JPS57131791A - Benzodiazepine derivative and its preparation - Google Patents
Benzodiazepine derivative and its preparationInfo
- Publication number
- JPS57131791A JPS57131791A JP56216205A JP21620581A JPS57131791A JP S57131791 A JPS57131791 A JP S57131791A JP 56216205 A JP56216205 A JP 56216205A JP 21620581 A JP21620581 A JP 21620581A JP S57131791 A JPS57131791 A JP S57131791A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- formulai
- lower alkoxyl
- formula
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 5
- 125000003545 alkoxy group Chemical group 0.000 abstract 4
- 238000000034 method Methods 0.000 abstract 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 2
- JEWCIEJYMIAHBW-UHFFFAOYSA-N 3,8-dihydroxy-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one Chemical compound N1=CC2CC(O)CN2C(=O)C2=C1C=C(O)C(OC)=C2 JEWCIEJYMIAHBW-UHFFFAOYSA-N 0.000 abstract 1
- 230000000845 anti-microbial effect Effects 0.000 abstract 1
- 239000004599 antimicrobial Substances 0.000 abstract 1
- 239000002246 antineoplastic agent Substances 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
Landscapes
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pyrrole Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8041626 | 1980-12-31 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS57131791A true JPS57131791A (en) | 1982-08-14 |
| JPH0216315B2 JPH0216315B2 (enrdf_load_stackoverflow) | 1990-04-16 |
Family
ID=10518286
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP56216205A Granted JPS57131791A (en) | 1980-12-31 | 1981-12-28 | Benzodiazepine derivative and its preparation |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS57131791A (enrdf_load_stackoverflow) |
Cited By (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5936678A (ja) * | 1982-07-26 | 1984-02-28 | Bristol Mayers Kenkyusho Kk | 抗腫瘍抗生物質 |
| WO2000012509A3 (en) * | 1998-08-27 | 2000-07-06 | Univ Portsmouth | Collections of compounds |
| WO2000012508A3 (en) * | 1998-08-27 | 2000-09-21 | Univ Portsmouth | Pyrrolbenzodiazepines |
| US6608192B1 (en) | 1998-08-27 | 2003-08-19 | Spirogen Limited | Collections of compounds |
| US6909006B1 (en) | 1999-08-27 | 2005-06-21 | Spirogen Limited | Cyclopropylindole derivatives |
| US7407951B2 (en) | 2002-11-14 | 2008-08-05 | Spirogen Limited | Pyrrolobenzodiazepines |
| US7429658B2 (en) | 2003-09-11 | 2008-09-30 | Spirogen Limited | Synthesis of protected pyrrolobenzodiazepines |
| US7528126B2 (en) | 2004-03-09 | 2009-05-05 | Spirogen Limited | Pyrrolobenzodiazepines |
| US7557099B2 (en) | 2004-03-01 | 2009-07-07 | Spirogen Limited | Pyrrolobenzodiazepines as key intermediates in the synthesis of dimeric cytotoxic pyrrolobenzodiazepines |
| US7741319B2 (en) | 2004-03-01 | 2010-06-22 | Spirogen Limited | 11-hydroxy-5h-pyrrolo[2,1-c][1,4] benzodiazepin-5-one derivatives as key intermediates for the preparation of c2 substituted pyrrolobenzodiazepines |
| EP2393362A4 (en) * | 2009-02-05 | 2013-07-24 | Immunogen Inc | NEW BENZODIAZEPINE DERIVATIVES |
| US8592576B2 (en) | 2008-10-17 | 2013-11-26 | Spirogen Sarl | Unsymmetrical pyrrolobenzodiazepine-dimers for treatment of proliferative diseases |
| US8765740B2 (en) | 2011-02-15 | 2014-07-01 | Immunogen, Inc. | Cytotoxic benzodiazepine derivatives |
| US8829184B2 (en) | 2010-04-15 | 2014-09-09 | Spirogen Sarl | Intermediates useful for the synthesis of pyrrolobenzodiazepines |
| US9102704B2 (en) | 2011-10-14 | 2015-08-11 | Spirogen Sarl | Synthesis method and intermediates useful in the preparation of pyrrolobenzodiazepines |
| US9242013B2 (en) | 2010-04-15 | 2016-01-26 | Seattle Genetics Inc. | Targeted pyrrolobenzodiazapine conjugates |
| AU2015224492B2 (en) * | 2009-02-05 | 2017-04-20 | Immunogen, Inc. | Novel benzodiazepine derivatives |
| US9707301B2 (en) | 2011-10-14 | 2017-07-18 | Seattle Genetics, Inc. | Pyrrolobenzodiazepines and targeted conjugates |
| US9713647B2 (en) | 2011-10-14 | 2017-07-25 | Seattle Genetics, Inc. | Pyrrolobenzodiazepines and targeted conjugates |
| US9732084B2 (en) | 2010-04-15 | 2017-08-15 | Medimmune Limited | Pyrrolobenzodiazepines used to treat proliferative diseases |
| US9745303B2 (en) | 2012-10-12 | 2017-08-29 | Medimmune Limited | Synthesis and intermediates of pyrrolobenzodiazepine derivatives for conjugation |
| US9889207B2 (en) | 2012-10-12 | 2018-02-13 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| US9919056B2 (en) | 2012-10-12 | 2018-03-20 | Adc Therapeutics S.A. | Pyrrolobenzodiazepine-anti-CD22 antibody conjugates |
| US9931414B2 (en) | 2012-10-12 | 2018-04-03 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US9931415B2 (en) | 2012-10-12 | 2018-04-03 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US9950078B2 (en) | 2013-10-11 | 2018-04-24 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US9956299B2 (en) | 2013-10-11 | 2018-05-01 | Medimmune Limited | Pyrrolobenzodiazepine—antibody conjugates |
| US9956298B2 (en) | 2013-10-11 | 2018-05-01 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| US10010624B2 (en) | 2013-10-11 | 2018-07-03 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US10029018B2 (en) | 2013-10-11 | 2018-07-24 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| US10392393B2 (en) | 2016-01-26 | 2019-08-27 | Medimmune Limited | Pyrrolobenzodiazepines |
| US10420777B2 (en) | 2014-09-12 | 2019-09-24 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| US10543279B2 (en) | 2016-04-29 | 2020-01-28 | Medimmune Limited | Pyrrolobenzodiazepine conjugates and their use for the treatment of cancer |
| US10544223B2 (en) | 2017-04-20 | 2020-01-28 | Adc Therapeutics Sa | Combination therapy with an anti-axl antibody-drug conjugate |
| US10695439B2 (en) | 2016-02-10 | 2020-06-30 | Medimmune Limited | Pyrrolobenzodiazepine conjugates |
| US10695433B2 (en) | 2012-10-12 | 2020-06-30 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US10736903B2 (en) | 2012-10-12 | 2020-08-11 | Medimmune Limited | Pyrrolobenzodiazepine-anti-PSMA antibody conjugates |
| US10751346B2 (en) | 2012-10-12 | 2020-08-25 | Medimmune Limited | Pyrrolobenzodiazepine—anti-PSMA antibody conjugates |
| US10780096B2 (en) | 2014-11-25 | 2020-09-22 | Adc Therapeutics Sa | Pyrrolobenzodiazepine-antibody conjugates |
| US10799595B2 (en) | 2016-10-14 | 2020-10-13 | Medimmune Limited | Pyrrolobenzodiazepine conjugates |
| US11059893B2 (en) | 2015-04-15 | 2021-07-13 | Bergenbio Asa | Humanized anti-AXL antibodies |
| US11160872B2 (en) | 2017-02-08 | 2021-11-02 | Adc Therapeutics Sa | Pyrrolobenzodiazepine-antibody conjugates |
| US11318211B2 (en) | 2017-06-14 | 2022-05-03 | Adc Therapeutics Sa | Dosage regimes for the administration of an anti-CD19 ADC |
| US11352324B2 (en) | 2018-03-01 | 2022-06-07 | Medimmune Limited | Methods |
| US11370801B2 (en) | 2017-04-18 | 2022-06-28 | Medimmune Limited | Pyrrolobenzodiazepine conjugates |
| US11517626B2 (en) | 2016-02-10 | 2022-12-06 | Medimmune Limited | Pyrrolobenzodiazepine antibody conjugates |
| US11524969B2 (en) | 2018-04-12 | 2022-12-13 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof as antitumour agents |
| US11583590B2 (en) | 2017-09-29 | 2023-02-21 | Daiichi Sankyo Company, Limited | Antibody-pyrrolobenzodiazepine derivative conjugate and method of use thereof for treating a tumor |
| US11612665B2 (en) | 2017-02-08 | 2023-03-28 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US11649250B2 (en) | 2017-08-18 | 2023-05-16 | Medimmune Limited | Pyrrolobenzodiazepine conjugates |
| US11702473B2 (en) | 2015-04-15 | 2023-07-18 | Medimmune Limited | Site-specific antibody-drug conjugates |
| US12209099B2 (en) | 2019-03-15 | 2025-01-28 | Medimmune Limited | Azetidobenzodiazepine dimers and conjugates comprising them for use in the treatment of cancer |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4925956A (enrdf_load_stackoverflow) * | 1972-06-29 | 1974-03-07 | ||
| JPS4925957A (enrdf_load_stackoverflow) * | 1972-06-29 | 1974-03-07 | ||
| JPS5283700A (en) * | 1976-01-01 | 1977-07-12 | Microbial Chem Res Found | Novel antibiotics neothramycin |
| JPS5337692A (en) * | 1976-09-17 | 1978-04-06 | Microbial Chem Res Found | Preparation of neosulamycin |
-
1981
- 1981-12-28 JP JP56216205A patent/JPS57131791A/ja active Granted
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4925956A (enrdf_load_stackoverflow) * | 1972-06-29 | 1974-03-07 | ||
| JPS4925957A (enrdf_load_stackoverflow) * | 1972-06-29 | 1974-03-07 | ||
| JPS5283700A (en) * | 1976-01-01 | 1977-07-12 | Microbial Chem Res Found | Novel antibiotics neothramycin |
| JPS5337692A (en) * | 1976-09-17 | 1978-04-06 | Microbial Chem Res Found | Preparation of neosulamycin |
Cited By (106)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5936678A (ja) * | 1982-07-26 | 1984-02-28 | Bristol Mayers Kenkyusho Kk | 抗腫瘍抗生物質 |
| US4464467A (en) * | 1982-07-26 | 1984-08-07 | Bristol-Myers Company | Antitumor antibiotics produced by new streptomyces |
| US7265105B2 (en) | 1998-08-27 | 2007-09-04 | Spirogen Limited | Pyrrolobenzodiazepines |
| US7704924B2 (en) | 1998-08-27 | 2010-04-27 | Spirogen Limited | Library of compounds comprising pyrrolobenzodiazepine moieties |
| EP1193270A3 (en) * | 1998-08-27 | 2002-04-17 | Spirogen Limited | Pyrrolobenzodiazepines |
| US6608192B1 (en) | 1998-08-27 | 2003-08-19 | Spirogen Limited | Collections of compounds |
| US6747144B1 (en) | 1998-08-27 | 2004-06-08 | Spirogen Limited | Collections of compounds |
| WO2000012508A3 (en) * | 1998-08-27 | 2000-09-21 | Univ Portsmouth | Pyrrolbenzodiazepines |
| US7049311B1 (en) | 1998-08-27 | 2006-05-23 | Spirogen Limited | Pyrrolbenzodiazepines |
| US7067511B2 (en) | 1998-08-27 | 2006-06-27 | Spirogen Limited | Pyrrolobenzodiazepines |
| WO2000012509A3 (en) * | 1998-08-27 | 2000-07-06 | Univ Portsmouth | Collections of compounds |
| JP4824165B2 (ja) * | 1998-08-27 | 2011-11-30 | スパイロジエン・リミテツド | ピロロベンゾジアゼピン類 |
| US6909006B1 (en) | 1999-08-27 | 2005-06-21 | Spirogen Limited | Cyclopropylindole derivatives |
| US7407951B2 (en) | 2002-11-14 | 2008-08-05 | Spirogen Limited | Pyrrolobenzodiazepines |
| US7429658B2 (en) | 2003-09-11 | 2008-09-30 | Spirogen Limited | Synthesis of protected pyrrolobenzodiazepines |
| US7557099B2 (en) | 2004-03-01 | 2009-07-07 | Spirogen Limited | Pyrrolobenzodiazepines as key intermediates in the synthesis of dimeric cytotoxic pyrrolobenzodiazepines |
| US7741319B2 (en) | 2004-03-01 | 2010-06-22 | Spirogen Limited | 11-hydroxy-5h-pyrrolo[2,1-c][1,4] benzodiazepin-5-one derivatives as key intermediates for the preparation of c2 substituted pyrrolobenzodiazepines |
| US7528126B2 (en) | 2004-03-09 | 2009-05-05 | Spirogen Limited | Pyrrolobenzodiazepines |
| US8940733B2 (en) | 2008-10-17 | 2015-01-27 | Spirogen Sarl | Unsymmetrical pyrrolobenzodiazepine-dimers for treatment of proliferative diseases |
| US8592576B2 (en) | 2008-10-17 | 2013-11-26 | Spirogen Sarl | Unsymmetrical pyrrolobenzodiazepine-dimers for treatment of proliferative diseases |
| US9624227B2 (en) | 2008-10-17 | 2017-04-18 | Medimmune Limited | Unsymmetrical pyrrolobenzodiazepine-dimers for treatment of proliferative diseases |
| AU2010210646B2 (en) * | 2009-02-05 | 2015-10-29 | Immunogen, Inc. | Novel benzodiazepine derivatives |
| EP2393362A4 (en) * | 2009-02-05 | 2013-07-24 | Immunogen Inc | NEW BENZODIAZEPINE DERIVATIVES |
| CN108727407A (zh) * | 2009-02-05 | 2018-11-02 | 伊缪诺金公司 | 新型苯并二氮杂*衍生物 |
| EP3360879A1 (en) * | 2009-02-05 | 2018-08-15 | ImmunoGen, Inc. | Benzodiazepine derivatives as cytotoxic agents |
| US8802667B2 (en) | 2009-02-05 | 2014-08-12 | Immunogen, Inc. | Benzodiazepine derivatives |
| US8809320B2 (en) | 2009-02-05 | 2014-08-19 | Immunogen, Inc. | Benzodiazepine derivatives |
| US10947315B2 (en) | 2009-02-05 | 2021-03-16 | Immunogen, Inc. | Benzodiazepine derivatives |
| JP2015187144A (ja) * | 2009-02-05 | 2015-10-29 | イミュノジェン・インコーポレーテッド | 新規ベンゾジアゼピン誘導体 |
| US10208127B2 (en) | 2009-02-05 | 2019-02-19 | Immunogen, Inc. | Benzodiazepine derivatives |
| AU2019202435B2 (en) * | 2009-02-05 | 2021-04-01 | Immunogen, Inc. | Novel benzodiazepine derivatives |
| US9265841B2 (en) | 2009-02-05 | 2016-02-23 | Immunogen, Inc. | Benzodiazepine derivatives |
| US11505617B2 (en) | 2009-02-05 | 2022-11-22 | Immunogen, Inc. | Benzodiazepine derivatives |
| JP2018021056A (ja) * | 2009-02-05 | 2018-02-08 | イミュノジェン・インコーポレーテッド | 新規ベンゾジアゼピン誘導体 |
| EP3100745A1 (en) * | 2009-02-05 | 2016-12-07 | Immunogen, Inc. | Novel benzodiazepine derivatives |
| AU2015224492B2 (en) * | 2009-02-05 | 2017-04-20 | Immunogen, Inc. | Novel benzodiazepine derivatives |
| US9550787B2 (en) | 2009-02-05 | 2017-01-24 | Immunogen, Inc. | Benzodiazepine derivatives |
| US9732084B2 (en) | 2010-04-15 | 2017-08-15 | Medimmune Limited | Pyrrolobenzodiazepines used to treat proliferative diseases |
| US8829184B2 (en) | 2010-04-15 | 2014-09-09 | Spirogen Sarl | Intermediates useful for the synthesis of pyrrolobenzodiazepines |
| US10561739B2 (en) | 2010-04-15 | 2020-02-18 | Seattle Genetics Inc. | Targeted pyrrolobenzodiazapine conjugates |
| US9242013B2 (en) | 2010-04-15 | 2016-01-26 | Seattle Genetics Inc. | Targeted pyrrolobenzodiazapine conjugates |
| USRE49918E1 (en) | 2011-02-15 | 2024-04-16 | Immunogen, Inc. | Cytotoxic benzodiazepine derivatives |
| US10570212B2 (en) | 2011-02-15 | 2020-02-25 | Immunogen, Inc. | Cytotoxic benzodiazepine derivatives |
| US9840564B2 (en) | 2011-02-15 | 2017-12-12 | Immunogen, Inc. | Cytotoxic benzodiazepine derivatives |
| US9868791B2 (en) | 2011-02-15 | 2018-01-16 | Immunogen, Inc. | Methods of preparation of conjugates |
| US9434748B2 (en) | 2011-02-15 | 2016-09-06 | Immunogen, Inc. | Cytotoxic benzodiazepine derivatives |
| US9353127B2 (en) | 2011-02-15 | 2016-05-31 | Immunogen, Inc. | Methods of preparation of conjugates |
| US10179818B2 (en) | 2011-02-15 | 2019-01-15 | Immunogen, Inc. | Cytotoxic benzodiazepine derivatives |
| US9169272B2 (en) | 2011-02-15 | 2015-10-27 | Immunogen, Inc. | Cytotoxic benzodiazepine derivatives |
| US9534000B2 (en) | 2011-02-15 | 2017-01-03 | Immunogen, Inc. | Cytotoxic benzodiazepine derivatives and methods of preparation |
| US8765740B2 (en) | 2011-02-15 | 2014-07-01 | Immunogen, Inc. | Cytotoxic benzodiazepine derivatives |
| US8889669B2 (en) | 2011-02-15 | 2014-11-18 | Immunogen, Inc. | Cytotoxic benzodiazepine derivatives |
| US10364294B2 (en) | 2011-02-15 | 2019-07-30 | Immunogen, Inc. | Methods of preparation of conjugates |
| US10329352B2 (en) | 2011-10-14 | 2019-06-25 | Seattle Genetics, Inc. | Pyrrolobenzodiazepines and targeted conjugates |
| US10328084B2 (en) | 2011-10-14 | 2019-06-25 | Seattle Genetics, Inc. | Pyrrolobenzodiazepines and targeted conjugates |
| US9707301B2 (en) | 2011-10-14 | 2017-07-18 | Seattle Genetics, Inc. | Pyrrolobenzodiazepines and targeted conjugates |
| US9102704B2 (en) | 2011-10-14 | 2015-08-11 | Spirogen Sarl | Synthesis method and intermediates useful in the preparation of pyrrolobenzodiazepines |
| US9713647B2 (en) | 2011-10-14 | 2017-07-25 | Seattle Genetics, Inc. | Pyrrolobenzodiazepines and targeted conjugates |
| US10799596B2 (en) | 2012-10-12 | 2020-10-13 | Adc Therapeutics S.A. | Pyrrolobenzodiazepine-antibody conjugates |
| US10736903B2 (en) | 2012-10-12 | 2020-08-11 | Medimmune Limited | Pyrrolobenzodiazepine-anti-PSMA antibody conjugates |
| US11690918B2 (en) | 2012-10-12 | 2023-07-04 | Medimmune Limited | Pyrrolobenzodiazepine-anti-CD22 antibody conjugates |
| US10335497B2 (en) | 2012-10-12 | 2019-07-02 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| US11701430B2 (en) | 2012-10-12 | 2023-07-18 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| US11771775B2 (en) | 2012-10-12 | 2023-10-03 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US10994023B2 (en) | 2012-10-12 | 2021-05-04 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| US12121590B2 (en) | 2012-10-12 | 2024-10-22 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| US9745303B2 (en) | 2012-10-12 | 2017-08-29 | Medimmune Limited | Synthesis and intermediates of pyrrolobenzodiazepine derivatives for conjugation |
| US9919056B2 (en) | 2012-10-12 | 2018-03-20 | Adc Therapeutics S.A. | Pyrrolobenzodiazepine-anti-CD22 antibody conjugates |
| US9931414B2 (en) | 2012-10-12 | 2018-04-03 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US10646584B2 (en) | 2012-10-12 | 2020-05-12 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| US9931415B2 (en) | 2012-10-12 | 2018-04-03 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US10695433B2 (en) | 2012-10-12 | 2020-06-30 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US10722594B2 (en) | 2012-10-12 | 2020-07-28 | Adc Therapeutics S.A. | Pyrrolobenzodiazepine-anti-CD22 antibody conjugates |
| US9889207B2 (en) | 2012-10-12 | 2018-02-13 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| US10751346B2 (en) | 2012-10-12 | 2020-08-25 | Medimmune Limited | Pyrrolobenzodiazepine—anti-PSMA antibody conjugates |
| US10780181B2 (en) | 2012-10-12 | 2020-09-22 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US11779650B2 (en) | 2012-10-12 | 2023-10-10 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US10029018B2 (en) | 2013-10-11 | 2018-07-24 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| US9950078B2 (en) | 2013-10-11 | 2018-04-24 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US9956299B2 (en) | 2013-10-11 | 2018-05-01 | Medimmune Limited | Pyrrolobenzodiazepine—antibody conjugates |
| US9956298B2 (en) | 2013-10-11 | 2018-05-01 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| US10010624B2 (en) | 2013-10-11 | 2018-07-03 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US10420777B2 (en) | 2014-09-12 | 2019-09-24 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof |
| US10780096B2 (en) | 2014-11-25 | 2020-09-22 | Adc Therapeutics Sa | Pyrrolobenzodiazepine-antibody conjugates |
| US11059893B2 (en) | 2015-04-15 | 2021-07-13 | Bergenbio Asa | Humanized anti-AXL antibodies |
| US11702473B2 (en) | 2015-04-15 | 2023-07-18 | Medimmune Limited | Site-specific antibody-drug conjugates |
| US10392393B2 (en) | 2016-01-26 | 2019-08-27 | Medimmune Limited | Pyrrolobenzodiazepines |
| US10695439B2 (en) | 2016-02-10 | 2020-06-30 | Medimmune Limited | Pyrrolobenzodiazepine conjugates |
| US11517626B2 (en) | 2016-02-10 | 2022-12-06 | Medimmune Limited | Pyrrolobenzodiazepine antibody conjugates |
| US10543279B2 (en) | 2016-04-29 | 2020-01-28 | Medimmune Limited | Pyrrolobenzodiazepine conjugates and their use for the treatment of cancer |
| US10799595B2 (en) | 2016-10-14 | 2020-10-13 | Medimmune Limited | Pyrrolobenzodiazepine conjugates |
| US11160872B2 (en) | 2017-02-08 | 2021-11-02 | Adc Therapeutics Sa | Pyrrolobenzodiazepine-antibody conjugates |
| US11612665B2 (en) | 2017-02-08 | 2023-03-28 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US11813335B2 (en) | 2017-02-08 | 2023-11-14 | Medimmune Limited | Pyrrolobenzodiazepine-antibody conjugates |
| US11370801B2 (en) | 2017-04-18 | 2022-06-28 | Medimmune Limited | Pyrrolobenzodiazepine conjugates |
| US10544223B2 (en) | 2017-04-20 | 2020-01-28 | Adc Therapeutics Sa | Combination therapy with an anti-axl antibody-drug conjugate |
| US11938192B2 (en) | 2017-06-14 | 2024-03-26 | Medimmune Limited | Dosage regimes for the administration of an anti-CD19 ADC |
| US11318211B2 (en) | 2017-06-14 | 2022-05-03 | Adc Therapeutics Sa | Dosage regimes for the administration of an anti-CD19 ADC |
| US11649250B2 (en) | 2017-08-18 | 2023-05-16 | Medimmune Limited | Pyrrolobenzodiazepine conjugates |
| US11628223B2 (en) | 2017-09-29 | 2023-04-18 | Daiichi Sankyo Company, Limited | Antibody-drug conjugates comprising substituted benzo[e]pyrrolo[1,2-α][1,4]diazepines |
| US11583590B2 (en) | 2017-09-29 | 2023-02-21 | Daiichi Sankyo Company, Limited | Antibody-pyrrolobenzodiazepine derivative conjugate and method of use thereof for treating a tumor |
| US12246196B2 (en) | 2017-09-29 | 2025-03-11 | Daiichi Sankyo Company, Limited | Antibody-drug conjugates comprising substituted benzo[e]pyrrolo[1,2-a][1,4]diazepines |
| US12350344B2 (en) | 2017-09-29 | 2025-07-08 | Daiichi Sankyo Company, Limited | Methods of treating a tumor by administering a claudin-6 (CLDN6) or CLDN9 antibody-pyrrolobenzodiazepine derivative conjugate |
| US11352324B2 (en) | 2018-03-01 | 2022-06-07 | Medimmune Limited | Methods |
| US11524969B2 (en) | 2018-04-12 | 2022-12-13 | Medimmune Limited | Pyrrolobenzodiazepines and conjugates thereof as antitumour agents |
| US12209099B2 (en) | 2019-03-15 | 2025-01-28 | Medimmune Limited | Azetidobenzodiazepine dimers and conjugates comprising them for use in the treatment of cancer |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0216315B2 (enrdf_load_stackoverflow) | 1990-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS57131791A (en) | Benzodiazepine derivative and its preparation | |
| JPS57176982A (en) | Dioxolanylazetidinone compound, its preparation and use | |
| JPS56131586A (en) | Triazolopyrimidine derivative and its preparation | |
| JPS57163369A (en) | Novel geldanamycin derivative, its preparation, and drug comprising it as active ingredient | |
| JPS57134428A (en) | Production of alpha or beta-irone or its intermediate | |
| JPS5793962A (en) | Carbostyryl derivative | |
| JPS5410399A (en) | Preparation of polyalkylene glycol derivative | |
| JPS57193479A (en) | Ansa-azacyclophane compound and its preparation | |
| JPS5711936A (en) | 5-octenals of geometrical isomerism, its preparation and its use | |
| JPS57212137A (en) | Preparation of phenyl aliphtic acid derivative | |
| JPS5758890A (en) | Preparation of glucosylmoranoline derivative | |
| JPS55154940A (en) | 2,3-butanediol ester, its preparation and use | |
| JPS5524127A (en) | 3,6-endomethylene-delta4-1,2,3,6-tetrahydrophtalimide derivative | |
| JPS5772997A (en) | Novel oligomannoside and its preparation | |
| JPS5772925A (en) | Liquid branched chain higher alphatic 1-ol and its preparation | |
| JPS57150626A (en) | Novel bicyclooctane derivative, its salt and their preparation | |
| JPS57109779A (en) | Polyalkyl-5-hydroxy-2h-chromene and its preparation | |
| JPS5795927A (en) | Liquid branched-chain higher aliphatic 1-ol | |
| JPS5750980A (en) | Tetrazole derivative | |
| JPS57183757A (en) | 5-oxopyrrolidine derivative, antiulcer comprising it as active ingredient, and its preparation | |
| JPS5446799A (en) | Penicillins and cephalosporins | |
| JPS5625175A (en) | Preparation of antispasmolytic agent | |
| JPS5668640A (en) | Novel bicyclooctane derivative and its preparation | |
| JPS5679642A (en) | Preparation of erythrohydroxy ester | |
| JPS56127378A (en) | 2-alkoxyindolizine derivative and its preparation |