JPS5921345B2 - 1:2金属錯塩 - Google Patents
1:2金属錯塩Info
- Publication number
- JPS5921345B2 JPS5921345B2 JP52062293A JP6229377A JPS5921345B2 JP S5921345 B2 JPS5921345 B2 JP S5921345B2 JP 52062293 A JP52062293 A JP 52062293A JP 6229377 A JP6229377 A JP 6229377A JP S5921345 B2 JPS5921345 B2 JP S5921345B2
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- hydrogen
- tables
- formulas
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 metal complex salt Chemical class 0.000 title claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 65
- 239000001257 hydrogen Substances 0.000 claims description 65
- 239000000975 dye Substances 0.000 claims description 58
- 150000003839 salts Chemical group 0.000 claims description 49
- 125000000217 alkyl group Chemical group 0.000 claims description 47
- 239000000203 mixture Substances 0.000 claims description 47
- 239000000460 chlorine Substances 0.000 claims description 42
- 229910052801 chlorine Inorganic materials 0.000 claims description 41
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 39
- 238000005859 coupling reaction Methods 0.000 claims description 32
- 150000002431 hydrogen Chemical class 0.000 claims description 32
- 230000008878 coupling Effects 0.000 claims description 28
- 238000010168 coupling process Methods 0.000 claims description 28
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 27
- 239000010985 leather Substances 0.000 claims description 25
- 239000002253 acid Substances 0.000 claims description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 20
- 125000003545 alkoxy group Chemical group 0.000 claims description 18
- 238000004043 dyeing Methods 0.000 claims description 18
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 18
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 18
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 18
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical group [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 14
- 239000011651 chromium Substances 0.000 claims description 13
- 229910052804 chromium Inorganic materials 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- 150000001768 cations Chemical class 0.000 claims description 8
- 229910052751 metal Inorganic materials 0.000 claims description 8
- 239000002184 metal Substances 0.000 claims description 8
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 7
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 7
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 239000010941 cobalt Chemical group 0.000 claims description 5
- 229910017052 cobalt Chemical group 0.000 claims description 5
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical group [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 239000000758 substrate Substances 0.000 claims description 5
- 125000000129 anionic group Chemical group 0.000 claims description 4
- 150000004696 coordination complex Chemical class 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 13
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 238000006193 diazotization reaction Methods 0.000 description 9
- 150000001412 amines Chemical class 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 6
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 235000010288 sodium nitrite Nutrition 0.000 description 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 5
- HBZVNWNSRNTWPS-UHFFFAOYSA-N 6-amino-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(N)=CC=C21 HBZVNWNSRNTWPS-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 150000008049 diazo compounds Chemical class 0.000 description 5
- 238000001465 metallisation Methods 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- 229910006069 SO3H Inorganic materials 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 4
- RHPXYZMDLOJTFF-UHFFFAOYSA-N 3-amino-4-hydroxy-5-nitrobenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC([N+]([O-])=O)=C1O RHPXYZMDLOJTFF-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 230000005540 biological transmission Effects 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 238000000227 grinding Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- VLZVIIYRNMWPSN-UHFFFAOYSA-N 2-Amino-4-nitrophenol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1O VLZVIIYRNMWPSN-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical class [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- KTVIXTQDYHMGHF-UHFFFAOYSA-L cobalt(2+) sulfate Chemical compound [Co+2].[O-]S([O-])(=O)=O KTVIXTQDYHMGHF-UHFFFAOYSA-L 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- 159000000001 potassium salts Chemical class 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000010698 whale oil Substances 0.000 description 2
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- UGEHFOSBNBEWMP-UHFFFAOYSA-N 2,3-diaminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1N UGEHFOSBNBEWMP-UHFFFAOYSA-N 0.000 description 1
- VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical compound CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 description 1
- HFZWRUODUSTPEG-UHFFFAOYSA-N 2,4-dichlorophenol Chemical compound OC1=CC=C(Cl)C=C1Cl HFZWRUODUSTPEG-UHFFFAOYSA-N 0.000 description 1
- KUFFULVDNCHOFZ-UHFFFAOYSA-N 2,4-xylenol Chemical compound CC1=CC=C(O)C(C)=C1 KUFFULVDNCHOFZ-UHFFFAOYSA-N 0.000 description 1
- SUHWXARLXCIBFK-UHFFFAOYSA-N 3-(2-methylanilino)phenol Chemical compound CC1=CC=CC=C1NC1=CC=CC(O)=C1 SUHWXARLXCIBFK-UHFFFAOYSA-N 0.000 description 1
- 229940018563 3-aminophenol Drugs 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- HGWQOFDAUWCQDA-UHFFFAOYSA-N 4-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 HGWQOFDAUWCQDA-UHFFFAOYSA-N 0.000 description 1
- MNVMYTVDDOXZLS-UHFFFAOYSA-N 4-methoxyguaiacol Natural products COC1=CC=C(O)C(OC)=C1 MNVMYTVDDOXZLS-UHFFFAOYSA-N 0.000 description 1
- GDBANHJMXDZUNE-UHFFFAOYSA-N 5-hydroxynaphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(O)=CC=CC2=C1 GDBANHJMXDZUNE-UHFFFAOYSA-N 0.000 description 1
- YKVBYISUDGOVDM-UHFFFAOYSA-N 6-acetamido-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(NC(=O)C)=CC=C21 YKVBYISUDGOVDM-UHFFFAOYSA-N 0.000 description 1
- VVPHSMHEYVOVLH-UHFFFAOYSA-N 6-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(O)=CC=C21 VVPHSMHEYVOVLH-UHFFFAOYSA-N 0.000 description 1
- HMNPDEGBVWDHAR-UHFFFAOYSA-N 8-aminonaphthalen-1-ol Chemical compound C1=CC(O)=C2C(N)=CC=CC2=C1 HMNPDEGBVWDHAR-UHFFFAOYSA-N 0.000 description 1
- DQIVFTJHYKDOMZ-UHFFFAOYSA-N 96-67-3 Chemical compound NC1=CC([N+]([O-])=O)=CC(S(O)(=O)=O)=C1O DQIVFTJHYKDOMZ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- IEQNHMZKTNKSHN-UHFFFAOYSA-N N.C(C)(C)O.C(C)(C)O.C(C)(C)O Chemical compound N.C(C)(C)O.C(C)(C)O.C(C)(C)O IEQNHMZKTNKSHN-UHFFFAOYSA-N 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- LJAOOBNHPFKCDR-UHFFFAOYSA-K chromium(3+) trichloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Cr+3] LJAOOBNHPFKCDR-UHFFFAOYSA-K 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940044175 cobalt sulfate Drugs 0.000 description 1
- 229910000361 cobalt sulfate Inorganic materials 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229940018564 m-phenylenediamine Drugs 0.000 description 1
- 239000000434 metal complex dye Substances 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 1
- 239000004745 nonwoven fabric Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical group [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 239000011265 semifinished product Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 1
- 239000002759 woven fabric Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/24—Disazo or polyazo compounds
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06P—DYEING OR PRINTING TEXTILES; DYEING LEATHER, FURS OR SOLID MACROMOLECULAR SUBSTANCES IN ANY FORM
- D06P3/00—Special processes of dyeing or printing textiles, or dyeing leather, furs, or solid macromolecular substances in any form, classified according to the material treated
- D06P3/02—Material containing basic nitrogen
- D06P3/04—Material containing basic nitrogen containing amide groups
- D06P3/32—Material containing basic nitrogen containing amide groups leather skins
- D06P3/326—Material containing basic nitrogen containing amide groups leather skins using metallisable or mordant dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Coloring (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH681276A CH606324A5 (enExample) | 1976-05-31 | 1976-05-31 | |
| CH000000681276 | 1976-05-31 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS52146431A JPS52146431A (en) | 1977-12-06 |
| JPS5921345B2 true JPS5921345B2 (ja) | 1984-05-19 |
Family
ID=4315404
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP52062293A Expired JPS5921345B2 (ja) | 1976-05-31 | 1977-05-30 | 1:2金属錯塩 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4150942A (enExample) |
| JP (1) | JPS5921345B2 (enExample) |
| AT (1) | AT369770B (enExample) |
| BR (1) | BR7703508A (enExample) |
| CH (1) | CH606324A5 (enExample) |
| DE (1) | DE2722855A1 (enExample) |
| ES (1) | ES459307A1 (enExample) |
| FR (1) | FR2353605A1 (enExample) |
| GB (1) | GB1574373A (enExample) |
| HU (1) | HU182574B (enExample) |
| IT (1) | IT1078868B (enExample) |
| SE (1) | SE435633B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2832756A1 (de) * | 1977-08-05 | 1979-02-15 | Sandoz Ag | 1 zu 2-chromkomplexe von disazofarbstoffen, deren herstellung und verwendung |
| US4256633A (en) * | 1978-04-25 | 1981-03-17 | Ciba-Geigy Corporation | Chromium complex compounds, process for their manufacture and use thereof |
| DE3018761A1 (de) * | 1979-05-28 | 1980-12-11 | Sandoz Ag | 1 zu 2 metallkomplexverbindungen, deren herstellung und verwendung |
| EP0061999B1 (de) | 1981-03-23 | 1985-07-03 | Ciba-Geigy Ag | Verwendung von 1:2-Chrom- oder -Kobaltkomplexfarbstoffen zum Färben von Leder oder Pelzen |
| EP0061670B2 (de) * | 1981-03-23 | 1994-06-01 | Ciba-Geigy Ag | Verfahren zum Färben von Leder und Pelzen mit Farbstoffmischungen |
| US4519802A (en) * | 1982-03-19 | 1985-05-28 | Ciba-Geigy Corporation | Use of 1:2 cobalt complex dyes for dyeing leather or furs |
| CH672969B5 (enExample) * | 1984-12-17 | 1990-07-31 | Ciba Geigy Ag | |
| DE3805746C2 (de) * | 1987-03-05 | 2003-04-10 | Clariant Finance Bvi Ltd | 1:2-Chromkomplexfarbstoffe |
| GB9212547D0 (en) * | 1992-06-12 | 1992-07-22 | Sandoz Ltd | Improvements in or relating to organic compounds |
| US9702051B2 (en) | 2013-12-17 | 2017-07-11 | Apple Inc. | Non-capacitive or radio frequency-transparent materials with anodized metal appearance |
| US9438710B2 (en) * | 2013-12-17 | 2016-09-06 | Apple Inc. | Color-matched polymer materials and method for forming the same |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2933488A (en) * | 1960-04-19 | Heavy metal-containing azo dyestuffs | ||
| US2775581A (en) * | 1956-12-25 | Oxhxc | ||
| US1873278A (en) * | 1929-04-19 | 1932-08-23 | Ici Ltd | Dyeing of regenerated cellulose materials |
| US2012779A (en) * | 1933-03-31 | 1935-08-27 | Chem Ind Basel | Chromiferous azo-dyestuff and process of making same |
| FR852484A (fr) * | 1938-04-04 | 1940-02-02 | Durand & Huguenin Sa | Procédé pour produire des colorants dis-azoïques secondaires à mordant, donnant des nuances bleues |
| DE731771C (de) * | 1938-04-08 | 1943-02-17 | Ig Farbenindustrie Ag | Verfahren zur Herstellung von chromhaltigen o-Oxyazofarbstoffen |
| DE829644C (de) * | 1949-04-14 | 1952-01-28 | Sandoz Ag | Verfahren zur Herstellung von Disazofarbstoffen und ihren Chrom-, Eisen- und Kobaltkomplexverbindungen |
| DE1644155B2 (de) * | 1965-09-07 | 1977-04-07 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von disazofarbstoffen und deren metallkomplexverbindungen |
| AT198397B (de) | 1956-01-26 | 1958-06-25 | Geigy Ag J R | Verfahren zur Herstellung von neuen, schwermetallhaltigen Azofarbstoffen |
| GB851861A (en) * | 1956-01-26 | 1960-10-19 | Geigy Ag J R | Improvements relating to heavy metal-containing azo dyestuffs and their use |
| US2938490A (en) * | 1958-05-06 | 1960-05-31 | Alvin H Martin | Boat hull |
| CH430000A (de) * | 1963-10-07 | 1967-02-15 | Geigy Ag J R | Verfahren zur Herstellung chromhaltiger Reaktivfarbstoffe |
| NL130114C (enExample) * | 1964-10-29 | |||
| CH476812A (de) * | 1966-05-06 | 1969-08-15 | Geigy Ag J R | Verfahren zur Herstellung schwermetallhaltiger Azofarbstoffe |
| CH1406567A4 (enExample) * | 1967-10-09 | 1971-09-30 | ||
| BE757581A (fr) * | 1969-10-17 | 1971-04-15 | Hoechst Ag | Colorants azoiques asymetriques contenant du chrome et leur preparatio |
| AT406507B (de) * | 1997-11-24 | 2000-06-26 | Vaillant Gmbh | Brenner mit separater zufuhr von brennstoff |
-
1976
- 1976-05-31 CH CH681276A patent/CH606324A5/xx not_active IP Right Cessation
-
1977
- 1977-05-20 DE DE19772722855 patent/DE2722855A1/de active Granted
- 1977-05-23 SE SE7705995A patent/SE435633B/xx not_active IP Right Cessation
- 1977-05-26 GB GB22271/77A patent/GB1574373A/en not_active Expired
- 1977-05-27 US US05/801,397 patent/US4150942A/en not_active Expired - Lifetime
- 1977-05-27 AT AT0378777A patent/AT369770B/de not_active IP Right Cessation
- 1977-05-30 BR BR7703508A patent/BR7703508A/pt unknown
- 1977-05-30 IT IT49618/77A patent/IT1078868B/it active
- 1977-05-30 JP JP52062293A patent/JPS5921345B2/ja not_active Expired
- 1977-05-30 ES ES459307A patent/ES459307A1/es not_active Expired
- 1977-05-30 HU HU77SA3037A patent/HU182574B/hu unknown
- 1977-05-31 FR FR7716461A patent/FR2353605A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| SE7705995L (sv) | 1977-12-01 |
| GB1574373A (en) | 1980-09-03 |
| CH606324A5 (enExample) | 1978-10-31 |
| DE2722855A1 (de) | 1977-12-15 |
| FR2353605A1 (fr) | 1977-12-30 |
| IT1078868B (it) | 1985-05-08 |
| AT369770B (de) | 1983-01-25 |
| BR7703508A (pt) | 1978-03-14 |
| JPS52146431A (en) | 1977-12-06 |
| US4150942A (en) | 1979-04-24 |
| SE435633B (sv) | 1984-10-08 |
| HU182574B (en) | 1984-02-28 |
| DE2722855C2 (enExample) | 1988-05-19 |
| ES459307A1 (es) | 1978-08-01 |
| ATA378777A (de) | 1982-06-15 |
| FR2353605B1 (enExample) | 1981-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2985646A (en) | Chromium-containing dyestuffs | |
| JPS5921345B2 (ja) | 1:2金属錯塩 | |
| CA1059997A (en) | Chromium complex dyes, their manufacture and use | |
| GB2059986A (en) | Water-soluble chromium complexes of disazo compounds | |
| CA1088051A (en) | Chromium complex dyes, process for their manufacture and use thereof | |
| US2708193A (en) | Water-soluble chromium-containing azo dyestuffs | |
| US4996303A (en) | Preparation of 1:2 metal complex dyes by coupling in the presence of a metal donor in an inert gas atmosphere | |
| JPS5943500B2 (ja) | 非対称型1:2クロム錯塩染料 | |
| JPH06287460A (ja) | 1:2クロム錯体染料 | |
| US3943122A (en) | Polyazo compounds containing benzhydrol as a component | |
| JPH0778181B2 (ja) | ポリアゾ染料のクロム錯体 | |
| US3189593A (en) | Polyazo dyes | |
| US2738345A (en) | Chrome-containing monoazo dyestuffs | |
| JPS6334185B2 (enExample) | ||
| CA1063599A (en) | Chromium complex dyes, their manufacture and their use | |
| JPS59100165A (ja) | アゾ化合物とアゾメチン化合物とを含む非対称1「い」2クロム錯塩染料 | |
| CA1148538A (en) | Metal complex compounds, processes for their manufacture and their use | |
| US3169951A (en) | Chromhjm-containing azo dyestuffs | |
| US2852502A (en) | Half metal complexes of acylacetonitrile azo dyes containing the sulfonamide group | |
| US2034304A (en) | Azo dyestuffs and their production | |
| JPS6025065B2 (ja) | 金属錯塩染料 | |
| EP0148121A2 (de) | Unsymmetrische 1:2-Chromkomplexfarbstoffe | |
| US4005067A (en) | Process for the synthesis of nitrite ion-containing 1:1 complexes of cobalt and metallizable monoazo or azomethine compounds and such complexes | |
| GB1571701A (en) | Unsymmetrical 1:2-chromium complexes containing and azo and an azomethine bond | |
| JPS6115902B2 (enExample) |