JPWO2019236567A5

JPWO2019236567A5 -

Download PDF

Info

Publication number: JPWO2019236567A5
Authority: JP; Japan
Prior art keywords: moiety; peptidase; drug conjugate; binder; drug
Prior art date: 2022-06-01
Legal status : Pending

Application number

JP2020567774A

Other languages

English (en)

Japanese (ja)

Other versions

JP2021527042A (ja

Publication date

2022-06-01

2019-06-04 Application filed filed Critical

2019-06-04 Priority claimed from PCT/US2019/035374 external-priority patent/WO2019236567A2/fr

2021-10-11 Publication of JP2021527042A publication Critical patent/JP2021527042A/ja

2022-06-01 Publication of JPWO2019236567A5 publication Critical patent/JPWO2019236567A5/ja

Status Pending legal-status Critical Current

Links

108091005771 Peptidases Proteins 0.000 claims description 454
239000003814 drug Substances 0.000 claims description 183
210000004027 cells Anatomy 0.000 claims description 178
241000282414 Homo sapiens Species 0.000 claims description 151
102000004169 proteins and genes Human genes 0.000 claims description 151
108090000623 proteins and genes Proteins 0.000 claims description 151
235000018102 proteins Nutrition 0.000 claims description 147
230000027455 binding Effects 0.000 claims description 126
229940079593 drugs Drugs 0.000 claims description 117
229920001184 polypeptide Polymers 0.000 claims description 102
206010028980 Neoplasm Diseases 0.000 claims description 79
-1 OX40-L Proteins 0.000 claims description 78
102000004965 antibodies Human genes 0.000 claims description 61
108090001123 antibodies Proteins 0.000 claims description 61
125000000539 amino acid group Chemical group 0.000 claims description 59
239000011230 binding agent Substances 0.000 claims description 55
230000002401 inhibitory effect Effects 0.000 claims description 55
239000000556 agonist Substances 0.000 claims description 54
230000036328 Free drug Effects 0.000 claims description 50
201000011510 cancer Diseases 0.000 claims description 49
MTCFGRXMJLQNBG-REOHCLBHSA-N L-serine Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 claims description 48
239000004365 Protease Substances 0.000 claims description 47
239000000758 substrate Substances 0.000 claims description 46
210000001519 tissues Anatomy 0.000 claims description 46
CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 claims description 45
WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 claims description 45
ODKSFYDXXFIFQN-BYPYZUCNSA-N L-arginine Chemical compound OC(=O)[C@@H](N)CCCN=C(N)N ODKSFYDXXFIFQN-BYPYZUCNSA-N 0.000 claims description 43
ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 claims description 43
125000003275 alpha amino acid group Chemical group 0.000 claims description 43
125000005647 linker group Chemical group 0.000 claims description 42
102000004190 Enzymes Human genes 0.000 claims description 41
108090000790 Enzymes Proteins 0.000 claims description 41
KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 claims description 41
239000003112 inhibitor Substances 0.000 claims description 36
125000003295 alanine group Chemical group N[C@@H](C)C(=O)* 0.000 claims description 35
229940088598 Enzyme Drugs 0.000 claims description 33
AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 claims description 33
239000000203 mixture Substances 0.000 claims description 31
125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 claims description 30
DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 claims description 28
KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 claims description 28
102100009984 FAP Human genes 0.000 claims description 23
108010072257 fibroblast activation protein alpha Proteins 0.000 claims description 23
108020001507 fusion proteins Proteins 0.000 claims description 22
102000037240 fusion proteins Human genes 0.000 claims description 22
239000000427 antigen Substances 0.000 claims description 21
102000038129 antigens Human genes 0.000 claims description 21
108091007172 antigens Proteins 0.000 claims description 21
102000005962 receptors Human genes 0.000 claims description 19
108020003175 receptors Proteins 0.000 claims description 19
XUJNEKJLAYXESH-REOHCLBHSA-N L-cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 claims description 18
230000001225 therapeutic Effects 0.000 claims description 18
238000003776 cleavage reaction Methods 0.000 claims description 17
102100007290 CD274 Human genes 0.000 claims description 16
101710012053 CD274 Proteins 0.000 claims description 16
102100012456 DPP8 Human genes 0.000 claims description 16
101700073826 DPP8 Proteins 0.000 claims description 16
102100012457 DPP9 Human genes 0.000 claims description 16
101700080548 DPP9 Proteins 0.000 claims description 16
206010000880 Acute myeloid leukaemia Diseases 0.000 claims description 15
235000018417 cysteine Nutrition 0.000 claims description 15
230000000144 pharmacologic effect Effects 0.000 claims description 14
210000004881 tumor cells Anatomy 0.000 claims description 14
210000001744 T-Lymphocytes Anatomy 0.000 claims description 13
210000002540 Macrophages Anatomy 0.000 claims description 12
102000002274 Matrix Metalloproteinases Human genes 0.000 claims description 11
125000004122 cyclic group Chemical group 0.000 claims description 11
230000028993 immune response Effects 0.000 claims description 11
230000036499 Half live Effects 0.000 claims description 10
230000003834 intracellular Effects 0.000 claims description 10
239000012528 membrane Substances 0.000 claims description 10
125000003396 thiol group Chemical group [H]S* 0.000 claims description 10
150000003573 thiols Chemical class 0.000 claims description 10
239000003795 chemical substances by application Substances 0.000 claims description 9
230000003308 immunostimulating Effects 0.000 claims description 9
239000003446 ligand Substances 0.000 claims description 9
230000005012 migration Effects 0.000 claims description 9
238000007799 mixed lymphocyte reaction Methods 0.000 claims description 9
125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 8
229940110715 ENZYMES FOR TREATMENT OF WOUNDS AND ULCERS Drugs 0.000 claims description 8
102100006355 TLR7 Human genes 0.000 claims description 8
101700075266 TLR7 Proteins 0.000 claims description 8
229940019336 antithrombotic Enzymes Drugs 0.000 claims description 8
210000002950 fibroblast Anatomy 0.000 claims description 8
229910052736 halogen Inorganic materials 0.000 claims description 8
150000002367 halogens Chemical class 0.000 claims description 8
229940020899 hematological Enzymes Drugs 0.000 claims description 8
230000003993 interaction Effects 0.000 claims description 8
239000011780 sodium chloride Substances 0.000 claims description 8
230000001629 suppression Effects 0.000 claims description 8
201000001845 syndromic X-linked intellectual disability Snyder type Diseases 0.000 claims description 8
102100005310 CTLA4 Human genes 0.000 claims description 7
101700054183 CTLA4 Proteins 0.000 claims description 7
102100013885 DDX58 Human genes 0.000 claims description 7
101700064525 DDX58 Proteins 0.000 claims description 7
108010002350 Interleukin-2 Proteins 0.000 claims description 7
102000000588 Interleukin-2 Human genes 0.000 claims description 7
108090000028 MMP12 Proteins 0.000 claims description 7
230000002238 attenuated Effects 0.000 claims description 7
238000004166 bioassay Methods 0.000 claims description 7
150000002430 hydrocarbons Chemical class 0.000 claims description 7
150000003839 salts Chemical class 0.000 claims description 7
101700028524 DID Proteins 0.000 claims description 6
210000001723 Extracellular Space Anatomy 0.000 claims description 6
239000012271 PD-L1 inhibitor Substances 0.000 claims description 6
229940121656 PD-L1 inhibitors Drugs 0.000 claims description 6
102100008790 TNFRSF14 Human genes 0.000 claims description 6
101700072533 VM2 Proteins 0.000 claims description 6
230000003042 antagnostic Effects 0.000 claims description 6
239000005557 antagonist Substances 0.000 claims description 6
239000002955 immunomodulating agent Substances 0.000 claims description 6
230000002584 immunomodulator Effects 0.000 claims description 6
229940121354 immunomodulators Drugs 0.000 claims description 6
230000001506 immunosuppresive Effects 0.000 claims description 6
125000005439 maleimidyl group Chemical group C1(C=CC(N1*)=O)=O 0.000 claims description 6
239000008194 pharmaceutical composition Substances 0.000 claims description 6
229920001223 polyethylene glycol Polymers 0.000 claims description 6
102000004196 processed proteins & peptides Human genes 0.000 claims description 6
108090000765 processed proteins & peptides Proteins 0.000 claims description 6
NKCXQMYPWXSLIZ-PSRDDEIFSA-N (2S)-2-[[(2S)-1-[(2S)-5-amino-2-[[2-[[(2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-[[(2S,3R)-2-[[(2S)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]propanoyl]amino]-4-oxobutanoyl]amino]-3-m Chemical compound O=C([C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@@H](N)[C@@H](C)O)[C@@H](C)O)C(C)C)N1CCC[C@H]1C(=O)N[C@@H](CO)C(O)=O NKCXQMYPWXSLIZ-PSRDDEIFSA-N 0.000 claims description 5
210000003719 B-Lymphocytes Anatomy 0.000 claims description 5
102100009333 BTLA Human genes 0.000 claims description 5
101700047069 BTLA Proteins 0.000 claims description 5
101710039069 CD160 Proteins 0.000 claims description 5
102100014174 CD160 Human genes 0.000 claims description 5
210000004443 Dendritic Cells Anatomy 0.000 claims description 5
102100017213 LAG3 Human genes 0.000 claims description 5
108060004270 LAG3 Proteins 0.000 claims description 5
108010061593 Member 14 Tumor Necrosis Factor Receptors Proteins 0.000 claims description 5
102100006047 TIGIT Human genes 0.000 claims description 5
101700052319 TIGIT Proteins 0.000 claims description 5
101710038603 TNFRSF18 Proteins 0.000 claims description 5
102100003096 TNFRSF18 Human genes 0.000 claims description 5
101710040448 TNFRSF4 Proteins 0.000 claims description 5
102100013135 TNFRSF4 Human genes 0.000 claims description 5
108090000190 Thrombin Proteins 0.000 claims description 5
238000009825 accumulation Methods 0.000 claims description 5
108091006028 chimera Proteins 0.000 claims description 5
101700084791 eprA1 Proteins 0.000 claims description 5
101700026663 expR Proteins 0.000 claims description 5
239000000411 inducer Substances 0.000 claims description 5
229910052760 oxygen Inorganic materials 0.000 claims description 5
230000037361 pathway Effects 0.000 claims description 5
239000000546 pharmaceutic aid Substances 0.000 claims description 5
230000003248 secreting Effects 0.000 claims description 5
230000002269 spontaneous Effects 0.000 claims description 5
229910052717 sulfur Inorganic materials 0.000 claims description 5
229960004072 thrombin Drugs 0.000 claims description 5
102100001249 ALB Human genes 0.000 claims description 4
101710027066 ALB Proteins 0.000 claims description 4
101700056583 CD27 Proteins 0.000 claims description 4
102100019459 CD27 Human genes 0.000 claims description 4
102100019461 CD28 Human genes 0.000 claims description 4
101700033362 CD28 Proteins 0.000 claims description 4
239000004215 Carbon black (E152) Substances 0.000 claims description 4
102000005600 Cathepsins Human genes 0.000 claims description 4
108010084457 Cathepsins Proteins 0.000 claims description 4
102100003966 ELANE Human genes 0.000 claims description 4
102100008658 FN1 Human genes 0.000 claims description 4
102100008453 FOLH1 Human genes 0.000 claims description 4
230000035693 Fab Effects 0.000 claims description 4
108010067306 Fibronectins Proteins 0.000 claims description 4
102100016384 HAVCR2 Human genes 0.000 claims description 4
101710004393 HAVCR2 Proteins 0.000 claims description 4
210000004692 Intercellular Junctions Anatomy 0.000 claims description 4
102000003729 Neprilysin Human genes 0.000 claims description 4
102100007289 PDCD1LG2 Human genes 0.000 claims description 4
101710011976 PDCD1LG2 Proteins 0.000 claims description 4
102100016187 PVR Human genes 0.000 claims description 4
102100009537 TNFRSF9 Human genes 0.000 claims description 4
101710040535 TNFRSF9 Proteins 0.000 claims description 4
102000004338 Transferrin Human genes 0.000 claims description 4
108090000901 Transferrin Proteins 0.000 claims description 4
102100015314 VSIR Human genes 0.000 claims description 4
101710036075 VSIR Proteins 0.000 claims description 4
230000004663 cell proliferation Effects 0.000 claims description 4
230000037320 fibronectin Effects 0.000 claims description 4
230000002147 killing Effects 0.000 claims description 4
239000000825 pharmaceutical preparation Substances 0.000 claims description 4
230000028327 secretion Effects 0.000 claims description 4
150000003384 small molecules Chemical class 0.000 claims description 4
239000012581 transferrin Substances 0.000 claims description 4
229940064734 Aminobenzoate Drugs 0.000 claims description 3
102100019456 CD276 Human genes 0.000 claims description 3
101700015421 CD276 Proteins 0.000 claims description 3
101710040446 CD40 Proteins 0.000 claims description 3
102100013137 CD40 Human genes 0.000 claims description 3
NZNMSOFKMUBTKW-UHFFFAOYSA-N Cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 claims description 3
101700036477 FOLH1 Proteins 0.000 claims description 3
102100003900 GEM Human genes 0.000 claims description 3
108060003143 GEM Proteins 0.000 claims description 3
210000003714 Granulocytes Anatomy 0.000 claims description 3
210000000822 Killer Cells, Natural Anatomy 0.000 claims description 3
102100004651 LGALS9 Human genes 0.000 claims description 3
108010028275 Leukocyte Elastase Proteins 0.000 claims description 3
210000001165 Lymph Nodes Anatomy 0.000 claims description 3
101710005673 NECTIN2 Proteins 0.000 claims description 3
101700008337 PSMA Proteins 0.000 claims description 3
239000004721 Polyphenylene oxide Substances 0.000 claims description 3
108060007796 SPATA2 Proteins 0.000 claims description 3
102100019633 ST14 Human genes 0.000 claims description 3
102000012479 Serine Proteases Human genes 0.000 claims description 3
108010022999 Serine Proteases Proteins 0.000 claims description 3
102100012088 TLR3 Human genes 0.000 claims description 3
101700023131 TLR3 Proteins 0.000 claims description 3
102000008235 Toll-Like Receptor 9 Human genes 0.000 claims description 3
108010060818 Toll-Like Receptor 9 Proteins 0.000 claims description 3
102100014952 VTCN1 Human genes 0.000 claims description 3
101700068327 VTCN1 Proteins 0.000 claims description 3
XXXHSQBVHSJQKS-UHFFFAOYSA-N amino benzoate Chemical compound NOC(=O)C1=CC=CC=C1 XXXHSQBVHSJQKS-UHFFFAOYSA-N 0.000 claims description 3
102000031064 asparaginylendopeptidase Human genes 0.000 claims description 3
108010055066 asparaginylendopeptidase Proteins 0.000 claims description 3
125000002619 bicyclic group Chemical group 0.000 claims description 3
UIIMBOGNXHQVGW-UHFFFAOYSA-M buffer Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 3
230000000981 bystander Effects 0.000 claims description 3
230000004656 cell transport Effects 0.000 claims description 3
230000001472 cytotoxic Effects 0.000 claims description 3
231100000433 cytotoxic Toxicity 0.000 claims description 3
HKXJWBUUDLVWML-UHFFFAOYSA-N methyl cyclohexanecarboxylate;pyrrole-2,5-dione Chemical compound O=C1NC(=O)C=C1.COC(=O)C1CCCCC1 HKXJWBUUDLVWML-UHFFFAOYSA-N 0.000 claims description 3
229920001481 poly(stearyl methacrylate) Polymers 0.000 claims description 3
229920000570 polyether Polymers 0.000 claims description 3
230000036593 pulmonary vascular resistance Effects 0.000 claims description 3
101710044770 sll1951 Proteins 0.000 claims description 3
102000002938 thrombospondin family Human genes 0.000 claims description 3
108060008245 thrombospondin family Proteins 0.000 claims description 3
PQEJXGNZBLONLG-XJDOXCRVSA-N (2R)-2-amino-3-[1-[3-[2-[4-[1,3-bis(2-methoxyethylcarbamoyloxy)propan-2-yloxy]butanoylamino]ethylamino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid Chemical compound COCCNC(=O)OCC(COC(=O)NCCOC)OCCCC(=O)NCCNC(=O)CCN1C(=O)CC(SC[C@H](N)C(O)=O)C1=O PQEJXGNZBLONLG-XJDOXCRVSA-N 0.000 claims description 2
XEYBRNLFEZDVAW-ARSRFYASSA-N (5Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-5-oxocyclopentyl]hept-5-enoic acid Chemical compound CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O XEYBRNLFEZDVAW-ARSRFYASSA-N 0.000 claims description 2
102100007702 BTN1A1 Human genes 0.000 claims description 2
101710043923 BTN1A1 Proteins 0.000 claims description 2
102100015496 BTN2A2 Human genes 0.000 claims description 2
101710012271 BTN2A2 Proteins 0.000 claims description 2
102100015491 BTN3A2 Human genes 0.000 claims description 2
101710012706 BTN3A2 Proteins 0.000 claims description 2
102100014180 BTNL2 Human genes 0.000 claims description 2
101700021769 BTNL2 Proteins 0.000 claims description 2
102100003729 CD40LG Human genes 0.000 claims description 2
101710003804 CD40LG Proteins 0.000 claims description 2
102100005175 CSF1R Human genes 0.000 claims description 2
101700063802 CSF1R Proteins 0.000 claims description 2
102000005927 Cysteine Proteases Human genes 0.000 claims description 2
108010005843 Cysteine Proteases Proteins 0.000 claims description 2
210000003979 Eosinophils Anatomy 0.000 claims description 2
101710042195 GAL9 Proteins 0.000 claims description 2
102100014733 ICOSLG Human genes 0.000 claims description 2
101710039212 ICOSLG Proteins 0.000 claims description 2
101700025933 IR07 Proteins 0.000 claims description 2
210000004322 M2 macrophage Anatomy 0.000 claims description 2
102100019764 PDCD1 Human genes 0.000 claims description 2
102000001938 Plasminogen Activators Human genes 0.000 claims description 2
108010001014 Plasminogen Activators Proteins 0.000 claims description 2
102100002617 TLR1 Human genes 0.000 claims description 2
101700068316 TLR1 Proteins 0.000 claims description 2
102100012096 TLR2 Human genes 0.000 claims description 2
101700064022 TLR2 Proteins 0.000 claims description 2
102100012087 TLR4 Human genes 0.000 claims description 2
101700022711 TLR4 Proteins 0.000 claims description 2
102100006352 TLR5 Human genes 0.000 claims description 2
101700025666 TLR5 Proteins 0.000 claims description 2
102100006353 TLR6 Human genes 0.000 claims description 2
101700030074 TLR6 Proteins 0.000 claims description 2
102100006354 TLR8 Human genes 0.000 claims description 2
101700071772 TLR8 Proteins 0.000 claims description 2
102100003084 TNFSF9 Human genes 0.000 claims description 2
101710025686 TNFSF9 Proteins 0.000 claims description 2
229960005356 Urokinase Drugs 0.000 claims description 2
102000003990 Urokinase-type plasminogen activator Human genes 0.000 claims description 2
108090000435 Urokinase-type plasminogen activator Proteins 0.000 claims description 2
229940050528 albumin Drugs 0.000 claims description 2
150000001412 amines Chemical class 0.000 claims description 2
230000000903 blocking Effects 0.000 claims description 2
210000003690 classically activated macrophage Anatomy 0.000 claims description 2
229960002986 dinoprostone Drugs 0.000 claims description 2
230000002255 enzymatic Effects 0.000 claims description 2
210000003289 regulatory T cell Anatomy 0.000 claims description 2
231100000331 toxic Toxicity 0.000 claims description 2
230000002588 toxic Effects 0.000 claims description 2
102000033147 ERVK-25 Human genes 0.000 claims 9
101700017647 CD33 Proteins 0.000 claims 2
102100016493 CD33 Human genes 0.000 claims 2
108009000330 Matrix Metalloproteinases Proteins 0.000 claims 2
125000001183 hydrocarbyl group Chemical group 0.000 claims 2
102000002689 toll-like receptors Human genes 0.000 claims 2
108020000411 toll-like receptors Proteins 0.000 claims 2
210000002889 Endothelial Cells Anatomy 0.000 claims 1
125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 claims 1
102100013504 RPL17 Human genes 0.000 claims 1
XZAZIVPAQXCKSW-UHFFFAOYSA-N [N-(hydroxymethyl)anilino]methanol Chemical compound OCN(CO)C1=CC=CC=C1 XZAZIVPAQXCKSW-UHFFFAOYSA-N 0.000 claims 1
230000014828 interferon-gamma production Effects 0.000 claims 1
108010091175 matriptase Proteins 0.000 claims 1
NQPDZGIKBAWPEJ-UHFFFAOYSA-M valerate Chemical compound CCCCC([O-])=O NQPDZGIKBAWPEJ-UHFFFAOYSA-M 0.000 claims 1
102000035443 Peptidases Human genes 0.000 description 445
235000019833 protease Nutrition 0.000 description 434
235000001014 amino acid Nutrition 0.000 description 57
150000001413 amino acids Chemical class 0.000 description 56
210000000349 Chromosomes Anatomy 0.000 description 33
229940021015 I.V. solution additive Amino Acids Drugs 0.000 description 33
241001430294 unidentified retrovirus Species 0.000 description 33
125000003118 aryl group Chemical group 0.000 description 30
230000002378 acidificating Effects 0.000 description 29
102000033207 ERVK-9 Human genes 0.000 description 28
101710003629 ERVK-9 Proteins 0.000 description 28
230000001264 neutralization Effects 0.000 description 27
OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 24
125000000510 L-tryptophano group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C(C([H])([H])[C@@]([H])(C(O[H])=O)N([H])[*])C2=C1[H] 0.000 description 23
230000000694 effects Effects 0.000 description 22
125000000217 alkyl group Chemical group 0.000 description 21
230000004044 response Effects 0.000 description 19
201000010099 disease Diseases 0.000 description 18
125000001500 prolyl group Chemical group [H]N1C([H])(C(=O)[*])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 17
102000006640 EC 2.3.2.2 Human genes 0.000 description 15
AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 description 15
COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 15
241000699666 Mus <mouse, genus> Species 0.000 description 15
108010050095 PT-100 dipeptide Proteins 0.000 description 15
125000001424 substituent group Chemical group 0.000 description 15
OZAIFHULBGXAKX-UHFFFAOYSA-N precursor Substances N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 14
108020004206 EC 2.3.2.2 Proteins 0.000 description 13
102000018358 Immunoglobulins Human genes 0.000 description 13
108060003951 Immunoglobulins Proteins 0.000 description 13
101710033528 TEPSIN Proteins 0.000 description 13
125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 13
201000009030 carcinoma Diseases 0.000 description 13
150000001875 compounds Chemical class 0.000 description 13
125000000623 heterocyclic group Chemical group 0.000 description 13
229960001153 serine Drugs 0.000 description 13
235000004400 serine Nutrition 0.000 description 13
ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 12
239000002253 acid Substances 0.000 description 12
229940088597 Hormone Drugs 0.000 description 11
101700086543 M23B Proteins 0.000 description 11
239000005556 hormone Substances 0.000 description 11
238000006467 substitution reaction Methods 0.000 description 11
229960002433 Cysteine Drugs 0.000 description 10
FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 10
FKCMADOPPWWGNZ-YUMQZZPRSA-N [(2R)-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidin-2-yl]boronic acid Chemical compound CC(C)[C@H](N)C(=O)N1CCC[C@H]1B(O)O FKCMADOPPWWGNZ-YUMQZZPRSA-N 0.000 description 10
230000004913 activation Effects 0.000 description 10
125000001931 aliphatic group Chemical group 0.000 description 10
DHMQDGOQFOQNFH-UHFFFAOYSA-N glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 10
108010000684 Matrix Metalloproteinases Proteins 0.000 description 9
230000004064 dysfunction Effects 0.000 description 9
230000002708 enhancing Effects 0.000 description 9
230000004927 fusion Effects 0.000 description 9
230000014509 gene expression Effects 0.000 description 9
125000001072 heteroaryl group Chemical group 0.000 description 9
125000005842 heteroatoms Chemical group 0.000 description 9
238000000338 in vitro Methods 0.000 description 9
125000004429 atoms Chemical group 0.000 description 8
230000015572 biosynthetic process Effects 0.000 description 8
125000004432 carbon atoms Chemical group C* 0.000 description 8
230000001413 cellular Effects 0.000 description 8
230000000875 corresponding Effects 0.000 description 8
125000000753 cycloalkyl group Chemical group 0.000 description 8
230000001965 increased Effects 0.000 description 8
SIKJAQJRHWYJAI-UHFFFAOYSA-N indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 8
238000000034 method Methods 0.000 description 8
238000003786 synthesis reaction Methods 0.000 description 8
AOJJSUZBOXZQNB-TZSSRYMLSA-N ADRIAMYCIN Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 7
108010047041 Complementarity Determining Regions Proteins 0.000 description 7
229960004679 Doxorubicin Drugs 0.000 description 7
108090000708 Proteasome Endopeptidase Complex Proteins 0.000 description 7
102000004245 Proteasome Endopeptidase Complex Human genes 0.000 description 7
230000003197 catalytic Effects 0.000 description 7
239000012274 immune-checkpoint protein inhibitor Substances 0.000 description 7
229940121650 immune-checkpoint protein inhibitors Drugs 0.000 description 7
230000002194 synthesizing Effects 0.000 description 7
230000004614 tumor growth Effects 0.000 description 7
206010006187 Breast cancer Diseases 0.000 description 6
102000004157 Hydrolases Human genes 0.000 description 6
108090000604 Hydrolases Proteins 0.000 description 6
229960000310 ISOLEUCINE Drugs 0.000 description 6
102100019442 ITGAL Human genes 0.000 description 6
239000004473 Threonine Substances 0.000 description 6
108090000848 Ubiquitin Proteins 0.000 description 6
102400000757 Ubiquitin Human genes 0.000 description 6
125000003342 alkenyl group Chemical group 0.000 description 6
125000004414 alkyl thio group Chemical group 0.000 description 6
125000004093 cyano group Chemical group *C#N 0.000 description 6
RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical group CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
210000002865 immune cell Anatomy 0.000 description 6
235000014705 isoleucine Nutrition 0.000 description 6
230000003902 lesions Effects 0.000 description 6
238000004519 manufacturing process Methods 0.000 description 6
239000011159 matrix material Substances 0.000 description 6
230000035755 proliferation Effects 0.000 description 6
125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 6
229960002898 threonine Drugs 0.000 description 6
235000008521 threonine Nutrition 0.000 description 6
229960003767 Alanine Drugs 0.000 description 5
229920001405 Coding region Polymers 0.000 description 5
102000003688 G-protein coupled receptors Human genes 0.000 description 5
108090000045 G-protein coupled receptors Proteins 0.000 description 5
229960002989 Glutamic Acid Drugs 0.000 description 5
229960002449 Glycine Drugs 0.000 description 5
239000004471 Glycine Substances 0.000 description 5
108010064750 Humanized Monoclonal Antibodies Proteins 0.000 description 5
102000015434 Humanized Monoclonal Antibodies Human genes 0.000 description 5
210000000987 Immune System Anatomy 0.000 description 5
QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 5
HPJKCIUCZWXJDR-UHFFFAOYSA-N Letrozole Chemical compound C1=CC(C#N)=CC=C1C(N1N=CN=C1)C1=CC=C(C#N)C=C1 HPJKCIUCZWXJDR-UHFFFAOYSA-N 0.000 description 5
206010024324 Leukaemias Diseases 0.000 description 5
101700060512 MMP2 Proteins 0.000 description 5
102100014894 MMP2 Human genes 0.000 description 5
229960004452 Methionine Drugs 0.000 description 5
229960005190 Phenylalanine Drugs 0.000 description 5
102000001400 Tryptase family Human genes 0.000 description 5
108060005989 Tryptase family Proteins 0.000 description 5
229960004441 Tyrosine Drugs 0.000 description 5
229960004528 Vincristine Drugs 0.000 description 5
235000004279 alanine Nutrition 0.000 description 5
125000000304 alkynyl group Chemical group 0.000 description 5
230000000259 anti-tumor Effects 0.000 description 5
239000002246 antineoplastic agent Substances 0.000 description 5
229910052799 carbon Inorganic materials 0.000 description 5
125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 5
230000000295 complement Effects 0.000 description 5
238000010192 crystallographic characterization Methods 0.000 description 5
150000002148 esters Chemical group 0.000 description 5
235000013922 glutamic acid Nutrition 0.000 description 5
239000004220 glutamic acid Substances 0.000 description 5
230000012010 growth Effects 0.000 description 5
125000000592 heterocycloalkyl group Chemical group 0.000 description 5
125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 5
150000002576 ketones Chemical group 0.000 description 5
229960003136 leucine Drugs 0.000 description 5
235000005772 leucine Nutrition 0.000 description 5
235000006109 methionine Nutrition 0.000 description 5
108020004707 nucleic acids Proteins 0.000 description 5
150000007523 nucleic acids Chemical class 0.000 description 5
150000002894 organic compounds Chemical class 0.000 description 5
210000000056 organs Anatomy 0.000 description 5
235000008729 phenylalanine Nutrition 0.000 description 5
239000000651 prodrug Substances 0.000 description 5
229940002612 prodrugs Drugs 0.000 description 5
230000002829 reduced Effects 0.000 description 5
239000000126 substance Substances 0.000 description 5
230000002459 sustained Effects 0.000 description 5
235000002374 tyrosine Nutrition 0.000 description 5
229960005486 vaccines Drugs 0.000 description 5
OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 5
CZPWVGJYEJSRLH-UHFFFAOYSA-N 289-95-2 Chemical class C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 4
208000000409 Breast Neoplasms Diseases 0.000 description 4
102000004127 Cytokines Human genes 0.000 description 4
108090000695 Cytokines Proteins 0.000 description 4
QIVBCDIJIAJPQS-SECBINFHSA-N D-tryptophane Chemical compound C1=CC=C2C(C[C@@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-SECBINFHSA-N 0.000 description 4
102100012353 DPP4 Human genes 0.000 description 4
206010011968 Decreased immune responsiveness Diseases 0.000 description 4
210000000981 Epithelium Anatomy 0.000 description 4
229960002743 Glutamine Drugs 0.000 description 4
229960002885 Histidine Drugs 0.000 description 4
RCINICONZNJXQF-MZXODVADSA-N Intaxel Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 4
HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 4
208000007046 Leukemia, Myeloid, Acute Diseases 0.000 description 4
102100007223 MGLL Human genes 0.000 description 4
101700027140 MGLL Proteins 0.000 description 4
101700019781 MMP1 Proteins 0.000 description 4
102100018200 MMP1 Human genes 0.000 description 4
101700040359 MMP3 Proteins 0.000 description 4
102100014893 MMP3 Human genes 0.000 description 4
101700067851 MMP9 Proteins 0.000 description 4
102100006844 MMP9 Human genes 0.000 description 4
206010027476 Metastasis Diseases 0.000 description 4
KKZJGLLVHKMTCM-UHFFFAOYSA-N Mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 4
229960001156 Mitoxantrone Drugs 0.000 description 4
241000699660 Mus musculus Species 0.000 description 4
102100016461 PIDD1 Human genes 0.000 description 4
101700026154 PIDD1 Proteins 0.000 description 4
229960001592 Paclitaxel Drugs 0.000 description 4
102100017643 SLAMF1 Human genes 0.000 description 4
206010039491 Sarcoma Diseases 0.000 description 4
241001522306 Serinus serinus Species 0.000 description 4
229960004799 Tryptophan Drugs 0.000 description 4
150000001299 aldehydes Chemical group 0.000 description 4
125000003710 aryl alkyl group Chemical group 0.000 description 4
XSCXGOPPNHTWEF-UHFFFAOYSA-N diazenide Chemical group [N-]=N XSCXGOPPNHTWEF-UHFFFAOYSA-N 0.000 description 4
201000009910 diseases by infectious agent Diseases 0.000 description 4
235000004554 glutamine Nutrition 0.000 description 4
235000014304 histidine Nutrition 0.000 description 4
230000001939 inductive effect Effects 0.000 description 4
229960003881 letrozole Drugs 0.000 description 4
230000003211 malignant Effects 0.000 description 4
125000001360 methionine group Chemical group N[C@@H](CCSC)C(=O)* 0.000 description 4
125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
229910052757 nitrogen Inorganic materials 0.000 description 4
125000003729 nucleotide group Chemical group 0.000 description 4
230000036961 partial Effects 0.000 description 4
230000035699 permeability Effects 0.000 description 4
ACVYVLVWPXVTIT-UHFFFAOYSA-M phosphinate Chemical group [O-][PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-M 0.000 description 4
NJRWNWYFPOFDFN-UHFFFAOYSA-L phosphonate(2-) Chemical group [O-][P]([O-])=O NJRWNWYFPOFDFN-UHFFFAOYSA-L 0.000 description 4
229920000023 polynucleotide Polymers 0.000 description 4
239000002157 polynucleotide Substances 0.000 description 4
125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
230000006010 pyroptosis Effects 0.000 description 4
230000011664 signaling Effects 0.000 description 4
210000000130 stem cell Anatomy 0.000 description 4
125000000547 substituted alkyl group Chemical group 0.000 description 4
230000004083 survival Effects 0.000 description 4
229960004295 valine Drugs 0.000 description 4
235000014393 valine Nutrition 0.000 description 4
239000004474 valine Substances 0.000 description 4
ZROHGHOFXNOHSO-BNTLRKBRSA-L (1R,2R)-cyclohexane-1,2-diamine;oxalate;platinum(2+) Chemical compound [H][N]([C@@H]1CCCC[C@H]1[N]1([H])[H])([H])[Pt]11OC(=O)C(=O)O1 ZROHGHOFXNOHSO-BNTLRKBRSA-L 0.000 description 3
GHASVSINZRGABV-UHFFFAOYSA-N 5-flurouricil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 3
102100010284 ADAM17 Human genes 0.000 description 3
101710043085 ADAM17 Proteins 0.000 description 3
101710043111 ADAM28 Proteins 0.000 description 3
108091005658 ADAMTS8 Proteins 0.000 description 3
206010000871 Acute monocytic leukaemia Diseases 0.000 description 3
108090000915 Aminopeptidases Proteins 0.000 description 3
102000004400 Aminopeptidases Human genes 0.000 description 3
229940064005 Antibiotic throat preparations Drugs 0.000 description 3
229940083879 Antibiotics FOR TREATMENT OF HEMORRHOIDS AND ANAL FISSURES FOR TOPICAL USE Drugs 0.000 description 3
229940042052 Antibiotics for systemic use Drugs 0.000 description 3
229940042786 Antitubercular Antibiotics Drugs 0.000 description 3
239000004475 Arginine Substances 0.000 description 3
229960001230 Asparagine Drugs 0.000 description 3
229960005261 Aspartic Acid Drugs 0.000 description 3
210000000941 Bile Anatomy 0.000 description 3
206010005003 Bladder cancer Diseases 0.000 description 3
210000000988 Bone and Bones Anatomy 0.000 description 3
102100016160 CAD Human genes 0.000 description 3
102100008191 CD8A Human genes 0.000 description 3
101700054655 CD8A Proteins 0.000 description 3
102100006090 CELA3B Human genes 0.000 description 3
108010051152 Carboxylesterase Proteins 0.000 description 3
102000013392 Carboxylesterase Human genes 0.000 description 3
102000005572 Cathepsin A Human genes 0.000 description 3
108010059081 Cathepsin A Proteins 0.000 description 3
230000037250 Clearance Effects 0.000 description 3
ACSIXWWBWUQEHA-UHFFFAOYSA-N Clodronic acid Chemical compound OP(O)(=O)C(Cl)(Cl)P(O)(O)=O ACSIXWWBWUQEHA-UHFFFAOYSA-N 0.000 description 3
108091000127 Dihydroorotase Proteins 0.000 description 3
229960002949 Fluorouracil Drugs 0.000 description 3
229940093922 Gynecological Antibiotics Drugs 0.000 description 3
206010020243 Hodgkin's disease Diseases 0.000 description 3
241000282412 Homo Species 0.000 description 3
102100019334 ITGA4 Human genes 0.000 description 3
101710006711 ITGA4 Proteins 0.000 description 3
102100012155 ITGA6 Human genes 0.000 description 3
101710006573 ITGAL Proteins 0.000 description 3
102100001475 ITGB2 Human genes 0.000 description 3
101710006663 ITGB2 Proteins 0.000 description 3
102100011339 KLK3 Human genes 0.000 description 3
ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 3
ONIBWKKTOPOVIA-BYPYZUCNSA-N L-proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 3
206010058467 Lung neoplasm malignant Diseases 0.000 description 3
108010064548 Lymphocyte Function-Associated Antigen-1 Proteins 0.000 description 3
206010025323 Lymphomas Diseases 0.000 description 3
239000004472 Lysine Substances 0.000 description 3
101700081066 MMP11 Proteins 0.000 description 3
102100016819 MMP11 Human genes 0.000 description 3
102100004961 MMP12 Human genes 0.000 description 3
101700084657 MMP13 Proteins 0.000 description 3
102100004962 MMP13 Human genes 0.000 description 3
102100004965 MMP14 Human genes 0.000 description 3
101700056196 MMP14 Proteins 0.000 description 3
102100018202 MMP19 Human genes 0.000 description 3
101710030790 MMP19 Proteins 0.000 description 3
102000009112 Mannose-Binding Lectin Human genes 0.000 description 3
108010087870 Mannose-Binding Lectin Proteins 0.000 description 3
229920001850 Nucleic acid sequence Polymers 0.000 description 3
101700047009 PCSK6 Proteins 0.000 description 3
102100003489 PCSK6 Human genes 0.000 description 3
210000002381 Plasma Anatomy 0.000 description 3
229960002429 Proline Drugs 0.000 description 3
108010072866 Prostate-Specific Antigen Proteins 0.000 description 3
102100017641 SLAMF6 Human genes 0.000 description 3
101710030439 SLAMF6 Proteins 0.000 description 3
210000001550 Testis Anatomy 0.000 description 3
FOCVUCIESVLUNU-UHFFFAOYSA-N ThioTEPA Chemical compound C1CN1P(N1CC1)(=S)N1CC1 FOCVUCIESVLUNU-UHFFFAOYSA-N 0.000 description 3
229940024982 Topical Antifungal Antibiotics Drugs 0.000 description 3
210000001635 Urinary Tract Anatomy 0.000 description 3
XRASPMIURGNCCH-UHFFFAOYSA-N Zoledronic acid Chemical compound OP(=O)(O)C(P(O)(O)=O)(O)CN1C=CN=C1 XRASPMIURGNCCH-UHFFFAOYSA-N 0.000 description 3
150000007513 acids Chemical class 0.000 description 3
230000001154 acute Effects 0.000 description 3
239000002671 adjuvant Substances 0.000 description 3
230000000240 adjuvant Effects 0.000 description 3
230000000735 allogeneic Effects 0.000 description 3
125000003277 amino group Chemical group 0.000 description 3
238000004458 analytical method Methods 0.000 description 3
239000003242 anti bacterial agent Substances 0.000 description 3
230000000890 antigenic Effects 0.000 description 3
229960000070 antineoplastic Monoclonal antibodies Drugs 0.000 description 3
229960003121 arginine Drugs 0.000 description 3
235000009697 arginine Nutrition 0.000 description 3
235000009582 asparagine Nutrition 0.000 description 3
235000003704 aspartic acid Nutrition 0.000 description 3
230000003115 biocidal Effects 0.000 description 3
OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
230000035512 clearance Effects 0.000 description 3
201000011231 colorectal cancer Diseases 0.000 description 3
230000009089 cytolysis Effects 0.000 description 3
230000001461 cytolytic Effects 0.000 description 3
230000001086 cytosolic Effects 0.000 description 3
230000003247 decreasing Effects 0.000 description 3
239000003937 drug carrier Substances 0.000 description 3
OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical class C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 description 3
YLQBMQCUIZJEEH-UHFFFAOYSA-N furane Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
229910052739 hydrogen Inorganic materials 0.000 description 3
239000001257 hydrogen Substances 0.000 description 3
230000036039 immunity Effects 0.000 description 3
230000001976 improved Effects 0.000 description 3
229940079866 intestinal antibiotics Drugs 0.000 description 3
229960003646 lysine Drugs 0.000 description 3
235000018977 lysine Nutrition 0.000 description 3
230000002438 mitochondrial Effects 0.000 description 3
230000004048 modification Effects 0.000 description 3
238000006011 modification reaction Methods 0.000 description 3
229960000060 monoclonal antibodies Drugs 0.000 description 3
108010045030 monoclonal antibodies Proteins 0.000 description 3
102000005614 monoclonal antibodies Human genes 0.000 description 3
IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
229940005935 ophthalmologic Antibiotics Drugs 0.000 description 3
125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 3
230000001717 pathogenic Effects 0.000 description 3
244000052769 pathogens Species 0.000 description 3
125000003367 polycyclic group Polymers 0.000 description 3
229920000642 polymer Polymers 0.000 description 3
230000004481 post-translational protein modification Effects 0.000 description 3
230000003389 potentiating Effects 0.000 description 3
239000000047 product Substances 0.000 description 3
235000013930 proline Nutrition 0.000 description 3
150000003254 radicals Chemical class 0.000 description 3
230000004043 responsiveness Effects 0.000 description 3
238000009958 sewing Methods 0.000 description 3
230000000638 stimulation Effects 0.000 description 3
229930003347 taxol Natural products 0.000 description 3
229960004276 zoledronic acid Drugs 0.000 description 3
ADGFNXYXROZUOG-VKHMYHEASA-N (2S)-2-(cyanoamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC#N ADGFNXYXROZUOG-VKHMYHEASA-N 0.000 description 2
BLCJBICVQSYOIF-UHFFFAOYSA-N 2,2-diaminobutanoic acid Chemical compound CCC(N)(N)C(O)=O BLCJBICVQSYOIF-UHFFFAOYSA-N 0.000 description 2
WTDRDQBEARUVNC-LURJTMIESA-N 3-hydroxy-L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-LURJTMIESA-N 0.000 description 2
229940000681 5-Hydroxytryptophan Drugs 0.000 description 2
LDCYZAJDBXYCGN-VIFPVBQESA-N 5-hydroxy-L-tryptophan zwitterion Chemical compound C1=C(O)C=C2C(C[C@H](N)C(O)=O)=CNC2=C1 LDCYZAJDBXYCGN-VIFPVBQESA-N 0.000 description 2
101710024036 AADAC Proteins 0.000 description 2
102100012011 AADAC Human genes 0.000 description 2
101710025678 ABHD12B Proteins 0.000 description 2
102100004960 ABHD12B Human genes 0.000 description 2
102100006013 ABHD14B Human genes 0.000 description 2
101710011283 ABHD14B Proteins 0.000 description 2
102100011386 ABHD5 Human genes 0.000 description 2
101700007844 ABHD5 Proteins 0.000 description 2
102100010286 ADAM10 Human genes 0.000 description 2
101710043077 ADAM10 Proteins 0.000 description 2
102100010288 ADAM12 Human genes 0.000 description 2
101710043080 ADAM12 Proteins 0.000 description 2
101710043098 ADAM15 Proteins 0.000 description 2
101710043108 ADAM20 Proteins 0.000 description 2
101710043106 ADAM21 Proteins 0.000 description 2
101710043107 ADAM23 Proteins 0.000 description 2
102100001917 ADAM28 Human genes 0.000 description 2
101710042945 ADAM33 Proteins 0.000 description 2
108091005564 ADAMTS18 Proteins 0.000 description 2
102100001556 ADGRA3 Human genes 0.000 description 2
101710005079 ADGRA3 Proteins 0.000 description 2
102100001554 ADGRB2 Human genes 0.000 description 2
101710005061 ADGRB2 Proteins 0.000 description 2
102100020344 ADGRD1 Human genes 0.000 description 2
101710005019 ADGRD1 Proteins 0.000 description 2
101710005032 ADGRE5 Proteins 0.000 description 2
102100020523 ADGRE5 Human genes 0.000 description 2
102100000074 ADGRF3 Human genes 0.000 description 2
101710005047 ADGRF3 Proteins 0.000 description 2
102100000071 ADGRF5 Human genes 0.000 description 2
101710005044 ADGRF5 Proteins 0.000 description 2
102100010882 ADGRG1 Human genes 0.000 description 2
101710005049 ADGRG1 Proteins 0.000 description 2
101710005048 ADGRG2 Proteins 0.000 description 2
102100010894 ADGRG3 Human genes 0.000 description 2
101710005054 ADGRG3 Proteins 0.000 description 2
101710005051 ADGRG5 Proteins 0.000 description 2
102100010897 ADGRG6 Human genes 0.000 description 2
101710005050 ADGRG6 Proteins 0.000 description 2
102100017222 ADGRG7 Human genes 0.000 description 2
101710005052 ADGRG7 Proteins 0.000 description 2
102100000313 ADGRL4 Human genes 0.000 description 2
101710004992 ADGRL4 Proteins 0.000 description 2
102100003718 APEH Human genes 0.000 description 2
102100001795 ASRGL1 Human genes 0.000 description 2
101700042854 ATP23 Proteins 0.000 description 2
229960004373 Acetylcholine Drugs 0.000 description 2
206010000830 Acute leukaemia Diseases 0.000 description 2
208000009956 Adenocarcinoma Diseases 0.000 description 2
OGSPWJRAVKPPFI-UHFFFAOYSA-N Alendronic Acid Chemical compound NCCCC(O)(P(O)(O)=O)P(O)(O)=O OGSPWJRAVKPPFI-UHFFFAOYSA-N 0.000 description 2
108020003076 Amidases Proteins 0.000 description 2
102000005922 Amidases Human genes 0.000 description 2
ROBVIMPUHSLWNV-UHFFFAOYSA-N Aminoglutethimide Chemical compound C=1C=C(N)C=CC=1C1(CC)CCC(=O)NC1=O ROBVIMPUHSLWNV-UHFFFAOYSA-N 0.000 description 2
229960003437 Aminoglutethimide Drugs 0.000 description 2
102100015650 BACE1 Human genes 0.000 description 2
210000004369 Blood Anatomy 0.000 description 2
102000015081 Blood Coagulation Factors Human genes 0.000 description 2
108010039209 Blood Coagulation Factors Proteins 0.000 description 2
210000001185 Bone Marrow Anatomy 0.000 description 2
210000004556 Brain Anatomy 0.000 description 2
102100003814 CASP3 Human genes 0.000 description 2
102100014427 CASP4 Human genes 0.000 description 2
102100006337 CASP5 Human genes 0.000 description 2
102100008990 CASP8 Human genes 0.000 description 2
102100000166 CD226 Human genes 0.000 description 2
101700022117 CD226 Proteins 0.000 description 2
102100019451 CD80 Human genes 0.000 description 2
101700080477 CD80 Proteins 0.000 description 2
102100014435 CD96 Human genes 0.000 description 2
101710026045 CD96 Proteins 0.000 description 2
101710026891 CES1 Proteins 0.000 description 2
101710026890 CES3 Proteins 0.000 description 2
102100001446 CES3 Human genes 0.000 description 2
102100003123 CPA4 Human genes 0.000 description 2
101710003556 CPA4 Proteins 0.000 description 2
102100003774 CPZ Human genes 0.000 description 2
102100009031 CTSK Human genes 0.000 description 2
102100015376 CTSV Human genes 0.000 description 2
VSJKWCGYPAHWDS-FQEVSTJZSA-N Camptothecin Chemical compound C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 description 2
GAGWJHPBXLXJQN-UORFTKCHSA-N Capecitabine Chemical compound C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](C)O1 GAGWJHPBXLXJQN-UORFTKCHSA-N 0.000 description 2
UJOBWOGCFQCDNV-UHFFFAOYSA-N Carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
108010080937 Carboxypeptidases A Proteins 0.000 description 2
102000000496 Carboxypeptidases A Human genes 0.000 description 2
208000005623 Carcinogenesis Diseases 0.000 description 2
102000004046 Caspase 2 Human genes 0.000 description 2
108090000552 Caspase 2 Proteins 0.000 description 2
108090000397 Caspase 3 Proteins 0.000 description 2
102000004018 Caspase 6 Human genes 0.000 description 2
108090000425 Caspase 6 Proteins 0.000 description 2
102000004041 Caspase 7 Human genes 0.000 description 2
108090000567 Caspase 7 Proteins 0.000 description 2
108090000538 Caspase 8 Proteins 0.000 description 2
102000004039 Caspase 9 Human genes 0.000 description 2
108090000566 Caspase 9 Proteins 0.000 description 2
102000004068 Caspase-10 Human genes 0.000 description 2
108090000572 Caspase-10 Proteins 0.000 description 2
102000004958 Caspase-14 Human genes 0.000 description 2
108090001132 Caspase-14 Proteins 0.000 description 2
108090000267 Cathepsin C Proteins 0.000 description 2
102000003902 Cathepsin C Human genes 0.000 description 2
210000002421 Cell Wall Anatomy 0.000 description 2
101700062655 Ces1d Proteins 0.000 description 2
206010009944 Colon cancer Diseases 0.000 description 2
PSNOPSMXOBPNNV-VVCTWANISA-N Cryptophycin 1 Chemical compound C1=C(Cl)C(OC)=CC=C1C[C@@H]1C(=O)NC[C@@H](C)C(=O)O[C@@H](CC(C)C)C(=O)O[C@H]([C@H](C)[C@@H]2[C@H](O2)C=2C=CC=CC=2)C/C=C/C(=O)N1 PSNOPSMXOBPNNV-VVCTWANISA-N 0.000 description 2
CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 2
102000015833 Cystatins Human genes 0.000 description 2
108050004038 Cystatins Proteins 0.000 description 2
101700028750 DPEP2 Proteins 0.000 description 2
101700062901 DPP Proteins 0.000 description 2
102100005612 DPP10 Human genes 0.000 description 2
101700023262 DPP10 Proteins 0.000 description 2
101700039720 DPP4 Proteins 0.000 description 2
101700071662 DPP6 Proteins 0.000 description 2
102100015578 DPP6 Human genes 0.000 description 2
108010016626 Dipeptides Proteins 0.000 description 2
101700057458 Drice Proteins 0.000 description 2
108030004769 EC 3.4.13.19 Proteins 0.000 description 2
108010061216 EC 3.4.19.1 Proteins 0.000 description 2
108030003252 EC 3.4.21.108 Proteins 0.000 description 2
108010090225 EC 3.4.21.26 Proteins 0.000 description 2
108030007201 EC 3.4.21.70 Proteins 0.000 description 2
108030007212 EC 3.4.21.79 Proteins 0.000 description 2
108030001378 EC 3.4.22.57 Proteins 0.000 description 2
108030001379 EC 3.4.22.58 Proteins 0.000 description 2
101700066372 ECM38 Proteins 0.000 description 2
102100010782 EGFR Human genes 0.000 description 2
101700039191 EGFR Proteins 0.000 description 2
238000002965 ELISA Methods 0.000 description 2
102100016847 ELN Human genes 0.000 description 2
101700012715 ELN Proteins 0.000 description 2
102100016692 ESR1 Human genes 0.000 description 2
102000005593 Endopeptidases Human genes 0.000 description 2
108010059378 Endopeptidases Proteins 0.000 description 2
VJJPUSNTGOMMGY-MRVIYFEKSA-N Etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 2
229960005420 Etoposide Drugs 0.000 description 2
210000003722 Extracellular Fluid Anatomy 0.000 description 2
102100015541 FCGR3A Human genes 0.000 description 2
101710044656 FCGR3A Proteins 0.000 description 2
101710044657 FCGR3B Proteins 0.000 description 2
101700010580 FLO11 Proteins 0.000 description 2
101700009480 Fcgr3 Proteins 0.000 description 2
108010088842 Fibrinolysin Proteins 0.000 description 2
108091006011 G proteins Proteins 0.000 description 2
102100003880 GGH Human genes 0.000 description 2
101700082072 GGT1 Proteins 0.000 description 2
108091000058 GTP-Binding Proteins Proteins 0.000 description 2
102000030007 GTP-Binding Proteins Human genes 0.000 description 2
102100004391 GZMB Human genes 0.000 description 2
CHPZKNULDCNCBW-UHFFFAOYSA-N Gallium nitrate Chemical compound [Ga+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O CHPZKNULDCNCBW-UHFFFAOYSA-N 0.000 description 2
SDUQYLNIPVEERB-QPPQHZFASA-N Gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 2
210000004907 Glands Anatomy 0.000 description 2
206010018338 Glioma Diseases 0.000 description 2
UYTPUPDQBNUYGX-UHFFFAOYSA-N Guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 description 2
102000004989 Hepsin Human genes 0.000 description 2
108090001101 Hepsin Proteins 0.000 description 2
241000713887 Human endogenous retrovirus Species 0.000 description 2
102100004115 ICAM1 Human genes 0.000 description 2
229940072221 IMMUNOGLOBULINS Drugs 0.000 description 2
102100019333 ITGA1 Human genes 0.000 description 2
101710006705 ITGA1 Proteins 0.000 description 2
101710006669 ITGA6 Proteins 0.000 description 2
102100012153 ITGAD Human genes 0.000 description 2
101710006584 ITGAD Proteins 0.000 description 2
102100012151 ITGAE Human genes 0.000 description 2
101710006585 ITGAE Proteins 0.000 description 2
102100019441 ITGAM Human genes 0.000 description 2
102100019437 ITGAX Human genes 0.000 description 2
101710006689 ITGAX Proteins 0.000 description 2
102100001478 ITGB1 Human genes 0.000 description 2
101710006661 ITGB1 Proteins 0.000 description 2
229960001101 Ifosfamide Drugs 0.000 description 2
HOMGKSMUEGBAAB-UHFFFAOYSA-N Ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 2
KTUFNOKKBVMGRW-UHFFFAOYSA-N Imatinib Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 KTUFNOKKBVMGRW-UHFFFAOYSA-N 0.000 description 2
DOUYETYNHWVLEO-UHFFFAOYSA-N Imiquimod Chemical compound C1=CC=CC2=C3N(CC(C)C)C=NC3=C(N)N=C21 DOUYETYNHWVLEO-UHFFFAOYSA-N 0.000 description 2
102000004851 Immunoglobulin G Human genes 0.000 description 2
108090001095 Immunoglobulin G Proteins 0.000 description 2
108010064593 Intercellular Adhesion Molecule-1 Proteins 0.000 description 2
102000008070 Interferon-gamma Human genes 0.000 description 2
108010074328 Interferon-gamma Proteins 0.000 description 2
108090001007 Interleukin-8 Proteins 0.000 description 2
UWKQSNNFCGGAFS-XIFFEERXSA-N Irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 description 2
108050009808 Isoaspartyl-dipeptidase Proteins 0.000 description 2
101700086173 KLRF1 Proteins 0.000 description 2
102100019598 KLRF1 Human genes 0.000 description 2
210000003734 Kidney Anatomy 0.000 description 2
LRQKBLKVPFOOQJ-YFKPBYRVSA-N L-2-aminohexanoic acid zwitterion Chemical compound CCCC[C@H]([NH3+])C([O-])=O LRQKBLKVPFOOQJ-YFKPBYRVSA-N 0.000 description 2
UKAUYVFTDYCKQA-VKHMYHEASA-N L-homoserine zwitterion Chemical compound OC(=O)[C@@H](N)CCO UKAUYVFTDYCKQA-VKHMYHEASA-N 0.000 description 2
FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 2
AHLPHDHHMVZTML-BYPYZUCNSA-N L-ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 2
239000005517 L01XE01 - Imatinib Substances 0.000 description 2
102200131020 LINS1 M67A Human genes 0.000 description 2
208000009721 Leukemia, Monocytic, Acute Diseases 0.000 description 2
210000002751 Lymph Anatomy 0.000 description 2
210000003712 Lysosomes Anatomy 0.000 description 2
102100012667 MIPEP Human genes 0.000 description 2
101700005917 MMP10 Proteins 0.000 description 2
102100016820 MMP10 Human genes 0.000 description 2
102100018201 MMP17 Human genes 0.000 description 2
101700031813 MMP17 Proteins 0.000 description 2
102100012746 MMP20 Human genes 0.000 description 2
101700010802 MMP20 Proteins 0.000 description 2
101710032498 MMP23B Proteins 0.000 description 2
101700048088 MMP26 Proteins 0.000 description 2
102100012739 MMP26 Human genes 0.000 description 2
101700057314 MMP7 Proteins 0.000 description 2
102100014892 MMP7 Human genes 0.000 description 2
101700042140 MMP8 Proteins 0.000 description 2
102100014897 MMP8 Human genes 0.000 description 2
102100000575 MST1 Human genes 0.000 description 2
102100006037 MUC1 Human genes 0.000 description 2
101700052761 MUC1 Proteins 0.000 description 2
108091009047 Macrophage stimulating protein Proteins 0.000 description 2
206010025650 Malignant melanoma Diseases 0.000 description 2
241000124008 Mammalia Species 0.000 description 2
208000007054 Medullary Carcinoma Diseases 0.000 description 2
102000013800 Meprin beta subunit Human genes 0.000 description 2
108050003615 Meprin beta subunit Proteins 0.000 description 2
241000579835 Merops Species 0.000 description 2
108020004999 Messenger RNA Proteins 0.000 description 2
108090000591 Metallocarboxypeptidase D Proteins 0.000 description 2
206010061289 Metastatic neoplasm Diseases 0.000 description 2
241001465754 Metazoa Species 0.000 description 2
229960004857 Mitomycin Drugs 0.000 description 2
210000001616 Monocytes Anatomy 0.000 description 2
101710005852 Msm_0361 Proteins 0.000 description 2
NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 2
JDHILDINMRGULE-LURJTMIESA-N N(pros)-methyl-L-histidine Chemical compound CN1C=NC=C1C[C@H](N)C(O)=O JDHILDINMRGULE-LURJTMIESA-N 0.000 description 2
BRMWTNUJHUMWMS-LURJTMIESA-N N(tele)-methyl-L-histidine Chemical compound CN1C=NC(C[C@H](N)C(O)=O)=C1 BRMWTNUJHUMWMS-LURJTMIESA-N 0.000 description 2
102000008822 Neuroligin 4 Human genes 0.000 description 2
108050000725 Neuroligin 4 Proteins 0.000 description 2
102100003153 OMA1 Human genes 0.000 description 2
101700054584 OMA1 Proteins 0.000 description 2
206010030155 Oesophageal carcinoma Diseases 0.000 description 2
229960003104 Ornithine Drugs 0.000 description 2
241000283973 Oryctolagus cuniculus Species 0.000 description 2
206010025310 Other lymphomas Diseases 0.000 description 2
206010033128 Ovarian cancer Diseases 0.000 description 2
210000001672 Ovary Anatomy 0.000 description 2
102100001905 PFAS Human genes 0.000 description 2
101710034855 PFAS Proteins 0.000 description 2
102100013251 PKD1 Human genes 0.000 description 2
101710027263 PKD1L2 Proteins 0.000 description 2
102100004367 PKD1L2 Human genes 0.000 description 2
101710010583 PLAU Proteins 0.000 description 2
102100019806 PREP Human genes 0.000 description 2
102100005189 PRSS3 Human genes 0.000 description 2
101710042152 PRSS3 Proteins 0.000 description 2
102100006605 PRSS53 Human genes 0.000 description 2
101710043673 PRSS53 Proteins 0.000 description 2
101710033516 PSMA7 Proteins 0.000 description 2
102100011593 PSMA7 Human genes 0.000 description 2
208000008443 Pancreatic Carcinoma Diseases 0.000 description 2
108090000155 Pancreatic elastase II Proteins 0.000 description 2
108090000284 Pepsin A Proteins 0.000 description 2
108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 2
BZQFBWGGLXLEPQ-REOHCLBHSA-N Phosphoserine Chemical compound OC(=O)[C@@H](N)COP(O)(O)=O BZQFBWGGLXLEPQ-REOHCLBHSA-N 0.000 description 2
206010035226 Plasma cell myeloma Diseases 0.000 description 2
229940012957 Plasmin Drugs 0.000 description 2
206010060862 Prostate cancer Diseases 0.000 description 2
102000014961 Protein Precursors Human genes 0.000 description 2
108010078762 Protein Precursors Proteins 0.000 description 2
PBMFSQRYOILNGV-UHFFFAOYSA-N Pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 2
102000014128 RANK Ligand Human genes 0.000 description 2
108010025832 RANK Ligand Proteins 0.000 description 2
102100000775 REN Human genes 0.000 description 2
241000700159 Rattus Species 0.000 description 2
208000006265 Renal Cell Carcinoma Diseases 0.000 description 2
108090000783 Renin Proteins 0.000 description 2
241000283984 Rodentia Species 0.000 description 2
102000020234 S-formylglutathione hydrolase Human genes 0.000 description 2
108010093322 S-formylglutathione hydrolase Proteins 0.000 description 2
102100001289 SEMA4D Human genes 0.000 description 2
101710023772 SEMA4D Proteins 0.000 description 2
101710028439 SLAMF1 Proteins 0.000 description 2
101700015221 ST14 Proteins 0.000 description 2
229940095743 Selective estrogen receptor modulators Drugs 0.000 description 2
108010074687 Signaling Lymphocytic Activation Molecule Family Member 1 Proteins 0.000 description 2
108010055297 Sterol Esterase Proteins 0.000 description 2
102000000019 Sterol Esterase Human genes 0.000 description 2
FDDDEECHVMSUSB-UHFFFAOYSA-N Sulfanilamide Chemical group NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 2
102100003033 TMPRSS11E Human genes 0.000 description 2
101710009828 TMPRSS11E Proteins 0.000 description 2
102100001067 TMPRSS4 Human genes 0.000 description 2
101710044691 TMPRSS4 Proteins 0.000 description 2
102100016217 TPP1 Human genes 0.000 description 2
102100011933 TPP2 Human genes 0.000 description 2
NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 2
229960001603 Tamoxifen Drugs 0.000 description 2
229960001196 Thiotepa Drugs 0.000 description 2
UCFGDBYHRUNTLO-QHCPKHFHSA-N Topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 description 2
102000000852 Tumor Necrosis Factor-alpha Human genes 0.000 description 2
108010001801 Tumor Necrosis Factor-alpha Proteins 0.000 description 2
102100015870 USP35 Human genes 0.000 description 2
101710010118 USP35 Proteins 0.000 description 2
102100011579 USP7 Human genes 0.000 description 2
108010032448 Ubiquitin-Specific Peptidase 7 Proteins 0.000 description 2
210000003462 Veins Anatomy 0.000 description 2
241000700605 Viruses Species 0.000 description 2
206010049644 Williams syndrome Diseases 0.000 description 2
201000001305 Williams-Beuren syndrome Diseases 0.000 description 2
QTBSBXVTEAMEQO-UHFFFAOYSA-M acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 2
101710038776 acyI Proteins 0.000 description 2
125000002015 acyclic group Chemical group 0.000 description 2
230000002411 adverse Effects 0.000 description 2
125000003545 alkoxy group Chemical group 0.000 description 2
125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 2
230000001195 anabolic Effects 0.000 description 2
230000010056 antibody-dependent cellular cytotoxicity Effects 0.000 description 2
NOWKCMXCCJGMRR-UHFFFAOYSA-N aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 2
230000001580 bacterial Effects 0.000 description 2
UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
108010087173 bile salt-stimulated lipase Proteins 0.000 description 2
102000024070 binding proteins Human genes 0.000 description 2
108091007650 binding proteins Proteins 0.000 description 2
201000000053 blastoma Diseases 0.000 description 2
239000008280 blood Substances 0.000 description 2
239000003114 blood coagulation factor Substances 0.000 description 2
125000001246 bromo group Chemical group Br* 0.000 description 2
230000036952 cancer formation Effects 0.000 description 2
125000002837 carbocyclic group Chemical group 0.000 description 2
231100000504 carcinogenesis Toxicity 0.000 description 2
230000001925 catabolic Effects 0.000 description 2
230000024881 catalytic activity Effects 0.000 description 2
230000003915 cell function Effects 0.000 description 2
125000001309 chloro group Chemical group Cl* 0.000 description 2
VYZAMTAEIAYCRO-UHFFFAOYSA-N chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
229910052804 chromium Inorganic materials 0.000 description 2
239000011651 chromium Substances 0.000 description 2
230000001684 chronic Effects 0.000 description 2
125000000392 cycloalkenyl group Chemical group 0.000 description 2
150000001945 cysteines Chemical class 0.000 description 2
CYQFCXCEBYINGO-IAGOWNOFSA-N delta1-THC Chemical compound C1=C(C)CC[C@H]2C(C)(C)OC3=CC(CCCCC)=CC(O)=C3[C@@H]21 CYQFCXCEBYINGO-IAGOWNOFSA-N 0.000 description 2
238000001514 detection method Methods 0.000 description 2
238000011161 development Methods 0.000 description 2
230000018109 developmental process Effects 0.000 description 2
229960004242 dronabinol Drugs 0.000 description 2
238000001647 drug administration Methods 0.000 description 2
201000008184 embryoma Diseases 0.000 description 2
230000003511 endothelial Effects 0.000 description 2
239000000328 estrogen antagonist Substances 0.000 description 2
108010038795 estrogen receptors Proteins 0.000 description 2
125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
125000001153 fluoro group Chemical group F* 0.000 description 2
125000000524 functional group Chemical group 0.000 description 2
108010062699 gamma-Glutamyl Hydrolase Proteins 0.000 description 2
UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
230000002209 hydrophobic Effects 0.000 description 2
229960002411 imatinib Drugs 0.000 description 2
230000002519 immonomodulatory Effects 0.000 description 2
230000001900 immune effect Effects 0.000 description 2
201000006334 interstitial nephritis Diseases 0.000 description 2
125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
229960004502 levodopa Drugs 0.000 description 2
101700053727 lipY Proteins 0.000 description 2
238000011068 load Methods 0.000 description 2
230000002934 lysing Effects 0.000 description 2
230000001868 lysosomic Effects 0.000 description 2
PEEHTFAAVSWFBL-UHFFFAOYSA-N maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 2
231100000682 maximum tolerated dose Toxicity 0.000 description 2
230000001404 mediated Effects 0.000 description 2
201000001441 melanoma Diseases 0.000 description 2
GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 2
229960001428 mercaptopurine Drugs 0.000 description 2
229920002106 messenger RNA Polymers 0.000 description 2
239000002207 metabolite Substances 0.000 description 2
108010090530 metallocarboxypeptidase Z Proteins 0.000 description 2
230000001394 metastastic Effects 0.000 description 2
229960000485 methotrexate Drugs 0.000 description 2
GIYXAJPCNFJEHY-UHFFFAOYSA-N methyl-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]azanium;chloride Chemical compound Cl.C=1C=CC=CC=1C(CCNC)OC1=CC=C(C(F)(F)F)C=C1 GIYXAJPCNFJEHY-UHFFFAOYSA-N 0.000 description 2
108010047660 mitochondrial intermediate peptidase Proteins 0.000 description 2
230000000051 modifying Effects 0.000 description 2
230000035772 mutation Effects 0.000 description 2
102000004990 neuroligin 1 Human genes 0.000 description 2
108090001100 neuroligin 1 Proteins 0.000 description 2
108090001075 neuroligin 2 Proteins 0.000 description 2
102000004872 neuroligin 2 Human genes 0.000 description 2
108090001073 neuroligin 3 Proteins 0.000 description 2
102000004871 neuroligin 3 Human genes 0.000 description 2
125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
239000002773 nucleotide Substances 0.000 description 2
229960001756 oxaliplatin Drugs 0.000 description 2
ZCQWOFVYLHDMMC-UHFFFAOYSA-N oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 2
125000000160 oxazolidinyl group Chemical group 0.000 description 2
LFGREXWGYUGZLY-UHFFFAOYSA-N oxophosphanyl Chemical group [P]=O LFGREXWGYUGZLY-UHFFFAOYSA-N 0.000 description 2
201000002528 pancreatic cancer Diseases 0.000 description 2
229940111202 pepsin Drugs 0.000 description 2
230000002093 peripheral Effects 0.000 description 2
230000000896 plasminic Effects 0.000 description 2
BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
108010059054 polycystic kidney disease 1 protein Proteins 0.000 description 2
230000000750 progressive Effects 0.000 description 2
125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
238000000746 purification Methods 0.000 description 2
KYQCOXFCLRTKLS-UHFFFAOYSA-N pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
WTKZEGDFNFYCGP-UHFFFAOYSA-N pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
KAESVJOAVNADME-UHFFFAOYSA-N pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
RWRDLPDLKQPQOW-UHFFFAOYSA-N pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 2
239000000333 selective estrogen receptor modulator Substances 0.000 description 2
238000000926 separation method Methods 0.000 description 2
FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
210000004872 soft tissue Anatomy 0.000 description 2
230000004936 stimulating Effects 0.000 description 2
229960001663 sulfanilamide Drugs 0.000 description 2
238000002560 therapeutic procedure Methods 0.000 description 2
102000005488 thioesterase family Human genes 0.000 description 2
108020002982 thioesterase family Proteins 0.000 description 2
YTPLMLYBLZKORZ-UHFFFAOYSA-N thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
WYWHKKSPHMUBEB-UHFFFAOYSA-N tioguanine Chemical compound N1C(N)=NC(=S)C2=C1N=CN2 WYWHKKSPHMUBEB-UHFFFAOYSA-N 0.000 description 2
229960000303 topotecan Drugs 0.000 description 2
230000001988 toxicity Effects 0.000 description 2
231100000419 toxicity Toxicity 0.000 description 2
238000000844 transformation Methods 0.000 description 2
230000001131 transforming Effects 0.000 description 2
108010039203 tripeptidyl-peptidase 1 Proteins 0.000 description 2
108010039189 tripeptidyl-peptidase 2 Proteins 0.000 description 2
201000005112 urinary bladder cancer Diseases 0.000 description 2
COFJBSXICYYSKG-FJFFLIEUSA-N vindesine sulfate Chemical compound OS(O)(=O)=O.C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(N)=O)N4C)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 COFJBSXICYYSKG-FJFFLIEUSA-N 0.000 description 2
238000011179 visual inspection Methods 0.000 description 2
SYOKIDBDQMKNDQ-HHUWHTLVSA-N (2S)-1-[2-[[(5S,7R)-3-hydroxy-1-adamantyl]amino]acetyl]pyrrolidine-2-carbonitrile Chemical compound C([C@@H]1C[C@H](C2)CC(C1)(C1)O)C21NCC(=O)N1CCC[C@H]1C#N SYOKIDBDQMKNDQ-HHUWHTLVSA-N 0.000 description 1
VGGGPCQERPFHOB-RDBSUJKOSA-N (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)[C@@H](O)[C@H](N)CC1=CC=CC=C1 VGGGPCQERPFHOB-RDBSUJKOSA-N 0.000 description 1
YXTKHLHCVFUPPT-YYFJYKOTSA-N (2S)-2-[[4-[(2-amino-5-formyl-4-oxo-1,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid;(1R,2R)-1,2-dimethanidylcyclohexane;5-fluoro-1H-pyrimidine-2,4-dione;oxalic acid;platinum(2+) Chemical compound [Pt+2].OC(=O)C(O)=O.[CH2-][C@@H]1CCCC[C@H]1[CH2-].FC1=CNC(=O)NC1=O.C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 YXTKHLHCVFUPPT-YYFJYKOTSA-N 0.000 description 1
FSIRXIHZBIXHKT-MHTVFEQDSA-N (2S)-2-[[4-[1-(2,4-diaminopteridin-6-yl)butan-2-yl]benzoyl]amino]pentanedioic acid Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CC(CC)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FSIRXIHZBIXHKT-MHTVFEQDSA-N 0.000 description 1
LDLGBNXSBZFATB-BYPYZUCNSA-N (2S)-5-amino-2-(difluoromethylamino)pentanoic acid Chemical compound NCCC[C@@H](C(O)=O)NC(F)F LDLGBNXSBZFATB-BYPYZUCNSA-N 0.000 description 1
NRUKOCRGYNPUPR-QBPJDGROSA-N (5S,5aR,8aR,9R)-5-[[(2R,4aR,6R,7R,8R,8aS)-7,8-dihydroxy-2-thiophen-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 description 1
CYQFCXCEBYINGO-ZYMOGRSISA-N (6aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol Chemical compound C1=C(C)CC[C@H]2C(C)(C)OC3=CC(CCCCC)=CC(O)=C3C21 CYQFCXCEBYINGO-ZYMOGRSISA-N 0.000 description 1
VWUXBMIQPBEWFH-WCCTWKNTSA-N (7R,8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3[C@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)CC2=C1 VWUXBMIQPBEWFH-WCCTWKNTSA-N 0.000 description 1
JXVAMODRWBNUSF-KZQKBALLSA-N (7S,9R,10R)-7-[(2R,4S,5S,6S)-5-[[(2S,4aS,5aS,7S,9S,9aR,10aR)-2,9-dimethyl-3-oxo-4,4a,5a,6,7,9,9a,10a-octahydrodipyrano[4,2-a:4',3'-e][1,4]dioxin-7-yl]oxy]-4-(dimethylamino)-6-methyloxan-2-yl]oxy-10-[(2S,4S,5S,6S)-4-(dimethylamino)-5-hydroxy-6-methyloxan-2 Chemical compound O([C@@H]1C2=C(O)C=3C(=O)C4=CC=CC(O)=C4C(=O)C=3C(O)=C2[C@@H](O[C@@H]2O[C@@H](C)[C@@H](O[C@@H]3O[C@@H](C)[C@H]4O[C@@H]5O[C@@H](C)C(=O)C[C@@H]5O[C@H]4C3)[C@H](C2)N(C)C)C[C@]1(O)CC)[C@H]1C[C@H](N(C)C)[C@H](O)[C@H](C)O1 JXVAMODRWBNUSF-KZQKBALLSA-N 0.000 description 1
MWWSFMDVAYGXBV-FGBJBKNOSA-N (7S,9S)-7-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride Chemical compound Cl.O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)C1CC(N)C(O)C(C)O1 MWWSFMDVAYGXBV-FGBJBKNOSA-N 0.000 description 1
NOPNWHSMQOXAEI-PUCKCBAPSA-N (7S,9S)-7-[(2R,4S,5S,6S)-4-(2,3-dihydropyrrol-1-yl)-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione Chemical compound N1([C@H]2C[C@@H](O[C@@H](C)[C@H]2O)O[C@H]2C[C@@](O)(CC=3C(O)=C4C(=O)C=5C=CC=C(C=5C(=O)C4=C(O)C=32)OC)C(=O)CO)CCC=C1 NOPNWHSMQOXAEI-PUCKCBAPSA-N 0.000 description 1
KMSKQZKKOZQFFG-YXRRJAAWSA-N (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-6-methyl-5-[(2R)-oxan-2-yl]oxyoxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione Chemical compound O([C@H]1[C@@H](N)C[C@@H](O[C@H]1C)O[C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@@H]1CCCCO1 KMSKQZKKOZQFFG-YXRRJAAWSA-N 0.000 description 1
IEXUMDBQLIVNHZ-YOUGDJEHSA-N (8S,11R,13R,14S,17S)-11-[4-(dimethylamino)phenyl]-17-hydroxy-17-(3-hydroxypropyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one Chemical compound C1=CC(N(C)C)=CC=C1[C@@H]1C2=C3CCC(=O)C=C3CC[C@H]2[C@H](CC[C@]2(O)CCCO)[C@@]2(C)C1 IEXUMDBQLIVNHZ-YOUGDJEHSA-N 0.000 description 1
125000006584 (C3-C10) heterocycloalkyl group Chemical group 0.000 description 1
AGNGYMCLFWQVGX-AGFFZDDWSA-N (E)-1-[(2S)-2-amino-2-carboxyethoxy]-2-diazonioethenolate Chemical compound OC(=O)[C@@H](N)CO\C([O-])=C\[N+]#N AGNGYMCLFWQVGX-AGFFZDDWSA-N 0.000 description 1
FONKWHRXTPJODV-DNQXCXABSA-N 1,3-bis[2-[(8S)-8-(chloromethyl)-4-hydroxy-1-methyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-6-carbonyl]-1H-indol-5-yl]urea Chemical compound C1([C@H](CCl)CN2C(=O)C=3NC4=CC=C(C=C4C=3)NC(=O)NC=3C=C4C=C(NC4=CC=3)C(=O)N3C4=CC(O)=C5NC=C(C5=C4[C@H](CCl)C3)C)=C2C=C(O)C2=C1C(C)=CN2 FONKWHRXTPJODV-DNQXCXABSA-N 0.000 description 1
COVZYZSDYWQREU-UHFFFAOYSA-N 1,4-Butanediol, dimethanesulfonate Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
BTOTXLJHDSNXMW-POYBYMJQSA-N 1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound O1[C@H](CO)CC[C@@H]1N1C(=O)NC(=O)C=C1 BTOTXLJHDSNXMW-POYBYMJQSA-N 0.000 description 1
FHJATBIERQTCTN-UHFFFAOYSA-N 1-[4-amino-2-(ethylaminomethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-ol Chemical compound C1=CC=CC2=C(N(C(CNCC)=N3)CC(C)(C)O)C3=C(N)N=C21 FHJATBIERQTCTN-UHFFFAOYSA-N 0.000 description 1
HNJBEVLQSNELDL-UHFFFAOYSA-N 2-Pyrrolidone Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
QCXJFISCRQIYID-IAEPZHFASA-N 2-amino-1-N-[(3S,6S,7R,10S,16S)-3-[(2S)-butan-2-yl]-7,11,14-trimethyl-2,5,9,12,15-pentaoxo-10-propan-2-yl-8-oxa-1,4,11,14-tetrazabicyclo[14.3.0]nonadecan-6-yl]-4,6-dimethyl-3-oxo-9-N-[(3S,6S,7R,10S,16S)-7,11,14-trimethyl-2,5,9,12,15-pentaoxo-3,10-di(propa Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N=C2C(C(=O)N[C@@H]3C(=O)N[C@H](C(N4CCC[C@H]4C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]3C)=O)[C@@H](C)CC)=C(N)C(=O)C(C)=C2O2)C2=C(C)C=C1 QCXJFISCRQIYID-IAEPZHFASA-N 0.000 description 1
DBIGHPPNXATHOF-UHFFFAOYSA-N 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate Chemical compound CS(=O)(=O)OCCCNCCCOS(C)(=O)=O DBIGHPPNXATHOF-UHFFFAOYSA-N 0.000 description 1
PWMYMKOUNYTVQN-UHFFFAOYSA-N 3-(8,8-diethyl-2-aza-8-germaspiro[4.5]decan-2-yl)-N,N-dimethylpropan-1-amine Chemical compound C1C[Ge](CC)(CC)CCC11CN(CCCN(C)C)CC1 PWMYMKOUNYTVQN-UHFFFAOYSA-N 0.000 description 1
101710027271 3b Proteins 0.000 description 1
YIMDLWDNDGKDTJ-ABYLTEMBSA-N 4-[(2S,3S,4S)-3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-4-yl]morpholine-3-carbonitrile Chemical compound N1([C@H]2CC(O[C@@H](C)[C@H]2O)O[C@H]2C[C@@](O)(CC=3C(O)=C4C(=O)C=5C=CC=C(C=5C(=O)C4=C(O)C=32)OC)C(=O)CO)CCOCC1C#N YIMDLWDNDGKDTJ-ABYLTEMBSA-N 0.000 description 1
TVZGACDUOSZQKY-LBPRGKRZSA-N 4-aminofolic acid Chemical compound C1=NC2=NC(N)=NC(N)=C2N=C1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 TVZGACDUOSZQKY-LBPRGKRZSA-N 0.000 description 1
DHMYGZIEILLVNR-UHFFFAOYSA-N 5-fluoro-1-(oxolan-2-yl)pyrimidine-2,4-dione;1H-pyrimidine-2,4-dione Chemical compound O=C1C=CNC(=O)N1.O=C1NC(=O)C(F)=CN1C1OCCC1 DHMYGZIEILLVNR-UHFFFAOYSA-N 0.000 description 1
WYXSYVWAUAUWLD-SHUUEZRQSA-N 6-azauridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=N1 WYXSYVWAUAUWLD-SHUUEZRQSA-N 0.000 description 1
FUXVKZWTXQUGMW-FQEVSTJZSA-N 9-Aminocamptothecin Chemical compound C1=CC(N)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 FUXVKZWTXQUGMW-FQEVSTJZSA-N 0.000 description 1
102100017803 ABHD16B Human genes 0.000 description 1
101710011450 ABHD16B Proteins 0.000 description 1
102100011385 ABHD4 Human genes 0.000 description 1
101700010684 ABHD4 Proteins 0.000 description 1
108060006693 ABL Proteins 0.000 description 1
102100017866 ACE2 Human genes 0.000 description 1
101710014780 ADAM1 Proteins 0.000 description 1
102100010291 ADAM11 Human genes 0.000 description 1
101710043079 ADAM11 Proteins 0.000 description 1
102100010287 ADAM15 Human genes 0.000 description 1
101710043073 ADAM18 Proteins 0.000 description 1
102100010283 ADAM18 Human genes 0.000 description 1
101710043083 ADAM19 Proteins 0.000 description 1
101700072668 ADAM2 Proteins 0.000 description 1
102100017435 ADAM2 Human genes 0.000 description 1
102100001915 ADAM22 Human genes 0.000 description 1
101710043117 ADAM22 Proteins 0.000 description 1
102100002254 ADAM32 Human genes 0.000 description 1
101710042946 ADAM32 Proteins 0.000 description 1
101700064649 ADAM7 Proteins 0.000 description 1
102100012525 ADAM7 Human genes 0.000 description 1
102100012519 ADAM8 Human genes 0.000 description 1
101710026630 ADAM8 Proteins 0.000 description 1
102100012515 ADAM9 Human genes 0.000 description 1
101700048048 ADAM9 Proteins 0.000 description 1
102100003881 ADAMDEC1 Human genes 0.000 description 1
101710045132 ADAMDEC1 Proteins 0.000 description 1
108091005652 ADAMTS1 Proteins 0.000 description 1
108091005660 ADAMTS10 Proteins 0.000 description 1
108091005663 ADAMTS12 Proteins 0.000 description 1
108091005662 ADAMTS13 Proteins 0.000 description 1
108091005665 ADAMTS14 Proteins 0.000 description 1
108091005664 ADAMTS15 Proteins 0.000 description 1
108091005667 ADAMTS16 Proteins 0.000 description 1
108091005666 ADAMTS17 Proteins 0.000 description 1
108091005655 ADAMTS5 Proteins 0.000 description 1
108091005657 ADAMTS6 Proteins 0.000 description 1
108091005661 ADAMTS9 Proteins 0.000 description 1
102100010892 ADGRG4 Human genes 0.000 description 1
101710005053 ADGRG4 Proteins 0.000 description 1
101710038364 AFG3L2 Proteins 0.000 description 1
102100017291 AFG3L2 Human genes 0.000 description 1
102100020405 AGA Human genes 0.000 description 1
102100001661 ALG13 Human genes 0.000 description 1
101700070408 ALG13 Proteins 0.000 description 1
229940100198 ALKYLATING AGENTS Drugs 0.000 description 1
102100018031 AMZ1 Human genes 0.000 description 1
101700008389 AMZ1 Proteins 0.000 description 1
102100018030 AMZ2 Human genes 0.000 description 1
101700012726 AMZ2 Proteins 0.000 description 1
102100004845 ARHGEF5 Human genes 0.000 description 1
101700076374 ASNS Proteins 0.000 description 1
229960003272 ASPARAGINASE Drugs 0.000 description 1
102100017828 ASPRV1 Human genes 0.000 description 1
101710024273 ASPRV1 Proteins 0.000 description 1
101710039338 ATP2A2 Proteins 0.000 description 1
102100005631 ATP2A2 Human genes 0.000 description 1
102100017901 ATXN3 Human genes 0.000 description 1
102200043458 ATXN3 C14A Human genes 0.000 description 1
102100009681 ATXN3L Human genes 0.000 description 1
101710005313 ATXN3L Proteins 0.000 description 1
229940028652 Abraxane Drugs 0.000 description 1
102000006772 Acid Ceramidase Human genes 0.000 description 1
108020005296 Acid Ceramidase Proteins 0.000 description 1
208000004064 Acoustic Neuroma Diseases 0.000 description 1
229940037127 Actonel Drugs 0.000 description 1
210000004100 Adrenal Glands Anatomy 0.000 description 1
229940009456 Adriamycin Drugs 0.000 description 1
TXUZVZSFRXZGTL-QPLCGJKRSA-N Afimoxifene Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=C(O)C=C1 TXUZVZSFRXZGTL-QPLCGJKRSA-N 0.000 description 1
229940062527 Alendronate Drugs 0.000 description 1
229940045714 Alkyl sulfonate alkylating agents Drugs 0.000 description 1
ZSBOMTDTBDDKMP-OAHLLOKOSA-N Alogliptin Chemical compound C=1C=CC=C(C#N)C=1CN1C(=O)N(C)C(=O)C=C1N1CCC[C@@H](N)C1 ZSBOMTDTBDDKMP-OAHLLOKOSA-N 0.000 description 1
UUVWYPNAQBNQJQ-UHFFFAOYSA-N Altretamine Chemical compound CN(C)C1=NC(N(C)C)=NC(N(C)C)=N1 UUVWYPNAQBNQJQ-UHFFFAOYSA-N 0.000 description 1
229960003896 Aminopterin Drugs 0.000 description 1
229960001220 Amsacrine Drugs 0.000 description 1
XCPGHVQEEXUHNC-UHFFFAOYSA-N Amsacrine Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1NC1=C(C=CC=C2)C2=NC2=CC=CC=C12 XCPGHVQEEXUHNC-UHFFFAOYSA-N 0.000 description 1
240000002254 Ananas comosus Species 0.000 description 1
235000007119 Ananas comosus Nutrition 0.000 description 1
YBBLVLTVTVSKRW-UHFFFAOYSA-N Anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 description 1
108090000975 Angiotensin-converting enzyme 2 Proteins 0.000 description 1
108010083359 Antigen Receptors Proteins 0.000 description 1
102000006306 Antigen Receptors Human genes 0.000 description 1
108010047814 Antigen-Antibody Complex Proteins 0.000 description 1
108020000948 Antisense Oligonucleotides Proteins 0.000 description 1
241000256844 Apis mellifera Species 0.000 description 1
OMLWNBVRVJYMBQ-YUMQZZPRSA-N Arg-Arg Chemical compound NC(N)=NCCC[C@H](N)C(=O)N[C@@H](CCCN=C(N)N)C(O)=O OMLWNBVRVJYMBQ-YUMQZZPRSA-N 0.000 description 1
229940087620 Aromasin Drugs 0.000 description 1
BFYIZQONLCFLEV-DAELLWKTSA-N Aromasine Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(=C)C2=C1 BFYIZQONLCFLEV-DAELLWKTSA-N 0.000 description 1
108010078554 Aromatase Proteins 0.000 description 1
229940046844 Aromatase inhibitors Drugs 0.000 description 1
108010024976 Asparaginase Proteins 0.000 description 1
102000015790 Asparaginase Human genes 0.000 description 1
229940009098 Aspartate Drugs 0.000 description 1
108010023546 Aspartylglucosylaminase Proteins 0.000 description 1
108010032947 Ataxin-3 Proteins 0.000 description 1
229950002916 Avelumab Drugs 0.000 description 1
229960002756 Azacitidine Drugs 0.000 description 1
108091008154 B cell receptors Proteins 0.000 description 1
101700044176 BACE Proteins 0.000 description 1
101700051112 BACE1 Proteins 0.000 description 1
102100015648 BACE2 Human genes 0.000 description 1
229950006844 BIZELESIN Drugs 0.000 description 1
102100007313 BMP1 Human genes 0.000 description 1
101700046223 BMP1 Proteins 0.000 description 1
101700031214 BRCC3 Proteins 0.000 description 1
206010004146 Basal cell carcinoma Diseases 0.000 description 1
230000037177 Biodistribution Effects 0.000 description 1
229940112871 Bisphosphonate drugs affecting bone structure and mineralization Drugs 0.000 description 1
229960001561 Bleomycin Drugs 0.000 description 1
108010006654 Bleomycin Proteins 0.000 description 1
210000001124 Body Fluids Anatomy 0.000 description 1
210000000481 Breast Anatomy 0.000 description 1
206010006417 Bronchial carcinoma Diseases 0.000 description 1
208000003362 Bronchogenic Carcinoma Diseases 0.000 description 1
229960005064 Buserelin Acetate Drugs 0.000 description 1
PYMDEDHDQYLBRT-DRIHCAFSSA-N Buserelin acetate Chemical compound CC(O)=O.CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](COC(C)(C)C)NC(=O)[C@@H](NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H]1NC(=O)CC1)CC1=CC=C(O)C=C1 PYMDEDHDQYLBRT-DRIHCAFSSA-N 0.000 description 1
XREUEWVEMYWFFA-CSKJXFQVSA-N CARUBICIN Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=C(O)C=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XREUEWVEMYWFFA-CSKJXFQVSA-N 0.000 description 1
229950001725 CARUBICIN Drugs 0.000 description 1
102100006374 CASP1 Human genes 0.000 description 1
108010017009 CD11b Antigen Proteins 0.000 description 1
102100005826 CD19 Human genes 0.000 description 1
101700087100 CD19 Proteins 0.000 description 1
102100000188 CD244 Human genes 0.000 description 1
101700000388 CD244 Proteins 0.000 description 1
102100013077 CD4 Human genes 0.000 description 1
101700022938 CD4 Proteins 0.000 description 1
101700080416 CD69 Proteins 0.000 description 1
102100005832 CD69 Human genes 0.000 description 1
102100008204 CD82 Human genes 0.000 description 1
101700087069 CD82 Proteins 0.000 description 1
102100008186 CD83 Human genes 0.000 description 1
101700013105 CD83 Proteins 0.000 description 1
102100017642 CD84 Human genes 0.000 description 1
101710028436 CD84 Proteins 0.000 description 1
102100011828 CEACAM1 Human genes 0.000 description 1
101710043957 CEACAM1 Proteins 0.000 description 1
102100006088 CELA2B Human genes 0.000 description 1
101710017129 CELA2B Proteins 0.000 description 1
101710034295 CES1P1 Proteins 0.000 description 1
102100019338 CES1P1 Human genes 0.000 description 1
102100001457 CES2 Human genes 0.000 description 1
101700045507 CES2 Proteins 0.000 description 1
102100016295 CFI Human genes 0.000 description 1
102100013000 CFLAR Human genes 0.000 description 1
101700079603 CFLAR Proteins 0.000 description 1
ABLZXFCXXLZCGV-UHFFFAOYSA-L CHEBI:8154 Chemical class [O-]P([O-])=O ABLZXFCXXLZCGV-UHFFFAOYSA-L 0.000 description 1
FDKXTQMXEQVLRF-ZHACJKMWSA-N CN(C)\N=N\c1[nH]cnc1C(N)=O Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 1
102100007493 CNTF Human genes 0.000 description 1
101710035136 COPS5 Proteins 0.000 description 1
102100001962 COPS8 Human genes 0.000 description 1
101710035133 COPS8 Proteins 0.000 description 1
102100003769 CPA1 Human genes 0.000 description 1
101710003550 CPA1 Proteins 0.000 description 1
102100003771 CPA2 Human genes 0.000 description 1
101710003552 CPA3 Proteins 0.000 description 1
102100003121 CPA5 Human genes 0.000 description 1
101710003555 CPA5 Proteins 0.000 description 1
102100003122 CPA6 Human genes 0.000 description 1
101710003559 CPA6 Proteins 0.000 description 1
102100006002 CPB1 Human genes 0.000 description 1
102100005992 CPB2 Human genes 0.000 description 1
101710023621 CPC735_009100 Proteins 0.000 description 1
102100019263 CPD Human genes 0.000 description 1
102100019264 CPE Human genes 0.000 description 1
102100019426 CPM Human genes 0.000 description 1
102100015814 CPXM1 Human genes 0.000 description 1
101700020394 CPXM1 Proteins 0.000 description 1
102100011418 CRTAM Human genes 0.000 description 1
102100006435 CSF3 Human genes 0.000 description 1
102100015378 CTSL Human genes 0.000 description 1
102100015379 CTSS Human genes 0.000 description 1
101710010384 CTSV Proteins 0.000 description 1
101700069118 CXE2 Proteins 0.000 description 1
101710005746 CYS-PIN Proteins 0.000 description 1
101700008313 CYTI Proteins 0.000 description 1
229950009908 Cactinomycin Drugs 0.000 description 1
102000000905 Cadherins Human genes 0.000 description 1
108050007957 Cadherins Proteins 0.000 description 1
229940088954 Camptosar Drugs 0.000 description 1
FSBIGDSBMBYOPN-VKHMYHEASA-N Canavanine Chemical compound OC(=O)[C@@H](N)CCONC(N)=N FSBIGDSBMBYOPN-VKHMYHEASA-N 0.000 description 1
241000282472 Canis lupus familiaris Species 0.000 description 1
229960004117 Capecitabine Drugs 0.000 description 1
OLESAACUTLOWQZ-UHFFFAOYSA-L Carboplatin Chemical compound O=C1O[Pt]([N]([H])([H])[H])([N]([H])([H])[H])OC(=O)C11CCC1 OLESAACUTLOWQZ-UHFFFAOYSA-L 0.000 description 1
229960004562 Carboplatin Drugs 0.000 description 1
108090000087 Carboxypeptidase B Proteins 0.000 description 1
108090000201 Carboxypeptidase B2 Proteins 0.000 description 1
108010058255 Carboxypeptidase H Proteins 0.000 description 1
102000005367 Carboxypeptidases Human genes 0.000 description 1
108010006303 Carboxypeptidases Proteins 0.000 description 1
210000000845 Cartilage Anatomy 0.000 description 1
108090000426 Caspase 1 Proteins 0.000 description 1
102000004066 Caspase-12 Human genes 0.000 description 1
108090000570 Caspase-12 Proteins 0.000 description 1
108090000712 Cathepsin B Proteins 0.000 description 1
102000004225 Cathepsin B Human genes 0.000 description 1
108090000258 Cathepsin D Proteins 0.000 description 1
102000003908 Cathepsin D Human genes 0.000 description 1
108090000611 Cathepsin E Proteins 0.000 description 1
102000004178 Cathepsin E Human genes 0.000 description 1
102000004173 Cathepsin G Human genes 0.000 description 1
108090000617 Cathepsin G Proteins 0.000 description 1
108090000625 Cathepsin K Proteins 0.000 description 1
108090000624 Cathepsin L Proteins 0.000 description 1
108090000613 Cathepsin S Proteins 0.000 description 1
102000011937 Cathepsin Z Human genes 0.000 description 1
108010061117 Cathepsin Z Proteins 0.000 description 1
206010057248 Cell death Diseases 0.000 description 1
CZTQZXZIADLWOZ-CRAIPNDOSA-N Cephaloridine Chemical compound O=C([C@@H](NC(=O)CC=1SC=CC=1)[C@H]1SC2)N1C(C(=O)[O-])=C2C[N+]1=CC=CC=C1 CZTQZXZIADLWOZ-CRAIPNDOSA-N 0.000 description 1
206010008342 Cervix carcinoma Diseases 0.000 description 1
101710032139 Ces2c Proteins 0.000 description 1
108010012236 Chemokines Proteins 0.000 description 1
102000019034 Chemokines Human genes 0.000 description 1
229960004630 Chlorambucil Drugs 0.000 description 1
JCKYGMPEJWAADB-UHFFFAOYSA-N Chlorambucil Chemical compound OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 JCKYGMPEJWAADB-UHFFFAOYSA-N 0.000 description 1
BFPSDSIWYFKGBC-UHFFFAOYSA-N Chlorotrianisene Chemical compound C1=CC(OC)=CC=C1C(Cl)=C(C=1C=CC(OC)=CC=1)C1=CC=C(OC)C=C1 BFPSDSIWYFKGBC-UHFFFAOYSA-N 0.000 description 1
102000003914 Cholinesterases Human genes 0.000 description 1
108090000322 Cholinesterases Proteins 0.000 description 1
208000005243 Chondrosarcoma Diseases 0.000 description 1
206010008943 Chronic leukaemia Diseases 0.000 description 1
206010008958 Chronic lymphocytic leukaemia Diseases 0.000 description 1
108010005939 Ciliary Neurotrophic Factor Proteins 0.000 description 1
WCZVZNOTHYJIEI-UHFFFAOYSA-N Cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 1
230000036849 Clc Effects 0.000 description 1
229960002286 Clodronic Acid Drugs 0.000 description 1
108090000056 Complement Factor B Proteins 0.000 description 1
102000003712 Complement Factor B Human genes 0.000 description 1
102000003706 Complement Factor D Human genes 0.000 description 1
108090000059 Complement Factor D Proteins 0.000 description 1
108090000044 Complement Factor I Proteins 0.000 description 1
229920000453 Consensus sequence Polymers 0.000 description 1
241000699800 Cricetinae Species 0.000 description 1
229960004397 Cyclophosphamide Drugs 0.000 description 1
210000000805 Cytoplasm Anatomy 0.000 description 1
229940104302 Cytosine Drugs 0.000 description 1
OPTASPLRGRRNAP-UHFFFAOYSA-N Cytosine Chemical class NC=1C=CNC(=O)N=1 OPTASPLRGRRNAP-UHFFFAOYSA-N 0.000 description 1
102100013390 DAG1 Human genes 0.000 description 1
STQGQHZAVUOBTE-VGBVRHCVSA-N DAUNOMYCIN Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 1
QGJUIPDUBHWZPV-YQBUGCKMSA-N DB07465 Chemical compound C([C@@H](C1)C2)[C@@H](C3)C[C@@]1(O)C[C@]23[C@H](N)C(=O)N1[C@H](C#N)C[C@@H]2C[C@@H]21 QGJUIPDUBHWZPV-YQBUGCKMSA-N 0.000 description 1
102100019946 DHH Human genes 0.000 description 1
101700012961 DHH Proteins 0.000 description 1
CKLJMWTZIZZHCS-UHFFFAOYSA-N DL-aspartic acid Chemical compound OC(=O)C(N)CC(O)=O CKLJMWTZIZZHCS-UHFFFAOYSA-N 0.000 description 1
102100014977 DPP7 Human genes 0.000 description 1
102100005620 DPYS Human genes 0.000 description 1
206010011953 Decreased activity Diseases 0.000 description 1
BMKDZUISNHGIBY-ZETCQYMHSA-N Dexrazoxane Chemical compound C([C@H](C)N1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1 BMKDZUISNHGIBY-ZETCQYMHSA-N 0.000 description 1
AUGQEEXBDZWUJY-NMAPUUFXSA-N Diacetoxyscirpenol Chemical compound C([C@@]12[C@]3(C)[C@H](OC(C)=O)[C@@H](O)[C@H]1O[C@@H]1C=C(C)CC[C@@]13COC(=O)C)O2 AUGQEEXBDZWUJY-NMAPUUFXSA-N 0.000 description 1
102000012122 Dihydropyrimidinase-related protein 1 Human genes 0.000 description 1
108050002656 Dihydropyrimidinase-related protein 1 Proteins 0.000 description 1
102000011972 Dihydropyrimidinase-related protein 2 Human genes 0.000 description 1
102000012123 Dihydropyrimidinase-related protein 3 Human genes 0.000 description 1
108050002650 Dihydropyrimidinase-related protein 3 Proteins 0.000 description 1
102000011993 Dihydropyrimidinase-related protein 4 Human genes 0.000 description 1
108050002475 Dihydropyrimidinase-related protein 4 Proteins 0.000 description 1
102000012120 Dihydropyrimidinase-related protein 5 Human genes 0.000 description 1
108050002654 Dihydropyrimidinase-related protein 5 Proteins 0.000 description 1
108090000212 Dipeptidyl-peptidase II Proteins 0.000 description 1
206010061818 Disease progression Diseases 0.000 description 1
230000036947 Dissociation constant Effects 0.000 description 1
CYQFCXCEBYINGO-DLBZAZTESA-N Dronabinol Natural products C1=C(C)CC[C@H]2C(C)(C)OC3=CC(CCCCC)=CC(O)=C3[C@H]21 CYQFCXCEBYINGO-DLBZAZTESA-N 0.000 description 1
VQNATVDKACXKTF-XELLLNAOSA-N Duocarmycin Chemical compound COC1=C(OC)C(OC)=C2NC(C(=O)N3C4=CC(=O)C5=C([C@@]64C[C@@H]6C3)C=C(N5)C(=O)OC)=CC2=C1 VQNATVDKACXKTF-XELLLNAOSA-N 0.000 description 1
229950009791 Durvalumab Drugs 0.000 description 1
108010071885 Dystroglycans Proteins 0.000 description 1
102000003642 EC 2.3.2.5 Human genes 0.000 description 1
108010081484 EC 2.3.2.5 Proteins 0.000 description 1
108010039224 EC 2.4.2.14 Proteins 0.000 description 1
108010004098 EC 3.4.11.1 Proteins 0.000 description 1
102000002704 EC 3.4.11.1 Human genes 0.000 description 1
108030003253 EC 3.4.17.15 Proteins 0.000 description 1
108030000059 EC 3.4.17.4 Proteins 0.000 description 1
108030001421 EC 3.4.18.1 Proteins 0.000 description 1
108030007132 EC 3.4.21.64 Proteins 0.000 description 1
108030007211 EC 3.4.21.78 Proteins 0.000 description 1
108010013369 EC 3.4.21.9 Proteins 0.000 description 1
108030001384 EC 3.4.22.43 Proteins 0.000 description 1
108030001044 EC 3.4.23.45 Proteins 0.000 description 1
108030001047 EC 3.4.23.46 Proteins 0.000 description 1
108010070255 EC 6.3.1.1 Proteins 0.000 description 1
101700033006 EGF Proteins 0.000 description 1
102100010813 EGF Human genes 0.000 description 1
229940121647 EGFR inhibitors Drugs 0.000 description 1
108060002510 ELA1 Proteins 0.000 description 1
101700030458 ERAP1 Proteins 0.000 description 1
102100016201 ERAP1 Human genes 0.000 description 1
101700029185 ERAP2 Proteins 0.000 description 1
102100016202 ERAP2 Human genes 0.000 description 1
101700025368 ERBB2 Proteins 0.000 description 1
102000027760 ERBB2 Human genes 0.000 description 1
101700068868 ERMP1 Proteins 0.000 description 1
ITSGNOIFAJAQHJ-BMFNZSJVSA-N ESORUBICIN Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)C[C@H](C)O1 ITSGNOIFAJAQHJ-BMFNZSJVSA-N 0.000 description 1
102000015782 Electron Transport Complex III Human genes 0.000 description 1
108010024882 Electron Transport Complex III Proteins 0.000 description 1
229940053594 Eligard Drugs 0.000 description 1
229940120655 Eloxatin Drugs 0.000 description 1
241000196324 Embryophyta Species 0.000 description 1
210000002615 Epidermis Anatomy 0.000 description 1
108050002910 Epoxide hydrolase-like Proteins 0.000 description 1
102000012377 Epoxide hydrolase-like Human genes 0.000 description 1
210000003238 Esophagus Anatomy 0.000 description 1
229950002017 Esorubicin Drugs 0.000 description 1
UMILHIMHKXVDGH-UHFFFAOYSA-N Etoglucid Chemical compound C1OC1COCCOCCOCCOCC1CO1 UMILHIMHKXVDGH-UHFFFAOYSA-N 0.000 description 1
229960005237 Etoglucid Drugs 0.000 description 1
229940085363 Evista Drugs 0.000 description 1
208000006168 Ewing Sarcoma Diseases 0.000 description 1
108090001126 FURIN Proteins 0.000 description 1
108010048049 Factor IXa Proteins 0.000 description 1
108010071241 Factor XIIa Proteins 0.000 description 1
108010080805 Factor XIa Proteins 0.000 description 1
108010074860 Factor Xa Proteins 0.000 description 1
229940087861 Faslodex Drugs 0.000 description 1
241000282326 Felis catus Species 0.000 description 1
229940087476 Femara Drugs 0.000 description 1
229960000304 Folic Acid Drugs 0.000 description 1
229940001490 Fosamax Drugs 0.000 description 1
229960002258 Fulvestrant Drugs 0.000 description 1
102000004961 Furin Human genes 0.000 description 1
102100017670 GATD1 Human genes 0.000 description 1
101700054748 GATD1 Proteins 0.000 description 1
102100018777 GATD3A Human genes 0.000 description 1
101710031273 GATD3A Proteins 0.000 description 1
102100018345 GFPT1 Human genes 0.000 description 1
101700069341 GFPT1 Proteins 0.000 description 1
101710016577 GGTLC2 Proteins 0.000 description 1
102100018371 GGTLC2 Human genes 0.000 description 1
102100004383 GZMA Human genes 0.000 description 1
102100004385 GZMH Human genes 0.000 description 1
101710014271 GZMH Proteins 0.000 description 1
102100004389 GZMK Human genes 0.000 description 1
101710014269 GZMK Proteins 0.000 description 1
206010017758 Gastric cancer Diseases 0.000 description 1
229940020967 Gemzar Drugs 0.000 description 1
206010064571 Gene mutation Diseases 0.000 description 1
229940049906 Glutamate Drugs 0.000 description 1
108090000369 Glutamate Carboxypeptidase II Proteins 0.000 description 1
BLCLNMBMMGCOAS-URPVMXJPSA-N Goserelin Chemical compound C([C@@H](C(=O)N[C@H](COC(C)(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1[C@@H](CCC1)C(=O)NNC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 BLCLNMBMMGCOAS-URPVMXJPSA-N 0.000 description 1
108010017080 Granulocyte Colony-Stimulating Factor Proteins 0.000 description 1
102000013811 Granzyme M Human genes 0.000 description 1
108050003624 Granzyme M Proteins 0.000 description 1
206010053759 Growth retardation Diseases 0.000 description 1
102000013587 Guanine Deaminase Human genes 0.000 description 1
108010012029 Guanine Deaminase Proteins 0.000 description 1
229940093912 Gynecological Sulfonamides Drugs 0.000 description 1
VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
210000002216 Heart Anatomy 0.000 description 1
102000002812 Heat-Shock Proteins Human genes 0.000 description 1
108010004889 Heat-Shock Proteins Proteins 0.000 description 1
208000001258 Hemangiosarcoma Diseases 0.000 description 1
208000002250 Hematologic Neoplasms Diseases 0.000 description 1
206010019695 Hepatic neoplasm Diseases 0.000 description 1
210000003494 Hepatocytes Anatomy 0.000 description 1
201000006743 Hodgkin's lymphoma Diseases 0.000 description 1
229940099552 Hyaluronan Drugs 0.000 description 1
KIUKXJAPPMFGSW-MNSSHETKSA-N Hyaluronan Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)C1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H](C(O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 KIUKXJAPPMFGSW-MNSSHETKSA-N 0.000 description 1
229940088013 Hycamtin Drugs 0.000 description 1
101700056821 ICIC Proteins 0.000 description 1
101710006761 ICY Proteins 0.000 description 1
101700046422 IFNA Proteins 0.000 description 1
101700077226 IGBP1 Proteins 0.000 description 1
102100008764 IGBP1 Human genes 0.000 description 1
101710003110 IL17A Proteins 0.000 description 1
102100008982 IL17A Human genes 0.000 description 1
102100018758 IL3 Human genes 0.000 description 1
101710006572 ITGAM Proteins 0.000 description 1
102100012517 ITGB7 Human genes 0.000 description 1
101710006575 ITGB7 Proteins 0.000 description 1
229940015872 Ibandronate Drugs 0.000 description 1
229960000908 Idarubicin Drugs 0.000 description 1
XDXDZDZNSLXDNA-TZNDIEGXSA-N Idarubicin hydrochloride Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XDXDZDZNSLXDNA-TZNDIEGXSA-N 0.000 description 1
108010009817 Immunoglobulin Constant Regions Proteins 0.000 description 1
102000009786 Immunoglobulin Constant Regions Human genes 0.000 description 1
206010062016 Immunosuppression Diseases 0.000 description 1
206010061218 Inflammation Diseases 0.000 description 1
206010022114 Injury Diseases 0.000 description 1
108010030465 Integrin alpha6beta1 Proteins 0.000 description 1
102000000589 Interleukin-1 Human genes 0.000 description 1
108010002352 Interleukin-1 Proteins 0.000 description 1
102000003777 Interleukin-1 beta Human genes 0.000 description 1
108090000193 Interleukin-1 beta Proteins 0.000 description 1
108090000174 Interleukin-10 Proteins 0.000 description 1
102000003814 Interleukin-10 Human genes 0.000 description 1
108090000177 Interleukin-11 Proteins 0.000 description 1
102000003815 Interleukin-11 Human genes 0.000 description 1
108010065805 Interleukin-12 Proteins 0.000 description 1
229940117681 Interleukin-12 Drugs 0.000 description 1
102000013462 Interleukin-12 Human genes 0.000 description 1
108090000176 Interleukin-13 Proteins 0.000 description 1
108090000172 Interleukin-15 Proteins 0.000 description 1
102000004125 Interleukin-1alpha Human genes 0.000 description 1
108010082786 Interleukin-1alpha Proteins 0.000 description 1
108010002386 Interleukin-3 Proteins 0.000 description 1
108090000978 Interleukin-4 Proteins 0.000 description 1
102000004388 Interleukin-4 Human genes 0.000 description 1
108090001005 Interleukin-6 Proteins 0.000 description 1
108010002586 Interleukin-7 Proteins 0.000 description 1
108010002335 Interleukin-9 Proteins 0.000 description 1
102000015696 Interleukins Human genes 0.000 description 1
108010063738 Interleukins Proteins 0.000 description 1
210000000936 Intestines Anatomy 0.000 description 1
108010089187 Ipilimumab Proteins 0.000 description 1
GURKHSYORGJETM-WAQYZQTGSA-N Irinotecan hydrochloride Chemical compound Cl.C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 GURKHSYORGJETM-WAQYZQTGSA-N 0.000 description 1
UXGVMFHEKMGWMA-UHFFFAOYSA-N Isobenzofuran Chemical compound C1=CC=CC2=COC=C21 UXGVMFHEKMGWMA-UHFFFAOYSA-N 0.000 description 1
AWJUIBRHMBBTKR-UHFFFAOYSA-N Isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 1
ZLTPDFXIESTBQG-UHFFFAOYSA-N Isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
CTAPFRYPJLPFDF-UHFFFAOYSA-N Isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
102100004464 KLK10 Human genes 0.000 description 1
101700050384 KLK10 Proteins 0.000 description 1
102100004459 KLK11 Human genes 0.000 description 1
101700039247 KLK11 Proteins 0.000 description 1
102100004461 KLK13 Human genes 0.000 description 1
101700042153 KLK13 Proteins 0.000 description 1
102100004462 KLK14 Human genes 0.000 description 1
101700012318 KLK14 Proteins 0.000 description 1
102100011337 KLK4 Human genes 0.000 description 1
102100011309 KLK5 Human genes 0.000 description 1
101700077195 KLK5 Proteins 0.000 description 1
102100011310 KLK6 Human genes 0.000 description 1
101700058468 KLK6 Proteins 0.000 description 1
102100011312 KLK7 Human genes 0.000 description 1
101700079133 KLK7 Proteins 0.000 description 1
102100005645 KLK8 Human genes 0.000 description 1
101700020455 KLK8 Proteins 0.000 description 1
102100017339 KLRC1 Human genes 0.000 description 1
101710036388 KLRC1 Proteins 0.000 description 1
102100012225 KLRC2 Human genes 0.000 description 1
101710036391 KLRC2 Proteins 0.000 description 1
101710036390 KLRK1 Proteins 0.000 description 1
102100012223 KLRK1 Human genes 0.000 description 1
210000002510 Keratinocytes Anatomy 0.000 description 1
101700070878 LAP1 Proteins 0.000 description 1
101710015837 LGALS9 Proteins 0.000 description 1
101710040442 LTBR Proteins 0.000 description 1
102100013136 LTBR Human genes 0.000 description 1
101710028176 LVRN Proteins 0.000 description 1
102100008092 LVRN Human genes 0.000 description 1
101700031346 LY9 Proteins 0.000 description 1
229940078795 Lactoferrin Drugs 0.000 description 1
108010063045 Lactoferrin Proteins 0.000 description 1
102000010445 Lactoferrin Human genes 0.000 description 1
BCFGMOOMADDAQU-UHFFFAOYSA-N Lapatinib Chemical compound O1C(CNCCS(=O)(=O)C)=CC=C1C1=CC=C(N=CN=C2NC=3C=C(Cl)C(OCC=4C=C(F)C=CC=4)=CC=3)C2=C1 BCFGMOOMADDAQU-UHFFFAOYSA-N 0.000 description 1
229920001491 Lentinan Polymers 0.000 description 1
206010024305 Leukaemia monocytic Diseases 0.000 description 1
208000000429 Leukemia, Lymphocytic, Chronic, B-Cell Diseases 0.000 description 1
208000008456 Leukemia, Myelogenous, Chronic, BCR-ABL Positive Diseases 0.000 description 1
210000000265 Leukocytes Anatomy 0.000 description 1
229960004338 Leuprorelin Drugs 0.000 description 1
LTXREWYXXSTFRX-QGZVFWFLSA-N Linagliptin Chemical compound N=1C=2N(C)C(=O)N(CC=3N=C4C=CC=CC4=C(C)N=3)C(=O)C=2N(CC#CC)C=1N1CCC[C@@H](N)C1 LTXREWYXXSTFRX-QGZVFWFLSA-N 0.000 description 1
229960002397 Linagliptin Drugs 0.000 description 1
206010024627 Liposarcoma Diseases 0.000 description 1
210000004185 Liver Anatomy 0.000 description 1
YROQEQPFUCPDCP-UHFFFAOYSA-N Losoxantrone Chemical compound OCCNCCN1N=C2C3=CC=CC(O)=C3C(=O)C3=C2C1=CC=C3NCCNCCO YROQEQPFUCPDCP-UHFFFAOYSA-N 0.000 description 1
229950008745 Losoxantrone Drugs 0.000 description 1
210000004072 Lung Anatomy 0.000 description 1
229940087857 Lupron Drugs 0.000 description 1
RVFGKBWWUQOIOU-NDEPHWFRSA-N Lurtotecan Chemical compound O=C([C@]1(O)CC)OCC(C(N2CC3=4)=O)=C1C=C2C3=NC1=CC=2OCCOC=2C=C1C=4CN1CCN(C)CC1 RVFGKBWWUQOIOU-NDEPHWFRSA-N 0.000 description 1
229950002654 Lurtotecan Drugs 0.000 description 1
210000003171 Lymphocytes, Tumor-Infiltrating Anatomy 0.000 description 1
102000004083 Lymphotoxin-alpha Human genes 0.000 description 1
108090000542 Lymphotoxin-alpha Proteins 0.000 description 1
108010085169 Lysine Carboxypeptidase Proteins 0.000 description 1
102100010544 MALT1 Human genes 0.000 description 1
101710042185 MCT7 Proteins 0.000 description 1
102100013126 METAP1 Human genes 0.000 description 1
101710039852 METAP1 Proteins 0.000 description 1
102100016477 METAP2 Human genes 0.000 description 1
101710012506 METAP2 Proteins 0.000 description 1
102100004973 MMP15 Human genes 0.000 description 1
101700033206 MMP15 Proteins 0.000 description 1
102100018198 MMP16 Human genes 0.000 description 1
101700013081 MMP16 Proteins 0.000 description 1
102100012744 MMP21 Human genes 0.000 description 1
102100012741 MMP23B Human genes 0.000 description 1
108091006994 MMP23B Proteins 0.000 description 1
102100012743 MMP24 Human genes 0.000 description 1
101700042912 MMP24 Proteins 0.000 description 1
101700026411 MMP25 Proteins 0.000 description 1
102100014895 MMP27 Human genes 0.000 description 1
101700046621 MMP27 Proteins 0.000 description 1
102100014896 MMP28 Human genes 0.000 description 1
101700054191 MMP28 Proteins 0.000 description 1
102000008904 MPN domain Human genes 0.000 description 1
108050000834 MPN domain Proteins 0.000 description 1
102100018546 MYSM1 Human genes 0.000 description 1
108060005975 MYSM1 Proteins 0.000 description 1
WKPWGQKGSOKKOO-RSFHAFMBSA-N Maitansine Chemical compound CO[C@@H]([C@@]1(O)C[C@](OC(=O)N1)([C@H]([C@@H]1O[C@@]1(C)[C@@H](OC(=O)[C@H](C)N(C)C(C)=O)CC(=O)N1C)C)[H])\C=C\C=C(C)\CC2=CC(OC)=C(Cl)C1=C2 WKPWGQKGSOKKOO-RSFHAFMBSA-N 0.000 description 1
229950001474 Maitansine Drugs 0.000 description 1
MQXVYODZCMMZEM-ZYUZMQFOSA-N Mannomustine Chemical compound ClCCNC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CNCCCl MQXVYODZCMMZEM-ZYUZMQFOSA-N 0.000 description 1
229940099262 Marinol Drugs 0.000 description 1
210000000138 Mast Cells Anatomy 0.000 description 1
229960004296 Megestrol Acetate Drugs 0.000 description 1
102000018697 Membrane Proteins Human genes 0.000 description 1
108010052285 Membrane Proteins Proteins 0.000 description 1
NPPQSCRMBWNHMW-UHFFFAOYSA-N Meprobamate Chemical compound NC(=O)OCC(C)(CCC)COC(N)=O NPPQSCRMBWNHMW-UHFFFAOYSA-N 0.000 description 1
241001342637 Mesophylla Species 0.000 description 1
102000005741 Metalloproteases Human genes 0.000 description 1
108010006035 Metalloproteases Proteins 0.000 description 1
108090000192 Methionyl aminopeptidases Proteins 0.000 description 1
VFKZTMPDYBFSTM-KVTDHHQDSA-N Mitobronitol Chemical compound BrC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CBr VFKZTMPDYBFSTM-KVTDHHQDSA-N 0.000 description 1
108010063698 Mucosa-Associated Lymphoid Tissue Lymphoma Translocation 1 Protein Proteins 0.000 description 1
210000002027 Muscle, Skeletal Anatomy 0.000 description 1
229960000951 Mycophenolic Acid Drugs 0.000 description 1
UWYXLGUQQFPJRI-UHFFFAOYSA-N N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-amine;4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1.CC1=CC=C(S(O)(=O)=O)C=C1.O1C(CNCCS(=O)(=O)C)=CC=C1C1=CC=C(N=CN=C2NC=3C=C(Cl)C(OCC=4C=C(F)C=CC=4)=CC=3)C2=C1 UWYXLGUQQFPJRI-UHFFFAOYSA-N 0.000 description 1
DYMRYCZRMAHYKE-UHFFFAOYSA-N N-diazonitramide Chemical group [O-][N+](=O)N=[N+]=[N-] DYMRYCZRMAHYKE-UHFFFAOYSA-N 0.000 description 1
XGXNTJHZPBRBHJ-UHFFFAOYSA-N N-phenylpyrimidin-2-amine Chemical class N=1C=CC=NC=1NC1=CC=CC=C1 XGXNTJHZPBRBHJ-UHFFFAOYSA-N 0.000 description 1
125000000729 N-terminal amino-acid group Chemical group 0.000 description 1
102100007527 NCLN Human genes 0.000 description 1
101700033979 NCLN Proteins 0.000 description 1
102100007907 NCR1 Human genes 0.000 description 1
101710009580 NCR1 Proteins 0.000 description 1
102100007909 NCR2 Human genes 0.000 description 1
101710009579 NCR2 Proteins 0.000 description 1
102100007908 NCR3 Human genes 0.000 description 1
101710009588 NCR3 Proteins 0.000 description 1
102100017247 NEK2 Human genes 0.000 description 1
101700042931 NEK2 Proteins 0.000 description 1
229940086322 Navelbine Drugs 0.000 description 1
108010008267 Nerve Growth Factors Proteins 0.000 description 1
102000007072 Nerve Growth Factors Human genes 0.000 description 1
210000000944 Nerve Tissue Anatomy 0.000 description 1
206010029260 Neuroblastoma Diseases 0.000 description 1
229940085033 Nolvadex Drugs 0.000 description 1
ZADPBFCGQRWHPN-UHFFFAOYSA-N OBO Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
101700035881 OTUD1 Proteins 0.000 description 1
102100019757 OTUD3 Human genes 0.000 description 1
101700086315 OTUD3 Proteins 0.000 description 1
229920000272 Oligonucleotide Polymers 0.000 description 1
229950011093 Onapristone Drugs 0.000 description 1
102100004038 PAN2 Human genes 0.000 description 1
108060005927 PAN2 Proteins 0.000 description 1
101700011774 PEPD Proteins 0.000 description 1
102100002874 PEPD Human genes 0.000 description 1
102100015416 PGPEP1 Human genes 0.000 description 1
101710027262 PKD1L3 Proteins 0.000 description 1
102100004368 PKD1L3 Human genes 0.000 description 1
102100012896 PLGLB1 Human genes 0.000 description 1
101710014095 PLGLB1 Proteins 0.000 description 1
102100004012 PPAT Human genes 0.000 description 1
102100007893 PRKCA Human genes 0.000 description 1
101710038828 PRKCA Proteins 0.000 description 1
102100000553 PRSS12 Human genes 0.000 description 1
101710043612 PRSS33 Proteins 0.000 description 1
102100020213 PRSS35 Human genes 0.000 description 1
101710043605 PRSS35 Proteins 0.000 description 1
102100012536 PRSS36 Human genes 0.000 description 1
101710040324 PRSS36 Proteins 0.000 description 1
102100003245 PSMA1 Human genes 0.000 description 1
101700083322 PSMA3 Proteins 0.000 description 1
102100009770 PSMA3 Human genes 0.000 description 1
101700065052 PSMA4 Proteins 0.000 description 1
102100016936 PSMA4 Human genes 0.000 description 1
101710033517 PSMA6 Proteins 0.000 description 1
102100020297 PSMA6 Human genes 0.000 description 1
101710033555 PSMB2 Proteins 0.000 description 1
102100018209 PSMB2 Human genes 0.000 description 1
101710033558 PSMB3 Proteins 0.000 description 1
102100009997 PSMB3 Human genes 0.000 description 1
101710033547 PSMB6 Proteins 0.000 description 1
102100010838 PSMB6 Human genes 0.000 description 1
101710033538 PSMB7 Proteins 0.000 description 1
102100018329 PSMB7 Human genes 0.000 description 1
102100017982 PSMD7 Human genes 0.000 description 1
101700054879 PSMD7 Proteins 0.000 description 1
RXWNCPJZOCPEPQ-NVWDDTSBSA-N PUROMYCIN Chemical compound C1=CC(OC)=CC=C1C[C@H](N)C(=O)N[C@H]1[C@@H](O)[C@H](N2C3=NC=NC(=C3N=C2)N(C)C)O[C@@H]1CO RXWNCPJZOCPEPQ-NVWDDTSBSA-N 0.000 description 1
229950010131 PUROMYCIN Drugs 0.000 description 1
WRUUGTRCQOWXEG-UHFFFAOYSA-N Pamidronic acid Chemical compound NCCC(O)(P(O)(O)=O)P(O)(O)=O WRUUGTRCQOWXEG-UHFFFAOYSA-N 0.000 description 1
210000000496 Pancreas Anatomy 0.000 description 1
102000016387 Pancreatic Elastase Human genes 0.000 description 1
108010067372 Pancreatic Elastase Proteins 0.000 description 1
208000004019 Papillary Adenocarcinoma Diseases 0.000 description 1
229960002340 Pentostatin Drugs 0.000 description 1
FPVKHBSQESCIEP-JQCXWYLXSA-N Pentostatin Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(N=CNC[C@H]2O)=C2N=C1 FPVKHBSQESCIEP-JQCXWYLXSA-N 0.000 description 1
108010067902 Peptide Library Proteins 0.000 description 1
RDOWQLZANAYVLL-UHFFFAOYSA-N Phenanthridine Chemical compound C1=CC=C2C3=CC=CC=C3C=NC2=C1 RDOWQLZANAYVLL-UHFFFAOYSA-N 0.000 description 1
PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Chemical compound C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
229950000688 Phenothiazine Drugs 0.000 description 1
TZMSYXZUNZXBOL-UHFFFAOYSA-N Phenoxazine Chemical compound C1=CC=C2NC3=CC=CC=C3OC2=C1 TZMSYXZUNZXBOL-UHFFFAOYSA-N 0.000 description 1
241000070023 Phoenicopterus roseus Species 0.000 description 1
LFSXCDWNBUNEEM-UHFFFAOYSA-N Phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
NJBFOOCLYDNZJN-UHFFFAOYSA-N Pipobroman Chemical compound BrCCC(=O)N1CCN(C(=O)CCBr)CC1 NJBFOOCLYDNZJN-UHFFFAOYSA-N 0.000 description 1
210000004011 Plasma Cells Anatomy 0.000 description 1
208000007452 Plasmacytoma Diseases 0.000 description 1
231100000614 Poison Toxicity 0.000 description 1
208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 1
OIGNJSKKLXVSLS-VWUMJDOOSA-N Prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 description 1
CPTBDICYNRMXFX-UHFFFAOYSA-N Procarbazine Chemical compound CNNCC1=CC=C(C(=O)NC(C)C)C=C1 CPTBDICYNRMXFX-UHFFFAOYSA-N 0.000 description 1
229940087463 Proleukin Drugs 0.000 description 1
210000002307 Prostate Anatomy 0.000 description 1
102000017850 Proteasome subunit alpha2 Human genes 0.000 description 1
108050007073 Proteasome subunit alpha2 Proteins 0.000 description 1
102000001593 Proteasome subunit alpha5 Human genes 0.000 description 1
108050009823 Proteasome subunit alpha5 Proteins 0.000 description 1
108050007094 Proteasome subunit alpha6 Proteins 0.000 description 1
101800001072 Protein 1A Proteins 0.000 description 1
102000017975 Protein C Human genes 0.000 description 1
229960000856 Protein C Drugs 0.000 description 1
108010029485 Protein Isoforms Proteins 0.000 description 1
102000001708 Protein Isoforms Human genes 0.000 description 1
108010009341 Protein-Serine-Threonine Kinases Proteins 0.000 description 1
102000009516 Protein-Serine-Threonine Kinases Human genes 0.000 description 1
102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 1
108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 1
102000016971 Proto-Oncogene Proteins c-kit Human genes 0.000 description 1
108010014608 Proto-Oncogene Proteins c-kit Proteins 0.000 description 1
CPNGPNLZQNNVQM-UHFFFAOYSA-N Pteridine Chemical compound N1=CN=CC2=NC=CN=C21 CPNGPNLZQNNVQM-UHFFFAOYSA-N 0.000 description 1
KDCGOANMDULRCW-UHFFFAOYSA-N Purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 1
MGADZUXDNSDTHW-UHFFFAOYSA-N Pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
108090000919 Pyroglutamyl-Peptidase I Proteins 0.000 description 1
JWVCLYRUEFBMGU-UHFFFAOYSA-N Quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
XSCHRSMBECNVNS-UHFFFAOYSA-N Quinoxaline Chemical compound N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 1
108020004532 RAS Proteins 0.000 description 1
102100015132 RNPEP Human genes 0.000 description 1
102100017713 RNPEPL1 Human genes 0.000 description 1
101710011110 RP373 Proteins 0.000 description 1
GZUITABIAKMVPG-UHFFFAOYSA-N Raloxifene Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 GZUITABIAKMVPG-UHFFFAOYSA-N 0.000 description 1
229960004622 Raloxifene Drugs 0.000 description 1
206010038389 Renal cancer Diseases 0.000 description 1
BXNMTOQRYBFHNZ-UHFFFAOYSA-N Resiquimod Chemical compound C1=CC=CC2=C(N(C(COCC)=N3)CC(C)(C)O)C3=C(N)N=C21 BXNMTOQRYBFHNZ-UHFFFAOYSA-N 0.000 description 1
229950010550 Resiquimod Drugs 0.000 description 1
IIDJRNMFWXDHID-UHFFFAOYSA-N Risedronic acid Chemical compound OP(=O)(O)C(P(O)(O)=O)(O)CC1=CC=CN=C1 IIDJRNMFWXDHID-UHFFFAOYSA-N 0.000 description 1
229950004892 Rodorubicin Drugs 0.000 description 1
101710026336 S5 Proteins 0.000 description 1
102100014586 SELPLG Human genes 0.000 description 1
101710023851 SELPLG Proteins 0.000 description 1
101700034670 SENP1 Proteins 0.000 description 1
102100000901 SENP1 Human genes 0.000 description 1
101700055362 SENP2 Proteins 0.000 description 1
102100000902 SENP2 Human genes 0.000 description 1
101700076793 SENP3 Proteins 0.000 description 1
102100001768 SENP3 Human genes 0.000 description 1
102100001774 SENP5 Human genes 0.000 description 1
101700085048 SENP5 Proteins 0.000 description 1
102100001773 SENP7 Human genes 0.000 description 1
101700006371 SENP7 Proteins 0.000 description 1
101700005866 SENP8 Proteins 0.000 description 1
102100001778 SENP8 Human genes 0.000 description 1
102100017640 SLAMF7 Human genes 0.000 description 1
101710030435 SLAMF7 Proteins 0.000 description 1
102100013400 STAMBP Human genes 0.000 description 1
101710035918 STAMBP Proteins 0.000 description 1
101700074681 STX2 Proteins 0.000 description 1
102100018831 SUPT16H Human genes 0.000 description 1
101710025445 SUPT16H Proteins 0.000 description 1
229960004937 Saxagliptin Drugs 0.000 description 1
101710033766 Segment-10 Proteins 0.000 description 1
210000002966 Serum Anatomy 0.000 description 1
108010070144 Single-Chain Antibodies Proteins 0.000 description 1
102000005632 Single-Chain Antibodies Human genes 0.000 description 1
MFFMDFFZMYYVKS-SECBINFHSA-N Sitagliptin Chemical compound C([C@H](CC(=O)N1CC=2N(C(=NN=2)C(F)(F)F)CC1)N)C1=CC(F)=C(F)C=C1F MFFMDFFZMYYVKS-SECBINFHSA-N 0.000 description 1
229940112726 Skelid Drugs 0.000 description 1
210000003491 Skin Anatomy 0.000 description 1
210000000278 Spinal Cord Anatomy 0.000 description 1
229950006315 Spirogermanium Drugs 0.000 description 1
210000000952 Spleen Anatomy 0.000 description 1
206010041823 Squamous cell carcinoma Diseases 0.000 description 1
210000002784 Stomach Anatomy 0.000 description 1
LSNNMFCWUKXFEE-UHFFFAOYSA-L Sulphite Chemical group [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
210000004243 Sweat Anatomy 0.000 description 1
230000017274 T cell anergy Effects 0.000 description 1
108091008153 T cell receptors Proteins 0.000 description 1
BXFOFFBJRFZBQZ-QYWOHJEZSA-N T-2 mycotoxin Chemical compound C([C@@]12[C@]3(C)[C@H](OC(C)=O)[C@@H](O)[C@H]1O[C@H]1[C@]3(COC(C)=O)C[C@@H](C(=C1)C)OC(=O)CC(C)C)O2 BXFOFFBJRFZBQZ-QYWOHJEZSA-N 0.000 description 1
102000016266 T-Cell Antigen Receptors Human genes 0.000 description 1
102100018462 TASP1 Human genes 0.000 description 1
101700039252 TASP1 Proteins 0.000 description 1
102100008336 TG Human genes 0.000 description 1
108060003967 TIM Proteins 0.000 description 1
108060008273 TIMELESS Proteins 0.000 description 1
102100001073 TMPRSS13 Human genes 0.000 description 1
101710044652 TMPRSS13 Proteins 0.000 description 1
102100009508 TMPRSS15 Human genes 0.000 description 1
102100011827 TMPRSS2 Human genes 0.000 description 1
101710044694 TMPRSS2 Proteins 0.000 description 1
101710044695 TMPRSS3 Proteins 0.000 description 1
102100001068 TMPRSS5 Human genes 0.000 description 1
101710044692 TMPRSS5 Proteins 0.000 description 1
101710030862 TNFRSF13C Proteins 0.000 description 1
102100009743 TNFRSF13C Human genes 0.000 description 1
101710038601 TNFRSF14 Proteins 0.000 description 1
101710038524 TNFRSF1B Proteins 0.000 description 1
102100003105 TNFRSF1B Human genes 0.000 description 1
102100012560 TPSB2 Human genes 0.000 description 1
101710037984 TPSB2 Proteins 0.000 description 1
102100009949 TPSD1 Human genes 0.000 description 1
101700078844 TPSD1 Proteins 0.000 description 1
102100009950 TPSG1 Human genes 0.000 description 1
101710037935 TPSG1 Proteins 0.000 description 1
AYUNIORJHRXIBJ-TXHRRWQRSA-N Tanespimycin Chemical compound N1C(=O)\C(C)=C\C=C/[C@H](OC)[C@@H](OC(N)=O)\C(C)=C\[C@H](C)[C@@H](O)[C@@H](OC)C[C@H](C)CC2=C(NCC=C)C(=O)C=C1C2=O AYUNIORJHRXIBJ-TXHRRWQRSA-N 0.000 description 1
WFWLQNSHRPWKFK-ZCFIWIBFSA-N Tegafur Chemical compound O=C1NC(=O)C(F)=CN1[C@@H]1OCCC1 WFWLQNSHRPWKFK-ZCFIWIBFSA-N 0.000 description 1
229960001278 Teniposide Drugs 0.000 description 1
KLBSRSYHIIAQTG-PZICIZFRSA-N Tenuazonic acid Chemical compound CC[C@H](C)[C@@H]1NC(=O)C(C(C)=O)C1=O KLBSRSYHIIAQTG-PZICIZFRSA-N 0.000 description 1
229940033529 Tetrahydrocannabinol Drugs 0.000 description 1
RAOIDOHSFRTOEL-UHFFFAOYSA-N Tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
229960005454 Thioguanine Drugs 0.000 description 1
229960002175 Thyroglobulin Drugs 0.000 description 1
108010034949 Thyroglobulin Proteins 0.000 description 1
210000001685 Thyroid Gland Anatomy 0.000 description 1
DKJJVAGXPKPDRL-UHFFFAOYSA-N Tiludronic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)SC1=CC=C(Cl)C=C1 DKJJVAGXPKPDRL-UHFFFAOYSA-N 0.000 description 1
102000003978 Tissue plasminogen activator Human genes 0.000 description 1
108090000373 Tissue plasminogen activator Proteins 0.000 description 1
239000000365 Topoisomerase I Inhibitor Substances 0.000 description 1
210000003437 Trachea Anatomy 0.000 description 1
206010044334 Trance Diseases 0.000 description 1
102000004357 Transferases Human genes 0.000 description 1
108090000992 Transferases Proteins 0.000 description 1
229950001353 Tretamine Drugs 0.000 description 1
229960001727 Tretinoin Drugs 0.000 description 1
SHGAZHPCJJPHSC-NWVFGJFESA-N Tretinoin Chemical compound OC(=O)/C=C(\C)/C=C/C=C(C)C=CC1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-NWVFGJFESA-N 0.000 description 1
NOYPYLRCIDNJJB-UHFFFAOYSA-N Trimetrexate Chemical compound COC1=C(OC)C(OC)=CC(NCC=2C(=C3C(N)=NC(N)=NC3=CC=2)C)=C1 NOYPYLRCIDNJJB-UHFFFAOYSA-N 0.000 description 1
229960001099 Trimetrexate Drugs 0.000 description 1
FYAMXEPQQLNQDM-UHFFFAOYSA-N Tris(1-aziridinyl)phosphine oxide Chemical compound C1CN1P(N1CC1)(=O)N1CC1 FYAMXEPQQLNQDM-UHFFFAOYSA-N 0.000 description 1
HRXKRNGNAMMEHJ-UHFFFAOYSA-K Trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 1
108090000631 Trypsin Proteins 0.000 description 1
102000004142 Trypsin Human genes 0.000 description 1
102000003390 Tumor Necrosis Factors Human genes 0.000 description 1
108060008682 Tumor Necrosis Factors Proteins 0.000 description 1
NMUSYJAQQFHJEW-KVTDHHQDSA-N U-18,496 Chemical compound O=C1N=C(N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 NMUSYJAQQFHJEW-KVTDHHQDSA-N 0.000 description 1
229950009811 UBENIMEX Drugs 0.000 description 1
101700074507 UFSP1 Proteins 0.000 description 1
102100011564 UFSP1 Human genes 0.000 description 1
101700012042 UFSP2 Proteins 0.000 description 1
102100008454 UFSP2 Human genes 0.000 description 1
101710008831 UQCRC1 Proteins 0.000 description 1
102100013168 UQCRC1 Human genes 0.000 description 1
102100013178 UQCRC2 Human genes 0.000 description 1
101710008836 UQCRC2 Proteins 0.000 description 1
102100011110 USP10 Human genes 0.000 description 1
108060005929 USP10 Proteins 0.000 description 1
102100017881 USP11 Human genes 0.000 description 1
101700043628 USP11 Proteins 0.000 description 1
102100017883 USP12 Human genes 0.000 description 1
101700045440 USP12 Proteins 0.000 description 1
102100008457 USP13 Human genes 0.000 description 1
101700047220 USP13 Proteins 0.000 description 1
102100008462 USP14 Human genes 0.000 description 1
101710009617 USP14 Proteins 0.000 description 1
102100008465 USP15 Human genes 0.000 description 1
101710009615 USP15 Proteins 0.000 description 1
102100005064 USP16 Human genes 0.000 description 1
108060005932 USP16 Proteins 0.000 description 1
102100005067 USP18 Human genes 0.000 description 1
101710009614 USP18 Proteins 0.000 description 1
102100011609 USP19 Human genes 0.000 description 1
101710009618 USP19 Proteins 0.000 description 1
102100007929 USP2 Human genes 0.000 description 1
108060005937 USP2 Proteins 0.000 description 1
102100011577 USP20 Human genes 0.000 description 1
101710010222 USP20 Proteins 0.000 description 1
102100002747 USP21 Human genes 0.000 description 1
108060005935 USP21 Proteins 0.000 description 1
102100002748 USP22 Human genes 0.000 description 1
101700010481 USP22 Proteins 0.000 description 1
102100002743 USP24 Human genes 0.000 description 1
101710010219 USP24 Proteins 0.000 description 1
102100005734 USP25 Human genes 0.000 description 1
101710010220 USP25 Proteins 0.000 description 1
102100005732 USP26 Human genes 0.000 description 1
101700065442 USP26 Proteins 0.000 description 1
102100005736 USP29 Human genes 0.000 description 1
101710010227 USP29 Proteins 0.000 description 1
102100007933 USP31 Human genes 0.000 description 1
101710010106 USP31 Proteins 0.000 description 1
102100007931 USP32 Human genes 0.000 description 1
101710010109 USP32 Proteins 0.000 description 1
102100015868 USP34 Human genes 0.000 description 1
101710010117 USP34 Proteins 0.000 description 1
102100015872 USP36 Human genes 0.000 description 1
101710010112 USP36 Proteins 0.000 description 1
102100015854 USP37 Human genes 0.000 description 1
101710010113 USP37 Proteins 0.000 description 1
102100017876 USP4 Human genes 0.000 description 1
108060005941 USP4 Proteins 0.000 description 1
102100015848 USP40 Human genes 0.000 description 1
101710010124 USP40 Proteins 0.000 description 1
102100015851 USP41 Human genes 0.000 description 1
101710010087 USP41 Proteins 0.000 description 1
102100015853 USP42 Human genes 0.000 description 1
101710010083 USP42 Proteins 0.000 description 1
102100011115 USP44 Human genes 0.000 description 1
108060005939 USP44 Proteins 0.000 description 1
102100011114 USP45 Human genes 0.000 description 1
101700075180 USP45 Proteins 0.000 description 1
102100017872 USP49 Human genes 0.000 description 1
101710010092 USP49 Proteins 0.000 description 1
102100002751 USP5 Human genes 0.000 description 1
101700023306 USP5 Proteins 0.000 description 1
102100002744 USP50 Human genes 0.000 description 1
101710010107 USP50 Proteins 0.000 description 1
102100002745 USP51 Human genes 0.000 description 1
101710010111 USP51 Proteins 0.000 description 1
102100002746 USP53 Human genes 0.000 description 1
101710010079 USP53 Proteins 0.000 description 1
102100002750 USP54 Human genes 0.000 description 1
101710010073 USP54 Proteins 0.000 description 1
102100002752 USP6 Human genes 0.000 description 1
101700066130 USP6 Proteins 0.000 description 1
102100011581 USP8 Human genes 0.000 description 1
101700064687 USP8 Proteins 0.000 description 1
102000001591 Ubiquitin specific peptidase 1 Human genes 0.000 description 1
108050009822 Ubiquitin specific peptidase 1 Proteins 0.000 description 1
102000001522 Ubiquitin-specific peptidase 38 Human genes 0.000 description 1
108050009759 Ubiquitin-specific peptidase 38 Proteins 0.000 description 1
210000003606 Umbilical Veins Anatomy 0.000 description 1
210000003932 Urinary Bladder Anatomy 0.000 description 1
206010046766 Uterine cancer Diseases 0.000 description 1
210000004291 Uterus Anatomy 0.000 description 1
102100010125 VCPIP1 Human genes 0.000 description 1
101710004386 VCPIP1 Proteins 0.000 description 1
229960004355 Vindesine Drugs 0.000 description 1
GBABOYUKABKIAF-GHYRFKGUSA-N Vinorelbine Chemical compound C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC GBABOYUKABKIAF-GHYRFKGUSA-N 0.000 description 1
206010047802 Waldenstrom's macroglobulinaemias Diseases 0.000 description 1
208000008383 Wilms Tumor Diseases 0.000 description 1
GJCOSYZMQJWQCA-UHFFFAOYSA-N Xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
229940053867 Xeloda Drugs 0.000 description 1
AOCCBINRVIKJHY-UHFFFAOYSA-N Yamafur Chemical compound CCCCCCNC(=O)N1C=C(F)C(=O)NC1=O AOCCBINRVIKJHY-UHFFFAOYSA-N 0.000 description 1
229940002005 Zometa Drugs 0.000 description 1
RQZAXGRLVPAYTJ-GQFGMJRRSA-N [(8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate Chemical compound C1=C(C)C2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(C)=O)(OC(=O)C)[C@@]1(C)CC2 RQZAXGRLVPAYTJ-GQFGMJRRSA-N 0.000 description 1
NUKCGLDCWQXYOQ-UHFFFAOYSA-N [3-[4-(3-methylsulfonyloxypropanoyl)piperazin-1-yl]-3-oxopropyl] methanesulfonate Chemical compound CS(=O)(=O)OCCC(=O)N1CCN(C(=O)CCOS(C)(=O)=O)CC1 NUKCGLDCWQXYOQ-UHFFFAOYSA-N 0.000 description 1
ZYJKONDZYOWOHE-UHFFFAOYSA-N [4-amino-3-(hydroxymethyl)phenyl]methanol Chemical compound NC1=CC=C(CO)C=C1CO ZYJKONDZYOWOHE-UHFFFAOYSA-N 0.000 description 1
AIWRTTMUVOZGPW-HSPKUQOVSA-N abarelix Chemical compound C([C@@H](C(=O)N[C@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCNC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@H](C)C(N)=O)N(C)C(=O)[C@H](CO)NC(=O)[C@@H](CC=1C=NC=CC=1)NC(=O)[C@@H](CC=1C=CC(Cl)=CC=1)NC(=O)[C@@H](CC=1C=C2C=CC=CC2=CC=1)NC(C)=O)C1=CC=C(O)C=C1 AIWRTTMUVOZGPW-HSPKUQOVSA-N 0.000 description 1
108010023617 abarelix Proteins 0.000 description 1
229960002184 abarelix Drugs 0.000 description 1
238000006640 acetylation reaction Methods 0.000 description 1
RJURFGZVJUQBHK-IIXSONLDSA-N actinomycin D Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)N[C@@H]4C(=O)N[C@@H](C(N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-IIXSONLDSA-N 0.000 description 1
230000003213 activating Effects 0.000 description 1
231100000215 acute (single dose) toxicity testing Toxicity 0.000 description 1
201000005510 acute lymphocytic leukemia Diseases 0.000 description 1
238000011047 acute toxicity test Methods 0.000 description 1
230000003044 adaptive Effects 0.000 description 1
230000033289 adaptive immune response Effects 0.000 description 1
230000001464 adherent Effects 0.000 description 1
239000000853 adhesive Substances 0.000 description 1
230000001070 adhesive Effects 0.000 description 1
210000001789 adipocyte Anatomy 0.000 description 1
230000001919 adrenal Effects 0.000 description 1
PYMYPHUHKUWMLA-WDCZJNDASA-N aldehydo-D-arabinose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)C=O PYMYPHUHKUWMLA-WDCZJNDASA-N 0.000 description 1
125000002723 alicyclic group Chemical group 0.000 description 1
150000008052 alkyl sulfonates Chemical class 0.000 description 1
239000002168 alkylating agent Substances 0.000 description 1
229930002945 all-trans-retinaldehyde Natural products 0.000 description 1
229960001667 alogliptin Drugs 0.000 description 1
150000001370 alpha-amino acid derivatives Chemical class 0.000 description 1
235000008206 alpha-amino acids Nutrition 0.000 description 1
229960000473 altretamine Drugs 0.000 description 1
125000004103 aminoalkyl group Chemical group 0.000 description 1
229960002749 aminolevulinic acid Drugs 0.000 description 1
ZGXJTSGNIOSYLO-UHFFFAOYSA-N aminolevulinic acid Chemical compound NCC(=O)CCC(O)=O ZGXJTSGNIOSYLO-UHFFFAOYSA-N 0.000 description 1
108090000449 aminopeptidase B Proteins 0.000 description 1
101700084907 ampp Proteins 0.000 description 1
230000033115 angiogenesis Effects 0.000 description 1
201000003076 angiosarcoma Diseases 0.000 description 1
230000002280 anti-androgenic Effects 0.000 description 1
230000003388 anti-hormone Effects 0.000 description 1
239000000051 antiandrogen Substances 0.000 description 1
239000003418 antiprogestin Substances 0.000 description 1
239000000074 antisense oligonucleotide Substances 0.000 description 1
101710043144 apeI Proteins 0.000 description 1
125000000511 arginine group Chemical group N[C@@H](CCCNC(N)=N)C(=O)* 0.000 description 1
108010068380 arginylarginine Proteins 0.000 description 1
239000003886 aromatase inhibitor Substances 0.000 description 1
150000001491 aromatic compounds Chemical class 0.000 description 1
108010072668 atezolizumab Proteins 0.000 description 1
230000003305 autocrine Effects 0.000 description 1
108010010826 avelumab Proteins 0.000 description 1
235000020127 ayran Nutrition 0.000 description 1
125000003725 azepanyl group Chemical group 0.000 description 1
125000002393 azetidinyl group Chemical group 0.000 description 1
150000001540 azides Chemical class 0.000 description 1
ICCBZGUDUOMNOF-UHFFFAOYSA-N azidoamine Chemical compound NN=[N+]=[N-] ICCBZGUDUOMNOF-UHFFFAOYSA-N 0.000 description 1
125000004069 aziridinyl group Chemical group 0.000 description 1
239000000560 biocompatible material Substances 0.000 description 1
230000033228 biological regulation Effects 0.000 description 1
150000004663 bisphosphonates Chemical class 0.000 description 1
201000001531 bladder carcinoma Diseases 0.000 description 1
OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 1
239000010839 body fluid Substances 0.000 description 1
238000006664 bond formation reaction Methods 0.000 description 1
MPBVHIBUJCELCL-UHFFFAOYSA-N bondronat Chemical compound CCCCCN(C)CCC(O)(P(O)(O)=O)P(O)(O)=O MPBVHIBUJCELCL-UHFFFAOYSA-N 0.000 description 1
210000002798 bone marrow cell Anatomy 0.000 description 1
201000010983 breast ductal carcinoma Diseases 0.000 description 1
GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
239000007853 buffer solution Substances 0.000 description 1
229960002092 busulfan Drugs 0.000 description 1
150000001720 carbohydrates Chemical class 0.000 description 1
235000014633 carbohydrates Nutrition 0.000 description 1
150000007942 carboxylates Chemical class 0.000 description 1
108090000007 carboxypeptidase M Proteins 0.000 description 1
229960003261 carmofur Drugs 0.000 description 1
239000000969 carrier Substances 0.000 description 1
230000010261 cell growth Effects 0.000 description 1
230000004709 cell invasion Effects 0.000 description 1
230000022534 cell killing Effects 0.000 description 1
201000010881 cervical cancer Diseases 0.000 description 1
229910052729 chemical element Inorganic materials 0.000 description 1
239000003153 chemical reaction reagent Substances 0.000 description 1
239000000460 chlorine Chemical group 0.000 description 1
229910052801 chlorine Inorganic materials 0.000 description 1
ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
229940048961 cholinesterase Drugs 0.000 description 1
QZHPTGXQGDFGEN-UHFFFAOYSA-N chromene Chemical compound C1=CC=C2C=C[CH]OC2=C1 QZHPTGXQGDFGEN-UHFFFAOYSA-N 0.000 description 1
LJAOOBNHPFKCDR-UHFFFAOYSA-K chromium(3+) trichloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Cr+3] LJAOOBNHPFKCDR-UHFFFAOYSA-K 0.000 description 1
201000006934 chronic myeloid leukemia Diseases 0.000 description 1
229960004316 cisplatin Drugs 0.000 description 1
108010072917 class-I restricted T cell-associated molecule Proteins 0.000 description 1
108010022822 collapsin response mediator protein-2 Proteins 0.000 description 1
238000002648 combination therapy Methods 0.000 description 1
230000002860 competitive Effects 0.000 description 1
230000021615 conjugation Effects 0.000 description 1
239000000356 contaminant Substances 0.000 description 1
230000000139 costimulatory Effects 0.000 description 1
108090000711 cruzipain Proteins 0.000 description 1
108010006226 cryptophycin Proteins 0.000 description 1
108010089438 cryptophycin 1 Proteins 0.000 description 1
108010090203 cryptophycin 8 Proteins 0.000 description 1
125000006448 cycloalkyl cycloalkyl group Chemical group 0.000 description 1
125000000151 cysteine group Chemical group N[C@@H](CS)C(=O)* 0.000 description 1
230000016396 cytokine production Effects 0.000 description 1
230000003013 cytotoxicity Effects 0.000 description 1
231100000135 cytotoxicity Toxicity 0.000 description 1
229960003901 dacarbazine Drugs 0.000 description 1
238000004925 denaturation Methods 0.000 description 1
230000036425 denaturation Effects 0.000 description 1
230000001419 dependent Effects 0.000 description 1
238000009795 derivation Methods 0.000 description 1
230000000378 dietary Effects 0.000 description 1
230000004069 differentiation Effects 0.000 description 1
238000009792 diffusion process Methods 0.000 description 1
108091022040 dihydropyrimidinase Proteins 0.000 description 1
230000003292 diminished Effects 0.000 description 1
201000008325 diseases of cellular proliferation Diseases 0.000 description 1
231100000371 dose-limiting toxicity Toxicity 0.000 description 1
108010016436 durvalumab Proteins 0.000 description 1
229950006700 edatrexate Drugs 0.000 description 1
210000003162 effector T lymphocyte Anatomy 0.000 description 1
235000013601 eggs Nutrition 0.000 description 1
238000003379 elimination reaction Methods 0.000 description 1
108091010081 enhancer binding proteins Proteins 0.000 description 1
230000029578 entry into host Effects 0.000 description 1
210000000222 eosinocyte Anatomy 0.000 description 1
102000017256 epidermal growth factor-activated receptor activity proteins Human genes 0.000 description 1
108040009258 epidermal growth factor-activated receptor activity proteins Proteins 0.000 description 1
201000004101 esophageal cancer Diseases 0.000 description 1
201000005619 esophageal carcinoma Diseases 0.000 description 1
239000000262 estrogen Substances 0.000 description 1
150000002170 ethers Chemical group 0.000 description 1
JOYRKODLDBILNP-UHFFFAOYSA-N ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
238000011156 evaluation Methods 0.000 description 1
229960000255 exemestane Drugs 0.000 description 1
108091005632 farnesylated proteins Proteins 0.000 description 1
201000008808 fibrosarcoma Diseases 0.000 description 1
229910052731 fluorine Inorganic materials 0.000 description 1
239000011737 fluorine Substances 0.000 description 1
235000019152 folic acid Nutrition 0.000 description 1
239000011724 folic acid Substances 0.000 description 1
238000005755 formation reaction Methods 0.000 description 1
238000009472 formulation Methods 0.000 description 1
125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
238000006062 fragmentation reaction Methods 0.000 description 1
229940044658 gallium nitrate Drugs 0.000 description 1
229940044627 gamma-interferon Drugs 0.000 description 1
229960005277 gemcitabine Drugs 0.000 description 1
238000001415 gene therapy Methods 0.000 description 1
150000004676 glycans Polymers 0.000 description 1
230000034659 glycolysis Effects 0.000 description 1
230000003899 glycosylation Effects 0.000 description 1
238000006206 glycosylation reaction Methods 0.000 description 1
101710031799 gp63-C1 Proteins 0.000 description 1
108010022683 guanidinobenzoate esterase Proteins 0.000 description 1
125000005843 halogen group Chemical group 0.000 description 1
230000036541 health Effects 0.000 description 1
201000008064 heavy chain disease Diseases 0.000 description 1
201000002222 hemangioblastoma Diseases 0.000 description 1
150000002390 heteroarenes Chemical class 0.000 description 1
230000028996 humoral immune response Effects 0.000 description 1
229920002674 hyaluronan Polymers 0.000 description 1
XPXMKIXDFWLRAA-UHFFFAOYSA-N hydrazinide Chemical compound [NH-]N XPXMKIXDFWLRAA-UHFFFAOYSA-N 0.000 description 1
125000004435 hydrogen atoms Chemical group [H]* 0.000 description 1
229960001330 hydroxycarbamide Drugs 0.000 description 1
VSNHCAURESNICA-UHFFFAOYSA-N hydroxyurea Chemical compound NC(=O)NO VSNHCAURESNICA-UHFFFAOYSA-N 0.000 description 1
229940027318 hydroxyurea Drugs 0.000 description 1
125000002632 imidazolidinyl group Chemical group 0.000 description 1
125000002636 imidazolinyl group Chemical group 0.000 description 1
150000002466 imines Chemical group 0.000 description 1
229960002751 imiquimod Drugs 0.000 description 1
230000002163 immunogen Effects 0.000 description 1
230000001771 impaired Effects 0.000 description 1
229950008097 improsulfan Drugs 0.000 description 1
230000002757 inflammatory Effects 0.000 description 1
230000004054 inflammatory process Effects 0.000 description 1
239000004615 ingredient Substances 0.000 description 1
239000003999 initiator Substances 0.000 description 1
238000002347 injection Methods 0.000 description 1
239000007924 injection Substances 0.000 description 1
230000015788 innate immune response Effects 0.000 description 1
229960003130 interferon gamma Drugs 0.000 description 1
230000004073 interleukin-2 production Effects 0.000 description 1
229940079867 intestinal antiinfectives Sulfonamides Drugs 0.000 description 1
229910052740 iodine Chemical group 0.000 description 1
239000011630 iodine Chemical group 0.000 description 1
PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
125000002346 iodo group Chemical group I* 0.000 description 1
229960005386 ipilimumab Drugs 0.000 description 1
229960004768 irinotecan Drugs 0.000 description 1
108010076401 isopeptidase Proteins 0.000 description 1
125000001786 isothiazolyl group Chemical group 0.000 description 1
125000000842 isoxazolyl group Chemical group 0.000 description 1
108010024383 kallikrein 4 Proteins 0.000 description 1
238000002372 labelling Methods 0.000 description 1
150000003951 lactams Chemical class 0.000 description 1
235000021242 lactoferrin Nutrition 0.000 description 1
150000002596 lactones Chemical class 0.000 description 1
229960001320 lapatinib ditosylate Drugs 0.000 description 1
229940115286 lentinan Drugs 0.000 description 1
101710013613 let-413 Proteins 0.000 description 1
230000021633 leukocyte mediated immunity Effects 0.000 description 1
GFIJNRVAKGFPGQ-LIJARHBVSA-N leuprolide Chemical compound CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H]1NC(=O)CC1)CC1=CC=C(O)C=C1 GFIJNRVAKGFPGQ-LIJARHBVSA-N 0.000 description 1
RGLRXNKKBLIBQS-XNHQSDQCSA-N leuprolide acetate Chemical compound CC(O)=O.CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H]1NC(=O)CC1)CC1=CC=C(O)C=C1 RGLRXNKKBLIBQS-XNHQSDQCSA-N 0.000 description 1
150000002632 lipids Chemical class 0.000 description 1
201000007270 liver cancer Diseases 0.000 description 1
230000004807 localization Effects 0.000 description 1
101710028320 ltah-1.1 Proteins 0.000 description 1
201000005202 lung cancer Diseases 0.000 description 1
201000005296 lung carcinoma Diseases 0.000 description 1
230000001926 lymphatic Effects 0.000 description 1
201000000564 macroglobulinemia Diseases 0.000 description 1
230000014759 maintenance of location Effects 0.000 description 1
229950008612 mannomustine Drugs 0.000 description 1
238000005259 measurement Methods 0.000 description 1
210000003071 memory T lymphocyte Anatomy 0.000 description 1
230000003340 mental Effects 0.000 description 1
108091007013 meprins Proteins 0.000 description 1
230000002503 metabolic Effects 0.000 description 1
AWIJRPNMLHPLNC-UHFFFAOYSA-M methanethioate Chemical compound [O-]C=S AWIJRPNMLHPLNC-UHFFFAOYSA-M 0.000 description 1
230000003278 mimic Effects 0.000 description 1
229960005485 mitobronitol Drugs 0.000 description 1
108010042046 mitochondrial processing peptidase Proteins 0.000 description 1
ZAHQPTJLOCWVPG-UHFFFAOYSA-N mitoxantrone dihydrochloride Chemical compound Cl.Cl.O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO ZAHQPTJLOCWVPG-UHFFFAOYSA-N 0.000 description 1
108060005018 mobB Proteins 0.000 description 1
125000002950 monocyclic group Chemical group 0.000 description 1
201000006894 monocytic leukemia Diseases 0.000 description 1
YNAVUWVOSKDBBP-UHFFFAOYSA-N morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
229940113083 morpholine Drugs 0.000 description 1
125000002757 morpholinyl group Chemical group 0.000 description 1
201000009251 multiple myeloma Diseases 0.000 description 1
230000000869 mutational Effects 0.000 description 1
HPNSFSBZBAHARI-RUDMXATFSA-N mycophenolic acid Chemical compound OC1=C(C\C=C(/C)CCC(O)=O)C(OC)=C(C)C2=C1C(=O)OC2 HPNSFSBZBAHARI-RUDMXATFSA-N 0.000 description 1
201000000050 myeloid neoplasm Diseases 0.000 description 1
201000004458 myoma Diseases 0.000 description 1
239000002105 nanoparticle Substances 0.000 description 1
239000005445 natural product Substances 0.000 description 1
229930014626 natural products Natural products 0.000 description 1
201000008026 nephroblastoma Diseases 0.000 description 1
210000004255 neuroglia Anatomy 0.000 description 1
239000003900 neurotrophic factor Substances 0.000 description 1
108010037733 neurotrypsin Proteins 0.000 description 1
QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
MAZYQGHSTXUZJF-ZBRHGPMOSA-N nogalamycin Chemical compound CO[C@@H]1[C@@](O)(C)[C@@H](OC)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=C(O)C=C4[C@]5(C)C[C@H](C[C@@H](O5)CC4=C3C3=O)N(C)C)=C3C=C2[C@@H](C(=O)OC)[C@@](C)(O)C1 MAZYQGHSTXUZJF-ZBRHGPMOSA-N 0.000 description 1
229950009266 nogalamycin Drugs 0.000 description 1
125000006574 non-aromatic ring group Chemical group 0.000 description 1
230000003000 nontoxic Effects 0.000 description 1
231100000252 nontoxic Toxicity 0.000 description 1
201000010133 oligodendroglioma Diseases 0.000 description 1
229940005938 ophthalmologic antiinfectives Sulfonamides Drugs 0.000 description 1
201000008968 osteosarcoma Diseases 0.000 description 1
125000001715 oxadiazolyl group Chemical group 0.000 description 1
125000002971 oxazolyl group Chemical group 0.000 description 1
239000001301 oxygen Substances 0.000 description 1
MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
229940046231 pamidronate Drugs 0.000 description 1
201000010198 papillary carcinoma Diseases 0.000 description 1
230000001575 pathological Effects 0.000 description 1
WBXPDJSOTKVWSJ-ZDUSSCGKSA-N pemetrexed Chemical compound C=1NC=2NC(N)=NC(=O)C=2C=1CCC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 WBXPDJSOTKVWSJ-ZDUSSCGKSA-N 0.000 description 1
229960005079 pemetrexed Drugs 0.000 description 1
230000000149 penetrating Effects 0.000 description 1
230000035515 penetration Effects 0.000 description 1
101700023892 pepA1 Proteins 0.000 description 1
101700006434 pept-1 Proteins 0.000 description 1
108010072633 peptidase 7 Proteins 0.000 description 1
125000001151 peptidyl group Chemical group 0.000 description 1
230000000737 periodic Effects 0.000 description 1
230000002085 persistent Effects 0.000 description 1
239000002831 pharmacologic agent Substances 0.000 description 1
239000012071 phase Substances 0.000 description 1
GYHHZMUNWLCUAH-UHFFFAOYSA-N phenothiazine Chemical compound C1=CC=C2[N]C3=CC=CC=C3SC2=C1 GYHHZMUNWLCUAH-UHFFFAOYSA-N 0.000 description 1
229910052698 phosphorus Inorganic materials 0.000 description 1
OAICVXFJPJFONN-UHFFFAOYSA-N phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
239000011574 phosphorus Substances 0.000 description 1
238000006366 phosphorylation reaction Methods 0.000 description 1
230000000865 phosphorylative Effects 0.000 description 1
230000037081 physical activity Effects 0.000 description 1
230000000704 physical effect Effects 0.000 description 1
GLUUGHFHXGJENI-UHFFFAOYSA-N piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 1
125000004193 piperazinyl group Chemical group 0.000 description 1
NQRYJNQNLNOLGT-UHFFFAOYSA-N piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 1
125000003386 piperidinyl group Chemical group 0.000 description 1
229960000952 pipobroman Drugs 0.000 description 1
229950001100 piposulfan Drugs 0.000 description 1
229960001221 pirarubicin Drugs 0.000 description 1
108010025221 plasma protein Z Proteins 0.000 description 1
150000003057 platinum Chemical class 0.000 description 1
229910052697 platinum Inorganic materials 0.000 description 1
239000002574 poison Substances 0.000 description 1
108010048507 poliovirus receptor Proteins 0.000 description 1
108091008117 polyclonal antibodies Proteins 0.000 description 1
229920001282 polysaccharide Polymers 0.000 description 1
239000005017 polysaccharide Substances 0.000 description 1
150000004804 polysaccharides Polymers 0.000 description 1
230000004492 positive regulation of T cell proliferation Effects 0.000 description 1
229960005205 prednisolone Drugs 0.000 description 1
230000002265 prevention Effects 0.000 description 1
230000000770 pro-inflamatory Effects 0.000 description 1
229960000624 procarbazine Drugs 0.000 description 1
230000003623 progesteronic Effects 0.000 description 1
238000004393 prognosis Methods 0.000 description 1
230000002062 proliferating Effects 0.000 description 1
108010066823 proline dipeptidase Proteins 0.000 description 1
125000006239 protecting group Chemical group 0.000 description 1
238000000159 protein binding assay Methods 0.000 description 1
108020001580 protein domains Proteins 0.000 description 1
230000007055 protein processing involved in protein targeting to mitochondrion Effects 0.000 description 1
230000004850 protein–protein interaction Effects 0.000 description 1
150000003212 purines Chemical class 0.000 description 1
125000003226 pyrazolyl group Chemical group 0.000 description 1
125000000719 pyrrolidinyl group Chemical group 0.000 description 1
125000000168 pyrrolyl group Chemical group 0.000 description 1
SMWDFEZZVXVKRB-UHFFFAOYSA-N quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 1
125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
108020001180 rasD Proteins 0.000 description 1
229960000460 razoxane Drugs 0.000 description 1
239000002464 receptor antagonist Substances 0.000 description 1
238000011084 recovery Methods 0.000 description 1
230000001172 regenerating Effects 0.000 description 1
239000003488 releasing hormone Substances 0.000 description 1
201000010174 renal carcinoma Diseases 0.000 description 1
230000000717 retained Effects 0.000 description 1
230000002207 retinal Effects 0.000 description 1
235000020945 retinal Nutrition 0.000 description 1
239000011604 retinal Substances 0.000 description 1
229930002330 retinoic acid Natural products 0.000 description 1
238000007363 ring formation reaction Methods 0.000 description 1
229960000759 risedronic acid Drugs 0.000 description 1
108010033693 saxagliptin Proteins 0.000 description 1
201000008407 sebaceous adenocarcinoma Diseases 0.000 description 1
230000019491 signal transduction Effects 0.000 description 1
125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
238000009097 single-agent therapy Methods 0.000 description 1
229960004034 sitagliptin Drugs 0.000 description 1
238000003998 size exclusion chromatography high performance liquid chromatography Methods 0.000 description 1
239000001509 sodium citrate Substances 0.000 description 1
239000002904 solvent Substances 0.000 description 1
241000894007 species Species 0.000 description 1
238000011105 stabilization Methods 0.000 description 1
201000011549 stomach cancer Diseases 0.000 description 1
125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
QAOWNCQODCNURD-UHFFFAOYSA-L sulfate Chemical group [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
150000003456 sulfonamides Chemical class 0.000 description 1
150000003871 sulfonates Chemical class 0.000 description 1
NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
239000011593 sulfur Substances 0.000 description 1
150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
230000002195 synergetic Effects 0.000 description 1
231100000057 systemic toxicity Toxicity 0.000 description 1
FQZYTYWMLGAPFJ-OQKDUQJOSA-N tamoxifen citrate Chemical compound [H+].[H+].[H+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O.C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 FQZYTYWMLGAPFJ-OQKDUQJOSA-N 0.000 description 1
229960001674 tegafur Drugs 0.000 description 1
230000002381 testicular Effects 0.000 description 1
125000001113 thiadiazolyl group Chemical group 0.000 description 1
FZWLAAWBMGSTSO-UHFFFAOYSA-N thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
125000000335 thiazolyl group Chemical group 0.000 description 1
150000007970 thio esters Chemical class 0.000 description 1
DUYAAUVXQSMXQP-UHFFFAOYSA-M thioacetate Chemical compound CC([S-])=O DUYAAUVXQSMXQP-UHFFFAOYSA-M 0.000 description 1
125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 1
125000004568 thiomorpholinyl group Chemical group 0.000 description 1
229940026752 topical Sulfonamides Drugs 0.000 description 1
230000002103 transcriptional Effects 0.000 description 1
102000035402 transmembrane proteins Human genes 0.000 description 1
108091005683 transmembrane proteins Proteins 0.000 description 1
LXZZYRPGZAFOLE-UHFFFAOYSA-L transplatin Chemical compound [H][N]([H])([H])[Pt](Cl)(Cl)[N]([H])([H])[H] LXZZYRPGZAFOLE-UHFFFAOYSA-L 0.000 description 1
IUCJMVBFZDHPDX-UHFFFAOYSA-N tretamine Chemical compound C1CN1C1=NC(N2CC2)=NC(N2CC2)=N1 IUCJMVBFZDHPDX-UHFFFAOYSA-N 0.000 description 1
150000003852 triazoles Chemical class 0.000 description 1
125000001425 triazolyl group Chemical group 0.000 description 1
150000003327 trichothecene derivatives Chemical class [H][C@]12O[C@]3([H])[C@H]([*])[C@@H]([*])[C@@](C)(C33CO3)C1(C[*])C([*])C([*])C(C)=C2 0.000 description 1
229930013292 trichothecenes Natural products 0.000 description 1
239000011778 trisodium citrate Substances 0.000 description 1
229960001322 trypsin Drugs 0.000 description 1
239000012588 trypsin Substances 0.000 description 1
230000001810 trypsinlike Effects 0.000 description 1
230000000381 tumorigenic Effects 0.000 description 1
239000005483 tyrosine kinase inhibitor Substances 0.000 description 1
150000004917 tyrosine kinase inhibitor derivatives Chemical class 0.000 description 1
229940121358 tyrosine kinase inhibitors Drugs 0.000 description 1
150000003668 tyrosines Chemical class 0.000 description 1
230000002792 vascular Effects 0.000 description 1
239000002525 vasculotropin inhibitor Substances 0.000 description 1
230000000982 vasogenic Effects 0.000 description 1
229960001254 vildagliptin Drugs 0.000 description 1
KDQAABAKXDWYSZ-JKDPCDLQSA-N vincaleukoblastine sulfate Chemical compound OS(O)(=O)=O.C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 KDQAABAKXDWYSZ-JKDPCDLQSA-N 0.000 description 1
229960002066 vinorelbine Drugs 0.000 description 1
CILBMBUYJCWATM-IJDPFCGHSA-N vinorelbine L-tartrate Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O.OC(=O)[C@H](O)[C@@H](O)C(O)=O.C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC CILBMBUYJCWATM-IJDPFCGHSA-N 0.000 description 1
238000005406 washing Methods 0.000 description 1
230000029663 wound healing Effects 0.000 description 1
MNFORVFSTILPAW-UHFFFAOYSA-N Β-Lactam Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 1

JP2020567774A 2018-06-04 2019-06-04 腫瘍微小環境活性化薬物・結合剤コンジュゲート、及びそれに関連する使用 Pending JP2021527042A (ja)