHFFFAOYSA-N CCC(C)NC1=NC2=CC=CC=C2C(CCC2=CNC3=CC=CC=C23)(N)N1 Chemical compound CCC(C)NC1=NC2=CC=CC=C2C(CCC2=CNC3=CC=CC=C23)(N)N1 FIXVTUBYLYGVLA-UHFFFAOYSA-N 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- 208000006402 Ductal Carcinoma Diseases 0.000 description 1
- 102100039620 Granulocyte-macrophage colony-stimulating factor Human genes 0.000 description 1
- 206010019695 Hepatic neoplasm Diseases 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000858474 Homo sapiens 28S ribosomal protein S6, mitochondrial Proteins 0.000 description 1
- 101000625727 Homo sapiens Tubulin beta chain Proteins 0.000 description 1
- 101000788517 Homo sapiens Tubulin beta-2A chain Proteins 0.000 description 1
- 208000008839 Kidney Neoplasms Diseases 0.000 description 1
- 208000031671 Large B-Cell Diffuse Lymphoma Diseases 0.000 description 1
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 1
- 206010025323 Lymphomas Diseases 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- AZDWIIYZLKZVAO-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-2-(5-methylpyridin-3-yl)-7-propan-2-ylthieno[3,2-d]pyrimidin-4-amine Chemical compound N1C=C(C2=CC=CC=C12)CCNC=1C2=C(N=C(N=1)C=1C=NC=C(C=1)C)C(=CS2)C(C)C AZDWIIYZLKZVAO-UHFFFAOYSA-N 0.000 description 1
- JZXRUFJTXOMGFJ-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-2-(5-methylpyridin-3-yl)furo[3,2-d]pyrimidin-4-amine Chemical compound N1C=C(C2=CC=CC=C12)CCNC=1C2=C(N=C(N=1)C=1C=NC=C(C=1)C)C=CO2 JZXRUFJTXOMGFJ-UHFFFAOYSA-N 0.000 description 1
- LKJPYSCBVHEWIU-UHFFFAOYSA-N N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide Chemical compound C=1C=C(C#N)C(C(F)(F)F)=CC=1NC(=O)C(O)(C)CS(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 1
- 208000009052 Precursor T-Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 1
- 201000000582 Retinoblastoma Diseases 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 208000029052 T-cell acute lymphoblastic leukemia Diseases 0.000 description 1
- 102100024717 Tubulin beta chain Human genes 0.000 description 1
- 201000011186 acute T cell leukemia Diseases 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 210000004700 fetal blood Anatomy 0.000 description 1
- 230000001605 fetal effect Effects 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 201000010536 head and neck cancer Diseases 0.000 description 1
- 208000014829 head and neck neoplasm Diseases 0.000 description 1
- 210000005260 human cell Anatomy 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 210000005229 liver cell Anatomy 0.000 description 1
- 208000014018 liver neoplasm Diseases 0.000 description 1
- 201000005202 lung cancer Diseases 0.000 description 1
- 208000037841 lung tumor Diseases 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 210000000066 myeloid cell Anatomy 0.000 description 1
- BDZSJWVTJFSUAE-UHFFFAOYSA-N n-[2-(1h-indol-3-yl)ethyl]-2-methyl-6-phenylthieno[2,3-d]pyrimidin-4-amine Chemical compound S1C2=NC(C)=NC(NCCC=3C4=CC=CC=C4NC=3)=C2C=C1C1=CC=CC=C1 BDZSJWVTJFSUAE-UHFFFAOYSA-N 0.000 description 1
- 201000002528 pancreatic cancer Diseases 0.000 description 1
- 210000004976 peripheral blood cell Anatomy 0.000 description 1
- 210000002826 placenta Anatomy 0.000 description 1
- 201000006845 reticulosarcoma Diseases 0.000 description 1
- 208000029922 reticulum cell sarcoma Diseases 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 230000004565 tumor cell growth Effects 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201862774114P | 2018-11-30 | 2018-11-30 | |
| US62/774,114 | 2018-11-30 | ||
| PCT/US2019/063876 WO2020113182A1 (en) | 2018-11-30 | 2019-11-29 | Expansion of natural killer cells and ilc3 cells with novel aromatic compounds |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JP2022511786A JP2022511786A (ja) | 2022-02-01 |
| JP2022511786A5 JP2022511786A5 (https=) | 2023-08-03 |
| JPWO2020113182A5 true JPWO2020113182A5 (https=) | 2023-08-03 |
Family
ID=69005918
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2021530785A Pending JP2022511786A (ja) | 2018-11-30 | 2019-11-29 | 新規芳香族化合物によるナチュラルキラー細胞およびｉｌｃ３細胞の増殖 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US20230028680A1 (https=) |
| EP (1) | EP3887508A1 (https=) |
| JP (1) | JP2022511786A (https=) |
| KR (1) | KR20210111762A (https=) |
| CN (1) | CN113454207A (https=) |
| AU (1) | AU2019387491A1 (https=) |
| BR (1) | BR112021010245A2 (https=) |
| CA (1) | CA3119427A1 (https=) |
| EA (1) | EA202191508A1 (https=) |
| MX (1) | MX2021006398A (https=) |
| PH (1) | PH12021551241A1 (https=) |
| SG (1) | SG11202105213XA (https=) |
| WO (1) | WO2020113182A1 (https=) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2020252464A1 (en) * | 2019-06-14 | 2020-12-17 | Celularity Inc. | Populations of natural killer cells for treating cancers |
| US20220273716A1 (en) * | 2019-07-25 | 2022-09-01 | Celularity Inc. | Populations of natural killer cells comprising a cd38 chimeric antigen receptor |
| WO2021155312A1 (en) * | 2020-01-29 | 2021-08-05 | Celularity Inc. | Placental derived natural killer cells for treatment of coronavirus infections |
| US11591381B2 (en) | 2020-11-30 | 2023-02-28 | Crispr Therapeutics Ag | Gene-edited natural killer cells |
| WO2022144632A1 (en) | 2020-12-30 | 2022-07-07 | Crispr Therapeutics Ag | Compositions and methods for differentiating stem cells into nk cells |
| US20240082398A1 (en) * | 2021-01-15 | 2024-03-14 | City Of Hope | Methods of preparing and expanding type i innate lymphoid cells and therapeutic uses thereof |
| WO2023278628A1 (en) * | 2021-06-29 | 2023-01-05 | Celularity Inc. | Human placental hematopoietic stem cell derived natural killer cells in acute myeloid leukemia (aml) remission with minimal residual disease (mrd) or relapsed/refractory aml |
| KR20240063899A (ko) * | 2021-09-08 | 2024-05-10 | 가부시키가이샤 가이아바이오메디신 | 세포의 처리 방법 |
| AU2023249795A1 (en) | 2022-04-08 | 2024-10-17 | Shy Therapeutics, Llc | Compounds that interact with ras superfamily proteins for treatment of cancers, inflammatory diseases, rasopathies, and fibrotic disease |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4798824A (en) | 1985-10-03 | 1989-01-17 | Wisconsin Alumni Research Foundation | Perfusate for the preservation of organs |
| US5190556A (en) | 1991-03-19 | 1993-03-02 | O.B. Tech, Inc. | Cord cutter sampler |
| US5552267A (en) | 1992-04-03 | 1996-09-03 | The Trustees Of Columbia University In The City Of New York | Solution for prolonged organ preservation |
| US5372581A (en) | 1993-07-21 | 1994-12-13 | Minneapolis Children's Services Corporation | Method and apparatus for placental blood collection |
| EP2305795B1 (en) | 2000-12-06 | 2019-07-03 | Celularity, Inc. | Method of collecting placental stem cells |
| EP2316918B1 (en) | 2001-02-14 | 2015-07-01 | Anthrogenesis Corporation | Post-partum mammalian placenta, its use and placental stem cells therefrom |
| US20030187515A1 (en) | 2002-03-26 | 2003-10-02 | Hariri Robert J. | Collagen biofabric and methods of preparing and using the collagen biofabric |
| US7498171B2 (en) | 2002-04-12 | 2009-03-03 | Anthrogenesis Corporation | Modulation of stem and progenitor cell differentiation, assays, and uses thereof |
| JP2005089352A (ja) * | 2003-09-16 | 2005-04-07 | Kissei Pharmaceut Co Ltd | 新規なイミダゾ［１，５−ａ］ピラジン誘導体、それを含有する医薬組成物およびそれらの用途 |
| US7147626B2 (en) | 2004-09-23 | 2006-12-12 | Celgene Corporation | Cord blood and placenta collection kit |
| ZA200804717B (en) | 2005-12-29 | 2010-02-24 | Anthrogenesis Corp | Improved composition for collecting and preserving a placental stem cells and methods of using the composition |
| PL2471907T3 (pl) | 2005-12-29 | 2019-07-31 | Celularity, Inc. | Populacje komórek macierzystych łożyska |
| ES2421191T3 (es) * | 2006-05-03 | 2013-08-29 | Symrise Ag | Antagonistas del receptor de Ah |
| KR20220122774A (ko) | 2007-09-26 | 2022-09-02 | 셀룰래리티 인코포레이티드 | 인간 태반 관류액으로부터의 혈관형성 세포 |
| AU2013203936A1 (en) * | 2008-10-30 | 2013-05-02 | Novartis Ag | Compounds that expand hematopoietic stem cells |
| RU2013120966A (ru) * | 2010-10-08 | 2014-11-20 | Эббви Инк. | ФУРО[3,2-d]ПИРИМИДИНОВЫЕ СОЕДИНЕНИЯ |
| NZ733213A (en) * | 2014-12-31 | 2022-10-28 | Celularity Inc | Natural killer cells and uses thereof |
| MY201637A (en) * | 2015-10-15 | 2024-03-06 | Celularity Inc | Natural killer cells and ilc3 cells and uses thereof |
| TWI752155B (zh) * | 2017-02-01 | 2022-01-11 | 德商菲尼克斯製藥股份有限公司 | 芳香烴受體(AhR)調節劑化合物 |
| WO2018195397A2 (en) * | 2017-04-21 | 2018-10-25 | Kyn Therapeutics | Indole ahr inhibitors and uses thereof |
-
2019
- 2019-11-29 CN CN201980090805.0A patent/CN113454207A/zh active Pending
- 2019-11-29 EP EP19827982.0A patent/EP3887508A1/en not_active Withdrawn
- 2019-11-29 WO PCT/US2019/063876 patent/WO2020113182A1/en not_active Ceased
- 2019-11-29 JP JP2021530785A patent/JP2022511786A/ja active Pending
- 2019-11-29 EA EA202191508A patent/EA202191508A1/ru unknown
- 2019-11-29 MX MX2021006398A patent/MX2021006398A/es unknown
- 2019-11-29 US US17/309,449 patent/US20230028680A1/en not_active Abandoned
- 2019-11-29 AU AU2019387491A patent/AU2019387491A1/en not_active Abandoned
- 2019-11-29 CA CA3119427A patent/CA3119427A1/en active Pending
- 2019-11-29 SG SG11202105213XA patent/SG11202105213XA/en unknown
- 2019-11-29 BR BR112021010245-0A patent/BR112021010245A2/pt not_active IP Right Cessation
- 2019-11-29 KR KR1020217020212A patent/KR20210111762A/ko not_active Ceased
-
2021
- 2021-05-28 PH PH12021551241A patent/PH12021551241A1/en unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2023171766A5 (https=) | ||
| Candido et al. | Cancer-related inflammation | |
| US9925220B2 (en) | Method of expanding double negative T cells | |
| US10457683B2 (en) | Aryl hydrocarbon receptor antagonists and uses thereof | |
| IL267161A (en) | JAK2 and ALK2 inhibitors and their use | |
| US12195475B2 (en) | Compounds for the treatment of kinase-dependent disorders | |
| ES2959645T3 (es) | Materiales y métodos para el tratamiento del cáncer | |
| He et al. | Combined IL-21 and low-dose IL-2 therapy induces anti-tumor immunity and long-term curative effects in a murine melanoma tumor model | |
| JP2004502691A (ja) | 抗癌薬としての置換トリアゾロピリミジン | |
| JP2016522232A5 (https=) | ||
| JP2010513523A5 (https=) | ||
| JP2014503567A5 (https=) | ||
| JPWO2020113182A5 (https=) | ||
| US11696928B2 (en) | Compounds and use thereof in the expansion of stem cells and/or progenitor cells | |
| RU2674262C2 (ru) | Трициклическое соединение и ингибитор jak | |
| CN113454207A (zh) | 用新型芳香族化合物扩增自然杀伤细胞和ilc3细胞 | |
| Isvoranu et al. | Therapeutic potential of interleukin-21 in cancer | |
| Ou et al. | Heterocyclic-modified imidazoquinoline derivatives: Selective TLR7 agonist regulates tumor microenvironment against melanoma | |
| Du et al. | The different effects of IFN‐β and IFN‐γ on the tumor‐suppressive activity of human amniotic fluid‐derived mesenchymal stem cells | |
| EP3228701A1 (en) | Method for preparing lymphocytes capable of infiltrating a solid tumor, lymphocytes obtainable by said method and uses thereof | |
| US20240360143A1 (en) | [1,2,4]triazolo[4,3-a]pyrimidin-7(8h)-one as mitochondrial pyruvate carrier inhibitors for use in the treatment of cancer | |
| Wang et al. | Tumor Microenvironment Onmyoji: Cytokines with Dual Protumor and Antitumor Roles | |
| JP5782426B2 (ja) | 制御性樹状細胞の作製方法 | |
| US20220251104A1 (en) | Aromatic compounds for use in activating hematopoietic stem and progenitor cells | |
| Lee | Comparative Analysis of Cytokine Levels in Multiple Myeloma Patients: Implications for Natural Killer Cells and Therapeutic Monoclonal Antibodies |