JPS5948829B2 - 3↓−フエニル↓−4(1h)ピリジンチオン類およびその塩類の製法 - Google Patents
3↓−フエニル↓−4(1h)ピリジンチオン類およびその塩類の製法Info
- Publication number
- JPS5948829B2 JPS5948829B2 JP58116827A JP11682783A JPS5948829B2 JP S5948829 B2 JPS5948829 B2 JP S5948829B2 JP 58116827 A JP58116827 A JP 58116827A JP 11682783 A JP11682783 A JP 11682783A JP S5948829 B2 JPS5948829 B2 JP S5948829B2
- Authority
- JP
- Japan
- Prior art keywords
- pyridone
- production example
- methyl
- yield
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 35
- 150000003839 salts Chemical class 0.000 title claims description 18
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical class SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 82
- -1 3-phenyl-4-(1H)pyridinethiones Chemical class 0.000 claims description 37
- 125000000217 alkyl group Chemical group 0.000 claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 229910052736 halogen Inorganic materials 0.000 claims description 13
- 239000000126 substance Substances 0.000 claims description 13
- 150000002367 halogens Chemical class 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 description 283
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 48
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 44
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 43
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 34
- 239000000203 mixture Substances 0.000 description 31
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 30
- 238000006243 chemical reaction Methods 0.000 description 24
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 125000003118 aryl group Chemical group 0.000 description 21
- 238000002360 preparation method Methods 0.000 description 21
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000000243 solution Substances 0.000 description 17
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 14
- 239000003795 chemical substances by application Substances 0.000 description 14
- 239000002994 raw material Substances 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 150000001412 amines Chemical class 0.000 description 12
- 239000000543 intermediate Substances 0.000 description 12
- 150000002576 ketones Chemical class 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 11
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 11
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 10
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 10
- 238000006170 formylation reaction Methods 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 9
- 239000000284 extract Substances 0.000 description 9
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 230000022244 formylation Effects 0.000 description 8
- 238000001819 mass spectrum Methods 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 7
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 7
- 238000003786 synthesis reaction Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 150000004820 halides Chemical class 0.000 description 6
- 239000004009 herbicide Substances 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- YWBVHLJPRPCRSD-UHFFFAOYSA-N Fluridone Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC=C1 YWBVHLJPRPCRSD-UHFFFAOYSA-N 0.000 description 5
- 101100272391 Schizosaccharomyces pombe (strain 972 / ATCC 24843) bgs1 gene Proteins 0.000 description 5
- 238000007429 general method Methods 0.000 description 5
- 230000002363 herbicidal effect Effects 0.000 description 5
- 230000001590 oxidative effect Effects 0.000 description 5
- YFKBXYGUSOXJGS-UHFFFAOYSA-N 1,3-Diphenyl-2-propanone Chemical compound C=1C=CC=CC=1CC(=O)CC1=CC=CC=C1 YFKBXYGUSOXJGS-UHFFFAOYSA-N 0.000 description 4
- MHBVFQPMQKODRK-UHFFFAOYSA-N 1-phenyl-3-[3-(trifluoromethyl)phenyl]propan-2-one Chemical compound FC(F)(F)C1=CC=CC(CC(=O)CC=2C=CC=CC=2)=C1 MHBVFQPMQKODRK-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- XPOLVIIHTDKJRY-UHFFFAOYSA-N acetic acid;methanimidamide Chemical compound NC=N.CC(O)=O XPOLVIIHTDKJRY-UHFFFAOYSA-N 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 239000000010 aprotic solvent Substances 0.000 description 3
- 229940125904 compound 1 Drugs 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- HNPCDFJZADHNHD-UHFFFAOYSA-N n-(diformamidomethyl)formamide Chemical compound O=CNC(NC=O)NC=O HNPCDFJZADHNHD-UHFFFAOYSA-N 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 2
- LZQWXHXEBCOWNT-UHFFFAOYSA-N 1-methyl-3,5-diphenylpyridin-4-one Chemical compound O=C1C(C=2C=CC=CC=2)=CN(C)C=C1C1=CC=CC=C1 LZQWXHXEBCOWNT-UHFFFAOYSA-N 0.000 description 2
- FMKVJFMYKQKHRA-UHFFFAOYSA-N 3,5-bis(3-chlorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C=C(Cl)C=CC=2)=CN(C)C=C1C1=CC=CC(Cl)=C1 FMKVJFMYKQKHRA-UHFFFAOYSA-N 0.000 description 2
- QSURMNTYIIOVHX-UHFFFAOYSA-N 3,5-diphenyl-1h-pyridin-4-one Chemical compound O=C1C(C=2C=CC=CC=2)=CNC=C1C1=CC=CC=C1 QSURMNTYIIOVHX-UHFFFAOYSA-N 0.000 description 2
- WVQHJTMQSOGRMR-UHFFFAOYSA-N 3-(4-methoxyphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound C1=CC(OC)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 WVQHJTMQSOGRMR-UHFFFAOYSA-N 0.000 description 2
- GCNTZFIIOFTKIY-UHFFFAOYSA-N 4-hydroxypyridine Chemical compound OC1=CC=NC=C1 GCNTZFIIOFTKIY-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 230000002152 alkylating effect Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 229940075894 denatured ethanol Drugs 0.000 description 2
- AVGAIPMGSIOHFZ-UHFFFAOYSA-N dichloromethane;2-propan-2-yloxypropane Chemical compound ClCCl.CC(C)OC(C)C AVGAIPMGSIOHFZ-UHFFFAOYSA-N 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- JYRCAWKOBDYVHA-UHFFFAOYSA-N ethyl 1-methyl-4-oxo-5-phenylpyridine-3-carboxylate Chemical compound O=C1C(C(=O)OCC)=CN(C)C=C1C1=CC=CC=C1 JYRCAWKOBDYVHA-UHFFFAOYSA-N 0.000 description 2
- 229940087669 ferate Drugs 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 125000001475 halogen functional group Chemical group 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- OIRDBPQYVWXNSJ-UHFFFAOYSA-N methyl trifluoromethansulfonate Chemical compound COS(=O)(=O)C(F)(F)F OIRDBPQYVWXNSJ-UHFFFAOYSA-N 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- DPLUMPJQXVYXBH-UHFFFAOYSA-N n,n-diethyl-2-phenylethenamine Chemical compound CCN(CC)C=CC1=CC=CC=C1 DPLUMPJQXVYXBH-UHFFFAOYSA-N 0.000 description 2
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 150000004040 pyrrolidinones Chemical class 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 238000001308 synthesis method Methods 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- PIMZJOMHOCTTIH-UHFFFAOYSA-N (4-oxo-3,5-diphenylpyridin-1-yl) acetate Chemical compound O=C1C(C=2C=CC=CC=2)=CN(OC(=O)C)C=C1C1=CC=CC=C1 PIMZJOMHOCTTIH-UHFFFAOYSA-N 0.000 description 1
- QRDAPCMJAOQZSU-KQQUZDAGSA-N (e)-3-[4-[(e)-3-(3-fluorophenyl)-3-oxoprop-1-enyl]-1-methylpyrrol-2-yl]-n-hydroxyprop-2-enamide Chemical compound C1=C(\C=C\C(=O)NO)N(C)C=C1\C=C\C(=O)C1=CC=CC(F)=C1 QRDAPCMJAOQZSU-KQQUZDAGSA-N 0.000 description 1
- SQJRILFFLWFHGB-UHFFFAOYSA-N 1,2,6-trimethyl-3,5-diphenylpyridin-4-one Chemical compound O=C1C(C=2C=CC=CC=2)=C(C)N(C)C(C)=C1C1=CC=CC=C1 SQJRILFFLWFHGB-UHFFFAOYSA-N 0.000 description 1
- VUCOOHFGXBBVGC-UHFFFAOYSA-N 1,3-dimethyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 VUCOOHFGXBBVGC-UHFFFAOYSA-N 0.000 description 1
- OUNWYVVLDFECCQ-UHFFFAOYSA-N 1,3-dimethyl-5-phenylpyridin-4-one Chemical compound O=C1C(C)=CN(C)C=C1C1=CC=CC=C1 OUNWYVVLDFECCQ-UHFFFAOYSA-N 0.000 description 1
- TVOAVJJIMKFWGP-UHFFFAOYSA-N 1-(2,4-dichlorophenyl)-3-phenylpropan-2-one Chemical compound ClC1=CC(Cl)=CC=C1CC(=O)CC1=CC=CC=C1 TVOAVJJIMKFWGP-UHFFFAOYSA-N 0.000 description 1
- RLCAUJHSDBSXLB-UHFFFAOYSA-N 1-(dimethylamino)-3,5-diphenylpyridin-4-one Chemical compound O=C1C(C=2C=CC=CC=2)=CN(N(C)C)C=C1C1=CC=CC=C1 RLCAUJHSDBSXLB-UHFFFAOYSA-N 0.000 description 1
- PPNCOQHHSGMKGI-UHFFFAOYSA-N 1-cyclononyldiazonane Chemical compound C1CCCCCCCC1N1NCCCCCCC1 PPNCOQHHSGMKGI-UHFFFAOYSA-N 0.000 description 1
- VZAWCLCJGSBATP-UHFFFAOYSA-N 1-cycloundecyl-1,2-diazacycloundecane Chemical compound C1CCCCCCCCCC1N1NCCCCCCCCC1 VZAWCLCJGSBATP-UHFFFAOYSA-N 0.000 description 1
- PZHIWRCQKBBTOW-UHFFFAOYSA-N 1-ethoxybutane Chemical compound CCCCOCC PZHIWRCQKBBTOW-UHFFFAOYSA-N 0.000 description 1
- NVJUHMXYKCUMQA-UHFFFAOYSA-N 1-ethoxypropane Chemical compound CCCOCC NVJUHMXYKCUMQA-UHFFFAOYSA-N 0.000 description 1
- YHAXFLHORZBWCZ-UHFFFAOYSA-N 1-ethyl-3,5-diphenylpyridin-4-one Chemical compound O=C1C(C=2C=CC=CC=2)=CN(CC)C=C1C1=CC=CC=C1 YHAXFLHORZBWCZ-UHFFFAOYSA-N 0.000 description 1
- WBUMGFVLCKFELD-UHFFFAOYSA-N 1-ethyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(CC)C=C1C1=CC=CC=C1 WBUMGFVLCKFELD-UHFFFAOYSA-N 0.000 description 1
- NDVIWLZRPODGER-UHFFFAOYSA-N 1-hydroxy-3,5-diphenylpyridin-4-one Chemical compound O=C1C(C=2C=CC=CC=2)=CN(O)C=C1C1=CC=CC=C1 NDVIWLZRPODGER-UHFFFAOYSA-N 0.000 description 1
- UYQYJQGFVUSHQS-UHFFFAOYSA-N 1-methoxy-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(OC)C=C1C1=CC=CC=C1 UYQYJQGFVUSHQS-UHFFFAOYSA-N 0.000 description 1
- LKKJQHHZMHXZQZ-UHFFFAOYSA-N 1-methyl-3,5-bis(4-methylphenyl)pyridin-4-one Chemical compound C1=CC(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=C(C)C=C1 LKKJQHHZMHXZQZ-UHFFFAOYSA-N 0.000 description 1
- WCPKPTIZAQAYLU-UHFFFAOYSA-N 1-methyl-3,5-diphenylpyridine-4-thione Chemical compound S=C1C(C=2C=CC=CC=2)=CN(C)C=C1C1=CC=CC=C1 WCPKPTIZAQAYLU-UHFFFAOYSA-N 0.000 description 1
- DOWJIZDWBUSYHL-UHFFFAOYSA-N 1-methyl-3-(2,2,2-trifluoroethoxy)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CN1C=C(OCC(F)(F)F)C(=O)C(C=2C=C(C=CC=2)C(F)(F)F)=C1 DOWJIZDWBUSYHL-UHFFFAOYSA-N 0.000 description 1
- LSCADUVZHBDNDQ-UHFFFAOYSA-N 1-methyl-3-(2-methyl-5-nitrophenyl)-5-phenylpyridin-4-one Chemical compound CC1=CC=C([N+]([O-])=O)C=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1 LSCADUVZHBDNDQ-UHFFFAOYSA-N 0.000 description 1
- QOYMDVZODDSWDA-UHFFFAOYSA-N 1-methyl-3-(2-methylphenyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CC1=CC=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 QOYMDVZODDSWDA-UHFFFAOYSA-N 0.000 description 1
- VAQXEKOOZVVGDQ-UHFFFAOYSA-N 1-methyl-3-(2-methylphenyl)-5-phenylpyridin-4-one Chemical compound CC1=CC=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1 VAQXEKOOZVVGDQ-UHFFFAOYSA-N 0.000 description 1
- FZCFUDJDBFANJW-UHFFFAOYSA-N 1-methyl-3-(2-nitrophenyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CN1C=C(C(C(=C1)C1=CC(=CC=C1)C(F)(F)F)=O)C1=C(C=CC=C1)[N+](=O)[O-] FZCFUDJDBFANJW-UHFFFAOYSA-N 0.000 description 1
- NVWXNJCQVUGHGO-UHFFFAOYSA-N 1-methyl-3-(3-methylphenyl)-5-phenylpyridin-4-one Chemical compound CC1=CC=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 NVWXNJCQVUGHGO-UHFFFAOYSA-N 0.000 description 1
- WFADELHOIGJNEN-UHFFFAOYSA-N 1-methyl-3-(3-methylsulfanylphenyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CSC1=CC=CC(C=2C(C(C=3C=C(C=CC=3)C(F)(F)F)=CN(C)C=2)=O)=C1 WFADELHOIGJNEN-UHFFFAOYSA-N 0.000 description 1
- XJXZWVLPPDGJLX-UHFFFAOYSA-N 1-methyl-3-(3-methylsulfinylphenyl)-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)S(C)=O)=CN(C)C=C1C1=CC=CC=C1 XJXZWVLPPDGJLX-UHFFFAOYSA-N 0.000 description 1
- DICIFTSQDRTGOQ-UHFFFAOYSA-N 1-methyl-3-(3-methylsulfonylphenyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)S(C)(=O)=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 DICIFTSQDRTGOQ-UHFFFAOYSA-N 0.000 description 1
- CMQIZHSMOTZCMX-UHFFFAOYSA-N 1-methyl-3-(3-methylsulfonylphenyl)-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)S(C)(=O)=O)=CN(C)C=C1C1=CC=CC=C1 CMQIZHSMOTZCMX-UHFFFAOYSA-N 0.000 description 1
- AXWUPLVZAACQLG-UHFFFAOYSA-N 1-methyl-3-(3-phenoxyphenyl)-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(OC=3C=CC=CC=3)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 AXWUPLVZAACQLG-UHFFFAOYSA-N 0.000 description 1
- MZLMRWPMJUSWOT-UHFFFAOYSA-N 1-methyl-3-(4-methylphenyl)-5-phenylpyridin-4-one Chemical compound C1=CC(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1 MZLMRWPMJUSWOT-UHFFFAOYSA-N 0.000 description 1
- HKQPYORMKJHZBT-UHFFFAOYSA-N 1-methyl-3-(4-nitrophenyl)-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=CC(=CC=2)[N+]([O-])=O)=CN(C)C=C1C1=CC=CC=C1 HKQPYORMKJHZBT-UHFFFAOYSA-N 0.000 description 1
- SFTGMPOVCUJIII-UHFFFAOYSA-N 1-methyl-3-(4-phenylmethoxyphenyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C(C=C1)=CC=C1OCC1=CC=CC=C1 SFTGMPOVCUJIII-UHFFFAOYSA-N 0.000 description 1
- OULBRLRWNPCELD-UHFFFAOYSA-N 1-methyl-3-[3-(2-methylpropyl)phenyl]-5-phenylpyridin-4-one Chemical compound CC(C)CC1=CC=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 OULBRLRWNPCELD-UHFFFAOYSA-N 0.000 description 1
- RSOHWPQLQIHLMP-UHFFFAOYSA-N 1-methyl-3-[3-(4-nitrophenoxy)phenyl]-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(OC=3C=CC(=CC=3)[N+]([O-])=O)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 RSOHWPQLQIHLMP-UHFFFAOYSA-N 0.000 description 1
- VJRIXDIYCWJUSG-UHFFFAOYSA-N 1-methyl-3-[3-(trifluoromethyl)phenyl]-5-(trifluoromethylsulfanyl)pyridin-4-one Chemical compound CN1C=C(SC(F)(F)F)C(=O)C(C=2C=C(C=CC=2)C(F)(F)F)=C1 VJRIXDIYCWJUSG-UHFFFAOYSA-N 0.000 description 1
- PNDRLSCUGGMUJC-UHFFFAOYSA-N 1-methyl-3-[3-(trifluoromethyl)phenyl]-5-(trifluoromethylsulfonyl)pyridin-4-one Chemical compound CN1C=C(C(=O)C(=C1)S(=O)(=O)C(F)(F)F)C1=CC(=CC=C1)C(F)(F)F PNDRLSCUGGMUJC-UHFFFAOYSA-N 0.000 description 1
- IASIQNJYUQGOLO-UHFFFAOYSA-N 1-methyl-3-[3-(trifluoromethyl)phenyl]-5-[3-(trifluoromethylsulfonyl)phenyl]pyridin-4-one Chemical compound CN1C=C(C(C(=C1)C1=CC(=CC=C1)S(=O)(=O)C(F)(F)F)=O)C1=CC(=CC=C1)C(F)(F)F IASIQNJYUQGOLO-UHFFFAOYSA-N 0.000 description 1
- SBERCJBUNCPWER-UHFFFAOYSA-N 1-methyl-3-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CN1C=CC(=O)C(C=2C=C(C=CC=2)C(F)(F)F)=C1 SBERCJBUNCPWER-UHFFFAOYSA-N 0.000 description 1
- JSQKCFKULSYABM-UHFFFAOYSA-N 1-methyl-3-naphthalen-1-yl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C3=CC=CC=C3C=CC=2)=CN(C)C=C1C1=CC=CC=C1 JSQKCFKULSYABM-UHFFFAOYSA-N 0.000 description 1
- IFKAIWRSFKDBLQ-UHFFFAOYSA-N 1-methyl-3-phenoxy-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1OC1=CC=CC=C1 IFKAIWRSFKDBLQ-UHFFFAOYSA-N 0.000 description 1
- ASJJPJQACIYAOB-UHFFFAOYSA-N 1-methyl-3-phenoxy-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=CC=CC=2)=CN(C)C=C1OC1=CC=CC=C1 ASJJPJQACIYAOB-UHFFFAOYSA-N 0.000 description 1
- WNFQVYWKHPEKFJ-UHFFFAOYSA-N 1-methyl-3-phenyl-5-(3-phenylmethoxyphenyl)pyridin-4-one Chemical compound O=C1C(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 WNFQVYWKHPEKFJ-UHFFFAOYSA-N 0.000 description 1
- KALGMRMJLBYJOT-UHFFFAOYSA-N 1-methyl-3-phenyl-5-(3-phenylphenyl)pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C=2C=CC=CC=2)=CN(C)C=C1C1=CC=CC=C1 KALGMRMJLBYJOT-UHFFFAOYSA-N 0.000 description 1
- BFVBEBPEOKKCOE-UHFFFAOYSA-N 1-methyl-3-phenyl-5-(3-propan-2-yloxyphenyl)pyridin-4-one Chemical compound CC(C)OC1=CC=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 BFVBEBPEOKKCOE-UHFFFAOYSA-N 0.000 description 1
- DNVBKAXQOJQGDY-UHFFFAOYSA-N 1-methyl-3-phenyl-5-(3-propoxyphenyl)pyridin-4-one Chemical compound CCCOC1=CC=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 DNVBKAXQOJQGDY-UHFFFAOYSA-N 0.000 description 1
- KGSHDRQNZDJRNQ-UHFFFAOYSA-N 1-methyl-3-phenyl-5-[2-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C(=CC=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC=C1 KGSHDRQNZDJRNQ-UHFFFAOYSA-N 0.000 description 1
- VSPRRCMVOPLABC-UHFFFAOYSA-N 1-methyl-3-phenyl-5-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(OC(F)(F)C(F)F)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 VSPRRCMVOPLABC-UHFFFAOYSA-N 0.000 description 1
- MGVVCRMNSFVLTM-UHFFFAOYSA-N 1-methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridine-4-thione Chemical compound S=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC=C1 MGVVCRMNSFVLTM-UHFFFAOYSA-N 0.000 description 1
- IZFKPAXPUNKHMT-UHFFFAOYSA-N 1-methyl-3-phenyl-5-[4-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=CC(=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC=C1 IZFKPAXPUNKHMT-UHFFFAOYSA-N 0.000 description 1
- RXXDETDGFHGNGL-UHFFFAOYSA-N 1-methyl-3-phenyl-5-thiophen-3-ylpyridin-4-one Chemical compound O=C1C(C=2C=CC=CC=2)=CN(C)C=C1C=1C=CSC=1 RXXDETDGFHGNGL-UHFFFAOYSA-N 0.000 description 1
- JLPJUTBNKUKCTC-UHFFFAOYSA-N 1-methyl-3-phenylpyridin-4-one Chemical compound CN1C=CC(=O)C(C=2C=CC=CC=2)=C1 JLPJUTBNKUKCTC-UHFFFAOYSA-N 0.000 description 1
- FHLKGSLPWFPPRG-UHFFFAOYSA-N 1-methyl-3-phenylsulfanyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1SC1=CC=CC=C1 FHLKGSLPWFPPRG-UHFFFAOYSA-N 0.000 description 1
- YFRWLIMGZKMSLL-UHFFFAOYSA-N 1-methyl-3-propan-2-yloxy-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(OC(C)C)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 YFRWLIMGZKMSLL-UHFFFAOYSA-N 0.000 description 1
- UJGIVLUARJLMDC-UHFFFAOYSA-N 1-methyl-3-propan-2-ylsulfanyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(SC(C)C)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 UJGIVLUARJLMDC-UHFFFAOYSA-N 0.000 description 1
- QXIPCVZWIYWEEP-UHFFFAOYSA-N 1-methyl-3-propylsulfanyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(SCCC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 QXIPCVZWIYWEEP-UHFFFAOYSA-N 0.000 description 1
- NKYUFELENRTQSR-UHFFFAOYSA-N 1-methyl-4-oxo-5-[3-(trifluoromethyl)phenyl]pyridine-3-carbonitrile Chemical compound CN1C=C(C#N)C(=O)C(C=2C=C(C=CC=2)C(F)(F)F)=C1 NKYUFELENRTQSR-UHFFFAOYSA-N 0.000 description 1
- DGYQMWOGVUXAFM-UHFFFAOYSA-N 1-phenylpyridin-4-one Chemical compound C1=CC(=O)C=CN1C1=CC=CC=C1 DGYQMWOGVUXAFM-UHFFFAOYSA-N 0.000 description 1
- XCPXCDAWEGOORH-UHFFFAOYSA-N 1-phenylpyridine-4-thione Chemical class C1=CC(=S)C=CN1C1=CC=CC=C1 XCPXCDAWEGOORH-UHFFFAOYSA-N 0.000 description 1
- MKWZHMTUFPPAIH-UHFFFAOYSA-N 2-(3-methylsulfanylphenyl)acetyl chloride Chemical compound CSC1=CC=CC(CC(Cl)=O)=C1 MKWZHMTUFPPAIH-UHFFFAOYSA-N 0.000 description 1
- CRNHLPZBBWBNDN-UHFFFAOYSA-N 2-(dimethylamino)prop-2-enenitrile Chemical compound CN(C)C(=C)C#N CRNHLPZBBWBNDN-UHFFFAOYSA-N 0.000 description 1
- MVCDHDAQVUTDDT-UHFFFAOYSA-N 2-(dimethylaminomethylidene)-3-oxo-4-phenylbutanenitrile Chemical compound CN(C)C=C(C#N)C(=O)CC1=CC=CC=C1 MVCDHDAQVUTDDT-UHFFFAOYSA-N 0.000 description 1
- XFCIAFOVJQVPLB-UHFFFAOYSA-N 2-[3-(1-methyl-4-oxo-5-phenylpyridin-3-yl)phenoxy]acetonitrile Chemical compound O=C1C(C=2C=C(OCC#N)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 XFCIAFOVJQVPLB-UHFFFAOYSA-N 0.000 description 1
- WMEZXURLOVCDTP-UHFFFAOYSA-N 2-[4-oxo-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-1-yl]propanoic acid Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C(C(O)=O)C)C=C1C1=CC=CC=C1 WMEZXURLOVCDTP-UHFFFAOYSA-N 0.000 description 1
- ULQQGOGMQRGFFR-UHFFFAOYSA-N 2-chlorobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=CC=C1Cl ULQQGOGMQRGFFR-UHFFFAOYSA-N 0.000 description 1
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical compound O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 description 1
- KRLZDKGJNOXHNY-UHFFFAOYSA-N 3,5-bis(3,4-dimethoxyphenyl)-1-methylpyridin-4-one Chemical compound C1=C(OC)C(OC)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=C(OC)C(OC)=C1 KRLZDKGJNOXHNY-UHFFFAOYSA-N 0.000 description 1
- LVWMUEHLPPAIRJ-UHFFFAOYSA-N 3,5-bis(3,5-dichlorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C=C(Cl)C=C(Cl)C=2)=CN(C)C=C1C1=CC(Cl)=CC(Cl)=C1 LVWMUEHLPPAIRJ-UHFFFAOYSA-N 0.000 description 1
- GATKNVWDUBJPFQ-UHFFFAOYSA-N 3,5-bis(3-chlorophenyl)-1-methylpyridine-4-thione Chemical compound S=C1C(C=2C=C(Cl)C=CC=2)=CN(C)C=C1C1=CC=CC(Cl)=C1 GATKNVWDUBJPFQ-UHFFFAOYSA-N 0.000 description 1
- YAFTYUDWIFJZJP-UHFFFAOYSA-N 3,5-bis(3-fluorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C=C(F)C=CC=2)=CN(C)C=C1C1=CC=CC(F)=C1 YAFTYUDWIFJZJP-UHFFFAOYSA-N 0.000 description 1
- DKMXZAGSGCAVPX-UHFFFAOYSA-N 3,5-dibenzyl-1-methylpyridin-4-one Chemical class O=C1C(CC=2C=CC=CC=2)=CN(C)C=C1CC1=CC=CC=C1 DKMXZAGSGCAVPX-UHFFFAOYSA-N 0.000 description 1
- DWWFABVQLMOKDT-UHFFFAOYSA-N 3,5-diphenyl-1-propylpyridin-4-one Chemical compound O=C1C(C=2C=CC=CC=2)=CN(CCC)C=C1C1=CC=CC=C1 DWWFABVQLMOKDT-UHFFFAOYSA-N 0.000 description 1
- XWDHZBMZZGGMKI-UHFFFAOYSA-N 3-(1-methyl-4-oxo-5-phenylpyridin-3-yl)benzoic acid Chemical compound O=C1C(C=2C=C(C=CC=2)C(O)=O)=CN(C)C=C1C1=CC=CC=C1 XWDHZBMZZGGMKI-UHFFFAOYSA-N 0.000 description 1
- DLELCFFLQFMLKG-UHFFFAOYSA-N 3-(1-methyl-4-oxo-5-phenylpyridin-3-yl)benzonitrile Chemical compound O=C1C(C=2C=C(C=CC=2)C#N)=CN(C)C=C1C1=CC=CC=C1 DLELCFFLQFMLKG-UHFFFAOYSA-N 0.000 description 1
- QFDMBPKNRMDYKG-UHFFFAOYSA-N 3-(2,3-dichlorophenoxy)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1OC1=CC=CC(Cl)=C1Cl QFDMBPKNRMDYKG-UHFFFAOYSA-N 0.000 description 1
- KCMNYFXGYDTIFL-UHFFFAOYSA-N 3-(2,4-dimethylphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CC1=CC(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 KCMNYFXGYDTIFL-UHFFFAOYSA-N 0.000 description 1
- ZWAUCPHSIQTYLG-UHFFFAOYSA-N 3-(2,4-dimethylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound CC1=CC(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1 ZWAUCPHSIQTYLG-UHFFFAOYSA-N 0.000 description 1
- ZKYJSUFRSLIXPD-UHFFFAOYSA-N 3-(2,5-dichlorophenoxy)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1OC1=CC(Cl)=CC=C1Cl ZKYJSUFRSLIXPD-UHFFFAOYSA-N 0.000 description 1
- LYPFCTNWIMCCOB-UHFFFAOYSA-N 3-(2,5-dichlorophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=C(Cl)C=2)Cl)=CN(C)C=C1C1=CC=CC=C1 LYPFCTNWIMCCOB-UHFFFAOYSA-N 0.000 description 1
- FOJXTTOFFRYKAV-UHFFFAOYSA-N 3-(2,5-dimethylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound CC1=CC=C(C)C(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 FOJXTTOFFRYKAV-UHFFFAOYSA-N 0.000 description 1
- AEJMCABCUCESFJ-UHFFFAOYSA-N 3-(2,5-dimethylphenyl)-5-(3-fluorophenyl)-1-methylpyridin-4-one Chemical compound CC1=CC=C(C)C(C=2C(C(C=3C=C(F)C=CC=3)=CN(C)C=2)=O)=C1 AEJMCABCUCESFJ-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- CPSYCRJDDNLMEE-UHFFFAOYSA-N 3-(2-bromo-5-fluorophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=C(F)C=2)Br)=CN(C)C=C1C1=CC=CC=C1 CPSYCRJDDNLMEE-UHFFFAOYSA-N 0.000 description 1
- RQLIJAVEEKLTKO-UHFFFAOYSA-N 3-(2-chloro-4-fluorophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C(=CC(F)=CC=2)Cl)=CN(C)C=C1C1=CC=CC=C1 RQLIJAVEEKLTKO-UHFFFAOYSA-N 0.000 description 1
- GGZDJALKLYSDCA-UHFFFAOYSA-N 3-(2-chlorophenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C(=CC=CC=2)Cl)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 GGZDJALKLYSDCA-UHFFFAOYSA-N 0.000 description 1
- ODZNAGIUEIGDJZ-UHFFFAOYSA-N 3-(2-chlorophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=CC=2)Cl)=CN(C)C=C1C1=CC=CC=C1 ODZNAGIUEIGDJZ-UHFFFAOYSA-N 0.000 description 1
- FWYVBUIEQQCRFW-UHFFFAOYSA-N 3-(2-chlorophenyl)-5-(3-chlorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=CC=2)Cl)=CN(C)C=C1C1=CC=CC(Cl)=C1 FWYVBUIEQQCRFW-UHFFFAOYSA-N 0.000 description 1
- JRWOQCCEZSXGEL-UHFFFAOYSA-N 3-(2-ethylphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CCC1=CC=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 JRWOQCCEZSXGEL-UHFFFAOYSA-N 0.000 description 1
- GDCAIRWUPXXDIU-UHFFFAOYSA-N 3-(2-fluorophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=CC=2)F)=CN(C)C=C1C1=CC=CC=C1 GDCAIRWUPXXDIU-UHFFFAOYSA-N 0.000 description 1
- ZEPZQEHOYXDHQJ-UHFFFAOYSA-N 3-(2-methoxyphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound COC1=CC=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 ZEPZQEHOYXDHQJ-UHFFFAOYSA-N 0.000 description 1
- PBXTULAEMWJINZ-UHFFFAOYSA-N 3-(3,4-dichlorophenoxy)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1OC1=CC=C(Cl)C(Cl)=C1 PBXTULAEMWJINZ-UHFFFAOYSA-N 0.000 description 1
- UDECNRBAPYJGCP-UHFFFAOYSA-N 3-(3,4-dichlorophenyl)-1-methyl-5-(3-methylphenyl)pyridin-4-one Chemical compound CC1=CC=CC(C=2C(C(C=3C=C(Cl)C(Cl)=CC=3)=CN(C)C=2)=O)=C1 UDECNRBAPYJGCP-UHFFFAOYSA-N 0.000 description 1
- GEHCOIVJDFDXCA-UHFFFAOYSA-N 3-(3,4-dichlorophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(Cl)C(Cl)=CC=2)=CN(C)C=C1C1=CC=CC=C1 GEHCOIVJDFDXCA-UHFFFAOYSA-N 0.000 description 1
- PIUWANAMCWDMKO-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound C1=C(OC)C(OC)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 PIUWANAMCWDMKO-UHFFFAOYSA-N 0.000 description 1
- KQZJTTJVNZENGS-UHFFFAOYSA-N 3-(3,4-dimethylphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound C1=C(C)C(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 KQZJTTJVNZENGS-UHFFFAOYSA-N 0.000 description 1
- ANBYKRIWQYPJEJ-UHFFFAOYSA-N 3-(3,4-dimethylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound C1=C(C)C(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1 ANBYKRIWQYPJEJ-UHFFFAOYSA-N 0.000 description 1
- SHHCZAZJNIAXTK-UHFFFAOYSA-N 3-(3,5-dichlorophenoxy)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1OC1=CC(Cl)=CC(Cl)=C1 SHHCZAZJNIAXTK-UHFFFAOYSA-N 0.000 description 1
- UXMVRFNURBAMQM-UHFFFAOYSA-N 3-(3,5-dimethylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound CC1=CC(C)=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 UXMVRFNURBAMQM-UHFFFAOYSA-N 0.000 description 1
- YIKCZGOLVIJOSE-UHFFFAOYSA-N 3-(3-butylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound CCCCC1=CC=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 YIKCZGOLVIJOSE-UHFFFAOYSA-N 0.000 description 1
- BROKQSKIPUWDNJ-UHFFFAOYSA-N 3-(3-chlorophenyl)-1-methyl-5-[4-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(Cl)C=CC=2)=CN(C)C=C1C1=CC=C(C(F)(F)F)C=C1 BROKQSKIPUWDNJ-UHFFFAOYSA-N 0.000 description 1
- VGSSXFWMRBTFGW-UHFFFAOYSA-N 3-(3-chlorophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(Cl)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 VGSSXFWMRBTFGW-UHFFFAOYSA-N 0.000 description 1
- DADURMGVLSSPQU-UHFFFAOYSA-N 3-(3-chlorophenyl)-1-methyl-5-phenylpyridine-4-thione Chemical compound S=C1C(C=2C=C(Cl)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 DADURMGVLSSPQU-UHFFFAOYSA-N 0.000 description 1
- AGSMFDSNVKMHMJ-UHFFFAOYSA-N 3-(3-chlorophenyl)-5-(3,4-dichlorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C=C(Cl)C(Cl)=CC=2)=CN(C)C=C1C1=CC=CC(Cl)=C1 AGSMFDSNVKMHMJ-UHFFFAOYSA-N 0.000 description 1
- BKJNBZQCGWKLFF-UHFFFAOYSA-N 3-(3-chlorophenyl)-5-(3-fluorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C=C(Cl)C=CC=2)=CN(C)C=C1C1=CC=CC(F)=C1 BKJNBZQCGWKLFF-UHFFFAOYSA-N 0.000 description 1
- VYDIPUUHVAQORM-UHFFFAOYSA-N 3-(3-chlorophenyl)-5-(4-chlorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C=C(Cl)C=CC=2)=CN(C)C=C1C1=CC=C(Cl)C=C1 VYDIPUUHVAQORM-UHFFFAOYSA-N 0.000 description 1
- AIILUKTUHGOXHZ-UHFFFAOYSA-N 3-(3-decoxyphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound CCCCCCCCCCOC1=CC=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 AIILUKTUHGOXHZ-UHFFFAOYSA-N 0.000 description 1
- UBLZKCXQMBJKJZ-UHFFFAOYSA-N 3-(3-dodecoxyphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound CCCCCCCCCCCCOC1=CC=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 UBLZKCXQMBJKJZ-UHFFFAOYSA-N 0.000 description 1
- FNQAFOVJGCHDEM-UHFFFAOYSA-N 3-(3-ethoxyphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound CCOC1=CC=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 FNQAFOVJGCHDEM-UHFFFAOYSA-N 0.000 description 1
- YEARPEVMUDEHHJ-UHFFFAOYSA-N 3-(3-hexoxyphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound CCCCCCOC1=CC=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 YEARPEVMUDEHHJ-UHFFFAOYSA-N 0.000 description 1
- SRLLNDZOZYTJEY-UHFFFAOYSA-N 3-(3-hexylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound CCCCCCC1=CC=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 SRLLNDZOZYTJEY-UHFFFAOYSA-N 0.000 description 1
- MQBRCRADEZDHHH-UHFFFAOYSA-N 3-(3-hydroxyphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(O)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 MQBRCRADEZDHHH-UHFFFAOYSA-N 0.000 description 1
- FCFDJFGLLZGCJU-UHFFFAOYSA-N 3-(3-iodophenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC(I)=C1 FCFDJFGLLZGCJU-UHFFFAOYSA-N 0.000 description 1
- VKORWEFFLNLJNC-UHFFFAOYSA-N 3-(4-bromophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=CC(Br)=CC=2)=CN(C)C=C1C1=CC=CC=C1 VKORWEFFLNLJNC-UHFFFAOYSA-N 0.000 description 1
- GVMHHCUTYCEIOB-UHFFFAOYSA-N 3-(4-chlorophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=CC(Cl)=CC=2)=CN(C)C=C1C1=CC=CC=C1 GVMHHCUTYCEIOB-UHFFFAOYSA-N 0.000 description 1
- GJYOKNJWSIARGN-UHFFFAOYSA-N 3-(4-ethylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound C1=CC(CC)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1 GJYOKNJWSIARGN-UHFFFAOYSA-N 0.000 description 1
- PFHOINPYJMFSHA-UHFFFAOYSA-N 3-(4-hydroxyphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=C(O)C=C1 PFHOINPYJMFSHA-UHFFFAOYSA-N 0.000 description 1
- BDSYDSMHSRDZJN-UHFFFAOYSA-N 3-(4-methoxy-3-methylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound C1=C(C)C(OC)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1 BDSYDSMHSRDZJN-UHFFFAOYSA-N 0.000 description 1
- XXWJMYINKVSUSR-UHFFFAOYSA-N 3-(4-methoxyphenoxy)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound C1=CC(OC)=CC=C1OC(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 XXWJMYINKVSUSR-UHFFFAOYSA-N 0.000 description 1
- IISFJGVSBQHFMY-UHFFFAOYSA-N 3-(4-methoxyphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound C1=CC(OC)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1 IISFJGVSBQHFMY-UHFFFAOYSA-N 0.000 description 1
- PSESGFASJZSNPK-UHFFFAOYSA-N 3-(5-fluoro-2-iodophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=C(F)C=2)I)=CN(C)C=C1C1=CC=CC=C1 PSESGFASJZSNPK-UHFFFAOYSA-N 0.000 description 1
- FNHKZZDGBMRCBZ-UHFFFAOYSA-N 3-(benzenesulfonyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(S(=O)(=O)C=2C=CC=CC=2)=CN(C)C=C1C1=CC=CC=C1 FNHKZZDGBMRCBZ-UHFFFAOYSA-N 0.000 description 1
- MQHBHPDZECZJOQ-UHFFFAOYSA-N 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C(=CC=C(C=2)C(F)(F)F)Cl)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 MQHBHPDZECZJOQ-UHFFFAOYSA-N 0.000 description 1
- AKXCSXPKLFYIGS-UHFFFAOYSA-N 3-[2-chloro-5-(trifluoromethyl)phenyl]-5-ethylsulfanyl-1-methylpyridin-4-one Chemical compound O=C1C(SCC)=CN(C)C=C1C1=CC(C(F)(F)F)=CC=C1Cl AKXCSXPKLFYIGS-UHFFFAOYSA-N 0.000 description 1
- MYYZEDFHCWALFH-UHFFFAOYSA-N 3-[3-(1-fluoro-2-iodoethenoxy)phenyl]-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(OC(F)=CI)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 MYYZEDFHCWALFH-UHFFFAOYSA-N 0.000 description 1
- YRYAAALFYIMNGZ-UHFFFAOYSA-N 3-[3-(benzenesulfonyl)phenyl]-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)S(=O)(=O)C=2C=CC=CC=2)=CN(C)C=C1C1=CC=CC=C1 YRYAAALFYIMNGZ-UHFFFAOYSA-N 0.000 description 1
- GKTYNDMWRHSQRS-UHFFFAOYSA-N 3-[3-(cyclohexylmethoxy)phenyl]-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(OCC3CCCCC3)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 GKTYNDMWRHSQRS-UHFFFAOYSA-N 0.000 description 1
- RWHPEPHIFSBMSU-UHFFFAOYSA-N 3-[3-(cyclohexylmethyl)phenyl]-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(CC3CCCCC3)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 RWHPEPHIFSBMSU-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- XPJHGLKTMDGHGF-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-phenoxypyridin-4-one Chemical compound O=C1C(C=2C=C(C(Cl)=CC=2)C(F)(F)F)=CN(C)C=C1OC1=CC=CC=C1 XPJHGLKTMDGHGF-UHFFFAOYSA-N 0.000 description 1
- OSPYOQPKGLKIEB-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(C(Cl)=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC=C1 OSPYOQPKGLKIEB-UHFFFAOYSA-N 0.000 description 1
- WDVRXTMUHHKVKF-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-propan-2-ylpyridin-4-one Chemical compound O=C1C(C(C)C)=CN(C)C=C1C1=CC=C(Cl)C(C(F)(F)F)=C1 WDVRXTMUHHKVKF-UHFFFAOYSA-N 0.000 description 1
- RSUUQCLUXRFJPU-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-propylpyridin-4-one Chemical compound O=C1C(CCC)=CN(C)C=C1C1=CC=C(Cl)C(C(F)(F)F)=C1 RSUUQCLUXRFJPU-UHFFFAOYSA-N 0.000 description 1
- YXXOTUZRLVEUIA-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-propylsulfanylpyridin-4-one Chemical compound O=C1C(SCCC)=CN(C)C=C1C1=CC=C(Cl)C(C(F)(F)F)=C1 YXXOTUZRLVEUIA-UHFFFAOYSA-N 0.000 description 1
- OKPZCDJLJVZSGD-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-thiophen-2-ylpyridin-4-one Chemical compound O=C1C(C=2C=C(C(Cl)=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CS1 OKPZCDJLJVZSGD-UHFFFAOYSA-N 0.000 description 1
- ZBLXIJIVIVBIEG-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-5-ethoxy-1-methylpyridin-4-one Chemical compound O=C1C(OCC)=CN(C)C=C1C1=CC=C(Cl)C(C(F)(F)F)=C1 ZBLXIJIVIVBIEG-UHFFFAOYSA-N 0.000 description 1
- VYODLZOOLCDJRT-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-1-methylpyridin-4-one Chemical compound O=C1C(CC)=CN(C)C=C1C1=CC=C(Cl)C(C(F)(F)F)=C1 VYODLZOOLCDJRT-UHFFFAOYSA-N 0.000 description 1
- OUZSNPHZWQOJGC-UHFFFAOYSA-N 3-[5-(3-cyanophenyl)-1-methyl-4-oxopyridin-3-yl]benzonitrile Chemical compound O=C1C(C=2C=C(C=CC=2)C#N)=CN(C)C=C1C1=CC=CC(C#N)=C1 OUZSNPHZWQOJGC-UHFFFAOYSA-N 0.000 description 1
- AEDAJCBBHLCLET-UHFFFAOYSA-N 3-benzylsulfanyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1SCC1=CC=CC=C1 AEDAJCBBHLCLET-UHFFFAOYSA-N 0.000 description 1
- QWGPRTOTXRDOTR-UHFFFAOYSA-N 3-bromo-1-methyl-5-phenylpyridin-4-one Chemical compound CN1C=C(Br)C(=O)C(C=2C=CC=CC=2)=C1 QWGPRTOTXRDOTR-UHFFFAOYSA-N 0.000 description 1
- UMCITUWUFQERSL-UHFFFAOYSA-N 3-butyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(CCCC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 UMCITUWUFQERSL-UHFFFAOYSA-N 0.000 description 1
- SHQGRYNRHBVIBZ-UHFFFAOYSA-N 3-chloro-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CN1C=C(Cl)C(=O)C(C=2C=C(C=CC=2)C(F)(F)F)=C1 SHQGRYNRHBVIBZ-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- UORXULCUDVCPID-UHFFFAOYSA-N 3-cyclohexyl-5-(3-hydroxyphenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C=C(O)C=CC=2)=CN(C)C=C1C1CCCCC1 UORXULCUDVCPID-UHFFFAOYSA-N 0.000 description 1
- ZUOBJEZINDUQCJ-UHFFFAOYSA-N 3-ethoxy-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(OCC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 ZUOBJEZINDUQCJ-UHFFFAOYSA-N 0.000 description 1
- FYKWBGLIFZIRGF-UHFFFAOYSA-N 3-ethyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(CC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 FYKWBGLIFZIRGF-UHFFFAOYSA-N 0.000 description 1
- BYDRRHYWLSSFEA-UHFFFAOYSA-N 3-ethylsulfanyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(SCC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 BYDRRHYWLSSFEA-UHFFFAOYSA-N 0.000 description 1
- RXGJTLBOHFPKIJ-UHFFFAOYSA-N 3-ethylsulfinyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(S(=O)CC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 RXGJTLBOHFPKIJ-UHFFFAOYSA-N 0.000 description 1
- VBUKBPYRJKIOCT-UHFFFAOYSA-N 3-ethylsulfonyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(S(=O)(=O)CC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 VBUKBPYRJKIOCT-UHFFFAOYSA-N 0.000 description 1
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 1
- CWSFNHNDGDHJSH-UHFFFAOYSA-N 3-methoxy-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(OC)=CN(C)C=C1C1=CC=CC=C1 CWSFNHNDGDHJSH-UHFFFAOYSA-N 0.000 description 1
- MJMLSTGLMLIENC-UHFFFAOYSA-N 3-phenyl-1-(2,2,2-trifluoroethyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(CC(F)(F)F)C=C1C1=CC=CC=C1 MJMLSTGLMLIENC-UHFFFAOYSA-N 0.000 description 1
- VQLBXEGLWJBKNP-UHFFFAOYSA-N 3-phenyl-1-propyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(CCC)C=C1C1=CC=CC=C1 VQLBXEGLWJBKNP-UHFFFAOYSA-N 0.000 description 1
- IBMFYIVDYOTODR-UHFFFAOYSA-N 3-phenyl-5-[3-(trifluoromethyl)phenyl]-1h-pyridin-4-one Chemical compound FC(F)(F)C1=CC=CC(C=2C(C(C=3C=CC=CC=3)=CNC=2)=O)=C1 IBMFYIVDYOTODR-UHFFFAOYSA-N 0.000 description 1
- CHVUNUOUPGCNFK-UHFFFAOYSA-N 4-(diethylamino)-1-(3-methylsulfanylphenyl)-3-phenylbut-3-en-2-one Chemical compound C1(=CC=CC=C1)C(=CN(CC)CC)C(CC1=CC(=CC=C1)SC)=O CHVUNUOUPGCNFK-UHFFFAOYSA-N 0.000 description 1
- MBLBOIUOWKZNJP-UHFFFAOYSA-N 4-(diethylamino)-3-phenyl-1-(3-phenylmethoxyphenyl)but-3-en-2-one Chemical compound C(C1=CC=CC=C1)OC=1C=C(C=CC=1)CC(C(=CN(CC)CC)C1=CC=CC=C1)=O MBLBOIUOWKZNJP-UHFFFAOYSA-N 0.000 description 1
- QYRYUVIWPOZMLZ-UHFFFAOYSA-N 4-(dimethylamino)-1-phenyl-3-[3-(trifluoromethyl)phenyl]but-3-en-2-one Chemical compound CN(C=C(C(CC1=CC=CC=C1)=O)C1=CC(=CC=C1)C(F)(F)F)C QYRYUVIWPOZMLZ-UHFFFAOYSA-N 0.000 description 1
- DSSKDNJSUQDAMM-UHFFFAOYSA-N 4-(methylamino)-1-(3-methylsulfanylphenyl)-3-phenylbut-3-en-2-one Chemical compound CNC=C(C(CC1=CC(=CC=C1)SC)=O)C1=CC=CC=C1 DSSKDNJSUQDAMM-UHFFFAOYSA-N 0.000 description 1
- CUDWHBOIQURKST-UHFFFAOYSA-N 4-(methylamino)-1-phenyl-3-[3-(trifluoromethyl)phenyl]but-3-en-2-one Chemical compound CNC=C(C(=O)CC1=CC=CC=C1)C1=CC(=CC=C1)C(F)(F)F CUDWHBOIQURKST-UHFFFAOYSA-N 0.000 description 1
- JQXHZTRPYPYDLX-UHFFFAOYSA-N 4-(methylamino)-3-phenyl-1-(3-phenylmethoxyphenyl)but-3-en-2-one Chemical compound C=1C=CC=CC=1C(=CNC)C(=O)CC(C=1)=CC=CC=1OCC1=CC=CC=C1 JQXHZTRPYPYDLX-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- MQUZWSZXBNQJPS-UHFFFAOYSA-M 4-chloro-1-methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-1-ium;iodide Chemical compound [I-].C=1[N+](C)=CC(C=2C=CC=CC=2)=C(Cl)C=1C1=CC=CC(C(F)(F)F)=C1 MQUZWSZXBNQJPS-UHFFFAOYSA-M 0.000 description 1
- NXBMIOANBPZWEM-UHFFFAOYSA-M 4-chloro-3,5-bis(3-chlorophenyl)-1-methylpyridin-1-ium;chloride Chemical compound [Cl-].C=1[N+](C)=CC(C=2C=C(Cl)C=CC=2)=C(Cl)C=1C1=CC=CC(Cl)=C1 NXBMIOANBPZWEM-UHFFFAOYSA-M 0.000 description 1
- ZLCGFPVUPHBXEX-UHFFFAOYSA-N 4-chloro-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridine Chemical compound ClC1=C(C=NC=C1C1=CC(=CC=C1)C(F)(F)F)C1=CC=CC=C1 ZLCGFPVUPHBXEX-UHFFFAOYSA-N 0.000 description 1
- VCJQCODACDHTHE-UHFFFAOYSA-M 4-methoxy-1-methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-1-ium;trifluoromethanesulfonate Chemical compound [O-]S(=O)(=O)C(F)(F)F.COC1=C(C=2C=CC=CC=2)C=[N+](C)C=C1C1=CC=CC(C(F)(F)F)=C1 VCJQCODACDHTHE-UHFFFAOYSA-M 0.000 description 1
- JFACACRTOHUIJN-UHFFFAOYSA-N 5-(2,5-dimethoxyphenyl)-1-methyl-4-oxopyridine-3-carbonitrile Chemical compound COC1=CC=C(OC)C(C=2C(C(C#N)=CN(C)C=2)=O)=C1 JFACACRTOHUIJN-UHFFFAOYSA-N 0.000 description 1
- WTFUTSCZYYCBAY-SXBRIOAWSA-N 6-[(E)-C-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-N-hydroxycarbonimidoyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C/C(=N/O)/C1=CC2=C(NC(O2)=O)C=C1 WTFUTSCZYYCBAY-SXBRIOAWSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical class N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Chemical class 0.000 description 1
- WXWTZUAPMZFRHT-UHFFFAOYSA-N Br.BrC1CC(CCC1Br)C1=CN(C=C(C1=O)C1=CC(=CC=C1)C(F)(F)F)C Chemical compound Br.BrC1CC(CCC1Br)C1=CN(C=C(C1=O)C1=CC(=CC=C1)C(F)(F)F)C WXWTZUAPMZFRHT-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 102100026422 Carbamoyl-phosphate synthase [ammonia], mitochondrial Human genes 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 102100035024 Carboxypeptidase B Human genes 0.000 description 1
- UWNXGZKSIKQKAH-UHFFFAOYSA-N Cc1cc(CNC(CO)C(O)=O)c(OCc2cccc(c2)C#N)cc1OCc1cccc(c1C)-c1ccc2OCCOc2c1 Chemical compound Cc1cc(CNC(CO)C(O)=O)c(OCc2cccc(c2)C#N)cc1OCc1cccc(c1C)-c1ccc2OCCOc2c1 UWNXGZKSIKQKAH-UHFFFAOYSA-N 0.000 description 1
- YSVAKVSDOGYAHN-UHFFFAOYSA-N Cl.C(=O)(O)C=1C=C(C=CC1)C1=CN(C=C(C1=O)C1=CC=CC=C1)C Chemical compound Cl.C(=O)(O)C=1C=C(C=CC1)C1=CN(C=C(C1=O)C1=CC=CC=C1)C YSVAKVSDOGYAHN-UHFFFAOYSA-N 0.000 description 1
- QYCXZTVURDBPLB-UHFFFAOYSA-N Cl.CN1C=C(C(C(=C1)C1=CC=CC=C1)=O)C1=CC=CC=C1 Chemical compound Cl.CN1C=C(C(C(=C1)C1=CC=CC=C1)=O)C1=CC=CC=C1 QYCXZTVURDBPLB-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical class OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 1
- 101000855412 Homo sapiens Carbamoyl-phosphate synthase [ammonia], mitochondrial Proteins 0.000 description 1
- 101000946524 Homo sapiens Carboxypeptidase B Proteins 0.000 description 1
- 101000983292 Homo sapiens N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Proteins 0.000 description 1
- 101000861263 Homo sapiens Steroid 21-hydroxylase Proteins 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019213 POCl3 Inorganic materials 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- DMQMYEXVKFVCAX-UHFFFAOYSA-N [4-oxo-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-1-yl] acetate Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(OC(=O)C)C=C1C1=CC=CC=C1 DMQMYEXVKFVCAX-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000004042 decolorization Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 1
- KOFGDZXGFOTMDE-UHFFFAOYSA-N ethyl 3-(1-methyl-4-oxo-5-phenylpyridin-3-yl)benzoate Chemical compound CCOC(=O)C1=CC=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 KOFGDZXGFOTMDE-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Inorganic materials Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 1
- 150000002465 imidoyl halides Chemical class 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- MXIRPJHGXWFUAE-UHFFFAOYSA-N lithium;propan-1-olate Chemical compound [Li+].CCC[O-] MXIRPJHGXWFUAE-UHFFFAOYSA-N 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- MBXNQZHITVCSLJ-UHFFFAOYSA-N methyl fluorosulfonate Chemical compound COS(F)(=O)=O MBXNQZHITVCSLJ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000001035 methylating effect Effects 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229960001190 pheniramine Drugs 0.000 description 1
- QCCDLTOVEPVEJK-UHFFFAOYSA-N phenylacetone Chemical compound CC(=O)CC1=CC=CC=C1 QCCDLTOVEPVEJK-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- AAZYNPCMLRQUHI-UHFFFAOYSA-N propan-2-one;2-propan-2-yloxypropane Chemical compound CC(C)=O.CC(C)OC(C)C AAZYNPCMLRQUHI-UHFFFAOYSA-N 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- NSKGQURZWSPSBC-VVPCINPTSA-N ribostamycin Chemical compound N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O[C@H]2[C@@H]([C@H](O)[C@@H](CO)O2)O)[C@@H](O)[C@H](N)C[C@@H]1N NSKGQURZWSPSBC-VVPCINPTSA-N 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M toluenesulfonate group Chemical group C=1(C(=CC=CC1)S(=O)(=O)[O-])C LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N vinyl methyl ketone Natural products CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/69—Two or more oxygen atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/68—One oxygen atom attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
- C07D213/85—Nitriles in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/89—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US50142474A | 1974-08-28 | 1974-08-28 | |
| US501424 | 1974-08-28 | ||
| US591661 | 1975-07-03 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5916877A JPS5916877A (ja) | 1984-01-28 |
| JPS5948829B2 true JPS5948829B2 (ja) | 1984-11-29 |
Family
ID=23993519
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP58116827A Expired JPS5948829B2 (ja) | 1974-08-28 | 1983-06-27 | 3↓−フエニル↓−4(1h)ピリジンチオン類およびその塩類の製法 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4152136A (Direct) |
| JP (1) | JPS5948829B2 (Direct) |
| FI (1) | FI61697C (Direct) |
| IN (1) | IN142614B (Direct) |
| ZA (1) | ZA755425B (Direct) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS62184947A (ja) * | 1986-02-10 | 1987-08-13 | Eiji Adachi | 積層内装材 |
| JPS63103481U (Direct) * | 1986-12-26 | 1988-07-05 |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1110234A (en) * | 1978-01-18 | 1981-10-06 | Hoffmann-La Roche Limited | 4-pyridone-3-carboxylic acids and process for the preparation thereof |
| US4174209A (en) * | 1978-06-19 | 1979-11-13 | Eli Lilly And Company | Herbicidal 1-alkyl-3-phenylpyridinium salts |
| US4218238A (en) * | 1978-06-19 | 1980-08-19 | Eli Lilly And Company | Herbicidal 1-alkyl-3-phenylpyridinium salts |
| US4964896A (en) * | 1980-05-12 | 1990-10-23 | Monsanto Company | Certain-2,6-diphenyl-1,4-dihydro-4-oxo-nicotinates which are useful for inducing male sterility in cereal grain plants |
| US4714492A (en) * | 1980-05-12 | 1987-12-22 | Rohm And Haas Company | Certain 2-phenyl-4-oxo-nicotinates and their use for inducing male sterility in a cereal grain plant |
| US4936904A (en) * | 1980-05-12 | 1990-06-26 | Carlson Glenn R | Aryl-4-oxonicotinates useful for inducing male sterility in cereal grain plants |
| US4319916A (en) * | 1980-08-21 | 1982-03-16 | Eli Lilly And Company | 3-Acyl-5-phenyl-4(1H)-pyridinones and their use as herbicides |
| US4288624A (en) * | 1980-08-21 | 1981-09-08 | Eli Lilly And Company | Acylation or sulfenylation process |
| US4559352A (en) * | 1981-03-30 | 1985-12-17 | Sterling Drug Inc. | 1,2-Dihydro-2-oxo-5-(hydroxy-and/or amino-phenyl)-nicotinonitriles and cardiotonic use thereof |
| ATE17482T1 (de) * | 1981-09-05 | 1986-02-15 | Bayer Ag | Hetero-substituierte 4-pyridon-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide. |
| KR880000733B1 (ko) * | 1983-05-27 | 1988-05-04 | 일라이 릴리 앤드 캄파니 | 수생 생물 조절용 조성물 |
| DE3430232A1 (de) * | 1984-08-17 | 1986-02-27 | Bayer Ag, 5090 Leverkusen | N-methyl-4-pyridone |
| MC2252A1 (fr) * | 1990-03-12 | 1993-03-25 | Wellcome Found | Composes heterocycliques |
| US5234895A (en) * | 1992-06-19 | 1993-08-10 | Imperial Chemical Industries Plc | Arylpyridone herbicides |
| DE19518739A1 (de) * | 1995-05-22 | 1996-11-28 | Basf Ag | N-Aminopyridonderivate |
| US5882799A (en) * | 1996-12-16 | 1999-03-16 | Vernay Laboratories, Inc. | Polymeric coupling agents for the adhesion of macromolecular materials and metal substrates |
| CN112028821A (zh) * | 2020-09-26 | 2020-12-04 | 安徽金禾实业股份有限公司 | 一种2-甲基-3-甲氧基-4-氯吡啶的合成方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE787805A (fr) | 1971-08-25 | 1973-02-21 | Ici Ltd | Pyridines herbicides |
| US4051142A (en) * | 1976-05-24 | 1977-09-27 | Rohm And Haas Company | 1-Aryl-4-pyridones |
-
1975
- 1975-08-22 IN IN1642/CAL/75A patent/IN142614B/en unknown
- 1975-08-25 ZA ZA00755425A patent/ZA755425B/xx unknown
- 1975-08-27 FI FI752407A patent/FI61697C/fi not_active IP Right Cessation
-
1977
- 1977-06-27 US US05/810,219 patent/US4152136A/en not_active Expired - Lifetime
-
1983
- 1983-06-27 JP JP58116827A patent/JPS5948829B2/ja not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS62184947A (ja) * | 1986-02-10 | 1987-08-13 | Eiji Adachi | 積層内装材 |
| JPS63103481U (Direct) * | 1986-12-26 | 1988-07-05 |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5916877A (ja) | 1984-01-28 |
| FI752407A7 (Direct) | 1976-02-29 |
| US4152136A (en) | 1979-05-01 |
| IN142614B (Direct) | 1977-08-06 |
| ZA755425B (en) | 1976-10-27 |
| FI61697C (fi) | 1982-09-10 |
| FI61697B (fi) | 1982-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU1074403A3 (ru) | Способ получени 3-фенил-5-замещенных-4( @ )-пиридонов или их солей | |
| EP2164831B1 (de) | Verfahren zur herstellung n-substituierter (3-dihalomethyl-1-methyl-pyrazol-4-yl)carboxamide | |
| JPS5916877A (ja) | 3↓−フエニル↓−4(1h)ピリジンチオン類およびその塩類の製法 | |
| DE602004011966T2 (de) | Heterocyclylverbindungen | |
| EP1802578B1 (de) | 3,6-substituierte 5-arylamino-1h-pyidin-2-on derivative und verwandte verbindungen als poly(adp-ribose)polymerase (parp) inhibitoren zur behandlung von durch nekose oder apoptose verursachten gewebeschäden oder erkankungen | |
| JPH05246997A (ja) | ピラゾール誘導体 | |
| JP3032840B2 (ja) | 置換インダゾール誘導体 | |
| CN102276520B (zh) | 2-乙基氨基吡啶衍生物的制备方法 | |
| CA2091246A1 (en) | Indole ureas as 5 ht receptor antagonist | |
| EP1274685B1 (en) | A pyridine-n-oxide derivative, and process for its transformation into pharmaceutically effective compounds | |
| JPS6230988B2 (Direct) | ||
| DE69904738T2 (de) | 2-phenylpyran-4-one derivate | |
| DE2726796A1 (de) | Neue substituierte pyridine, verfahren zu ihrer herstellung und ihre pharmazeutische verwendung | |
| EP0559695A1 (de) | Neue pyridinderivate, verfahren zu ihrer herstellung und verwendung als arzneimittel. | |
| DE60015844T2 (de) | Pyridin- und Piperidinderivate zur Behandlung von neurodegenerativen Erkrankungen | |
| DE3442860A1 (de) | 5-alkyl-1-phenyl-2-piperazinoalkylpyrazolin-3- on-verbindungen sowie verfahren und zwischenprodukte zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| NO138530B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive 1-substituerte pyrazolon-(5)-derivater | |
| Adkins et al. | Preparation of Derivatives of Pyrrole and Pyridine by Hydrogenation | |
| US5734059A (en) | Production intermediate and process for producing pyridine derivative | |
| CN106220554B (zh) | 一种芳基吡啶及其衍生物的制备方法 | |
| Potts et al. | Ring-fused meso-ionic s-triazole derivatives | |
| JPS6159625B2 (Direct) | ||
| DE60103859T2 (de) | 2-Phenylpyran-4-on Derivat | |
| CH632247A5 (de) | Verfahren zur herstellung von 3-phenyl-5-substituierten-4(1h)-pyridonen und deren verwendung. | |
| DD237509A5 (de) | Verfahren zur herstellung von 2-(1h)-chinolonen |