JPS6256850B2 - - Google Patents
Info
- Publication number
- JPS6256850B2 JPS6256850B2 JP53090043A JP9004378A JPS6256850B2 JP S6256850 B2 JPS6256850 B2 JP S6256850B2 JP 53090043 A JP53090043 A JP 53090043A JP 9004378 A JP9004378 A JP 9004378A JP S6256850 B2 JPS6256850 B2 JP S6256850B2
- Authority
- JP
- Japan
- Prior art keywords
- formula
- nitro
- group
- onium salt
- trifluoromethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 36
- 238000000034 method Methods 0.000 claims description 34
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 10
- ZOQOPXVJANRGJZ-UHFFFAOYSA-N 2-(trifluoromethyl)phenol Chemical compound OC1=CC=CC=C1C(F)(F)F ZOQOPXVJANRGJZ-UHFFFAOYSA-N 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 9
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 125000000623 heterocyclic group Chemical group 0.000 claims description 6
- 125000004429 atom Chemical group 0.000 claims description 5
- 125000005842 heteroatom Chemical group 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 230000001476 alcoholic effect Effects 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 claims description 3
- 150000002500 ions Chemical class 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 3
- 150000004714 phosphonium salts Chemical class 0.000 claims description 3
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 3
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 3
- 239000003431 cross linking reagent Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- 239000000203 mixture Substances 0.000 description 17
- 239000000243 solution Substances 0.000 description 15
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- -1 methoxy compound Chemical class 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- XZEDEVRSUANQEM-UHFFFAOYSA-N 2-nitro-4-(trifluoromethyl)phenol Chemical compound OC1=CC=C(C(F)(F)F)C=C1[N+]([O-])=O XZEDEVRSUANQEM-UHFFFAOYSA-N 0.000 description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 125000000962 organic group Chemical group 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- YMBCJWGVCUEGHA-UHFFFAOYSA-M tetraethylammonium chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC YMBCJWGVCUEGHA-UHFFFAOYSA-M 0.000 description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 3
- TZGFQIXRVUHDLE-UHFFFAOYSA-N 1-chloro-2-nitro-4-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=CC=C1Cl TZGFQIXRVUHDLE-UHFFFAOYSA-N 0.000 description 3
- HQROXDLWVGFPDE-UHFFFAOYSA-N 1-chloro-4-nitro-2-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(C(F)(F)F)=C1 HQROXDLWVGFPDE-UHFFFAOYSA-N 0.000 description 3
- NDZJSUCUYPZXPR-UHFFFAOYSA-N 1-nitro-2-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC=CC=C1C(F)(F)F NDZJSUCUYPZXPR-UHFFFAOYSA-N 0.000 description 3
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 3
- GWGZFNRFNIXCGH-UHFFFAOYSA-N 4-nitro-2-(trifluoromethyl)benzenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1C(F)(F)F GWGZFNRFNIXCGH-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- JBIROUFYLSSYDX-UHFFFAOYSA-M benzododecinium chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 JBIROUFYLSSYDX-UHFFFAOYSA-M 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000004009 herbicide Substances 0.000 description 3
- 239000013067 intermediate product Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- FZHCKUHPOZBPHB-UHFFFAOYSA-N 1,2-dichloro-3-nitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=CC(Cl)=C1Cl FZHCKUHPOZBPHB-UHFFFAOYSA-N 0.000 description 2
- KGFADEJSZXEVMC-UHFFFAOYSA-N 1-methoxy-4-nitro-2-(trifluoromethyl)benzene Chemical compound COC1=CC=C([N+]([O-])=O)C=C1C(F)(F)F KGFADEJSZXEVMC-UHFFFAOYSA-N 0.000 description 2
- PSRPKTROFCUEOD-UHFFFAOYSA-N 2-chloro-3-nitro-5-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC(C(F)(F)F)=CC([N+]([O-])=O)=C1Cl PSRPKTROFCUEOD-UHFFFAOYSA-N 0.000 description 2
- IPYLMZRACSULIH-UHFFFAOYSA-N 2-chloro-5-nitro-3-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC(C(F)(F)F)=C1Cl IPYLMZRACSULIH-UHFFFAOYSA-N 0.000 description 2
- GAZOASPEAVAGAU-UHFFFAOYSA-N 2-chloro-6-nitro-4-(trifluoromethyl)phenol Chemical compound OC1=C(Cl)C=C(C(F)(F)F)C=C1[N+]([O-])=O GAZOASPEAVAGAU-UHFFFAOYSA-N 0.000 description 2
- BEFJANXIJAXYRJ-UHFFFAOYSA-N 2-hydroxy-5-nitro-3-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC(C(F)(F)F)=C1O BEFJANXIJAXYRJ-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003444 phase transfer catalyst Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 2
- IBWGNZVCJVLSHB-UHFFFAOYSA-M tetrabutylphosphanium;chloride Chemical compound [Cl-].CCCC[P+](CCCC)(CCCC)CCCC IBWGNZVCJVLSHB-UHFFFAOYSA-M 0.000 description 2
- CVEZLEUJNKTWOB-UHFFFAOYSA-M 1,1-dibutylpiperidin-1-ium;bromide Chemical compound [Br-].CCCC[N+]1(CCCC)CCCCC1 CVEZLEUJNKTWOB-UHFFFAOYSA-M 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- DPOBIBPWXIPEHF-UHFFFAOYSA-N 1,2-dichloro-5-nitro-3-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(Cl)=C(Cl)C(C(F)(F)F)=C1 DPOBIBPWXIPEHF-UHFFFAOYSA-N 0.000 description 1
- VLVNHMVSVDVAOA-UHFFFAOYSA-N 1,5-dichloro-2-nitro-4-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=C(Cl)C=C1Cl VLVNHMVSVDVAOA-UHFFFAOYSA-N 0.000 description 1
- KZGHFILDOPGINM-UHFFFAOYSA-M 1-benzyl-1-methylpiperidin-1-ium;hydroxide Chemical compound [OH-].C=1C=CC=CC=1C[N+]1(C)CCCCC1 KZGHFILDOPGINM-UHFFFAOYSA-M 0.000 description 1
- PESPBNYBZVIGRO-UHFFFAOYSA-N 1-bromo-2-nitro-4-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=CC=C1Br PESPBNYBZVIGRO-UHFFFAOYSA-N 0.000 description 1
- SXEQQBBOAMHOID-UHFFFAOYSA-N 1-bromo-4-nitro-2-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC=C(Br)C(C(F)(F)F)=C1 SXEQQBBOAMHOID-UHFFFAOYSA-N 0.000 description 1
- OIMZVJUBJXJIQO-UHFFFAOYSA-M 1-butyl-1-methylpiperidin-1-ium;chloride Chemical compound [Cl-].CCCC[N+]1(C)CCCCC1 OIMZVJUBJXJIQO-UHFFFAOYSA-M 0.000 description 1
- ZECBOHAXBNGMSP-UHFFFAOYSA-N 1-chloro-2-nitro-3-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=C(Cl)C=CC=C1C(F)(F)F ZECBOHAXBNGMSP-UHFFFAOYSA-N 0.000 description 1
- IQINJIIPYDIFFF-UHFFFAOYSA-N 1-chloro-5-methoxy-2-nitro-4-(trifluoromethyl)benzene Chemical compound COC1=CC(Cl)=C([N+]([O-])=O)C=C1C(F)(F)F IQINJIIPYDIFFF-UHFFFAOYSA-N 0.000 description 1
- RPMVCORTTKCGQU-UHFFFAOYSA-M 1-ethyl-1-methylpiperidin-1-ium;bromide Chemical compound [Br-].CC[N+]1(C)CCCCC1 RPMVCORTTKCGQU-UHFFFAOYSA-M 0.000 description 1
- ZDGMUMYTECMUEP-UHFFFAOYSA-N 2-chloro-1-methoxy-5-nitro-3-(trifluoromethyl)benzene Chemical compound COC1=CC([N+]([O-])=O)=CC(C(F)(F)F)=C1Cl ZDGMUMYTECMUEP-UHFFFAOYSA-N 0.000 description 1
- HVGBLBWQDJLOQT-UHFFFAOYSA-N 2-chloro-4-nitro-6-(trifluoromethyl)phenol Chemical compound OC1=C(Cl)C=C([N+]([O-])=O)C=C1C(F)(F)F HVGBLBWQDJLOQT-UHFFFAOYSA-N 0.000 description 1
- RUASQOAEBVHEHE-UHFFFAOYSA-N 2-hydroxy-3-nitro-5-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC(C(F)(F)F)=CC([N+]([O-])=O)=C1O RUASQOAEBVHEHE-UHFFFAOYSA-N 0.000 description 1
- FMPKXGYPBUWNNG-UHFFFAOYSA-N 2-nitro-6-(trifluoromethyl)phenol Chemical compound OC1=C([N+]([O-])=O)C=CC=C1C(F)(F)F FMPKXGYPBUWNNG-UHFFFAOYSA-N 0.000 description 1
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 1
- IDLIMVJATJRKPZ-UHFFFAOYSA-N 4-chloro-2-nitro-6-(trifluoromethyl)phenol Chemical compound OC1=C([N+]([O-])=O)C=C(Cl)C=C1C(F)(F)F IDLIMVJATJRKPZ-UHFFFAOYSA-N 0.000 description 1
- CQYPDXUWXKXLSD-UHFFFAOYSA-N 5-methoxy-2-nitro-4-(trifluoromethyl)phenol Chemical compound COC1=CC(O)=C([N+]([O-])=O)C=C1C(F)(F)F CQYPDXUWXKXLSD-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 241000199911 Peridinium Species 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229960001716 benzalkonium Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- CHQVQXZFZHACQQ-UHFFFAOYSA-M benzyl(triethyl)azanium;bromide Chemical compound [Br-].CC[N+](CC)(CC)CC1=CC=CC=C1 CHQVQXZFZHACQQ-UHFFFAOYSA-M 0.000 description 1
- WTEPWWCRWNCUNA-UHFFFAOYSA-M benzyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)CC1=CC=CC=C1 WTEPWWCRWNCUNA-UHFFFAOYSA-M 0.000 description 1
- QLRKASHXFNIPLZ-UHFFFAOYSA-M benzyl-dimethyl-phenylazanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[N+](C)(C)CC1=CC=CC=C1 QLRKASHXFNIPLZ-UHFFFAOYSA-M 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- USJRLGNYCQWLPF-UHFFFAOYSA-N chlorophosphane Chemical group ClP USJRLGNYCQWLPF-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- AIDQOWOCUYDWFA-UHFFFAOYSA-M cyclohexyl-dodecyl-dimethylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C1CCCCC1 AIDQOWOCUYDWFA-UHFFFAOYSA-M 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JVQOASIPRRGMOS-UHFFFAOYSA-M dodecyl(trimethyl)azanium;hydroxide Chemical compound [OH-].CCCCCCCCCCCC[N+](C)(C)C JVQOASIPRRGMOS-UHFFFAOYSA-M 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 230000001546 nitrifying effect Effects 0.000 description 1
- HVZWVEKIQMJYIK-UHFFFAOYSA-N nitryl chloride Chemical compound [O-][N+](Cl)=O HVZWVEKIQMJYIK-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004010 onium ions Chemical group 0.000 description 1
- 150000002891 organic anions Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical group O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical compound OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000006104 solid solution Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- ICTMDIORIDZWQN-UHFFFAOYSA-M triethyl(phenyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)C1=CC=CC=C1 ICTMDIORIDZWQN-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/12—Preparation of nitro compounds by reactions not involving the formation of nitro groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772733682 DE2733682A1 (de) | 1977-07-26 | 1977-07-26 | Verfahren zur herstellung von trifluormethylphenolen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5424839A JPS5424839A (en) | 1979-02-24 |
| JPS6256850B2 true JPS6256850B2 (enExample) | 1987-11-27 |
Family
ID=6014871
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP9004378A Granted JPS5424839A (en) | 1977-07-26 | 1978-07-25 | Process for preparing trifluoromethylphenol |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4225731A (enExample) |
| EP (1) | EP0000542B1 (enExample) |
| JP (1) | JPS5424839A (enExample) |
| DE (2) | DE2733682A1 (enExample) |
| DK (1) | DK154949C (enExample) |
| IL (1) | IL55209A (enExample) |
| IT (1) | IT1105942B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4400552A (en) * | 1980-04-21 | 1983-08-23 | The Franklin Institute | Method for decomposition of halogenated organic compounds |
| US4460797A (en) * | 1981-03-05 | 1984-07-17 | The Franklin Institute | Method for decomposition of halogenated organic compounds |
| DE3120912A1 (de) * | 1981-05-26 | 1982-12-16 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von p-nitrophenetol |
| FR2529197A1 (fr) * | 1982-06-29 | 1983-12-30 | Rhone Poulenc Agrochimie | Procede de preparation de phenates substitues par des groupes halogenes ou des phenols correspondants |
| US4602994A (en) * | 1982-09-30 | 1986-07-29 | The Franklin Institute | Removal of PCBs and other halogenated organic compounds from organic fluids |
| US4417977A (en) * | 1982-09-30 | 1983-11-29 | The Franklin Institute | Removal of PCBS and other halogenated organic compounds from organic fluids |
| HU190439B (en) * | 1983-02-03 | 1986-09-29 | Budapesti Vegyimuevek,Hu | Herbicidal, akaricidal and plant growth regulating compsitions comprising 2-/trifluoromethyl/-4,6-dinitrophenol or its salts as active substance and process for preparing the active substances |
| GB8708517D0 (en) * | 1987-04-09 | 1987-05-13 | Shell Int Research | Preparation of fluorophenols |
| DE3712817A1 (de) * | 1987-04-15 | 1988-10-27 | Bayer Ag | Verwendung von fluormethylphenolen als loesungsmittel fuer lc-polymere, und neue fluormethylphenole |
| ES2083048T3 (es) * | 1991-10-09 | 1996-04-01 | Hoechst Ag | Procedimiento para fabricar 2-nitro-5-fluoro- o bien -5-cloro-fenol. |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB718779A (en) * | 1952-01-05 | 1954-11-17 | Pechney Cie De Prod Chim Et El | Process for manufacturing pentachlorophenol and alkali pentachlorophenates |
| US2872461A (en) * | 1954-10-21 | 1959-02-03 | Schering Ag | Process of producing chloranil |
| US2950325A (en) * | 1958-06-06 | 1960-08-23 | Dow Chemical Co | Process for making fluorophenols |
| BE635553A (enExample) * | 1962-07-30 | |||
| FR1469596A (fr) * | 1966-01-06 | 1967-02-17 | Saint Gobain | Procédé de préparation du para-trifluorméthylphénol |
| US3813446A (en) * | 1968-06-24 | 1974-05-28 | Sherwin Williams Co | Production of trifluoromethylnitrophenols and related compounds |
| US3943180A (en) * | 1972-02-29 | 1976-03-09 | Bayer Aktiengesellschaft | 2,4-Bis-(trifluoromethyl)-6-nitrophenol compounds and herbicidal compositions |
-
1977
- 1977-07-26 DE DE19772733682 patent/DE2733682A1/de not_active Withdrawn
-
1978
- 1978-07-13 US US05/924,474 patent/US4225731A/en not_active Expired - Lifetime
- 1978-07-19 EP EP78100436A patent/EP0000542B1/de not_active Expired
- 1978-07-19 DE DE7878100436T patent/DE2860838D1/de not_active Expired
- 1978-07-24 IT IT50434/78A patent/IT1105942B/it active
- 1978-07-24 IL IL55209A patent/IL55209A/xx unknown
- 1978-07-25 JP JP9004378A patent/JPS5424839A/ja active Granted
- 1978-07-25 DK DK330178A patent/DK154949C/da not_active IP Right Cessation
Non-Patent Citations (1)
| Title |
|---|
| J. ORG. CHEM.=1971 * |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2860838D1 (en) | 1981-10-22 |
| EP0000542A1 (de) | 1979-02-07 |
| DK330178A (da) | 1979-01-27 |
| DE2733682A1 (de) | 1979-02-08 |
| IT7850434A0 (it) | 1978-07-24 |
| IT1105942B (it) | 1985-11-11 |
| EP0000542B1 (de) | 1981-07-15 |
| DK154949C (da) | 1989-05-29 |
| IL55209A (en) | 1983-02-23 |
| IL55209A0 (en) | 1978-09-29 |
| US4225731A (en) | 1980-09-30 |
| DK154949B (da) | 1989-01-09 |
| JPS5424839A (en) | 1979-02-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP5996647B2 (ja) | 4−置換イミダゾールの新規な調製プロセス | |
| JPS6256850B2 (enExample) | ||
| JP2007231022A (ja) | ハロゲン化触媒としてのn,n−ジ置換ホルムアミドの使用 | |
| JPH0442065B2 (enExample) | ||
| EP0129528A1 (en) | Process for the preparation of nitro-substituted benzotrifluoride compounds | |
| US4078008A (en) | Process for the preparation of dienes | |
| CN113272286B (zh) | 制备4-(2,2,3,3-四氟丙基)吗啉的方法 | |
| US3155733A (en) | Aryloxyarylthioalkenyl ethers | |
| EP0778260B1 (en) | Process for racemization of optically active 1-phenylethylamine derivatives | |
| JPS6045631B2 (ja) | フエニルグリオキザル酸エステの製造法 | |
| KR20170108080A (ko) | 메데토미딘의 합성에서 유용한 3-아릴부탄알과 같은 화합물의 제조 방법 | |
| US5705674A (en) | Process for preparing ortho-nitrobenzonitriles | |
| NO139782B (no) | Fremgangsmaate til fremstilling av derivater av 3-benzoylfenyleddiksyre eller 2-(3-benzoylfenyl)-propionsyre | |
| JPH0535145B2 (enExample) | ||
| EP0010856B1 (en) | Halogenated hydrocarbons and a method for their preparation | |
| US3246040A (en) | Di (alkylthio) ether | |
| JP4709741B2 (ja) | ピリジン−置換アミノケタール誘導体の製造法 | |
| JPS6097920A (ja) | 置換1‐フエニルインダンの製造方法 | |
| US3322780A (en) | alpha-(acinitromethyl)- and alpha-(nitromethyl)-2, 1, 3-benzothiadiazole-methanol compounds | |
| US2416974A (en) | Manufacture of mono-nitration products of toluene | |
| SE509040C2 (sv) | Förestringsförfarande som använder tillsats av alkanol under ytan | |
| JP2003342208A (ja) | ハロゲノスチレン誘導体の製造方法 | |
| JPH0576473B2 (enExample) | ||
| JPS6364429B2 (enExample) | ||
| JPH0584298B2 (enExample) |