JPS6157307B2 - - Google Patents
Info
- Publication number
- JPS6157307B2 JPS6157307B2 JP56163370A JP16337081A JPS6157307B2 JP S6157307 B2 JPS6157307 B2 JP S6157307B2 JP 56163370 A JP56163370 A JP 56163370A JP 16337081 A JP16337081 A JP 16337081A JP S6157307 B2 JPS6157307 B2 JP S6157307B2
- Authority
- JP
- Japan
- Prior art keywords
- guanidino
- thiazole
- imidazolyl
- mmol
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 93
- 239000002253 acid Substances 0.000 claims description 23
- 150000003839 salts Chemical class 0.000 claims description 23
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 18
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 15
- 229910052794 bromium Inorganic materials 0.000 claims description 15
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 14
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- GQOVTZHEZPKTGS-UHFFFAOYSA-N 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine Chemical class S1C(NC(=N)N)=NC(C=2N=C(N)SC=2)=C1 GQOVTZHEZPKTGS-UHFFFAOYSA-N 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- AXCNMJYJGZCULB-UHFFFAOYSA-N 2-[4-(1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine Chemical compound S1C(NC(=N)N)=NC(C=2N=CSC=2)=C1 AXCNMJYJGZCULB-UHFFFAOYSA-N 0.000 claims description 2
- LQXWVSXNRXFDKX-UHFFFAOYSA-N 2-[4-[2-(hydroxymethyl)-1h-imidazol-5-yl]-1,3-thiazol-2-yl]guanidine Chemical compound S1C(NC(=N)N)=NC(C=2N=C(CO)NC=2)=C1 LQXWVSXNRXFDKX-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Chemical group 0.000 claims description 2
- VQWJQJWRWJGSHN-UHFFFAOYSA-N 2-(1h-imidazol-2-yl)-1,3-thiazole Chemical compound C1=CNC(C=2SC=CN=2)=N1 VQWJQJWRWJGSHN-UHFFFAOYSA-N 0.000 claims 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 1
- OEVXDSVBHOYPRJ-UHFFFAOYSA-N 2-[4-(2,4-dimethylimidazol-4-yl)-1,3-thiazol-2-yl]guanidine Chemical compound C1=NC(C)=NC1(C)C1=CSC(N=C(N)N)=N1 OEVXDSVBHOYPRJ-UHFFFAOYSA-N 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 239000007787 solid Substances 0.000 description 73
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 67
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 63
- 239000000203 mixture Substances 0.000 description 59
- 239000000243 solution Substances 0.000 description 57
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 47
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- 238000002844 melting Methods 0.000 description 44
- 230000008018 melting Effects 0.000 description 44
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 42
- -1 ethanone compound Chemical class 0.000 description 41
- 238000001914 filtration Methods 0.000 description 40
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 32
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 28
- 238000006243 chemical reaction Methods 0.000 description 28
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 238000010992 reflux Methods 0.000 description 27
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 26
- 239000002244 precipitate Substances 0.000 description 25
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 22
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 22
- 239000000543 intermediate Substances 0.000 description 20
- 239000000706 filtrate Substances 0.000 description 19
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 16
- 238000000354 decomposition reaction Methods 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 14
- 229910000029 sodium carbonate Inorganic materials 0.000 description 14
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 14
- 239000002198 insoluble material Substances 0.000 description 13
- 239000012458 free base Substances 0.000 description 12
- 239000000463 material Substances 0.000 description 11
- 238000001953 recrystallisation Methods 0.000 description 11
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 10
- 239000007864 aqueous solution Substances 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- OKGXJRGLYVRVNE-UHFFFAOYSA-N diaminomethylidenethiourea Chemical compound NC(N)=NC(N)=S OKGXJRGLYVRVNE-UHFFFAOYSA-N 0.000 description 9
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 9
- 239000003960 organic solvent Substances 0.000 description 9
- 239000002002 slurry Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- RGHIROSMHZJRQK-UHFFFAOYSA-N 2-(diaminomethylideneamino)-1,3-thiazole-4-carboxylic acid Chemical compound NC(=N)NC1=NC(C(O)=O)=CS1 RGHIROSMHZJRQK-UHFFFAOYSA-N 0.000 description 8
- 229910052736 halogen Inorganic materials 0.000 description 8
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 8
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 8
- 238000011282 treatment Methods 0.000 description 8
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 7
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- 235000011114 ammonium hydroxide Nutrition 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 150000002367 halogens Chemical class 0.000 description 7
- 150000002431 hydrogen Chemical group 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 239000003485 histamine H2 receptor antagonist Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 208000008469 Peptic Ulcer Diseases 0.000 description 5
- 125000005233 alkylalcohol group Chemical group 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 239000000908 ammonium hydroxide Substances 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 235000008504 concentrate Nutrition 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- 229960001340 histamine Drugs 0.000 description 5
- 239000000546 pharmaceutical excipient Substances 0.000 description 5
- MZJZNADJWQEIIG-UHFFFAOYSA-N 1-(2-methyl-1h-imidazol-5-yl)ethanone Chemical compound CC(=O)C1=CN=C(C)N1 MZJZNADJWQEIIG-UHFFFAOYSA-N 0.000 description 4
- UJLNITKVGULKNI-UHFFFAOYSA-N 2-[4-(hydrazinecarbonyl)-1,3-thiazol-2-yl]guanidine Chemical compound NNC(=O)C1=CSC(NC(N)=N)=N1 UJLNITKVGULKNI-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 206010020601 Hyperchlorhydria Diseases 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 108010079943 Pentagastrin Proteins 0.000 description 4
- 239000003937 drug carrier Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 230000029142 excretion Effects 0.000 description 4
- 230000002496 gastric effect Effects 0.000 description 4
- 210000002837 heart atrium Anatomy 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 4
- 238000001819 mass spectrum Methods 0.000 description 4
- ANRIQLNBZQLTFV-DZUOILHNSA-N pentagastrin Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1[C]2C=CC=CC2=NC=1)NC(=O)CCNC(=O)OC(C)(C)C)CCSC)C(N)=O)C1=CC=CC=C1 ANRIQLNBZQLTFV-DZUOILHNSA-N 0.000 description 4
- 229960000444 pentagastrin Drugs 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 210000002784 stomach Anatomy 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- TUFOJIVMBHBZRQ-UHFFFAOYSA-N 1-(1h-imidazol-5-yl)ethanone Chemical compound CC(=O)C1=CN=CN1 TUFOJIVMBHBZRQ-UHFFFAOYSA-N 0.000 description 3
- SGXWMBXNTCVZPY-UHFFFAOYSA-N 1-(2,4-dimethylimidazol-1-yl)ethanone Chemical compound CC(=O)N1C=C(C)N=C1C SGXWMBXNTCVZPY-UHFFFAOYSA-N 0.000 description 3
- HEUBFSYOZRPRTD-UHFFFAOYSA-N 1-(2,5-dimethyl-1h-imidazol-4-yl)ethanone Chemical compound CC(=O)C=1NC(C)=NC=1C HEUBFSYOZRPRTD-UHFFFAOYSA-N 0.000 description 3
- HUKNDBAKSCHISX-UHFFFAOYSA-N 1-(5-methyl-1h-imidazol-4-yl)ethanone Chemical compound CC(=O)C=1N=CNC=1C HUKNDBAKSCHISX-UHFFFAOYSA-N 0.000 description 3
- MGSUZKWFACFSDH-UHFFFAOYSA-N 1-[2-(hydroxymethyl)-1h-imidazol-5-yl]ethanone Chemical compound CC(=O)C1=CNC(CO)=N1 MGSUZKWFACFSDH-UHFFFAOYSA-N 0.000 description 3
- QTVGLOOZIYZYRQ-UHFFFAOYSA-N 2-bromo-1-[2-(hydroxymethyl)-1h-imidazol-5-yl]ethanone;hydrobromide Chemical compound Br.OCC1=NC(C(=O)CBr)=CN1 QTVGLOOZIYZYRQ-UHFFFAOYSA-N 0.000 description 3
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 3
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 230000001476 alcoholic effect Effects 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- LBSBQVAGEVSBQP-UHFFFAOYSA-N ethyl 2-(diaminomethylideneamino)-1,3-thiazole-4-carboxylate Chemical compound CCOC(=O)C1=CSC(N=C(N)N)=N1 LBSBQVAGEVSBQP-UHFFFAOYSA-N 0.000 description 3
- VICYTAYPKBLQFB-UHFFFAOYSA-N ethyl 3-bromo-2-oxopropanoate Chemical compound CCOC(=O)C(=O)CBr VICYTAYPKBLQFB-UHFFFAOYSA-N 0.000 description 3
- 230000027119 gastric acid secretion Effects 0.000 description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 description 3
- 239000012433 hydrogen halide Substances 0.000 description 3
- 238000001802 infusion Methods 0.000 description 3
- 238000007911 parenteral administration Methods 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- RYYCFQTWLMFJIG-UHFFFAOYSA-N propylcyanamide Chemical compound CCCNC#N RYYCFQTWLMFJIG-UHFFFAOYSA-N 0.000 description 3
- 239000010453 quartz Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000002731 stomach secretion inhibitor Substances 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 238000001665 trituration Methods 0.000 description 3
- 229910052727 yttrium Inorganic materials 0.000 description 3
- RROBYWWPVULLSU-UHFFFAOYSA-N 2-[4-(1h-imidazol-5-yl)-1,3-thiazol-2-yl]guanidine Chemical compound S1C(NC(=N)N)=NC(C=2N=CNC=2)=C1 RROBYWWPVULLSU-UHFFFAOYSA-N 0.000 description 2
- FQOXJJNWHXRGIV-UHFFFAOYSA-N 2-[4-(2-aminoacetyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride Chemical compound Cl.Cl.NCC(=O)C1=CSC(NC(N)=N)=N1 FQOXJJNWHXRGIV-UHFFFAOYSA-N 0.000 description 2
- HNCBHFLGVNAVNT-UHFFFAOYSA-N 2-[4-(2-bromoacetyl)-1,3-thiazol-2-yl]guanidine;hydrobromide Chemical compound Br.NC(=N)NC1=NC(C(=O)CBr)=CS1 HNCBHFLGVNAVNT-UHFFFAOYSA-N 0.000 description 2
- YQWRPDMPXIRUSH-UHFFFAOYSA-N 2-[4-(5-methyl-1h-imidazol-4-yl)-1,3-thiazol-2-yl]guanidine;hydrobromide Chemical compound Br.N1=CNC(C=2N=C(NC(N)=N)SC=2)=C1C YQWRPDMPXIRUSH-UHFFFAOYSA-N 0.000 description 2
- YIUSMHXFPSORGW-UHFFFAOYSA-N 2-[4-(5-propyl-1h-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]guanidine Chemical compound CCCC1=NNC(C=2N=C(NC(N)=N)SC=2)=N1 YIUSMHXFPSORGW-UHFFFAOYSA-N 0.000 description 2
- UDFQWTOIRFJRHP-UHFFFAOYSA-N 2-[4-[2-(hydroxymethyl)-1h-imidazol-5-yl]-1,3-thiazol-2-yl]guanidine;hydrobromide Chemical compound Br.S1C(NC(=N)N)=NC(C=2N=C(CO)NC=2)=C1 UDFQWTOIRFJRHP-UHFFFAOYSA-N 0.000 description 2
- MVTGVDHNHMILAT-UHFFFAOYSA-N 2-bromo-1-(2-methyl-1h-imidazol-5-yl)ethanone;hydrobromide Chemical compound Br.CC1=NC(C(=O)CBr)=CN1 MVTGVDHNHMILAT-UHFFFAOYSA-N 0.000 description 2
- NHZTZQDWMOWTJF-UHFFFAOYSA-N 2-bromo-1-(5-methyl-1h-imidazol-4-yl)ethanone Chemical compound CC=1N=CNC=1C(=O)CBr NHZTZQDWMOWTJF-UHFFFAOYSA-N 0.000 description 2
- DRWDZFNIPARKSG-UHFFFAOYSA-N 2-hydroxyethanimidamide;hydrochloride Chemical compound Cl.NC(=N)CO DRWDZFNIPARKSG-UHFFFAOYSA-N 0.000 description 2
- ILURHDNYPWZLFB-UHFFFAOYSA-N 2-phenylethylcyanamide Chemical compound N#CNCCC1=CC=CC=C1 ILURHDNYPWZLFB-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- QIRSDXBXWUTMRE-UHFFFAOYSA-N benzylcyanamide Chemical compound N#CNCC1=CC=CC=C1 QIRSDXBXWUTMRE-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 231100000673 dose–response relationship Toxicity 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 238000001647 drug administration Methods 0.000 description 2
- NJSUFZNXBBXAAC-UHFFFAOYSA-N ethanol;toluene Chemical class CCO.CC1=CC=CC=C1 NJSUFZNXBBXAAC-UHFFFAOYSA-N 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 210000004211 gastric acid Anatomy 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- CYEBJEDOHLIWNP-UHFFFAOYSA-N methanethioamide Chemical compound NC=S CYEBJEDOHLIWNP-UHFFFAOYSA-N 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- KSXJITOVDCAVAY-UHFFFAOYSA-N n,2-bis(diaminomethylideneamino)-1,3-thiazole-4-carboxamide Chemical compound NC(=N)NNC(=O)C1=CSC(NC(N)=N)=N1 KSXJITOVDCAVAY-UHFFFAOYSA-N 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 239000003495 polar organic solvent Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- 230000003248 secreting effect Effects 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- KYVBNYUBXIEUFW-UHFFFAOYSA-N 1,1,3,3-tetramethylguanidine Chemical compound CN(C)C(=N)N(C)C KYVBNYUBXIEUFW-UHFFFAOYSA-N 0.000 description 1
- RZMOICJDRADLCT-UHFFFAOYSA-N 1,4-Dibromodiacetyl Chemical compound BrCC(=O)C(=O)CBr RZMOICJDRADLCT-UHFFFAOYSA-N 0.000 description 1
- OSMJIXXVEWORDJ-UHFFFAOYSA-N 1-(1h-imidazol-2-yl)ethanone Chemical group CC(=O)C1=NC=CN1 OSMJIXXVEWORDJ-UHFFFAOYSA-N 0.000 description 1
- REQORQAFNBDQKR-UHFFFAOYSA-N 1-(2-methylimidazol-1-yl)ethanone Chemical compound CC(=O)N1C=CN=C1C REQORQAFNBDQKR-UHFFFAOYSA-N 0.000 description 1
- WQNVXLSZFIYEDC-UHFFFAOYSA-N 1-(4-methylimidazol-1-yl)ethanone Chemical compound CC(=O)N1C=NC(C)=C1 WQNVXLSZFIYEDC-UHFFFAOYSA-N 0.000 description 1
- MZEWIHBWBREJIS-UHFFFAOYSA-N 2-[4-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]guanidine Chemical compound S1C(NC(=N)N)=NC(C=2SC=CN=2)=C1 MZEWIHBWBREJIS-UHFFFAOYSA-N 0.000 description 1
- HQJOVVJTCQROAG-UHFFFAOYSA-N 2-[4-(1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide Chemical compound Br.Br.S1C(NC(=N)N)=NC(C=2N=CSC=2)=C1 HQJOVVJTCQROAG-UHFFFAOYSA-N 0.000 description 1
- LOLURPLOTOYRRI-UHFFFAOYSA-N 2-[4-(1h-imidazol-2-yl)-1,3-thiazol-2-yl]guanidine Chemical compound S1C(N=C(N)N)=NC(C=2NC=CN=2)=C1 LOLURPLOTOYRRI-UHFFFAOYSA-N 0.000 description 1
- XFVCDLRNOZHDTH-UHFFFAOYSA-N 2-[4-(1h-imidazol-5-yl)-1,3-thiazol-2-yl]guanidine;hydrobromide Chemical compound Br.S1C(NC(=N)N)=NC(C=2N=CNC=2)=C1 XFVCDLRNOZHDTH-UHFFFAOYSA-N 0.000 description 1
- BZPHFGXTTYHSOU-UHFFFAOYSA-N 2-[4-(2,4-dimethylimidazol-4-yl)-1,3-thiazol-2-yl]guanidine;hydrobromide Chemical compound Br.C1=NC(C)=NC1(C)C1=CSC(NC(N)=N)=N1 BZPHFGXTTYHSOU-UHFFFAOYSA-N 0.000 description 1
- FWWYLOBUQDCUCT-UHFFFAOYSA-N 2-[4-(2,5-dimethyl-1h-imidazol-4-yl)-1,3-thiazol-2-yl]guanidine;hydrobromide Chemical compound Br.N1C(C)=NC(C)=C1C1=CSC(NC(N)=N)=N1 FWWYLOBUQDCUCT-UHFFFAOYSA-N 0.000 description 1
- KVKPPTWDKZOEQA-UHFFFAOYSA-N 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide Chemical compound Br.Br.S1C(NC(=N)N)=NC(C=2N=C(N)SC=2)=C1 KVKPPTWDKZOEQA-UHFFFAOYSA-N 0.000 description 1
- DJEBAFSBIQCGFA-UHFFFAOYSA-N 2-[4-(2-amino-1h-imidazol-5-yl)-1,3-thiazol-2-yl]guanidine Chemical compound S1C(NC(=N)N)=NC(C=2N=C(N)NC=2)=C1 DJEBAFSBIQCGFA-UHFFFAOYSA-N 0.000 description 1
- VDJFKJZIBGJUEJ-UHFFFAOYSA-N 2-[4-(2-azidoacetyl)-1,3-thiazol-2-yl]guanidine Chemical compound NC(=N)NC1=NC(C(=O)CN=[N+]=[N-])=CS1 VDJFKJZIBGJUEJ-UHFFFAOYSA-N 0.000 description 1
- BYVUVDJTYQRZHQ-UHFFFAOYSA-N 2-[4-(2-bromo-1,1-diethoxyethyl)-1,3-thiazol-2-yl]guanidine Chemical compound CCOC(CBr)(OCC)C1=CSC(NC(N)=N)=N1 BYVUVDJTYQRZHQ-UHFFFAOYSA-N 0.000 description 1
- UNSJOUBUPRTVBE-UHFFFAOYSA-N 2-[4-(2-oxopropyl)-1,3-thiazol-2-yl]guanidine Chemical compound CC(=O)CC1=CSC(NC(N)=N)=N1 UNSJOUBUPRTVBE-UHFFFAOYSA-N 0.000 description 1
- VYASUAGYPLGDSK-UHFFFAOYSA-N 2-[4-(2h-triazol-4-yl)-1,3-thiazol-2-yl]guanidine Chemical compound S1C(NC(=N)N)=NC(C=2N=NNC=2)=C1 VYASUAGYPLGDSK-UHFFFAOYSA-N 0.000 description 1
- VQSANDFXYKDZIX-UHFFFAOYSA-N 2-[4-(3-amino-1h-1,2,4-triazol-5-yl)-1,3-thiazol-2-yl]guanidine Chemical compound S1C(NC(=N)N)=NC(C=2NN=C(N)N=2)=C1 VQSANDFXYKDZIX-UHFFFAOYSA-N 0.000 description 1
- BDMVKKQPHWQHON-UHFFFAOYSA-N 2-[4-(5-ethyl-1h-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]guanidine Chemical compound CCC1=NNC(C=2N=C(NC(N)=N)SC=2)=N1 BDMVKKQPHWQHON-UHFFFAOYSA-N 0.000 description 1
- VDMGUZLKLQMVJV-UHFFFAOYSA-N 2-[4-(5-methyl-1h-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]guanidine Chemical compound CC1=NNC(C=2N=C(NC(N)=N)SC=2)=N1 VDMGUZLKLQMVJV-UHFFFAOYSA-N 0.000 description 1
- NPAHPKSIQYJDLO-UHFFFAOYSA-N 2-[4-(5-methyl-1h-imidazol-4-yl)-1,3-thiazol-2-yl]guanidine Chemical compound N1=CNC(C=2N=C(NC(N)=N)SC=2)=C1C NPAHPKSIQYJDLO-UHFFFAOYSA-N 0.000 description 1
- KFJUMZIFXCCMMA-UHFFFAOYSA-N 2-bromo-1-(1h-imidazol-5-yl)ethanone;hydrobromide Chemical compound Br.BrCC(=O)C1=CN=CN1 KFJUMZIFXCCMMA-UHFFFAOYSA-N 0.000 description 1
- QJWIMGXDWBBGAN-UHFFFAOYSA-N 2-bromo-1-(2,5-dimethyl-1h-imidazol-4-yl)ethanone Chemical compound CC1=NC(C)=C(C(=O)CBr)N1 QJWIMGXDWBBGAN-UHFFFAOYSA-N 0.000 description 1
- PSXFGGSTDYRXHA-UHFFFAOYSA-N 2-bromo-1-(5-methyl-1h-imidazol-4-yl)ethanone;hydrobromide Chemical compound Br.CC=1N=CNC=1C(=O)CBr PSXFGGSTDYRXHA-UHFFFAOYSA-N 0.000 description 1
- DMJVNZUWGQHJJB-UHFFFAOYSA-N 3-bromo-1-(1h-imidazol-5-yl)propane-1,2-dione;hydrobromide Chemical compound Br.BrCC(=O)C(=O)C1=CNC=N1 DMJVNZUWGQHJJB-UHFFFAOYSA-N 0.000 description 1
- VSEUYEAKIAUEHZ-UHFFFAOYSA-N 3-bromo-4-ethoxybut-3-en-2-one Chemical compound CCOC=C(Br)C(C)=O VSEUYEAKIAUEHZ-UHFFFAOYSA-N 0.000 description 1
- RXXQKTSOBMGARS-UHFFFAOYSA-N 3-bromo-4-hydroxybut-3-en-2-one Chemical compound CC(=O)C(Br)=CO RXXQKTSOBMGARS-UHFFFAOYSA-N 0.000 description 1
- XLKLSWJVKFKHAE-UHFFFAOYSA-N 3-bromo-4-methoxybut-3-en-2-one Chemical compound COC=C(Br)C(C)=O XLKLSWJVKFKHAE-UHFFFAOYSA-N 0.000 description 1
- BCJVUSULIBUMFY-UHFFFAOYSA-N 4-(2-bromoethyl)-5-methyl-1H-imidazole Chemical compound Cc1[nH]cnc1CCBr BCJVUSULIBUMFY-UHFFFAOYSA-N 0.000 description 1
- BVPWJMCABCPUQY-UHFFFAOYSA-N 4-amino-5-chloro-2-methoxy-N-[1-(phenylmethyl)-4-piperidinyl]benzamide Chemical compound COC1=CC(N)=C(Cl)C=C1C(=O)NC1CCN(CC=2C=CC=CC=2)CC1 BVPWJMCABCPUQY-UHFFFAOYSA-N 0.000 description 1
- PADDNCJJHROILV-UHFFFAOYSA-N 6-methoxy-4-methylpyridin-3-amine Chemical compound COC1=CC(C)=C(N)C=N1 PADDNCJJHROILV-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 235000006491 Acacia senegal Nutrition 0.000 description 1
- QCFFFXHJJXXAFT-UHFFFAOYSA-N CC1=C(N=C(N1)C)CCBr Chemical compound CC1=C(N=C(N1)C)CCBr QCFFFXHJJXXAFT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 239000004705 High-molecular-weight polyethylene Substances 0.000 description 1
- 239000012839 Krebs-Henseleit buffer Substances 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- KQJQICVXLJTWQD-UHFFFAOYSA-N N-Methylthiourea Chemical compound CNC(N)=S KQJQICVXLJTWQD-UHFFFAOYSA-N 0.000 description 1
- VIHYIVKEECZGOU-UHFFFAOYSA-N N-acetylimidazole Chemical compound CC(=O)N1C=CN=C1 VIHYIVKEECZGOU-UHFFFAOYSA-N 0.000 description 1
- IPCRBOOJBPETMF-UHFFFAOYSA-N N-acetylthiourea Chemical compound CC(=O)NC(N)=S IPCRBOOJBPETMF-UHFFFAOYSA-N 0.000 description 1
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methylthiourea Natural products CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- LINDOXZENKYESA-UHFFFAOYSA-N TMG Natural products CNC(N)=NC LINDOXZENKYESA-UHFFFAOYSA-N 0.000 description 1
- SSBRSHIQIANGKS-UHFFFAOYSA-N [amino(hydroxy)methylidene]azanium;hydrogen sulfate Chemical compound NC(N)=O.OS(O)(=O)=O SSBRSHIQIANGKS-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M bisulphate group Chemical group S([O-])(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- PQZVCRPSQXDXJL-UHFFFAOYSA-N butylcyanamide Chemical compound CCCCNC#N PQZVCRPSQXDXJL-UHFFFAOYSA-N 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid group Chemical class C(CC(O)(C(=O)O)CC(=O)O)(=O)O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 208000000718 duodenal ulcer Diseases 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- WCQOBLXWLRDEQA-UHFFFAOYSA-N ethanimidamide;hydrochloride Chemical compound Cl.CC(N)=N WCQOBLXWLRDEQA-UHFFFAOYSA-N 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- TZMFJUDUGYTVRY-UHFFFAOYSA-N ethyl methyl diketone Natural products CCC(=O)C(C)=O TZMFJUDUGYTVRY-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 238000004896 high resolution mass spectrometry Methods 0.000 description 1
- BTGBUDSSMOZMFI-UHFFFAOYSA-N hydrazine 1,3-thiazole-2-carboxylic acid Chemical compound NN.OC(=O)c1nccs1 BTGBUDSSMOZMFI-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 1
- 229960000582 mepyramine Drugs 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- MCLITRXWHZUNCQ-UHFFFAOYSA-N methylcyanamide Chemical compound CNC#N MCLITRXWHZUNCQ-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- XGZVNVFLUGNOJQ-UHFFFAOYSA-N n,n-dimethylformamide;ethyl acetate Chemical compound CN(C)C=O.CCOC(C)=O XGZVNVFLUGNOJQ-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- JLXXLCJERIYMQG-UHFFFAOYSA-N phenylcyanamide Chemical compound N#CNC1=CC=CC=C1 JLXXLCJERIYMQG-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical compound O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000012066 reaction slurry Substances 0.000 description 1
- 210000005245 right atrium Anatomy 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000010414 supernatant solution Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 238000009281 ultraviolet germicidal irradiation Methods 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US19623180A | 1980-10-14 | 1980-10-14 |
Publications (2)
Publication Number | Publication Date |
---|---|
JPS5795972A JPS5795972A (en) | 1982-06-15 |
JPS6157307B2 true JPS6157307B2 (fi) | 1986-12-06 |
Family
ID=22724544
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP56163370A Granted JPS5795972A (en) | 1980-10-14 | 1981-10-13 | 2-guanidino-4-heteroarylthiazole compound |
Country Status (6)
Country | Link |
---|---|
JP (1) | JPS5795972A (fi) |
HU (2) | HU191496B (fi) |
IN (2) | IN163170B (fi) |
PL (1) | PL135097B1 (fi) |
SU (3) | SU1311621A3 (fi) |
ZA (1) | ZA817047B (fi) |
Families Citing this family (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4997949A (en) * | 1986-10-29 | 1991-03-05 | Pfizer Inc. | Crystalline 2-(1-pentyl-3-guanidino)-4-(2-methyl-4-imidazolyl) thiazole dihydrochloride trihydrate |
IL95548A0 (en) * | 1989-09-15 | 1991-06-30 | Fujisawa Pharmaceutical Co | Thiazole derivatives,processes for the preparation thereof and pharmaceutical composition containing the same |
WO2013146754A1 (ja) * | 2012-03-27 | 2013-10-03 | 塩野義製薬株式会社 | Trpv4阻害活性を有する芳香族複素5員環誘導体 |
-
1981
- 1981-09-07 IN IN572/DEL/81A patent/IN163170B/en unknown
- 1981-10-13 HU HU833917A patent/HU191496B/hu not_active IP Right Cessation
- 1981-10-13 JP JP56163370A patent/JPS5795972A/ja active Granted
- 1981-10-13 ZA ZA817047A patent/ZA817047B/xx unknown
- 1981-10-13 HU HU833916A patent/HU192826B/hu not_active IP Right Cessation
- 1981-10-14 PL PL24164581A patent/PL135097B1/pl unknown
-
1982
- 1982-09-17 SU SU823491025A patent/SU1311621A3/ru active
- 1982-09-17 SU SU823493197A patent/SU1217258A3/ru active
- 1982-09-17 SU SU823495554A patent/SU1205768A3/ru active
-
1985
- 1985-02-13 IN IN120/DEL/85A patent/IN163394B/en unknown
Also Published As
Publication number | Publication date |
---|---|
HU192826B (en) | 1987-07-28 |
IN163394B (fi) | 1988-09-17 |
ZA817047B (en) | 1982-09-29 |
SU1311621A3 (ru) | 1987-05-15 |
SU1205768A3 (ru) | 1986-01-15 |
PL135097B1 (en) | 1985-09-30 |
JPS5795972A (en) | 1982-06-15 |
PL241645A1 (en) | 1983-11-21 |
IN163170B (fi) | 1988-08-20 |
SU1217258A3 (ru) | 1986-03-07 |
HU191496B (en) | 1987-02-27 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
EP0050458B1 (en) | 2-guanidino-4-heteroarylthiazoles and pharmaceutical compositions containing them | |
EP0161841B1 (en) | 2-(n-substituteguanidino)-4-hetero-arylthiazole antiulcer agents | |
HU184259B (en) | Process for producing 2-imidazoline derivatives | |
HU212302B (en) | Process for producing imidazole guanidine derivatives and pharmaceutical compositions containing them | |
EP0094191B1 (en) | Antiulcer 2-guanidino-4-(2-substituted-amino-4-imidazolyl)-thiazoles and process therefor | |
GB2096987A (en) | Substituted imidazole and imidazole derivatives and their preparation and use | |
US5025015A (en) | Thioformamidines, and use as medicaments | |
JPS60105672A (ja) | 胃抗分泌剤としてのチアトリアジンジオキサイド類 | |
EP0102227B1 (en) | 2(1h)-pyridinones, useful as cardiotonic agents, and their production | |
JPS6157307B2 (fi) | ||
US4590299A (en) | 2-guanidino-4-heteroarylthiazoles | |
DE3336409A1 (de) | Chinazolinderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
HU201059B (en) | Process for producing 6-oxo-pyridazine derivatives and pharmaceutical compositions containing them | |
EP0074229B1 (en) | Triazole gastric anti-secretory agents | |
US4452987A (en) | Haloacetyl imidazoles | |
US4808727A (en) | Imidazolium hydrogen carbonates | |
US4510313A (en) | 2-Guanidino-4-heteroarylthiazoles | |
US4468399A (en) | 2-[2-(2-Aminoalkyl-4-thiazolylmethylthio)alkyl]-amino-5-substituted-4-pyrimidones | |
NZ207258A (en) | Substituted imidazoles | |
JPH0680041B2 (ja) | 2−ピリジル酢酸誘導体、その製法およびそれを含む医薬 | |
NZ207257A (en) | 2-guanidino-thiazoles | |
JPH02304086A (ja) | ジアジン誘導体、それらの製造方法およびそれらの化合物を含む医薬 | |
US4544659A (en) | Schistosomicidal acridanone hydrazones | |
DE2628642A1 (de) | In 2-stellung substituierte 1,3-diazacycloverbindungen, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
CS235969B2 (cs) | Způsob výroby 2-guanidino-4-thiazolylthiazolů |