JPH0557274B2 - - Google Patents
Info
- Publication number
- JPH0557274B2 JPH0557274B2 JP81200237A JP20023781A JPH0557274B2 JP H0557274 B2 JPH0557274 B2 JP H0557274B2 JP 81200237 A JP81200237 A JP 81200237A JP 20023781 A JP20023781 A JP 20023781A JP H0557274 B2 JPH0557274 B2 JP H0557274B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- atom
- atoms
- lower alkyl
- groups
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 76
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 64
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 53
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 21
- 239000001257 hydrogen Substances 0.000 claims abstract description 20
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 18
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 12
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 9
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 8
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 7
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 7
- 125000005843 halogen group Chemical group 0.000 claims abstract description 7
- 229910052740 iodine Inorganic materials 0.000 claims abstract description 7
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims abstract description 6
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims abstract description 6
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 6
- 229920006395 saturated elastomer Polymers 0.000 claims abstract description 6
- 230000002936 tranquilizing effect Effects 0.000 claims abstract description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000001301 oxygen Substances 0.000 claims abstract description 5
- 239000003204 tranquilizing agent Substances 0.000 claims abstract description 5
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 4
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 4
- AIFRHYZBTHREPW-UHFFFAOYSA-N β-carboline Chemical class N1=CC=C2C3=CC=CC=C3NC2=C1 AIFRHYZBTHREPW-UHFFFAOYSA-N 0.000 claims abstract 7
- 229910052717 sulfur Inorganic materials 0.000 claims abstract 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 16
- 125000000623 heterocyclic group Chemical group 0.000 claims description 9
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims description 6
- HCUOEKSZWPGJIM-IYNMRSRQSA-N (e,2z)-2-hydroxyimino-6-methoxy-4-methyl-5-nitrohex-3-enamide Chemical group COCC([N+]([O-])=O)\C(C)=C\C(=N\O)\C(N)=O HCUOEKSZWPGJIM-IYNMRSRQSA-N 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000003386 piperidinyl group Chemical group 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 229940125725 tranquilizer Drugs 0.000 claims description 3
- -1 β-carboline compound Chemical class 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 14
- 150000002431 hydrogen Chemical class 0.000 abstract 8
- 125000003118 aryl group Chemical group 0.000 abstract 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 3
- 125000000041 C6-C10 aryl group Chemical group 0.000 abstract 2
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 abstract 1
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 abstract 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract 1
- 125000002648 azanetriyl group Chemical group *N(*)* 0.000 abstract 1
- 229910052794 bromium Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 125000005842 heteroatom Chemical group 0.000 abstract 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 abstract 1
- 125000004043 oxo group Chemical group O=* 0.000 abstract 1
- 230000000506 psychotropic effect Effects 0.000 abstract 1
- 238000012360 testing method Methods 0.000 description 9
- 241000699670 Mus sp. Species 0.000 description 7
- 229960002200 flunitrazepam Drugs 0.000 description 5
- 229940049706 benzodiazepine Drugs 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 150000001557 benzodiazepines Chemical class 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- YIZNPYBICIOFLG-UHFFFAOYSA-N 9h-pyrido[3,4-b]indole-3-carboxamide Chemical group N1C2=CC=CC=C2C2=C1C=NC(C(=O)N)=C2 YIZNPYBICIOFLG-UHFFFAOYSA-N 0.000 description 2
- 102000004300 GABA-A Receptors Human genes 0.000 description 2
- 108090000839 GABA-A Receptors Proteins 0.000 description 2
- PPTYJKAXVCCBDU-UHFFFAOYSA-N Rohypnol Chemical compound N=1CC(=O)N(C)C2=CC=C([N+]([O-])=O)C=C2C=1C1=CC=CC=C1F PPTYJKAXVCCBDU-UHFFFAOYSA-N 0.000 description 2
- 230000002539 anti-aggressive effect Effects 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- WUHLVXDDBHWHLQ-UHFFFAOYSA-N pentazole Chemical compound N=1N=NNN=1 WUHLVXDDBHWHLQ-UHFFFAOYSA-N 0.000 description 2
- 210000004129 prosencephalon Anatomy 0.000 description 2
- 230000009870 specific binding Effects 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 230000001629 suppression Effects 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 1
- ZVAPWJGRRUHKGP-UHFFFAOYSA-N 1h-1,5-benzodiazepine Chemical class N1C=CC=NC2=CC=CC=C12 ZVAPWJGRRUHKGP-UHFFFAOYSA-N 0.000 description 1
- 206010007882 Cellulitis Diseases 0.000 description 1
- 206010053398 Clonic convulsion Diseases 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 206010043994 Tonic convulsion Diseases 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- 230000016571 aggressive behavior Effects 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000002082 anti-convulsion Effects 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 229960003529 diazepam Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/20—Hypnotics; Sedatives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/18—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D209/20—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals substituted additionally by nitrogen atoms, e.g. tryptophane
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6561—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom containing systems of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring or ring system, with or without other non-condensed hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Neurology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Biomedical Technology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Neurosurgery (AREA)
- Animal Behavior & Ethology (AREA)
- Molecular Biology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Biochemistry (AREA)
- Anesthesiology (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803048318 DE3048318A1 (de) | 1980-12-17 | 1980-12-17 | 4-alkoxyalkyl substituierte (beta)-carbolin-3-carbonsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| DK91381 | 1981-02-27 | ||
| DE19813136857 DE3136857A1 (de) | 1981-09-14 | 1981-09-14 | Substituierte (beta)-carbolin-3-carbonsaeurealkylester, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS57123180A JPS57123180A (en) | 1982-07-31 |
| JPH0557274B2 true JPH0557274B2 (OSRAM) | 1993-08-23 |
Family
ID=27189019
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP56200237A Granted JPS57123180A (en) | 1980-12-17 | 1981-12-14 | 3-substituted beta-carboline, manufacture and psychotropic drug containing same |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US4435403A (OSRAM) |
| EP (1) | EP0054507B1 (OSRAM) |
| JP (1) | JPS57123180A (OSRAM) |
| AT (1) | ATE32513T1 (OSRAM) |
| AU (1) | AU558450B2 (OSRAM) |
| CA (1) | CA1188300A (OSRAM) |
| DD (1) | DD161210A5 (OSRAM) |
| DE (1) | DE3176650D1 (OSRAM) |
| EG (1) | EG17159A (OSRAM) |
| ES (1) | ES508073A0 (OSRAM) |
| HU (1) | HU187395B (OSRAM) |
| IE (1) | IE53931B1 (OSRAM) |
| IL (1) | IL64560A (OSRAM) |
| NZ (1) | NZ199312A (OSRAM) |
| PT (1) | PT74143B (OSRAM) |
| RO (1) | RO82164A (OSRAM) |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ194747A (en) * | 1979-08-29 | 1988-11-29 | Schering Ag | 9h-pyrido(3,4-b)indol-3-ylcarboxylic acid derivatives |
| DE3240514A1 (de) * | 1982-10-29 | 1984-05-03 | Schering AG, 1000 Berlin und 4709 Bergkamen | Ss-carboline, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische praeparate |
| DK151808C (da) * | 1982-11-16 | 1988-06-20 | Ferrosan As | Analogifremgangsmaade til fremstilling af oxadiazolylimidazo-oe1,4aa-benzodiazepinderivater |
| DE3246932A1 (de) * | 1982-12-16 | 1984-06-20 | Schering AG, 1000 Berlin und 4709 Bergkamen | Substituierte 5h-pyrimido(5,4-b)indole |
| DK149270C (da) * | 1983-05-27 | 1986-08-25 | Schering Ag | Analogifremgangsmaade til fremstilling af beta-carbolin-3-carboxylsyrederivater |
| DE3322895A1 (de) * | 1983-06-23 | 1985-01-03 | Schering AG, 1000 Berlin und 4709 Bergkamen | Neue ss-carboline, verfahren zur ihrer herstellung und ihre verwendung als arzneimittel (s) |
| DE3322894A1 (de) * | 1983-06-23 | 1985-01-03 | Schering AG, 1000 Berlin und 4709 Bergkamen | Neue (beta)-carboline, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel (h) |
| US4631149A (en) * | 1983-07-25 | 1986-12-23 | University Of Illinois | Antiviral eudistomins from a marine tunicate |
| DE3335323A1 (de) * | 1983-09-27 | 1985-04-04 | Schering AG, 1000 Berlin und 4709 Bergkamen | Substituierte ss-carboline, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| DE3587913D1 (de) * | 1984-01-19 | 1994-10-06 | Hoffmann La Roche | Imidazodiazepin-Derivate. |
| DK240184D0 (da) * | 1984-05-15 | 1984-05-15 | Ferrosan As | Beta-carboline-3-carboxylic acid derivatives and method of preparing the same |
| DK240084D0 (da) * | 1984-05-15 | 1984-05-15 | Ferrosan As | New beta-carboline-3-oxadiazolyl derivatives |
| GB8432073D0 (en) * | 1984-12-19 | 1985-01-30 | Roussel Lab Ltd | Chemical compounds |
| DE3504045A1 (de) * | 1985-02-04 | 1986-08-07 | Schering AG, 1000 Berlin und 4709 Bergkamen | Verfahren zur herstellung von ss-carbolinen durch dehydrierung |
| AU587802B2 (en) * | 1985-03-08 | 1989-08-31 | Ferrosan A/S | Novel oxadiazolyl imidazobenzodiazepine derivatives and methods of preparing such compounds |
| US4622320A (en) * | 1985-05-17 | 1986-11-11 | As Ferrosan | Oxadiazolylimidazobenzodiazepine, compositions, and method |
| US4745112A (en) * | 1985-05-17 | 1988-05-17 | A/S Ferrosan | Oxadiazolylimidazobenzodiazepine, compositions, and method III |
| DE3535927A1 (de) * | 1985-10-04 | 1987-04-09 | Schering Ag | 3-vinyl- und 3-ethinyl-ss-carbolinderivate, ihre herstellung und ihre verwendung als arzneimittel |
| DE3540654A1 (de) | 1985-11-13 | 1987-05-14 | Schering Ag | Phenoxy-substituierte ss-carbolinderivate, ihre herstellung und ihre verwendung als arzneimittel |
| DE3540653A1 (de) * | 1985-11-13 | 1987-05-14 | Schering Ag | Neue 3-oxadiazol- und 3-carbonsaeure-ss-carbolinderivate, ihre herstellung und ihre verwendung als arzneimittel |
| DE3545776A1 (de) * | 1985-12-20 | 1987-06-25 | Schering Ag | 5-aminoalkyl-ss-carbolinderivate, ihre herstellung und ihre verwendung als arzneimittel |
| US4952584A (en) * | 1986-01-11 | 1990-08-28 | Beecham Group P.L.C. | 9H-pyrido[2,B-8]indole-3-carboxylic acid ester compounds having useful pharmaceutical activity |
| DE3609699A1 (de) * | 1986-03-20 | 1987-09-24 | Schering Ag | 5- oder 6-substituierte-(beta)-carbolin-3-carbonsaeureester |
| DE3608089A1 (de) * | 1986-03-08 | 1987-09-10 | Schering Ag | Heteroaryl-oxy-ss-carbolinderivate, ihre herstellung und ihre verwendung als arzneimittel |
| DK174086D0 (da) * | 1986-04-16 | 1986-04-16 | Ferrosan As | Nye benzodiazepinderivater samt fremgangsmaade til fremstilling af samme |
| EP0304223A3 (en) * | 1987-08-17 | 1990-10-24 | Merck & Co. Inc. | Beta-carbolines as cholecy-stokinin and gastrin antagonist |
| AU619203B2 (en) * | 1987-08-28 | 1992-01-23 | Schering Aktiengesellschaft | Isoxazole-beta-carboline derivatives |
| DE3729370C2 (de) * | 1987-08-31 | 1995-04-20 | Schering Ag | Verfahren zur Herstellung von 4-Alkoxyalkyl-beta-carbolinen |
| DE3943225A1 (de) * | 1989-12-23 | 1991-06-27 | Schering Ag | Neue ss-carboline, verfahren zu deren herstellung und deren verwendung in arzneimitteln |
| DE4013907A1 (de) * | 1990-04-26 | 1991-10-31 | Schering Ag | Verfahren zur herstellung von gramin-derivaten |
| DE4029389A1 (de) * | 1990-09-13 | 1992-03-26 | Schering Ag | Verfahren zur herstellung von (beta)-carbolin-derivaten |
| US5350750A (en) * | 1991-04-27 | 1994-09-27 | Schering Aktiengesellschaft | β-carboline-3-hydroxyalkylcarboxylic acid ester derivatives, process for their production and their use in pharmaceutical agents |
| DE4120109A1 (de) * | 1991-06-15 | 1992-12-17 | Schering Ag | 3-aryl- oder 3-hetaryl-(beta)-carboline, deren herstellung und verwendung in arzneimitteln |
| US5543519A (en) * | 1991-06-15 | 1996-08-06 | Schering Aktiengesellschaft | 3-aryl or 3-hetaryl-β-carbolines, their production and use in pharmaceutical agents |
| DE4122722A1 (de) * | 1991-07-06 | 1993-01-07 | Schering Ag | Verfahren zur herstellung von indol-derivaten |
| DE4130933A1 (de) * | 1991-09-13 | 1993-03-18 | Schering Ag | Neue (beta)-carbolinderivate, deren herstellung und verwendung in arzneimitteln |
| US5585490A (en) * | 1991-10-08 | 1996-12-17 | Neurogen Corporation | Certain cycloalkyl and azacycloalkyl pyrrolopyrimidines; a new class of GABA brain receptor ligands |
| US5367077A (en) * | 1992-04-08 | 1994-11-22 | Neurogen Corporation | Certain cycloalkyl and azacycloalkyl pyrrolopyridines; a new class of gaba rain receptor ligands |
| AU4117493A (en) * | 1992-04-08 | 1994-11-21 | Neurogen Corporation | Certain aryl fused pyrrolopyrimidines; a new class of gaba brain receptor ligands |
| US5286860A (en) * | 1992-11-12 | 1994-02-15 | Neurogen Corporation | Certain aryl substituted pyrrolopyrazines; a new class of GABA brain receptor ligands |
| US5750702A (en) * | 1993-10-27 | 1998-05-12 | Neurogen Corporation | Certain pyrrolo pyridine-3-carboxamides; a new class of GABA brain receptor ligands |
| DE4330175A1 (de) * | 1993-08-31 | 1995-03-02 | Schering Ag | Alkoxy-substituierte beta-Carboline |
| US5484944A (en) * | 1993-10-27 | 1996-01-16 | Neurogen Corporation | Certain fused pyrrolecarboxanilides and their use as GABA brain receptor ligands |
| US5804686A (en) * | 1996-01-19 | 1998-09-08 | Neurogen Corporation | fused pyrrolecarboxamides; a new class of GABA brain receptor ligands |
| US6211365B1 (en) | 1996-01-19 | 2001-04-03 | Neurogen Corporation | Fused pyrrolecarboxamides; a new class of GABA brain receptor ligands |
| EP0888300A1 (en) | 1996-03-22 | 1999-01-07 | Neurogen Corporation | Certain fused pyrrolecarboxamides as gaba brain receptor ligands |
| US5723462A (en) * | 1996-04-26 | 1998-03-03 | Neurogen Corporation | Certain fused pyrrolecarboxamides a new class of GABA brain receptor ligands |
| US20050014939A1 (en) * | 1999-08-31 | 2005-01-20 | Neurogen Corporation | Fused pyrrolecarboxamides: GABA brain receptor ligands |
| EP1210328A1 (en) | 1999-08-31 | 2002-06-05 | Neurogen Corporation | Fused pyrrolecarboxamides: a new class of gaba brain receptor ligands |
| US20040253891A1 (en) * | 2000-09-12 | 2004-12-16 | Schierenbeck Alan W. | Composite structure for protective garment |
| US20050101623A1 (en) * | 2003-07-23 | 2005-05-12 | Pharmacia Corporation | Beta-carboline compounds and analogues thereof as mitogen-activated protein kinase-activated protein kinase-2 inhibitors |
| FR2953838B1 (fr) * | 2009-12-10 | 2012-02-24 | Sanofi Aventis | Derives de 9h-beta-carboline (ou 9h-pyridino[3,4-b]indole) trisubstitues, leur preparation et leur utilisation therapeutique |
| FR2953837B1 (fr) * | 2009-12-10 | 2012-03-09 | Sanofi Aventis | Derives 9h-pyridino[3,4-b]indole disubstitues, leur preparation et leur utilisation therapeutique |
| WO2020072675A1 (en) | 2018-10-02 | 2020-04-09 | Northwestern University | Beta-carbolines as positive allosteric modulators of the human serotonin receptor 2c (5-ht2c) |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA786351A (en) | 1968-05-28 | Leonard Frederick | PROCESS FOR THE PREPARATION OF NEW .beta.-CARBOLIN-CARBOXYLIC ACID AMIDE DERIVATIVES | |
| FR894620A (fr) | 1943-02-08 | 1944-12-29 | Barrere & Cie M | Embrayeur-inverseur pour la commande des arbres porte-hélice des bateaux |
| ES273769A1 (es) * | 1961-01-18 | 1962-06-01 | Geigy Ag J R | Procedimiento para la preparaciën de nuevos derivados de amidas de acido beta-carbolin-carboxilico |
| FR2306693A1 (fr) * | 1975-04-11 | 1976-11-05 | Roussel Uclaf | Nouveaux derives du /9h/pyrido/3,4-b/ indole et leurs sels, procede de preparation et application a titre de medicaments |
| FR2455044A1 (fr) * | 1979-04-26 | 1980-11-21 | Synthelabo | Pyrido-indoles et leur application en therapeutique |
| NZ194747A (en) | 1979-08-29 | 1988-11-29 | Schering Ag | 9h-pyrido(3,4-b)indol-3-ylcarboxylic acid derivatives |
| JPS574987A (en) * | 1980-06-09 | 1982-01-11 | Sankyo Co Ltd | Pyridoindolecarboxylic acid derivative and its preparation |
-
1981
- 1981-12-14 JP JP56200237A patent/JPS57123180A/ja active Granted
- 1981-12-15 DE DE8181730122T patent/DE3176650D1/de not_active Expired
- 1981-12-15 IL IL64560A patent/IL64560A/xx not_active IP Right Cessation
- 1981-12-15 RO RO81106006A patent/RO82164A/ro unknown
- 1981-12-15 AT AT81730122T patent/ATE32513T1/de not_active IP Right Cessation
- 1981-12-15 EP EP81730122A patent/EP0054507B1/en not_active Expired
- 1981-12-16 HU HU813799A patent/HU187395B/hu not_active IP Right Cessation
- 1981-12-16 DD DD81235831A patent/DD161210A5/de not_active IP Right Cessation
- 1981-12-16 CA CA000392470A patent/CA1188300A/en not_active Expired
- 1981-12-16 EG EG741/81A patent/EG17159A/xx active
- 1981-12-16 PT PT74143A patent/PT74143B/pt not_active IP Right Cessation
- 1981-12-16 IE IE2954/81A patent/IE53931B1/en not_active IP Right Cessation
- 1981-12-17 US US06/331,740 patent/US4435403A/en not_active Expired - Lifetime
- 1981-12-17 ES ES508073A patent/ES508073A0/es active Granted
- 1981-12-17 AU AU78592/81A patent/AU558450B2/en not_active Ceased
- 1981-12-17 NZ NZ199312A patent/NZ199312A/xx unknown
-
1983
- 1983-12-01 US US06/556,869 patent/US4596808A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| IL64560A (en) | 1988-05-31 |
| ATE32513T1 (de) | 1988-03-15 |
| IE53931B1 (en) | 1989-04-26 |
| EP0054507A3 (en) | 1982-09-15 |
| CA1188300A (en) | 1985-06-04 |
| PT74143A (de) | 1982-01-01 |
| RO82164A (ro) | 1983-07-07 |
| HU187395B (en) | 1985-12-28 |
| EG17159A (en) | 1990-12-30 |
| DE3176650D1 (en) | 1988-03-24 |
| ES8301984A1 (es) | 1983-02-01 |
| DD161210A5 (de) | 1985-06-12 |
| EP0054507B1 (en) | 1988-02-17 |
| RO82164B (ro) | 1983-06-30 |
| PT74143B (de) | 1983-05-16 |
| IL64560A0 (en) | 1982-03-31 |
| EP0054507A2 (en) | 1982-06-23 |
| NZ199312A (en) | 1989-08-29 |
| AU558450B2 (en) | 1987-01-29 |
| US4435403A (en) | 1984-03-06 |
| IE812954L (en) | 1982-06-17 |
| JPS57123180A (en) | 1982-07-31 |
| AU7859281A (en) | 1982-06-24 |
| US4596808A (en) | 1986-06-24 |
| ES508073A0 (es) | 1983-02-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0557274B2 (OSRAM) | ||
| JP5726737B2 (ja) | 自己免疫障害および免疫性障害の治療において有用なs1p1受容体のアゴニストとしての置換三環式酸誘導体 | |
| US6812243B2 (en) | Indole derivatives and their use for the treatment of malignant and other diseases based on pathological proliferation | |
| EP0362695B1 (de) | Pyrrolocarbazol-Derivate, Verfahren zu deren Herstellung und deren Verwendung als Arzneimittel | |
| MX2011000879A (es) | Derivados de ácido 1,2,3,4-tetrahidrociclopenta [b] indol-3-il) acetico sustituidos útiles en el tratamiento de enfermedades autoinmune e inflamatorias. | |
| EA000036B1 (ru) | Метансульфонат производного камптотецина, способы его получения и фармацевтическая композиция на его основе | |
| EP0421762A1 (en) | Novel nicotine analogs and method | |
| WO2011005295A1 (en) | Modulators of the sphingosine-1-phosphate (s1p) receptor useful for the treatment of disorders related thereto | |
| WO2017122722A1 (ja) | 2環性複素環化合物 | |
| JPH03294279A (ja) | インドーロカルバゾール誘導体、その製造方法及びその使用。 | |
| US5489608A (en) | Indolocarbazole derivatives and the use thereof | |
| TW202333713A (zh) | 一種噠嗪類化合物、其藥物組合物及應用 | |
| US5138062A (en) | Nicotine analogs | |
| DE2433308A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| Heymans et al. | Structure-activity relationship in PAF-acether. 2. RAC-1-O-octadecyl-2-O-acetyl-3-O-[. gamma.-(dimethylamino) propyl] glycerol | |
| WO1998042710A1 (fr) | Derives de dihydropyrazino[1,2-a]indole-1-one, leur preparation et leur application en therapeutique | |
| JP4549387B2 (ja) | タンパク質キナーゼc阻害剤としての置換ピロール−2,5−ジオン | |
| DE69113338T2 (de) | Pyranobenzoxadiazolderivate. | |
| WO2025201503A1 (en) | Compounds, preparation methods and uses thereof | |
| JPWO2018133854A5 (OSRAM) | ||
| EP0383759A1 (en) | N6 substituted 9-methyladenines: a new class of adenosine receptor antagonists | |
| TW202515569A (zh) | 雙環及單環trpa1抑制劑 | |
| CA2130519A1 (en) | Antimigraine cyclobutenedione derivatives of tryptamines | |
| FI88039C (fi) | Foerfarande foer framstaellning av 2,3-dihydro-1-(8-metyl-1,2,4-triatsolo/4,3-b/pyridazin-6-yl)-4(1h)-pyridinon | |
| FR2797630A1 (fr) | DERIVES ETHERS DE PYRROLO[1,2-a] QUINOXALINES, LEUR PROCEDE DE PREPARATION ET LEUR APPLICATION EN THERAPEUTIQUE |