JPS6162040A - 電子写真用感光体 - Google Patents
電子写真用感光体Info
- Publication number
- JPS6162040A JPS6162040A JP18372184A JP18372184A JPS6162040A JP S6162040 A JPS6162040 A JP S6162040A JP 18372184 A JP18372184 A JP 18372184A JP 18372184 A JP18372184 A JP 18372184A JP S6162040 A JPS6162040 A JP S6162040A
- Authority
- JP
- Japan
- Prior art keywords
- charge transport
- polycarbonate resin
- layer
- transport layer
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 229920000642 polymer Polymers 0.000 claims abstract description 22
- 239000011230 binding agent Substances 0.000 claims abstract description 16
- 239000004431 polycarbonate resin Substances 0.000 claims abstract description 15
- 229920005668 polycarbonate resin Polymers 0.000 claims abstract description 14
- 125000005843 halogen group Chemical group 0.000 claims abstract description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 6
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 3
- 108091008695 photoreceptors Proteins 0.000 claims description 25
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 229930185605 Bisphenol Natural products 0.000 abstract description 14
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 abstract description 14
- 238000000576 coating method Methods 0.000 abstract description 14
- 239000011248 coating agent Substances 0.000 abstract description 13
- 229920000515 polycarbonate Polymers 0.000 abstract description 12
- 239000004417 polycarbonate Substances 0.000 abstract description 12
- 239000002904 solvent Substances 0.000 abstract description 12
- 238000002425 crystallisation Methods 0.000 abstract description 5
- 230000008025 crystallization Effects 0.000 abstract description 5
- 238000002156 mixing Methods 0.000 abstract description 4
- 229920005989 resin Polymers 0.000 abstract description 3
- 239000011347 resin Substances 0.000 abstract description 3
- 239000010410 layer Substances 0.000 description 49
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 239000000463 material Substances 0.000 description 11
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- -1 polyethylene terephthalate Polymers 0.000 description 3
- 229920000139 polyethylene terephthalate Polymers 0.000 description 3
- 239000005020 polyethylene terephthalate Substances 0.000 description 3
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 2
- PLAZXGNBGZYJSA-UHFFFAOYSA-N 9-ethylcarbazole Chemical compound C1=CC=C2N(CC)C3=CC=CC=C3C2=C1 PLAZXGNBGZYJSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 238000005452 bending Methods 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 230000005525 hole transport Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- BBEAQIROQSPTKN-UHFFFAOYSA-N pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 238000007740 vapor deposition Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- NGXPSFCDNMDGCI-UHFFFAOYSA-N 2-chloro-n-[4-[4-(n-(2-chlorophenyl)anilino)phenyl]phenyl]-n-phenylaniline Chemical compound ClC1=CC=CC=C1N(C=1C=CC(=CC=1)C=1C=CC(=CC=1)N(C=1C=CC=CC=1)C=1C(=CC=CC=1)Cl)C1=CC=CC=C1 NGXPSFCDNMDGCI-UHFFFAOYSA-N 0.000 description 1
- QACPCJGYSAXOKW-UHFFFAOYSA-N 2-ethyl-n-[4-[4-(n-(2-ethylphenyl)anilino)phenyl]phenyl]-n-phenylaniline Chemical compound CCC1=CC=CC=C1N(C=1C=CC(=CC=1)C=1C=CC(=CC=1)N(C=1C=CC=CC=1)C=1C(=CC=CC=1)CC)C1=CC=CC=C1 QACPCJGYSAXOKW-UHFFFAOYSA-N 0.000 description 1
- QNXWZWDKCBKRKK-UHFFFAOYSA-N 2-methyl-n-[4-[4-(n-(2-methylphenyl)anilino)phenyl]phenyl]-n-phenylaniline Chemical compound CC1=CC=CC=C1N(C=1C=CC(=CC=1)C=1C=CC(=CC=1)N(C=1C=CC=CC=1)C=1C(=CC=CC=1)C)C1=CC=CC=C1 QNXWZWDKCBKRKK-UHFFFAOYSA-N 0.000 description 1
- FZFWUYVLUXMWPM-UHFFFAOYSA-N 2-propan-2-yl-n-[4-[4-(2-propan-2-ylanilino)phenyl]phenyl]aniline Chemical compound CC(C)C1=CC=CC=C1NC1=CC=C(C=2C=CC(NC=3C(=CC=CC=3)C(C)C)=CC=2)C=C1 FZFWUYVLUXMWPM-UHFFFAOYSA-N 0.000 description 1
- AWQHGWADSJKKEZ-UHFFFAOYSA-N 2-tert-butyl-n-[4-[4-(n-(2-tert-butylphenyl)anilino)phenyl]phenyl]-n-phenylaniline Chemical compound CC(C)(C)C1=CC=CC=C1N(C=1C=CC(=CC=1)C=1C=CC(=CC=1)N(C=1C=CC=CC=1)C=1C(=CC=CC=1)C(C)(C)C)C1=CC=CC=C1 AWQHGWADSJKKEZ-UHFFFAOYSA-N 0.000 description 1
- LSZJZNNASZFXKN-UHFFFAOYSA-N 9-propan-2-ylcarbazole Chemical compound C1=CC=C2N(C(C)C)C3=CC=CC=C3C2=C1 LSZJZNNASZFXKN-UHFFFAOYSA-N 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920004011 Macrolon® Polymers 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920002433 Vinyl chloride-vinyl acetate copolymer Polymers 0.000 description 1
- 239000012790 adhesive layer Substances 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthrene Natural products C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 229910003437 indium oxide Inorganic materials 0.000 description 1
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- GSAIMWRAOAAKKF-UHFFFAOYSA-N n-phenyl-2-propyl-n-[4-[4-(n-(2-propylphenyl)anilino)phenyl]phenyl]aniline Chemical compound CCCC1=CC=CC=C1N(C=1C=CC(=CC=1)C=1C=CC(=CC=1)N(C=1C=CC=CC=1)C=1C(=CC=CC=1)CCC)C1=CC=CC=C1 GSAIMWRAOAAKKF-UHFFFAOYSA-N 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920001470 polyketone Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- WVIICGIFSIBFOG-UHFFFAOYSA-N pyrylium Chemical class C1=CC=[O+]C=C1 WVIICGIFSIBFOG-UHFFFAOYSA-N 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000004544 sputter deposition Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- NLDYACGHTUPAQU-UHFFFAOYSA-N tetracyanoethylene Chemical group N#CC(C#N)=C(C#N)C#N NLDYACGHTUPAQU-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- ANRHNWWPFJCPAZ-UHFFFAOYSA-M thionine Chemical compound [Cl-].C1=CC(N)=CC2=[S+]C3=CC(N)=CC=C3N=C21 ANRHNWWPFJCPAZ-UHFFFAOYSA-M 0.000 description 1
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/05—Organic bonding materials; Methods for coating a substrate with a photoconductive layer; Inert supplements for use in photoconductive layers
- G03G5/0528—Macromolecular bonding materials
- G03G5/0557—Macromolecular bonding materials obtained otherwise than by reactions only involving carbon-to-carbon unsatured bonds
- G03G5/0564—Polycarbonates
Landscapes
- Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Spectroscopy & Molecular Physics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP18372184A JPS6162040A (ja) | 1984-09-04 | 1984-09-04 | 電子写真用感光体 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP18372184A JPS6162040A (ja) | 1984-09-04 | 1984-09-04 | 電子写真用感光体 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS6162040A true JPS6162040A (ja) | 1986-03-29 |
| JPH0349426B2 JPH0349426B2 (cs) | 1991-07-29 |
Family
ID=16140795
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP18372184A Granted JPS6162040A (ja) | 1984-09-04 | 1984-09-04 | 電子写真用感光体 |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS6162040A (cs) |
Cited By (102)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH02222415A (ja) * | 1988-12-23 | 1990-09-05 | Bayer Ag | 熱可塑性芳香族ポリカーボネート |
| US5034458A (en) * | 1989-08-22 | 1991-07-23 | Bayer Aktiengesellschaft | Polycarbonates of substituted cyclohexylindenebisphenols |
| US5034457A (en) * | 1989-03-11 | 1991-07-23 | Bayer Aktiengesellschaft | Thermoplastic blends containing polycarbonates based on substituted cyclohexylidenebisphenols |
| EP0387596A3 (de) * | 1989-03-11 | 1992-07-08 | Bayer Ag | Thermoplastische Legierungen mit Polycarbonaten auf Basis n-alkyl-substituierter Cyclohexylidenbisphenole |
| US5254423A (en) * | 1991-10-17 | 1993-10-19 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member, and electrophotographic apparatus, device unit and facsimile machine having the photosensitive member |
| US5418099A (en) * | 1992-05-19 | 1995-05-23 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member, and electrophotographic apparatus and device unit employing the same |
| EP0701175A1 (en) | 1994-08-11 | 1996-03-13 | Fuji Electric Co., Ltd. | Electrophotographic photosensitive material |
| EP0702050A1 (de) | 1994-08-19 | 1996-03-20 | Bayer Ag | Verfahren zur Reduzierung des Oligokondensatanteils von Polykondensaten |
| EP0703263A1 (de) | 1994-08-22 | 1996-03-27 | Bayer Ag | Verfahren zur Herstellung von UV-stabilen Polycarbonaten |
| EP0709442A2 (de) | 1994-10-28 | 1996-05-01 | Bayer Ag | UV-geschützte, beschichtete Polycarbonatformkörper |
| EP0783020A1 (de) | 1995-12-05 | 1997-07-09 | Bayer Ag | Verwendung von Carbonaten als Entformungsmittel für thermoplastische Polycarbonate |
| US6001523A (en) * | 1998-10-29 | 1999-12-14 | Lexmark International, Inc. | Electrophotographic photoconductors |
| US7074351B2 (en) | 2000-05-05 | 2006-07-11 | Leibniz-Institut Fur Neue Materialien Gem. Gmbh | IR-absorbing compositions |
| US7169834B2 (en) | 2000-02-11 | 2007-01-30 | Leibniz-Institut Fuer Neue Materialien Gemeinnuetzige Gmbh | IR absorbing compositions |
| US7449271B2 (en) | 2003-10-08 | 2008-11-11 | Fuji Electric Device Technology Co., Ltd. | Electrophotographic photoconductor and methods therefor |
| US7534539B2 (en) | 2003-06-03 | 2009-05-19 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image forming apparatus having the same |
| DE102007061760A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polyalkylenterephthalat/Polycarbonat-Zusammensetzungen |
| DE102008016260A1 (de) | 2008-03-29 | 2009-10-01 | Bayer Materialscience Ag | Schlagzähmodifizierte Polyalkylenterephthalat/Polycarbonat-Zusammensetzungen |
| US7803507B2 (en) | 2003-02-07 | 2010-09-28 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image forming apparatus including the same |
| DE102009058200A1 (de) | 2009-12-15 | 2011-06-16 | Bayer Materialscience Ag | Polymer-Zusammensetzung mit Wärme-absorbierenden Eigenschaften und hoher Stabilität |
| DE102009058462A1 (de) | 2009-12-16 | 2011-06-22 | Bayer MaterialScience AG, 51373 | Polycarbonat mit erhöhter Transmission und bakterizider Wirksamkeit |
| DE102010013991A1 (de) | 2010-04-07 | 2011-10-13 | Bayer Materialscience Ag | Flammgeschützte Polycarbonat-Zusammensetzungen |
| WO2011141365A1 (de) | 2010-05-10 | 2011-11-17 | Bayer Materialscience Ag | Stabilisatorzusammensetzungen |
| WO2011141366A1 (de) | 2010-05-10 | 2011-11-17 | Bayer Materialscience Ag | Polymer-zusammensetzung mit wärme-absorbierenden eigenschaften und verbesserten farbeigenschaften |
| WO2011141368A1 (de) | 2010-05-10 | 2011-11-17 | Bayer Materialscience Ag | Polymer-zusammensetzung mit wärme-absorbierenden eigenschaften und hoher stabilität |
| WO2011141369A1 (de) | 2010-05-10 | 2011-11-17 | Bayer Materialscience Ag | Polymer-zusammensetzung mit wärme-absorbierenden eigenschaften und verbesserten farbeigenschaften |
| DE102010027239A1 (de) | 2010-07-15 | 2012-01-19 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Verfahren zur Beschichtung eines Substrates mit einer Schutzschicht, beschichtetes Substrat, elektronisches Bauteil sowie Verwendungszwecke |
| WO2012080397A2 (de) | 2010-12-17 | 2012-06-21 | Bayer Materialscience Ag | Polymer-zusammensetzung mit wärme-absorbierenden eigenschaften und hoher stabilität gegen bewitterung |
| WO2012080395A1 (de) | 2010-12-17 | 2012-06-21 | Bayer Materialscience Ag | Polymer-zusammensetzung mit wärme-absorbierenden eigenschaften und hoher stabilität gegen bewitterung |
| WO2012080396A1 (de) | 2010-12-17 | 2012-06-21 | Bayer Materialscience Ag | Farbstabile led-substrate |
| WO2012172372A1 (en) | 2011-06-17 | 2012-12-20 | Colormatrix Holdings, Inc. | Polymeric materials |
| WO2013020982A1 (de) | 2011-08-08 | 2013-02-14 | Bayer Intellectual Property Gmbh | Gefüllte polymerzusammensetzung und coextrudierte platte erhältlich hieraus |
| US8404414B2 (en) | 2008-04-30 | 2013-03-26 | Fuji Electric Co., Ltd. | Electrophotographic photoconductor and manufacturing method thereof |
| WO2013045552A1 (de) | 2011-09-28 | 2013-04-04 | Bayer Intellectual Property Gmbh | Polycarbonat mit glasfasern |
| WO2013057074A1 (de) | 2011-10-18 | 2013-04-25 | Bayer Intellectual Property Gmbh | Polymer-zusammensetzung mit wärme-absorbierenden eigenschaften |
| WO2013079630A1 (de) | 2011-11-30 | 2013-06-06 | Bayer Intellectual Property Gmbh | Ethylen-alkyl(meth)acrylat-block-copolymere als schlagzahmodifikator in glasfaserverstärkten flammgeschützten polycarbonaten für den ee-bereich |
| WO2013079599A1 (de) | 2011-11-30 | 2013-06-06 | Bayer Intellectual Property Gmbh | Polycarbonatzusammensetzungen mit verbesserter oberfläche |
| US8597864B2 (en) | 2009-02-16 | 2013-12-03 | Fuji Electric Co., Ltd. | Photoreceptor for electrophotography, process for producing the same, and electrophotographic apparatus |
| US8703370B2 (en) | 2010-01-29 | 2014-04-22 | Fuji Electric Co., Ltd. | Electrophotographic photoreceptor, manufacturing method therefor and electrophotographic device |
| KR20140131503A (ko) | 2012-02-28 | 2014-11-13 | 후지 덴키 가부시키가이샤 | 전자사진용 감광체, 그 제조 방법 및 전자사진 장치, 및 공중합 폴리아릴레이트 수지의 제조 방법 |
| US9212272B2 (en) | 2010-12-17 | 2015-12-15 | Bayer Materialscience Ag | Organic colouring agents and coloured polymer compositions with a high stability to weathering |
| EP3020752A1 (de) | 2014-11-17 | 2016-05-18 | LANXESS Deutschland GmbH | Flammgeschützte Faser-Matrix-Halbzeuge |
| WO2016087296A1 (de) | 2014-12-01 | 2016-06-09 | Covestro Deutschland Ag | Gefüllte polycarbonatzusammensetzungen mit verbesserter fliessfähigkeit und hoher steifigkeit |
| WO2016087295A1 (de) | 2014-12-01 | 2016-06-09 | Covestro Deutschland Ag | Verbesserung der fliessfähigkeit von polycarbonatzusammensetzungen |
| KR20160103970A (ko) | 2013-12-27 | 2016-09-02 | 후지 덴키 가부시키가이샤 | 전자 사진용 감광체, 그 제조방법 및 전자 사진 장치 |
| EP3115417A1 (de) | 2015-07-08 | 2017-01-11 | Covestro Deutschland AG | Schlagzähmodifizierte polycarbonatzusammensetzungen mit verbesserter fliessfähigkeit und hoher wärmeformbeständigkeit |
| EP3115408A1 (de) | 2015-07-08 | 2017-01-11 | Covestro Deutschland AG | Verbesserung der fliessfähigkeit von thermisch leitfähigen polycarbonatzusammensetzungen |
| WO2017072053A1 (de) | 2015-10-26 | 2017-05-04 | Covestro Deutschland Ag | Mehrschichtiger faserverbundwerkstoff |
| WO2017072054A1 (de) | 2015-10-26 | 2017-05-04 | Covestro Deutschland Ag | Mehrschichtiger faserverbundwerkstoff |
| US9665019B2 (en) | 2013-07-16 | 2017-05-30 | Fuji Electric Co., Ltd. | Electrophotographic photoconductor, production method thereof, and electrophotographic apparatus |
| WO2017178583A1 (de) | 2016-04-14 | 2017-10-19 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen enthaltend isosorbiddiester. |
| EP3243652A1 (de) | 2016-05-11 | 2017-11-15 | Covestro Deutschland AG | Thermoplastischer träger/glas-verbund |
| WO2017198808A1 (de) | 2016-05-19 | 2017-11-23 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen enthaltend eine carbonsäure und deren glycerol- oder diglycerolester |
| WO2017202751A1 (de) | 2016-05-24 | 2017-11-30 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen enthaltend füllstoffe, eine carbonsäure und deren glycerol- oder diglycerolester |
| WO2018037037A1 (de) | 2016-08-24 | 2018-03-01 | Covestro Deutschland Ag | Polycarbonatzusammensetzung umfassend talk |
| WO2018054847A1 (de) | 2016-09-22 | 2018-03-29 | Covestro Deutschland Ag | Transparente formteile mit geringer dicke |
| WO2018065480A1 (de) | 2016-10-05 | 2018-04-12 | Covestro Deutschland Ag | Mischelemente mit verringerter bautiefe für statische mischer |
| WO2018122137A1 (de) | 2016-12-28 | 2018-07-05 | Covestro Deutschland Ag | Verbundbauteil |
| WO2018122143A1 (de) | 2016-12-28 | 2018-07-05 | Covestro Deutschland Ag | Lagenweises fertigungsverfahren für einen gegenstand mit unterschiedlichem lagenmaterial und gegenstand mit unterschiedlichem lagenmaterial |
| WO2018122142A1 (de) | 2016-12-28 | 2018-07-05 | Covestro Deutschland Ag | Additives fertigungsverfahren mit einem aufbaumaterial enthaltend einen ir-absorber |
| WO2018134371A1 (de) | 2017-01-23 | 2018-07-26 | Covestro Deutschland Ag | GRAPHIT-HALTIGE POLYCARBONAT-ZUSAMMENSETZUNGEN ENTHALTEND EIN NEUARTIGES FLIEßHILFSMITTEL |
| EP3354433A1 (de) | 2017-01-31 | 2018-08-01 | Covestro Deutschland AG | Vorrichtung mit freilaufenden kühlwalzen zur herstellung eines faserverbundwerkstoffs in form eines mit polymer imprägnierten faserbands, verfahren zur herstellung dieses faserbands, ein imprägniertes faserband und ein aus dem imprägnierten faserband hergestellter mehrschichtverbund |
| WO2018149831A1 (de) | 2017-02-14 | 2018-08-23 | Covestro Deutschland Ag | Verfahren zur herstellung eines gegenstands mittels eines additiven fertigungsverfahrens unter einsatz eines polycarbonat-aufbaumaterials mit verbesserter fliessfähigkeit |
| EP3381636A1 (de) | 2017-03-28 | 2018-10-03 | Covestro Deutschland AG | Benetzungsdüse mit benetzungstaschen zur herstellung eines mit polymer benetzten faserbands, verfahren zur herstellung dieses faserbands und ein benetztes faserband |
| EP3395898A1 (de) | 2017-04-28 | 2018-10-31 | Covestro Deutschland AG | Polycarbonatzusammensetzung mit perlglanzpigment und/oder interferenzpigment |
| WO2019016369A1 (de) | 2017-07-21 | 2019-01-24 | Covestro Deutschland Ag | Talkgefüllte zusammensetzung und thermoplastische formmasse |
| US10254665B2 (en) | 2012-04-20 | 2019-04-09 | Fuji Electric Co., Ltd. | Electrophotographic photoreceptor, method for manufacturing the photoreceptor, and electrophotographic apparatus including the photoreceptor |
| EP3502306A1 (de) | 2017-12-19 | 2019-06-26 | Covestro Deutschland AG | Mehrschichtkörper, umfassend eine substratschicht enthaltend polycarbonat, talk und wachs |
| WO2019185627A1 (de) | 2018-03-28 | 2019-10-03 | Covestro Deutschland Ag | Zusammensetzung und thermoplastische formmasse zur herstellung von formkörpern mit erhöhtem glanz |
| EP3572469A1 (de) | 2018-05-25 | 2019-11-27 | Covestro Deutschland AG | Polycarbonatzusammensetzung mit perlglanzpigment und/oder interferenzpigment |
| US10551754B2 (en) | 2015-06-05 | 2020-02-04 | Fuji Electric Co., Ltd. | Method of producing an electrophotographic photoreceptor |
| US10585364B2 (en) | 2015-12-24 | 2020-03-10 | Fuji Electric Co., Ltd. | Electrophotographic photoreceptor, method for producing the same, and electrophotographic device including the same |
| EP3620288A1 (de) | 2018-09-10 | 2020-03-11 | Covestro Deutschland AG | Dynamisch temperiertes folien-hinterspritzen |
| EP3620485A1 (de) | 2018-09-04 | 2020-03-11 | Covestro Deutschland AG | Verfahren zur herstellung einer formmasse mit verbesserten eigenschaften |
| WO2020083800A1 (de) | 2018-10-26 | 2020-04-30 | Covestro Deutschland Ag | Additives fertigungsverfahren mit einem aufbaumaterial enthaltend metalloxid-beschichteten glimmer |
| WO2020120119A1 (de) | 2018-12-12 | 2020-06-18 | Covestro Intellectual Property Gmbh & Co. Kg | Verfahren zur herstellung einer formmasse mit verbesserten eigenschaften |
| US10747129B2 (en) | 2018-02-16 | 2020-08-18 | Fuji Electric Co., Ltd. | Electrophotographic photoconductor, method of manufacturing the same, and electrophotographic apparatus |
| WO2020187704A1 (de) | 2019-03-15 | 2020-09-24 | Lanxess Deutschland Gmbh | Hochvoltkomponenten |
| EP3792303A1 (de) | 2019-09-10 | 2021-03-17 | LANXESS Deutschland GmbH | Hochvoltkomponenten |
| EP3804938A1 (de) | 2019-10-07 | 2021-04-14 | Covestro Deutschland AG | Fahrzeugsitz enthaltend faserverbundwerkstoff und expandierte thermoplastische kunststoffe |
| EP3808544A1 (de) | 2019-10-14 | 2021-04-21 | Covestro Deutschland AG | Direkt-imprägnierungs prozess |
| WO2021122182A1 (de) | 2019-12-16 | 2021-06-24 | Covestro Intellectual Property Gmbh & Co. Kg | Verfahren zur herstellung einer formmasse mit verbesserten oberflächeneigenschaften |
| WO2021122183A1 (de) | 2019-12-16 | 2021-06-24 | Covestro Intellectual Property Gmbh & Co. Kg | Verfahren zur herstellung eines masterbatches und einer formmasse mit verbesserten eigenschaften |
| US11073771B2 (en) | 2019-07-24 | 2021-07-27 | Fuji Electric Co., Ltd. | Electrophotographic photoconductor, method of manufacturing the same, and electrophotographic device including the same |
| US11073770B2 (en) | 2019-03-18 | 2021-07-27 | Fuji Electric Co., Ltd. | Electrophotographic photoreceptor, production method thereof, and electrophotographic apparatus |
| EP3868818A1 (de) | 2020-02-19 | 2021-08-25 | LANXESS Deutschland GmbH | Hochvoltkomponenten |
| EP3916055A1 (de) | 2020-05-26 | 2021-12-01 | Covestro Deutschland AG | Polycarbonat-zusammensetzungen enthaltend polyethercarbonatpolyole |
| EP3922452A1 (de) | 2020-06-08 | 2021-12-15 | LANXESS Deutschland GmbH | Mehrschichtverbundwerkstoff |
| DE202020005721U1 (de) | 2020-06-08 | 2022-03-08 | Lanxess Deutschland Gmbh | Mehrschichtverbundwerkstoff |
| WO2022106524A1 (de) | 2020-11-23 | 2022-05-27 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen enthaltend titandioxid und metalloxid-beschichtete glimmerteilchen |
| WO2022106533A1 (de) | 2020-11-23 | 2022-05-27 | Covestro Deutschland Ag | Flammgeschützte, titandioxid enthaltende polycarbonat-zusammensetzungen |
| WO2022106534A1 (de) | 2020-11-23 | 2022-05-27 | Covestro Deutschland Ag | Verbesserung der reflexion und des yellowness-index bei thermoplastischen reflective white-zusammensetzungen |
| WO2022106530A1 (de) | 2020-11-23 | 2022-05-27 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen enthaltend titandioxid und epoxy-gruppen enthaltendes triacylglycerol |
| WO2022112406A1 (de) | 2020-11-30 | 2022-06-02 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen enthaltend titandioxid und eine titandioxid-beschichtung umfassende glas-plättchen |
| WO2022152560A1 (en) | 2021-01-14 | 2022-07-21 | Covestro Deutschland Ag | Easily recyclable thermoplastic housing |
| WO2022218593A1 (de) | 2021-04-15 | 2022-10-20 | Lanxess Deutschland Gmbh | Stabilisatoren für polymere |
| US11506987B2 (en) | 2019-07-17 | 2022-11-22 | Fuji Electric Co., Ltd. | Electrophotographic photoreceptor, method of manufacturing the photoreceptor, and electrophotographic device |
| EP4092070A1 (de) | 2021-05-17 | 2022-11-23 | Covestro Deutschland AG | Reduzierung des gehalts spezieller salze von sulfonsäure-, sulfonamiden- oder sulfonimidderivaten im abwasser |
| EP4092075A1 (de) | 2021-05-17 | 2022-11-23 | Covestro Deutschland AG | Flammwidrige zusammensetzung umfassend 0,040 bis 0,095 gew.-% eines flammschutzmittels |
| US11586119B2 (en) | 2020-03-02 | 2023-02-21 | Fuji Electric Co., Ltd. | Electrophotographic photoconductor, method of manufacturing the same, and electrophotographic device |
| EP4230697A1 (en) | 2022-02-16 | 2023-08-23 | Covestro Deutschland AG | Hydrolysis-resistant polycarbonate composition |
| WO2025051460A1 (de) | 2023-09-05 | 2025-03-13 | Lanxess Deutschland Gmbh | Elektromobilitätskomponenten |
-
1984
- 1984-09-04 JP JP18372184A patent/JPS6162040A/ja active Granted
Cited By (138)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH02222415A (ja) * | 1988-12-23 | 1990-09-05 | Bayer Ag | 熱可塑性芳香族ポリカーボネート |
| US5010162A (en) * | 1988-12-23 | 1991-04-23 | Bayer Aktiengesellschaft | Polycarbonate of alkyl cyclohexylidene bisphenol |
| US5034457A (en) * | 1989-03-11 | 1991-07-23 | Bayer Aktiengesellschaft | Thermoplastic blends containing polycarbonates based on substituted cyclohexylidenebisphenols |
| EP0387593A3 (de) * | 1989-03-11 | 1992-07-08 | Bayer Ag | Thermoplastische Legierungen mit Polycarbonaten auf Basis substituierter Cyclohexylidenbisphenole |
| EP0387596A3 (de) * | 1989-03-11 | 1992-07-08 | Bayer Ag | Thermoplastische Legierungen mit Polycarbonaten auf Basis n-alkyl-substituierter Cyclohexylidenbisphenole |
| US5034458A (en) * | 1989-08-22 | 1991-07-23 | Bayer Aktiengesellschaft | Polycarbonates of substituted cyclohexylindenebisphenols |
| US5254423A (en) * | 1991-10-17 | 1993-10-19 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member, and electrophotographic apparatus, device unit and facsimile machine having the photosensitive member |
| US5418099A (en) * | 1992-05-19 | 1995-05-23 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member, and electrophotographic apparatus and device unit employing the same |
| EP0701175A1 (en) | 1994-08-11 | 1996-03-13 | Fuji Electric Co., Ltd. | Electrophotographic photosensitive material |
| EP0702050A1 (de) | 1994-08-19 | 1996-03-20 | Bayer Ag | Verfahren zur Reduzierung des Oligokondensatanteils von Polykondensaten |
| EP0703263A1 (de) | 1994-08-22 | 1996-03-27 | Bayer Ag | Verfahren zur Herstellung von UV-stabilen Polycarbonaten |
| EP0709442A2 (de) | 1994-10-28 | 1996-05-01 | Bayer Ag | UV-geschützte, beschichtete Polycarbonatformkörper |
| EP0783020A1 (de) | 1995-12-05 | 1997-07-09 | Bayer Ag | Verwendung von Carbonaten als Entformungsmittel für thermoplastische Polycarbonate |
| US6001523A (en) * | 1998-10-29 | 1999-12-14 | Lexmark International, Inc. | Electrophotographic photoconductors |
| US7169834B2 (en) | 2000-02-11 | 2007-01-30 | Leibniz-Institut Fuer Neue Materialien Gemeinnuetzige Gmbh | IR absorbing compositions |
| US7074351B2 (en) | 2000-05-05 | 2006-07-11 | Leibniz-Institut Fur Neue Materialien Gem. Gmbh | IR-absorbing compositions |
| US7803507B2 (en) | 2003-02-07 | 2010-09-28 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image forming apparatus including the same |
| US7534539B2 (en) | 2003-06-03 | 2009-05-19 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image forming apparatus having the same |
| US7449271B2 (en) | 2003-10-08 | 2008-11-11 | Fuji Electric Device Technology Co., Ltd. | Electrophotographic photoconductor and methods therefor |
| DE102007061760A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polyalkylenterephthalat/Polycarbonat-Zusammensetzungen |
| DE102008016260A1 (de) | 2008-03-29 | 2009-10-01 | Bayer Materialscience Ag | Schlagzähmodifizierte Polyalkylenterephthalat/Polycarbonat-Zusammensetzungen |
| US8404414B2 (en) | 2008-04-30 | 2013-03-26 | Fuji Electric Co., Ltd. | Electrophotographic photoconductor and manufacturing method thereof |
| US8597864B2 (en) | 2009-02-16 | 2013-12-03 | Fuji Electric Co., Ltd. | Photoreceptor for electrophotography, process for producing the same, and electrophotographic apparatus |
| WO2011082940A1 (de) | 2009-12-15 | 2011-07-14 | Bayer Materialscience Ag | Polymer-zusammensetzung mit wärme-absorbierenden eigenschaften und hoher stabilität |
| DE102009058200A1 (de) | 2009-12-15 | 2011-06-16 | Bayer Materialscience Ag | Polymer-Zusammensetzung mit Wärme-absorbierenden Eigenschaften und hoher Stabilität |
| DE102009058462A1 (de) | 2009-12-16 | 2011-06-22 | Bayer MaterialScience AG, 51373 | Polycarbonat mit erhöhter Transmission und bakterizider Wirksamkeit |
| US8703370B2 (en) | 2010-01-29 | 2014-04-22 | Fuji Electric Co., Ltd. | Electrophotographic photoreceptor, manufacturing method therefor and electrophotographic device |
| DE102010013991A1 (de) | 2010-04-07 | 2011-10-13 | Bayer Materialscience Ag | Flammgeschützte Polycarbonat-Zusammensetzungen |
| WO2011124540A1 (de) | 2010-04-07 | 2011-10-13 | Bayer Materialscience Ag | Flammgeschützte polycarbonat-zusammensetzungen |
| WO2011141365A1 (de) | 2010-05-10 | 2011-11-17 | Bayer Materialscience Ag | Stabilisatorzusammensetzungen |
| WO2011141369A1 (de) | 2010-05-10 | 2011-11-17 | Bayer Materialscience Ag | Polymer-zusammensetzung mit wärme-absorbierenden eigenschaften und verbesserten farbeigenschaften |
| WO2011141368A1 (de) | 2010-05-10 | 2011-11-17 | Bayer Materialscience Ag | Polymer-zusammensetzung mit wärme-absorbierenden eigenschaften und hoher stabilität |
| WO2011141366A1 (de) | 2010-05-10 | 2011-11-17 | Bayer Materialscience Ag | Polymer-zusammensetzung mit wärme-absorbierenden eigenschaften und verbesserten farbeigenschaften |
| DE102010027239A1 (de) | 2010-07-15 | 2012-01-19 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Verfahren zur Beschichtung eines Substrates mit einer Schutzschicht, beschichtetes Substrat, elektronisches Bauteil sowie Verwendungszwecke |
| WO2012080397A2 (de) | 2010-12-17 | 2012-06-21 | Bayer Materialscience Ag | Polymer-zusammensetzung mit wärme-absorbierenden eigenschaften und hoher stabilität gegen bewitterung |
| WO2012080395A1 (de) | 2010-12-17 | 2012-06-21 | Bayer Materialscience Ag | Polymer-zusammensetzung mit wärme-absorbierenden eigenschaften und hoher stabilität gegen bewitterung |
| WO2012080396A1 (de) | 2010-12-17 | 2012-06-21 | Bayer Materialscience Ag | Farbstabile led-substrate |
| US9212272B2 (en) | 2010-12-17 | 2015-12-15 | Bayer Materialscience Ag | Organic colouring agents and coloured polymer compositions with a high stability to weathering |
| WO2012172372A1 (en) | 2011-06-17 | 2012-12-20 | Colormatrix Holdings, Inc. | Polymeric materials |
| WO2013020982A1 (de) | 2011-08-08 | 2013-02-14 | Bayer Intellectual Property Gmbh | Gefüllte polymerzusammensetzung und coextrudierte platte erhältlich hieraus |
| WO2013045552A1 (de) | 2011-09-28 | 2013-04-04 | Bayer Intellectual Property Gmbh | Polycarbonat mit glasfasern |
| US8916630B2 (en) | 2011-09-28 | 2014-12-23 | Bayer Intellectual Property Gmbh | Polycarbonate comprising glass fibres |
| WO2013057074A1 (de) | 2011-10-18 | 2013-04-25 | Bayer Intellectual Property Gmbh | Polymer-zusammensetzung mit wärme-absorbierenden eigenschaften |
| US9296893B2 (en) | 2011-11-30 | 2016-03-29 | Bayer Intellectual Property Gmbh | Ethylene-propylene-maleic acid anhydride copolymer as impact modifier in glass-fiber reinforced, flame-retardant polycarbonates for the EE sector |
| WO2013079633A1 (de) | 2011-11-30 | 2013-06-06 | Bayer Intellectual Property Gmbh | Uv-stabilisierte, glasfaserverstärkte, flammgeschützte polycarbonate für den ee- und it-bereich |
| WO2013079631A1 (de) | 2011-11-30 | 2013-06-06 | Bayer Intellectual Property Gmbh | Glasfaserverstärkte, flammgeschützte polycarbonatzusammensetzungen |
| WO2013079599A1 (de) | 2011-11-30 | 2013-06-06 | Bayer Intellectual Property Gmbh | Polycarbonatzusammensetzungen mit verbesserter oberfläche |
| WO2013079634A1 (de) | 2011-11-30 | 2013-06-06 | Bayer Intellectual Property Gmbh | Ethylen-propylen-maleinsäureanhydrid-copolymer als schlagzähmodifikator in glasfaserverstärkten fr-polycarbonaten für den ee-bereich |
| WO2013079630A1 (de) | 2011-11-30 | 2013-06-06 | Bayer Intellectual Property Gmbh | Ethylen-alkyl(meth)acrylat-block-copolymere als schlagzahmodifikator in glasfaserverstärkten flammgeschützten polycarbonaten für den ee-bereich |
| KR20140131503A (ko) | 2012-02-28 | 2014-11-13 | 후지 덴키 가부시키가이샤 | 전자사진용 감광체, 그 제조 방법 및 전자사진 장치, 및 공중합 폴리아릴레이트 수지의 제조 방법 |
| US9442400B2 (en) | 2012-02-28 | 2016-09-13 | Fuji Electric Co., Ltd. | Electrophotographic photoreceptor including a copolymer polyarylate resin, production method therefor, electrophotographic device including the photoreceptor, and production method for the copolymer polyarylate resin |
| US10254665B2 (en) | 2012-04-20 | 2019-04-09 | Fuji Electric Co., Ltd. | Electrophotographic photoreceptor, method for manufacturing the photoreceptor, and electrophotographic apparatus including the photoreceptor |
| US9665019B2 (en) | 2013-07-16 | 2017-05-30 | Fuji Electric Co., Ltd. | Electrophotographic photoconductor, production method thereof, and electrophotographic apparatus |
| US9703215B2 (en) | 2013-12-27 | 2017-07-11 | Fuji Electric Co., Ltd. | Electrophotographic photoreceptor, method of producing same, and electrophotographic apparatus |
| KR20160103970A (ko) | 2013-12-27 | 2016-09-02 | 후지 덴키 가부시키가이샤 | 전자 사진용 감광체, 그 제조방법 및 전자 사진 장치 |
| EP3020752A1 (de) | 2014-11-17 | 2016-05-18 | LANXESS Deutschland GmbH | Flammgeschützte Faser-Matrix-Halbzeuge |
| EP3020753A1 (de) | 2014-11-17 | 2016-05-18 | LANXESS Deutschland GmbH | Flammgeschützte faser-matrix-halbzeuge |
| WO2016087295A1 (de) | 2014-12-01 | 2016-06-09 | Covestro Deutschland Ag | Verbesserung der fliessfähigkeit von polycarbonatzusammensetzungen |
| US10119009B2 (en) | 2014-12-01 | 2018-11-06 | Covestro Deutschland Ag | Flowability of polycarbonate compositions |
| WO2016087296A1 (de) | 2014-12-01 | 2016-06-09 | Covestro Deutschland Ag | Gefüllte polycarbonatzusammensetzungen mit verbesserter fliessfähigkeit und hoher steifigkeit |
| US10551754B2 (en) | 2015-06-05 | 2020-02-04 | Fuji Electric Co., Ltd. | Method of producing an electrophotographic photoreceptor |
| WO2017005739A1 (de) | 2015-07-08 | 2017-01-12 | Covestro Deutschland Ag | Schlagzähmodifizierte polycarbonatzusammensetzungen mit verbesserter fliessfähigkeit und hoher wärmeformbeständigkeit |
| EP3115408A1 (de) | 2015-07-08 | 2017-01-11 | Covestro Deutschland AG | Verbesserung der fliessfähigkeit von thermisch leitfähigen polycarbonatzusammensetzungen |
| EP3115417A1 (de) | 2015-07-08 | 2017-01-11 | Covestro Deutschland AG | Schlagzähmodifizierte polycarbonatzusammensetzungen mit verbesserter fliessfähigkeit und hoher wärmeformbeständigkeit |
| US10472516B2 (en) | 2015-07-08 | 2019-11-12 | Coverstro Deutschland Ag | Improving the flowability of thermoconductive polycarbonate compositions |
| WO2017072053A1 (de) | 2015-10-26 | 2017-05-04 | Covestro Deutschland Ag | Mehrschichtiger faserverbundwerkstoff |
| DE202016009061U1 (de) | 2015-10-26 | 2021-11-03 | Covestro Deutschland Ag | Mehrschichtiger Faserverbundwerkstoff |
| US11155059B2 (en) | 2015-10-26 | 2021-10-26 | Covestro Deutschland Ag | Multi-layered fibre composite material |
| WO2017072054A1 (de) | 2015-10-26 | 2017-05-04 | Covestro Deutschland Ag | Mehrschichtiger faserverbundwerkstoff |
| US10585364B2 (en) | 2015-12-24 | 2020-03-10 | Fuji Electric Co., Ltd. | Electrophotographic photoreceptor, method for producing the same, and electrophotographic device including the same |
| US10676613B2 (en) | 2016-04-14 | 2020-06-09 | Covestro Deutschland Ag | Poycarbonate compositions containing isosorbide diesters |
| WO2017178583A1 (de) | 2016-04-14 | 2017-10-19 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen enthaltend isosorbiddiester. |
| EP3243652A1 (de) | 2016-05-11 | 2017-11-15 | Covestro Deutschland AG | Thermoplastischer träger/glas-verbund |
| WO2017198808A1 (de) | 2016-05-19 | 2017-11-23 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen enthaltend eine carbonsäure und deren glycerol- oder diglycerolester |
| WO2017202751A1 (de) | 2016-05-24 | 2017-11-30 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen enthaltend füllstoffe, eine carbonsäure und deren glycerol- oder diglycerolester |
| US10934415B2 (en) | 2016-05-24 | 2021-03-02 | Covestro Deutschland Ag | Polycarbonate compositions containing a carboxylic acid and their glycerol or diglycerol esters |
| WO2018037037A1 (de) | 2016-08-24 | 2018-03-01 | Covestro Deutschland Ag | Polycarbonatzusammensetzung umfassend talk |
| US11795323B2 (en) | 2016-08-24 | 2023-10-24 | Covestro Deutschland Ag | Polycarbonate composition comprising talc |
| WO2018054847A1 (de) | 2016-09-22 | 2018-03-29 | Covestro Deutschland Ag | Transparente formteile mit geringer dicke |
| WO2018065480A1 (de) | 2016-10-05 | 2018-04-12 | Covestro Deutschland Ag | Mischelemente mit verringerter bautiefe für statische mischer |
| WO2018122142A1 (de) | 2016-12-28 | 2018-07-05 | Covestro Deutschland Ag | Additives fertigungsverfahren mit einem aufbaumaterial enthaltend einen ir-absorber |
| WO2018122143A1 (de) | 2016-12-28 | 2018-07-05 | Covestro Deutschland Ag | Lagenweises fertigungsverfahren für einen gegenstand mit unterschiedlichem lagenmaterial und gegenstand mit unterschiedlichem lagenmaterial |
| WO2018122137A1 (de) | 2016-12-28 | 2018-07-05 | Covestro Deutschland Ag | Verbundbauteil |
| US11559951B2 (en) | 2016-12-28 | 2023-01-24 | Covestro Deutschland Ag | Composite component |
| US11267192B2 (en) | 2016-12-28 | 2022-03-08 | Covestro Deutschland Ag | Layered manufacturing process for an object with different layer material and object with different layer material |
| US10974498B2 (en) | 2016-12-28 | 2021-04-13 | Covestro Deutschland Ag | Additive fabrication process with a structural material comprising an IR absorber |
| US11279812B2 (en) | 2017-01-23 | 2022-03-22 | Covestro Deutschland Ag | Graphite-containing polycarbonate compositions containing a new type of flow promoter |
| WO2018134371A1 (de) | 2017-01-23 | 2018-07-26 | Covestro Deutschland Ag | GRAPHIT-HALTIGE POLYCARBONAT-ZUSAMMENSETZUNGEN ENTHALTEND EIN NEUARTIGES FLIEßHILFSMITTEL |
| EP3354433A1 (de) | 2017-01-31 | 2018-08-01 | Covestro Deutschland AG | Vorrichtung mit freilaufenden kühlwalzen zur herstellung eines faserverbundwerkstoffs in form eines mit polymer imprägnierten faserbands, verfahren zur herstellung dieses faserbands, ein imprägniertes faserband und ein aus dem imprägnierten faserband hergestellter mehrschichtverbund |
| WO2018141718A1 (de) | 2017-01-31 | 2018-08-09 | Covestro Deutschland Ag | Vorrichtung mit freilaufenden kühlwalzen zur herstellung eines faserverbundwerkstoffs in form eines mit polymer imprägnierten faserbands, verfahren zur herstellung dieses faserbands, ein imprägniertes faserband und ein aus dem imprägnierten faserband hergestellter mehrschichtverbund |
| WO2018149831A1 (de) | 2017-02-14 | 2018-08-23 | Covestro Deutschland Ag | Verfahren zur herstellung eines gegenstands mittels eines additiven fertigungsverfahrens unter einsatz eines polycarbonat-aufbaumaterials mit verbesserter fliessfähigkeit |
| US11472099B2 (en) | 2017-02-14 | 2022-10-18 | Covestro Deutschland Ag | Method for producing an object by means of an additive manufacturing process using a polycarbonate building material with improved flowability |
| WO2018178147A1 (de) | 2017-03-28 | 2018-10-04 | Covestro Deutschland Ag | Benetzungsdüse mit benetzungstaschen zur herstellung eines mit polymer benetzten faserbands, verfahren zur herstellung dieses faserbands und ein benetztes faserband |
| EP3381636A1 (de) | 2017-03-28 | 2018-10-03 | Covestro Deutschland AG | Benetzungsdüse mit benetzungstaschen zur herstellung eines mit polymer benetzten faserbands, verfahren zur herstellung dieses faserbands und ein benetztes faserband |
| EP3395898A1 (de) | 2017-04-28 | 2018-10-31 | Covestro Deutschland AG | Polycarbonatzusammensetzung mit perlglanzpigment und/oder interferenzpigment |
| US11485853B2 (en) | 2017-04-28 | 2022-11-01 | Covestro Deutschland Ag | Polycarbonate composition comprising pearlescent pigment and/or interference pigment |
| WO2018197572A1 (de) | 2017-04-28 | 2018-11-01 | Covestro Deutschland Ag | Polycarbonatzusammensetzung mit perlglanzpigment und/oder interferenzpigment |
| WO2019016369A1 (de) | 2017-07-21 | 2019-01-24 | Covestro Deutschland Ag | Talkgefüllte zusammensetzung und thermoplastische formmasse |
| EP3502306A1 (de) | 2017-12-19 | 2019-06-26 | Covestro Deutschland AG | Mehrschichtkörper, umfassend eine substratschicht enthaltend polycarbonat, talk und wachs |
| US12012494B2 (en) | 2017-12-19 | 2024-06-18 | Covestro Deutschland Ag | Multilayer body, comprising a substrate layer containing polycarbonate, talc and wax |
| WO2019121256A1 (de) | 2017-12-19 | 2019-06-27 | Covestro Deutschland Ag | Mehrschichtkörper, umfassend eine substratschicht enthaltend polycarbonat, talk und wachs |
| US10747129B2 (en) | 2018-02-16 | 2020-08-18 | Fuji Electric Co., Ltd. | Electrophotographic photoconductor, method of manufacturing the same, and electrophotographic apparatus |
| WO2019185627A1 (de) | 2018-03-28 | 2019-10-03 | Covestro Deutschland Ag | Zusammensetzung und thermoplastische formmasse zur herstellung von formkörpern mit erhöhtem glanz |
| WO2019224151A1 (de) | 2018-05-25 | 2019-11-28 | Covestro Deutschland Ag | Polycarbonatzusammensetzung mit perlglanzpigment und/oder interferenzpigment |
| EP3572469A1 (de) | 2018-05-25 | 2019-11-27 | Covestro Deutschland AG | Polycarbonatzusammensetzung mit perlglanzpigment und/oder interferenzpigment |
| EP3620485A1 (de) | 2018-09-04 | 2020-03-11 | Covestro Deutschland AG | Verfahren zur herstellung einer formmasse mit verbesserten eigenschaften |
| WO2020048750A1 (de) | 2018-09-04 | 2020-03-12 | Covestro Deutschland Ag | Verfahren zur herstellung einer formmasse mit verbesserten eigenschaften |
| EP3620288A1 (de) | 2018-09-10 | 2020-03-11 | Covestro Deutschland AG | Dynamisch temperiertes folien-hinterspritzen |
| WO2020052955A1 (de) | 2018-09-10 | 2020-03-19 | Covestro Deutschland Ag | Dynamisch temperiertes folien-hinterspritzen |
| WO2020083800A1 (de) | 2018-10-26 | 2020-04-30 | Covestro Deutschland Ag | Additives fertigungsverfahren mit einem aufbaumaterial enthaltend metalloxid-beschichteten glimmer |
| WO2020120119A1 (de) | 2018-12-12 | 2020-06-18 | Covestro Intellectual Property Gmbh & Co. Kg | Verfahren zur herstellung einer formmasse mit verbesserten eigenschaften |
| WO2020187704A1 (de) | 2019-03-15 | 2020-09-24 | Lanxess Deutschland Gmbh | Hochvoltkomponenten |
| US11073770B2 (en) | 2019-03-18 | 2021-07-27 | Fuji Electric Co., Ltd. | Electrophotographic photoreceptor, production method thereof, and electrophotographic apparatus |
| US11506987B2 (en) | 2019-07-17 | 2022-11-22 | Fuji Electric Co., Ltd. | Electrophotographic photoreceptor, method of manufacturing the photoreceptor, and electrophotographic device |
| US11073771B2 (en) | 2019-07-24 | 2021-07-27 | Fuji Electric Co., Ltd. | Electrophotographic photoconductor, method of manufacturing the same, and electrophotographic device including the same |
| WO2021047937A1 (de) | 2019-09-10 | 2021-03-18 | Lanxess Deutschland Gmbh | Hochvoltkomponenten |
| EP3792303A1 (de) | 2019-09-10 | 2021-03-17 | LANXESS Deutschland GmbH | Hochvoltkomponenten |
| EP3804938A1 (de) | 2019-10-07 | 2021-04-14 | Covestro Deutschland AG | Fahrzeugsitz enthaltend faserverbundwerkstoff und expandierte thermoplastische kunststoffe |
| EP3808544A1 (de) | 2019-10-14 | 2021-04-21 | Covestro Deutschland AG | Direkt-imprägnierungs prozess |
| WO2021122182A1 (de) | 2019-12-16 | 2021-06-24 | Covestro Intellectual Property Gmbh & Co. Kg | Verfahren zur herstellung einer formmasse mit verbesserten oberflächeneigenschaften |
| WO2021122183A1 (de) | 2019-12-16 | 2021-06-24 | Covestro Intellectual Property Gmbh & Co. Kg | Verfahren zur herstellung eines masterbatches und einer formmasse mit verbesserten eigenschaften |
| EP3868818A1 (de) | 2020-02-19 | 2021-08-25 | LANXESS Deutschland GmbH | Hochvoltkomponenten |
| US11586119B2 (en) | 2020-03-02 | 2023-02-21 | Fuji Electric Co., Ltd. | Electrophotographic photoconductor, method of manufacturing the same, and electrophotographic device |
| WO2021239569A1 (de) | 2020-05-26 | 2021-12-02 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen enthaltend polyethercarbonatpolyole |
| EP3916055A1 (de) | 2020-05-26 | 2021-12-01 | Covestro Deutschland AG | Polycarbonat-zusammensetzungen enthaltend polyethercarbonatpolyole |
| EP3922452A1 (de) | 2020-06-08 | 2021-12-15 | LANXESS Deutschland GmbH | Mehrschichtverbundwerkstoff |
| DE202020005721U1 (de) | 2020-06-08 | 2022-03-08 | Lanxess Deutschland Gmbh | Mehrschichtverbundwerkstoff |
| WO2022106524A1 (de) | 2020-11-23 | 2022-05-27 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen enthaltend titandioxid und metalloxid-beschichtete glimmerteilchen |
| WO2022106530A1 (de) | 2020-11-23 | 2022-05-27 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen enthaltend titandioxid und epoxy-gruppen enthaltendes triacylglycerol |
| WO2022106534A1 (de) | 2020-11-23 | 2022-05-27 | Covestro Deutschland Ag | Verbesserung der reflexion und des yellowness-index bei thermoplastischen reflective white-zusammensetzungen |
| WO2022106533A1 (de) | 2020-11-23 | 2022-05-27 | Covestro Deutschland Ag | Flammgeschützte, titandioxid enthaltende polycarbonat-zusammensetzungen |
| WO2022112406A1 (de) | 2020-11-30 | 2022-06-02 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen enthaltend titandioxid und eine titandioxid-beschichtung umfassende glas-plättchen |
| WO2022152560A1 (en) | 2021-01-14 | 2022-07-21 | Covestro Deutschland Ag | Easily recyclable thermoplastic housing |
| WO2022218593A1 (de) | 2021-04-15 | 2022-10-20 | Lanxess Deutschland Gmbh | Stabilisatoren für polymere |
| EP4092070A1 (de) | 2021-05-17 | 2022-11-23 | Covestro Deutschland AG | Reduzierung des gehalts spezieller salze von sulfonsäure-, sulfonamiden- oder sulfonimidderivaten im abwasser |
| EP4092075A1 (de) | 2021-05-17 | 2022-11-23 | Covestro Deutschland AG | Flammwidrige zusammensetzung umfassend 0,040 bis 0,095 gew.-% eines flammschutzmittels |
| EP4230697A1 (en) | 2022-02-16 | 2023-08-23 | Covestro Deutschland AG | Hydrolysis-resistant polycarbonate composition |
| WO2025051460A1 (de) | 2023-09-05 | 2025-03-13 | Lanxess Deutschland Gmbh | Elektromobilitätskomponenten |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0349426B2 (cs) | 1991-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6162040A (ja) | 電子写真用感光体 | |
| DE3882820T2 (de) | Arylamin-Polymere. | |
| EP0638848B1 (en) | Process for fabricating an electrophotographic imaging member | |
| US5385796A (en) | Electrophotographic imaging member having unmodified hydroxy methacrylate polymer charge blocking layer | |
| US4464450A (en) | Multi-layer photoreceptor containing siloxane on a metal oxide layer | |
| JPS6162039A (ja) | 電子写真用感光体 | |
| US3745005A (en) | Electrophotographic elements having barrier layers | |
| US5725985A (en) | Charge generation layer containing mixture of terpolymer and copolymer | |
| JPS61105550A (ja) | 電子写真用感光体 | |
| JPH0339970A (ja) | 電子写真像形成システム | |
| US5422213A (en) | Multilayer electrophotographic imaging member having cross-linked adhesive layer | |
| US5413886A (en) | Transport layers containing two or more charge transporting molecules | |
| US5229239A (en) | Substrate for electrostatographic device and method of making | |
| US6165660A (en) | Organic photoreceptor with improved adhesion between coated layers | |
| EP1081164B1 (en) | Binder resin with reduced hydroxyl content | |
| EP0448780A1 (en) | Electrophotographic imaging member | |
| JPS5964848A (ja) | 電子写真感光体の製造方法 | |
| JPH0437860A (ja) | 電子写真感光体 | |
| EP0046960B1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| JPS62250458A (ja) | 電子写真用感光体 | |
| JPH01319752A (ja) | 電子写真感光体 | |
| JP2631735B2 (ja) | 電子写真感光体 | |
| JPH01174565A (ja) | 顔料分散液 | |
| JPS58136044A (ja) | 透明導電性膜の形成方法 | |
| JPH0437858A (ja) | 電子写真感光体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| LAPS | Cancellation because of no payment of annual fees |