JPS57146788A - Preparation of silicon-functional benzylsilane compound - Google Patents
Preparation of silicon-functional benzylsilane compoundInfo
- Publication number
- JPS57146788A JPS57146788A JP56033337A JP3333781A JPS57146788A JP S57146788 A JPS57146788 A JP S57146788A JP 56033337 A JP56033337 A JP 56033337A JP 3333781 A JP3333781 A JP 3333781A JP S57146788 A JPS57146788 A JP S57146788A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- palladium
- silicon
- functional
- benzylsilane
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 benzylsilane compound Chemical class 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 abstract 3
- ZOUWOGOTHLRRLS-UHFFFAOYSA-N palladium;phosphane Chemical compound P.[Pd] ZOUWOGOTHLRRLS-UHFFFAOYSA-N 0.000 abstract 3
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 abstract 2
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 abstract 1
- 229940073608 benzyl chloride Drugs 0.000 abstract 1
- SFAZXBAPWCPIER-UHFFFAOYSA-N chloro-[chloro(dimethyl)silyl]-dimethylsilane Chemical compound C[Si](C)(Cl)[Si](C)(C)Cl SFAZXBAPWCPIER-UHFFFAOYSA-N 0.000 abstract 1
- 150000008282 halocarbons Chemical class 0.000 abstract 1
- 150000003377 silicon compounds Chemical class 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 1
Abstract
PURPOSE: To prepare the titled compound useful as a synthetic intermediate of other useful organic silicon compound, in high yield, by reacting a specific halogenated hydrocarbon with a silicon-functional disilane compound in the presence of a palladium-phosphine complex.
CONSTITUTION: The compound of formula III (R1 is H, halogne or alkyl; a is 1W5; m is 0W2) is prepared by reacting the compound of formulaI(X is Cl or Br) (e.g. benzyl chloride) with the compound of formula II (Y is Cl or alkoxy; n is 0W5) (e.g. 1,1,2,2-tetramethyl-1,2-dichlorodisilane) in a solvent such as toluene in the presence of a palladium-phosphine complex[e.g. tetrakis(triphenyl-phosphine)palladium]preferably at 80W170°C. The amount of the palladium-phosphine complex is preferably 0.001W0.1mol per 1mol of the compound of formulaI.
COPYRIGHT: (C)1982,JPO&Japio
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP56033337A JPS57146788A (en) | 1981-03-09 | 1981-03-09 | Preparation of silicon-functional benzylsilane compound |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP56033337A JPS57146788A (en) | 1981-03-09 | 1981-03-09 | Preparation of silicon-functional benzylsilane compound |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPS57146788A true JPS57146788A (en) | 1982-09-10 |
Family
ID=12383746
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP56033337A Pending JPS57146788A (en) | 1981-03-09 | 1981-03-09 | Preparation of silicon-functional benzylsilane compound |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS57146788A (en) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1995016712A1 (en) * | 1993-12-15 | 1995-06-22 | Smithkline Beecham Corporation | Compounds and methods |
| US5773512A (en) * | 1994-12-15 | 1998-06-30 | Smithkline Beecham Corp. | Compounds and methods |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2260282A1 (en) * | 1971-12-15 | 1973-06-20 | Dow Corning | SILYLATION PROCESS |
| JPS52116442A (en) * | 1976-03-26 | 1977-09-29 | Toshiba Silicone | Process for preparing organic silicon compound |
-
1981
- 1981-03-09 JP JP56033337A patent/JPS57146788A/en active Pending
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2260282A1 (en) * | 1971-12-15 | 1973-06-20 | Dow Corning | SILYLATION PROCESS |
| JPS52116442A (en) * | 1976-03-26 | 1977-09-29 | Toshiba Silicone | Process for preparing organic silicon compound |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1995016712A1 (en) * | 1993-12-15 | 1995-06-22 | Smithkline Beecham Corporation | Compounds and methods |
| US5773512A (en) * | 1994-12-15 | 1998-06-30 | Smithkline Beecham Corp. | Compounds and methods |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS56103264A (en) | Silicone compositin for adhesive | |
| JPS56131565A (en) | 4-substituted-2-oxoazetidine compound and its preparation | |
| JPS57146788A (en) | Preparation of silicon-functional benzylsilane compound | |
| JPS5583713A (en) | Anti-tumor agent composed mainly of organo-silicon compound | |
| JPS57146787A (en) | Preparation of bissilylated xylene | |
| JPS57146786A (en) | Optically active borane compound and preparation of optically active compound using the same | |
| JPS57183784A (en) | Preparation of organic carbonate | |
| JPS5569513A (en) | Anti-tumor agent | |
| JPS5746991A (en) | Preparation of bivalent organotin compound | |
| JPS572278A (en) | Dibenzoxazepin derivative | |
| JPS5758890A (en) | Preparation of glucosylmoranoline derivative | |
| JPS57197256A (en) | Novel cyclohexanecarboxamide derivative and its preparation | |
| JPS559059A (en) | Preparation of dicyclohexyl neophyltin halide | |
| JPS5646891A (en) | Preparation of compound useful as flame-retardant | |
| JPS5427548A (en) | Preparation of tricyclohexyltin halide | |
| IE41003L (en) | N-substituted -9- alkoxy -5- methyl -6, 7-benzomorphans | |
| JPS5323952A (en) | Thiocyclopentenone derivatives and their preparation | |
| JPS56127370A (en) | Novel piperazine compound, its preparation and utilization | |
| JPS55162758A (en) | Novel phenylacetamide derivative | |
| JPS57150626A (en) | Novel bicyclooctane derivative, its salt and their preparation | |
| JPS56115790A (en) | Preparation of silyl-group-substituted sulfur compound | |
| JPS54114600A (en) | Preparation of organosilicon polymer | |
| JPS56108777A (en) | Novel guanidinothiazole derivative and its preparation | |
| JPS57197251A (en) | Synthetic method of azoxyarene and azoarene | |
| JPS55122736A (en) | Novel bicyclooctane derivative and its preparation |