JPH0521939B2 - - Google Patents
Info
- Publication number
- JPH0521939B2 JPH0521939B2 JP58084876A JP8487683A JPH0521939B2 JP H0521939 B2 JPH0521939 B2 JP H0521939B2 JP 58084876 A JP58084876 A JP 58084876A JP 8487683 A JP8487683 A JP 8487683A JP H0521939 B2 JPH0521939 B2 JP H0521939B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- groups
- formula
- saturated
- unsaturated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000203 mixture Chemical class 0.000 claims description 192
- 229920000642 polymer Polymers 0.000 claims description 65
- 239000002318 adhesion promoter Substances 0.000 claims description 51
- 239000003054 catalyst Substances 0.000 claims description 49
- 239000002516 radical scavenger Substances 0.000 claims description 47
- 238000000034 method Methods 0.000 claims description 42
- -1 acryloxy groups Chemical group 0.000 claims description 37
- 229920001296 polysiloxane Polymers 0.000 claims description 35
- 238000009833 condensation Methods 0.000 claims description 32
- 230000005494 condensation Effects 0.000 claims description 32
- 229920006395 saturated elastomer Polymers 0.000 claims description 26
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 21
- 239000004971 Cross linker Substances 0.000 claims description 17
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 17
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 claims description 17
- 150000001412 amines Chemical class 0.000 claims description 15
- 229910052710 silicon Inorganic materials 0.000 claims description 14
- 125000003277 amino group Chemical group 0.000 claims description 13
- 150000002357 guanidines Chemical class 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 125000004423 acyloxy group Chemical group 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical group OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 claims description 9
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 9
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 8
- 125000002947 alkylene group Chemical group 0.000 claims description 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 8
- 125000001033 ether group Chemical group 0.000 claims description 8
- 230000000087 stabilizing effect Effects 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 7
- 125000000524 functional group Chemical group 0.000 claims description 7
- ZRALSGWEFCBTJO-UHFFFAOYSA-N anhydrous guanidine Natural products NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims description 6
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical compound FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 claims description 5
- 239000004593 Epoxy Substances 0.000 claims description 5
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 5
- 229920001971 elastomer Polymers 0.000 claims description 5
- 239000000806 elastomer Substances 0.000 claims description 5
- PHQOGHDTIVQXHL-UHFFFAOYSA-N n'-(3-trimethoxysilylpropyl)ethane-1,2-diamine Chemical group CO[Si](OC)(OC)CCCNCCN PHQOGHDTIVQXHL-UHFFFAOYSA-N 0.000 claims description 5
- KVUMYOWDFZAGPN-UHFFFAOYSA-N 3-trimethoxysilylpropanenitrile Chemical group CO[Si](OC)(OC)CCC#N KVUMYOWDFZAGPN-UHFFFAOYSA-N 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims description 3
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims description 3
- 229930195734 saturated hydrocarbon Natural products 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 230000002000 scavenging effect Effects 0.000 claims description 2
- 125000005504 styryl group Chemical group 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 54
- 125000003700 epoxy group Chemical group 0.000 claims 5
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims 5
- 150000002431 hydrogen Chemical class 0.000 claims 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 62
- 229910000077 silane Inorganic materials 0.000 description 40
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 39
- 150000002430 hydrocarbons Chemical group 0.000 description 32
- 239000000853 adhesive Substances 0.000 description 29
- 230000001070 adhesive effect Effects 0.000 description 29
- 238000004519 manufacturing process Methods 0.000 description 26
- 229910052782 aluminium Inorganic materials 0.000 description 25
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 25
- 239000000654 additive Substances 0.000 description 24
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 20
- 239000000945 filler Substances 0.000 description 18
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 16
- 238000003860 storage Methods 0.000 description 13
- 239000004567 concrete Substances 0.000 description 12
- 239000011521 glass Substances 0.000 description 12
- 229920000058 polyacrylate Polymers 0.000 description 12
- 229910000989 Alclad Inorganic materials 0.000 description 11
- 150000004756 silanes Chemical class 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 239000000543 intermediate Substances 0.000 description 10
- 229910052697 platinum Inorganic materials 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 9
- UMVBXBACMIOFDO-UHFFFAOYSA-N [N].[Si] Chemical compound [N].[Si] UMVBXBACMIOFDO-UHFFFAOYSA-N 0.000 description 8
- 230000000996 additive effect Effects 0.000 description 8
- 239000004615 ingredient Substances 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 238000002156 mixing Methods 0.000 description 7
- 239000000565 sealant Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 229910017464 nitrogen compound Inorganic materials 0.000 description 6
- 125000005372 silanol group Chemical group 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 229920002554 vinyl polymer Chemical group 0.000 description 6
- 230000032683 aging Effects 0.000 description 5
- 238000004132 cross linking Methods 0.000 description 5
- 125000004122 cyclic group Chemical group 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 150000003335 secondary amines Chemical class 0.000 description 5
- YUYCVXFAYWRXLS-UHFFFAOYSA-N trimethoxysilane Chemical compound CO[SiH](OC)OC YUYCVXFAYWRXLS-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 4
- FPJPAIQDDFIEKJ-UHFFFAOYSA-N 4-trimethoxysilylbutanenitrile Chemical compound CO[Si](OC)(OC)CCCC#N FPJPAIQDDFIEKJ-UHFFFAOYSA-N 0.000 description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical class [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 4
- 239000013522 chelant Substances 0.000 description 4
- 239000003431 cross linking reagent Substances 0.000 description 4
- 125000004185 ester group Chemical group 0.000 description 4
- NKSJNEHGWDZZQF-UHFFFAOYSA-N ethenyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)C=C NKSJNEHGWDZZQF-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 230000000704 physical effect Effects 0.000 description 4
- 239000004800 polyvinyl chloride Substances 0.000 description 4
- 229920000915 polyvinyl chloride Polymers 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000000344 soap Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 239000010936 titanium Substances 0.000 description 4
- 229910052719 titanium Inorganic materials 0.000 description 4
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 3
- FMGBDYLOANULLW-UHFFFAOYSA-N 3-isocyanatopropyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)CCCN=C=O FMGBDYLOANULLW-UHFFFAOYSA-N 0.000 description 3
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 3
- 150000001336 alkenes Chemical group 0.000 description 3
- 150000001408 amides Chemical group 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 125000000732 arylene group Chemical group 0.000 description 3
- 229920005645 diorganopolysiloxane polymer Polymers 0.000 description 3
- 125000003709 fluoroalkyl group Chemical group 0.000 description 3
- 229910021485 fumed silica Inorganic materials 0.000 description 3
- 230000014509 gene expression Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- BFXIKLCIZHOAAZ-UHFFFAOYSA-N methyltrimethoxysilane Chemical compound CO[Si](C)(OC)OC BFXIKLCIZHOAAZ-UHFFFAOYSA-N 0.000 description 3
- 230000009972 noncorrosive effect Effects 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229920000515 polycarbonate Polymers 0.000 description 3
- 239000004417 polycarbonate Substances 0.000 description 3
- 229920002631 room-temperature vulcanizate silicone Polymers 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- DQZNLOXENNXVAD-UHFFFAOYSA-N trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-4-yl)ethyl]silane Chemical group C1C(CC[Si](OC)(OC)OC)CCC2OC21 DQZNLOXENNXVAD-UHFFFAOYSA-N 0.000 description 3
- SXUXGFHXUDLTFO-UHFFFAOYSA-N (E)-4-oxo-4-silyloxybut-2-enoic acid Chemical class OC(=O)C=CC(=O)O[SiH3] SXUXGFHXUDLTFO-UHFFFAOYSA-N 0.000 description 2
- ZYAASQNKCWTPKI-UHFFFAOYSA-N 3-[dimethoxy(methyl)silyl]propan-1-amine Chemical compound CO[Si](C)(OC)CCCN ZYAASQNKCWTPKI-UHFFFAOYSA-N 0.000 description 2
- SJECZPVISLOESU-UHFFFAOYSA-N 3-trimethoxysilylpropan-1-amine Chemical compound CO[Si](OC)(OC)CCCN SJECZPVISLOESU-UHFFFAOYSA-N 0.000 description 2
- FZTPAOAMKBXNSH-UHFFFAOYSA-N 3-trimethoxysilylpropyl acetate Chemical compound CO[Si](OC)(OC)CCCOC(C)=O FZTPAOAMKBXNSH-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N N-methylacetamide Chemical compound CNC(C)=O OHLUUHNLEMFGTQ-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000007259 addition reaction Methods 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 125000005011 alkyl ether group Chemical group 0.000 description 2
- SJNALLRHIVGIBI-UHFFFAOYSA-N allyl cyanide Chemical compound C=CCC#N SJNALLRHIVGIBI-UHFFFAOYSA-N 0.000 description 2
- HXBPYFMVGFDZFT-UHFFFAOYSA-N allyl isocyanate Chemical compound C=CCN=C=O HXBPYFMVGFDZFT-UHFFFAOYSA-N 0.000 description 2
- 235000013405 beer Nutrition 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- DMZWVCJEOLBQCZ-UHFFFAOYSA-N chloro(ethenyl)silane Chemical compound Cl[SiH2]C=C DMZWVCJEOLBQCZ-UHFFFAOYSA-N 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 239000012975 dibutyltin dilaurate Substances 0.000 description 2
- 239000004205 dimethyl polysiloxane Substances 0.000 description 2
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- LCUQPCZFCROAPF-UHFFFAOYSA-N n-[dimethoxy(methyl)silyl]-n-hexylhexan-1-amine Chemical compound CCCCCCN([Si](C)(OC)OC)CCCCCC LCUQPCZFCROAPF-UHFFFAOYSA-N 0.000 description 2
- 150000002830 nitrogen compounds Chemical class 0.000 description 2
- SBOJXQVPLKSXOG-UHFFFAOYSA-N o-amino-hydroxylamine Chemical compound NON SBOJXQVPLKSXOG-UHFFFAOYSA-N 0.000 description 2
- 125000000962 organic group Chemical group 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000004945 silicone rubber Substances 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 150000003606 tin compounds Chemical class 0.000 description 2
- 150000003609 titanium compounds Chemical class 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- ZDHXKXAHOVTTAH-UHFFFAOYSA-N trichlorosilane Chemical class Cl[SiH](Cl)Cl ZDHXKXAHOVTTAH-UHFFFAOYSA-N 0.000 description 2
- 125000000725 trifluoropropyl group Chemical group [H]C([H])(*)C([H])([H])C(F)(F)F 0.000 description 2
- BPSIOYPQMFLKFR-UHFFFAOYSA-N trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane Chemical compound CO[Si](OC)(OC)CCCOCC1CO1 BPSIOYPQMFLKFR-UHFFFAOYSA-N 0.000 description 2
- 150000003755 zirconium compounds Chemical class 0.000 description 2
- YXTDAZMTQFUZHK-ZVGUSBNCSA-L (2r,3r)-2,3-dihydroxybutanedioate;tin(2+) Chemical compound [Sn+2].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O YXTDAZMTQFUZHK-ZVGUSBNCSA-L 0.000 description 1
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 1
- WYTZZXDRDKSJID-UHFFFAOYSA-N (3-aminopropyl)triethoxysilane Chemical compound CCO[Si](OCC)(OCC)CCCN WYTZZXDRDKSJID-UHFFFAOYSA-N 0.000 description 1
- OVSGBKZKXUMMHS-VGKOASNMSA-L (z)-4-oxopent-2-en-2-olate;propan-2-olate;titanium(4+) Chemical compound [Ti+4].CC(C)[O-].CC(C)[O-].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O OVSGBKZKXUMMHS-VGKOASNMSA-L 0.000 description 1
- MPJJRYGVHNTASI-SUKNRPLKSA-L (z)-4-oxopent-2-en-2-olate;propane-1,3-diolate;titanium(4+) Chemical compound [Ti+4].[O-]CCC[O-].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O MPJJRYGVHNTASI-SUKNRPLKSA-L 0.000 description 1
- QMTFKWDCWOTPGJ-KVVVOXFISA-N (z)-octadec-9-enoic acid;tin Chemical compound [Sn].CCCCCCCC\C=C/CCCCCCCC(O)=O QMTFKWDCWOTPGJ-KVVVOXFISA-N 0.000 description 1
- NRQVEWMTFLREAZ-UHFFFAOYSA-N 1,1-dimethoxy-N-methylsilylmethanamine Chemical compound C[SiH2]NC(OC)OC NRQVEWMTFLREAZ-UHFFFAOYSA-N 0.000 description 1
- GDUKVUYBZPXXHH-UHFFFAOYSA-N 1-[diethoxy(methyl)silyl]propan-2-yl acetate Chemical compound CCO[Si](C)(OCC)CC(C)OC(C)=O GDUKVUYBZPXXHH-UHFFFAOYSA-N 0.000 description 1
- SOIOCWRKKDYODY-UHFFFAOYSA-N 1-[dimethoxy(methyl)silyl]-1,3,3-trimethylurea Chemical compound CO[Si](C)(OC)N(C)C(=O)N(C)C SOIOCWRKKDYODY-UHFFFAOYSA-N 0.000 description 1
- HPHOVRJOBLOYJZ-UHFFFAOYSA-N 1-[dimethoxy(methyl)silyl]propan-2-yl acetate Chemical compound CO[Si](C)(OC)CC(C)OC(C)=O HPHOVRJOBLOYJZ-UHFFFAOYSA-N 0.000 description 1
- URXZKGGRKRRVDC-UHFFFAOYSA-N 1-[dimethoxy(propyl)silyl]oxyethanamine Chemical compound CCC[Si](OC)(OC)OC(C)N URXZKGGRKRRVDC-UHFFFAOYSA-N 0.000 description 1
- RIVXVSRXAHVDKT-UHFFFAOYSA-N 1-dimethoxysilyl-N,N-dimethylmethanamine Chemical compound CN(C)C[SiH](OC)OC RIVXVSRXAHVDKT-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- BSXYGPVTNNBOFT-UHFFFAOYSA-N 1-triethoxysilylpropan-2-yl acetate Chemical compound CCO[Si](OCC)(OCC)CC(C)OC(C)=O BSXYGPVTNNBOFT-UHFFFAOYSA-N 0.000 description 1
- FIADVASZMLCQIF-UHFFFAOYSA-N 2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetrazatetrasilocane Chemical compound C[Si]1(C)N[Si](C)(C)N[Si](C)(C)N[Si](C)(C)N1 FIADVASZMLCQIF-UHFFFAOYSA-N 0.000 description 1
- WGGNJZRNHUJNEM-UHFFFAOYSA-N 2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-triazatrisilinane Chemical compound C[Si]1(C)N[Si](C)(C)N[Si](C)(C)N1 WGGNJZRNHUJNEM-UHFFFAOYSA-N 0.000 description 1
- ITLDOQCDKSCTPJ-UHFFFAOYSA-N 2,2-dimethoxy-N-methylsilylethanamine Chemical compound C[SiH2]NCC(OC)OC ITLDOQCDKSCTPJ-UHFFFAOYSA-N 0.000 description 1
- STMDPCBYJCIZOD-UHFFFAOYSA-N 2-(2,4-dinitroanilino)-4-methylpentanoic acid Chemical compound CC(C)CC(C(O)=O)NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O STMDPCBYJCIZOD-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- MMQVRDSHVCEHMQ-UHFFFAOYSA-N 2-[2-(3-trimethoxysilylpropylamino)ethylamino]ethyl 2-methylprop-2-enoate Chemical compound CO[Si](OC)(OC)CCCNCCNCCOC(=O)C(C)=C MMQVRDSHVCEHMQ-UHFFFAOYSA-N 0.000 description 1
- VIAWXLFFSHQNAO-UHFFFAOYSA-N 2-[bis(2-hydroxyethyl)amino]butan-1-ol Chemical compound CCC(CO)N(CCO)CCO VIAWXLFFSHQNAO-UHFFFAOYSA-N 0.000 description 1
- TXZUUQRMOIEKKQ-UHFFFAOYSA-N 2-[diethoxy(phenyl)silyl]oxy-n,n-dimethylethanamine Chemical compound CN(C)CCO[Si](OCC)(OCC)C1=CC=CC=C1 TXZUUQRMOIEKKQ-UHFFFAOYSA-N 0.000 description 1
- LJFXYAWQDZDDBY-UHFFFAOYSA-N 2-[tris(2-methoxyethoxy)silyl]propanenitrile Chemical class COCCO[Si](OCCOC)(OCCOC)C(C)C#N LJFXYAWQDZDDBY-UHFFFAOYSA-N 0.000 description 1
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical compound C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- KTXWGMUMDPYXNN-UHFFFAOYSA-N 2-ethylhexan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCCC(CC)C[O-].CCCCC(CC)C[O-].CCCCC(CC)C[O-].CCCCC(CC)C[O-] KTXWGMUMDPYXNN-UHFFFAOYSA-N 0.000 description 1
- SMSVUYQRWYTTLI-UHFFFAOYSA-L 2-ethylhexanoate;iron(2+) Chemical compound [Fe+2].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O SMSVUYQRWYTTLI-UHFFFAOYSA-L 0.000 description 1
- FHRAKXJVEOBCBQ-UHFFFAOYSA-L 2-ethylhexanoate;manganese(2+) Chemical compound [Mn+2].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O FHRAKXJVEOBCBQ-UHFFFAOYSA-L 0.000 description 1
- WKRJCCZAZDZNJL-UHFFFAOYSA-N 2-methoxyethoxysilicon Chemical compound COCCO[Si] WKRJCCZAZDZNJL-UHFFFAOYSA-N 0.000 description 1
- BVTACSRUXCUEHT-UHFFFAOYSA-N 2-methyl-6-triethoxysilylhex-1-en-3-one Chemical compound CCO[Si](OCC)(OCC)CCCC(=O)C(C)=C BVTACSRUXCUEHT-UHFFFAOYSA-N 0.000 description 1
- KUQVFOOAIOMQOT-UHFFFAOYSA-N 2-methylpropyltin Chemical compound CC(C)C[Sn] KUQVFOOAIOMQOT-UHFFFAOYSA-N 0.000 description 1
- BNCADMBVWNPPIZ-UHFFFAOYSA-N 2-n,2-n,4-n,4-n,6-n,6-n-hexakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine Chemical compound COCN(COC)C1=NC(N(COC)COC)=NC(N(COC)COC)=N1 BNCADMBVWNPPIZ-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- WBWAUFJXONIXBV-UHFFFAOYSA-N 2-triethoxysilylethyl acetate Chemical compound CCO[Si](OCC)(OCC)CCOC(C)=O WBWAUFJXONIXBV-UHFFFAOYSA-N 0.000 description 1
- QWXBQMDGNKCDOB-UHFFFAOYSA-N 2-trimethoxysilylethyl acetate Chemical compound CO[Si](OC)(OC)CCOC(C)=O QWXBQMDGNKCDOB-UHFFFAOYSA-N 0.000 description 1
- UYIOITAGWJIBKY-UHFFFAOYSA-N 3-(2-methyl-4-trimethoxysilylbut-3-en-2-yl)oxypropanenitrile Chemical compound CO[Si](OC)(OC)C=CC(C)(C)OCCC#N UYIOITAGWJIBKY-UHFFFAOYSA-N 0.000 description 1
- HXLAEGYMDGUSBD-UHFFFAOYSA-N 3-[diethoxy(methyl)silyl]propan-1-amine Chemical compound CCO[Si](C)(OCC)CCCN HXLAEGYMDGUSBD-UHFFFAOYSA-N 0.000 description 1
- ITSZNKWGCBRYQB-UHFFFAOYSA-N 3-[diethoxy(methyl)silyl]propanenitrile Chemical compound CCO[Si](C)(OCC)CCC#N ITSZNKWGCBRYQB-UHFFFAOYSA-N 0.000 description 1
- TWANXESQHWBHNY-UHFFFAOYSA-N 3-[diethoxy(propan-2-yloxy)silyl]propan-1-amine Chemical compound CCO[Si](OC(C)C)(OCC)CCCN TWANXESQHWBHNY-UHFFFAOYSA-N 0.000 description 1
- WKGYMMAZQLFVEB-UHFFFAOYSA-N 3-[dimethoxy(methyl)silyl]propanenitrile Chemical compound CO[Si](C)(OC)CCC#N WKGYMMAZQLFVEB-UHFFFAOYSA-N 0.000 description 1
- LZMNXXQIQIHFGC-UHFFFAOYSA-N 3-[dimethoxy(methyl)silyl]propyl 2-methylprop-2-enoate Chemical compound CO[Si](C)(OC)CCCOC(=O)C(C)=C LZMNXXQIQIHFGC-UHFFFAOYSA-N 0.000 description 1
- DMZPTAFGSRVFIA-UHFFFAOYSA-N 3-[tris(2-methoxyethoxy)silyl]propyl 2-methylprop-2-enoate Chemical compound COCCO[Si](OCCOC)(OCCOC)CCCOC(=O)C(C)=C DMZPTAFGSRVFIA-UHFFFAOYSA-N 0.000 description 1
- RWLDCNACDPTRMY-UHFFFAOYSA-N 3-triethoxysilyl-n-(3-triethoxysilylpropyl)propan-1-amine Chemical compound CCO[Si](OCC)(OCC)CCCNCCC[Si](OCC)(OCC)OCC RWLDCNACDPTRMY-UHFFFAOYSA-N 0.000 description 1
- GBQYMXVQHATSCC-UHFFFAOYSA-N 3-triethoxysilylpropanenitrile Chemical compound CCO[Si](OCC)(OCC)CCC#N GBQYMXVQHATSCC-UHFFFAOYSA-N 0.000 description 1
- XDQWJFXZTAWJST-UHFFFAOYSA-N 3-triethoxysilylpropyl prop-2-enoate Chemical compound CCO[Si](OCC)(OCC)CCCOC(=O)C=C XDQWJFXZTAWJST-UHFFFAOYSA-N 0.000 description 1
- XDLMVUHYZWKMMD-UHFFFAOYSA-N 3-trimethoxysilylpropyl 2-methylprop-2-enoate Chemical compound CO[Si](OC)(OC)CCCOC(=O)C(C)=C XDLMVUHYZWKMMD-UHFFFAOYSA-N 0.000 description 1
- KBQVDAIIQCXKPI-UHFFFAOYSA-N 3-trimethoxysilylpropyl prop-2-enoate Chemical compound CO[Si](OC)(OC)CCCOC(=O)C=C KBQVDAIIQCXKPI-UHFFFAOYSA-N 0.000 description 1
- YSEVGVGBHWFTIF-UHFFFAOYSA-N 4-[dimethoxy(methyl)silyl]butanenitrile Chemical compound CO[Si](C)(OC)CCCC#N YSEVGVGBHWFTIF-UHFFFAOYSA-N 0.000 description 1
- QPEZXRRQLZVKSU-UHFFFAOYSA-N 4-oxo-4-silyloxybutanoic acid Chemical class OC(=O)CCC(=O)O[SiH3] QPEZXRRQLZVKSU-UHFFFAOYSA-N 0.000 description 1
- VGIURMCNTDVGJM-UHFFFAOYSA-N 4-triethoxysilylbutanenitrile Chemical compound CCO[Si](OCC)(OCC)CCCC#N VGIURMCNTDVGJM-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- MKUWNMKVSHFQJR-UHFFFAOYSA-H COC(=O)[Sn+2]C1=CC=CC=C1.COC(=O)[Sn+2]C1=CC=CC=C1.COC(=O)[Sn+2]C1=CC=CC=C1.[O-]C(=O)CCCCCCC([O-])=O.[O-]C(=O)CCCCCCC([O-])=O.[O-]C(=O)CCCCCCC([O-])=O Chemical compound COC(=O)[Sn+2]C1=CC=CC=C1.COC(=O)[Sn+2]C1=CC=CC=C1.COC(=O)[Sn+2]C1=CC=CC=C1.[O-]C(=O)CCCCCCC([O-])=O.[O-]C(=O)CCCCCCC([O-])=O.[O-]C(=O)CCCCCCC([O-])=O MKUWNMKVSHFQJR-UHFFFAOYSA-H 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- SDPYGHWPYDANRI-UHFFFAOYSA-N N-ethenylsilyl-1,1-dimethoxymethanamine Chemical compound COC(N[SiH2]C=C)OC SDPYGHWPYDANRI-UHFFFAOYSA-N 0.000 description 1
- VISCLWKQWGKGDE-UHFFFAOYSA-N N-methylacetamide silane Chemical compound [SiH4].CNC(C)=O VISCLWKQWGKGDE-UHFFFAOYSA-N 0.000 description 1
- 241001486234 Sciota Species 0.000 description 1
- 239000004965 Silica aerogel Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- BOTDANWDWHJENH-UHFFFAOYSA-N Tetraethyl orthosilicate Chemical compound CCO[Si](OCC)(OCC)OCC BOTDANWDWHJENH-UHFFFAOYSA-N 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- HBKVUWMWOSEXRG-UHFFFAOYSA-N [(isocyanoiminohydrazinylidene)hydrazinylidene]carbamic acid Chemical group C(=O)(O)N=NN=NN=N[N+]#[C-] HBKVUWMWOSEXRG-UHFFFAOYSA-N 0.000 description 1
- YCZAPQGMCQVUSZ-UHFFFAOYSA-N [SiH4].N1C(CCC1)=O Chemical class [SiH4].N1C(CCC1)=O YCZAPQGMCQVUSZ-UHFFFAOYSA-N 0.000 description 1
- LHFURYICKMKJHJ-UHFFFAOYSA-L [benzoyloxy(dibutyl)stannyl] benzoate Chemical compound CCCC[Sn+2]CCCC.[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 LHFURYICKMKJHJ-UHFFFAOYSA-L 0.000 description 1
- HAAANJSJNWKVMX-UHFFFAOYSA-L [butanoyloxy(dimethyl)stannyl] butanoate Chemical compound CCCC(=O)O[Sn](C)(C)OC(=O)CCC HAAANJSJNWKVMX-UHFFFAOYSA-L 0.000 description 1
- HSULLSUSGAHAOJ-UHFFFAOYSA-N acetic acid;hexan-1-amine Chemical compound CC([O-])=O.CCCCCC[NH3+] HSULLSUSGAHAOJ-UHFFFAOYSA-N 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- FWYSSOIRLVHQNC-UHFFFAOYSA-M benzyl(trimethyl)azanium;acetate Chemical compound CC([O-])=O.C[N+](C)(C)CC1=CC=CC=C1 FWYSSOIRLVHQNC-UHFFFAOYSA-M 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- UBYDHPXTAIURJV-UHFFFAOYSA-N but-2-en-2-yloxy-dimethoxy-methylsilane Chemical compound CO[Si](C)(OC)OC(C)=CC UBYDHPXTAIURJV-UHFFFAOYSA-N 0.000 description 1
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- LUZSPGQEISANPO-UHFFFAOYSA-N butyltin Chemical compound CCCC[Sn] LUZSPGQEISANPO-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- OWIUPIRUAQMTTK-UHFFFAOYSA-N carbazic acid Chemical group NNC(O)=O OWIUPIRUAQMTTK-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- QAEKNCDIHIGLFI-UHFFFAOYSA-L cobalt(2+);2-ethylhexanoate Chemical compound [Co+2].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O QAEKNCDIHIGLFI-UHFFFAOYSA-L 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 150000001354 dialkyl silanes Chemical class 0.000 description 1
- ZXDVQYBUEVYUCG-UHFFFAOYSA-N dibutyltin(2+);methanolate Chemical compound CCCC[Sn](OC)(OC)CCCC ZXDVQYBUEVYUCG-UHFFFAOYSA-N 0.000 description 1
- NFCOROXLVHLOIN-UHFFFAOYSA-N diethoxy-methyl-(3-phenylmethoxypropyl)silane Chemical compound CCO[Si](C)(OCC)CCCOCC1=CC=CC=C1 NFCOROXLVHLOIN-UHFFFAOYSA-N 0.000 description 1
- ASGKDLGXPOIMTM-UHFFFAOYSA-N diethoxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-4-yl)ethyl]silane Chemical compound C1C(CC[Si](C)(OCC)OCC)CCC2OC21 ASGKDLGXPOIMTM-UHFFFAOYSA-N 0.000 description 1
- OTARVPUIYXHRRB-UHFFFAOYSA-N diethoxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane Chemical compound CCO[Si](C)(OCC)CCCOCC1CO1 OTARVPUIYXHRRB-UHFFFAOYSA-N 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- QIXFYORLWOFUQF-UHFFFAOYSA-N diisocyanato(dimethoxy)silane Chemical compound O=C=N[Si](OC)(OC)N=C=O QIXFYORLWOFUQF-UHFFFAOYSA-N 0.000 description 1
- MRGUOKJJTKDIIC-UHFFFAOYSA-N diisothiocyanato-methoxy-methylsilane Chemical compound S=C=N[Si](C)(OC)N=C=S MRGUOKJJTKDIIC-UHFFFAOYSA-N 0.000 description 1
- OQRBGEUZNWMSQN-UHFFFAOYSA-N dimethoxy-methyl-(1-phenylethenoxy)silane Chemical compound CO[Si](C)(OC)OC(=C)C1=CC=CC=C1 OQRBGEUZNWMSQN-UHFFFAOYSA-N 0.000 description 1
- QTKKIFBPHNENBA-UHFFFAOYSA-N dimethoxy-methyl-(3-phenylmethoxypropyl)silane Chemical compound CO[Si](C)(OC)CCCOCC1=CC=CC=C1 QTKKIFBPHNENBA-UHFFFAOYSA-N 0.000 description 1
- SLQTWNAJXFHMHM-UHFFFAOYSA-N dimethoxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-4-yl)ethyl]silane Chemical compound C1C(CC[Si](C)(OC)OC)CCC2OC21 SLQTWNAJXFHMHM-UHFFFAOYSA-N 0.000 description 1
- ACXQZRYFNOHDID-UHFFFAOYSA-N dimethoxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-4-yl)propyl]silane Chemical compound C1C(C(C)C[Si](C)(OC)OC)CCC2OC21 ACXQZRYFNOHDID-UHFFFAOYSA-N 0.000 description 1
- WHGNXNCOTZPEEK-UHFFFAOYSA-N dimethoxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane Chemical compound CO[Si](C)(OC)CCCOCC1CO1 WHGNXNCOTZPEEK-UHFFFAOYSA-N 0.000 description 1
- YTPNLBCMTSWLKJ-UHFFFAOYSA-N dimethoxy-methyl-prop-1-en-2-yloxysilane Chemical compound CO[Si](C)(OC)OC(C)=C YTPNLBCMTSWLKJ-UHFFFAOYSA-N 0.000 description 1
- PWEVMPIIOJUPRI-UHFFFAOYSA-N dimethyltin Chemical compound C[Sn]C PWEVMPIIOJUPRI-UHFFFAOYSA-N 0.000 description 1
- LAWOZCWGWDVVSG-UHFFFAOYSA-N dioctylamine Chemical compound CCCCCCCCNCCCCCCCC LAWOZCWGWDVVSG-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- FWDBOZPQNFPOLF-UHFFFAOYSA-N ethenyl(triethoxy)silane Chemical compound CCO[Si](OCC)(OCC)C=C FWDBOZPQNFPOLF-UHFFFAOYSA-N 0.000 description 1
- MBGQQKKTDDNCSG-UHFFFAOYSA-N ethenyl-diethoxy-methylsilane Chemical compound CCO[Si](C)(C=C)OCC MBGQQKKTDDNCSG-UHFFFAOYSA-N 0.000 description 1
- WOXXJEVNDJOOLV-UHFFFAOYSA-N ethenyl-tris(2-methoxyethoxy)silane Chemical compound COCCO[Si](OCCOC)(OCCOC)C=C WOXXJEVNDJOOLV-UHFFFAOYSA-N 0.000 description 1
- LDLDYFCCDKENPD-UHFFFAOYSA-N ethenylcyclohexane Chemical compound C=CC1CCCCC1 LDLDYFCCDKENPD-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 229940093858 ethyl acetoacetate Drugs 0.000 description 1
- SBRXLTRZCJVAPH-UHFFFAOYSA-N ethyl(trimethoxy)silane Chemical compound CC[Si](OC)(OC)OC SBRXLTRZCJVAPH-UHFFFAOYSA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 150000008282 halocarbons Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 1
- 235000013980 iron oxide Nutrition 0.000 description 1
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000001261 isocyanato group Chemical group *N=C=O 0.000 description 1
- MAMPQFAGGHUOQJ-UHFFFAOYSA-N isocyanato-dimethoxy-methylsilane Chemical compound CO[Si](C)(OC)N=C=O MAMPQFAGGHUOQJ-UHFFFAOYSA-N 0.000 description 1
- BUZRAOJSFRKWPD-UHFFFAOYSA-N isocyanatosilane Chemical class [SiH3]N=C=O BUZRAOJSFRKWPD-UHFFFAOYSA-N 0.000 description 1
- OFYZZNNWQRYKHA-UHFFFAOYSA-N isothiocyanato-dimethoxy-methylsilane Chemical compound CO[Si](C)(OC)N=C=S OFYZZNNWQRYKHA-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- ARYZCSRUUPFYMY-UHFFFAOYSA-N methoxysilane Chemical class CO[SiH3] ARYZCSRUUPFYMY-UHFFFAOYSA-N 0.000 description 1
- ZWXYOPPJTRVTST-UHFFFAOYSA-N methyl-tris(prop-1-en-2-yloxy)silane Chemical compound CC(=C)O[Si](C)(OC(C)=C)OC(C)=C ZWXYOPPJTRVTST-UHFFFAOYSA-N 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- AKOGQRGKYFJORL-UHFFFAOYSA-N n'-[3-[dimethoxy-[(2-methylpropan-2-yl)oxy]silyl]propyl]ethane-1,2-diamine Chemical compound CC(C)(C)O[Si](OC)(OC)CCCNCCN AKOGQRGKYFJORL-UHFFFAOYSA-N 0.000 description 1
- QMIREOCYHAFOPK-UHFFFAOYSA-N n,n'-bis(3-triethoxysilylpropyl)ethane-1,2-diamine Chemical compound CCO[Si](OCC)(OCC)CCCNCCNCCC[Si](OCC)(OCC)OCC QMIREOCYHAFOPK-UHFFFAOYSA-N 0.000 description 1
- QIOYHIUHPGORLS-UHFFFAOYSA-N n,n-dimethyl-3-trimethoxysilylpropan-1-amine Chemical compound CO[Si](OC)(OC)CCCN(C)C QIOYHIUHPGORLS-UHFFFAOYSA-N 0.000 description 1
- SBSPZXNNGHZVCR-UHFFFAOYSA-N n-[[acetyl(methyl)amino]-methoxy-methylsilyl]-n-methylacetamide Chemical compound CC(=O)N(C)[Si](C)(OC)N(C)C(C)=O SBSPZXNNGHZVCR-UHFFFAOYSA-N 0.000 description 1
- HXTZZFBBMWUFFG-UHFFFAOYSA-N n-[bis[acetyl(methyl)amino]-methylsilyl]-n-methylacetamide Chemical compound CC(=O)N(C)[Si](C)(N(C)C(C)=O)N(C)C(C)=O HXTZZFBBMWUFFG-UHFFFAOYSA-N 0.000 description 1
- ZWRBXRIQPXAXNU-UHFFFAOYSA-N n-[dimethoxy(methyl)silyl]propan-2-amine Chemical compound CO[Si](C)(OC)NC(C)C ZWRBXRIQPXAXNU-UHFFFAOYSA-N 0.000 description 1
- ABMDIECEEGFXNC-UHFFFAOYSA-N n-ethylpropanamide Chemical compound CCNC(=O)CC ABMDIECEEGFXNC-UHFFFAOYSA-N 0.000 description 1
- PXSXRABJBXYMFT-UHFFFAOYSA-N n-hexylhexan-1-amine Chemical compound CCCCCCNCCCCCC PXSXRABJBXYMFT-UHFFFAOYSA-N 0.000 description 1
- WZXSAXDNMYMUBG-UHFFFAOYSA-N n-methyl-n-trimethoxysilylacetamide Chemical compound CO[Si](OC)(OC)N(C)C(C)=O WZXSAXDNMYMUBG-UHFFFAOYSA-N 0.000 description 1
- NCCHARWOCKOHIH-UHFFFAOYSA-N n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1 NCCHARWOCKOHIH-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- FZHAPNGMFPVSLP-UHFFFAOYSA-N silanamine Chemical class [SiH3]N FZHAPNGMFPVSLP-UHFFFAOYSA-N 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 125000004469 siloxy group Chemical group [SiH3]O* 0.000 description 1
- WSFQLUVWDKCYSW-UHFFFAOYSA-M sodium;2-hydroxy-3-morpholin-4-ylpropane-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)CC(O)CN1CCOCC1 WSFQLUVWDKCYSW-UHFFFAOYSA-M 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- XNDVYJMKIJRDPF-UHFFFAOYSA-N tetrakis(prop-1-en-2-yl) silicate Chemical compound CC(=C)O[Si](OC(C)=C)(OC(C)=C)OC(C)=C XNDVYJMKIJRDPF-UHFFFAOYSA-N 0.000 description 1
- KSBAEPSJVUENNK-UHFFFAOYSA-L tin(ii) 2-ethylhexanoate Chemical compound [Sn+2].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O KSBAEPSJVUENNK-UHFFFAOYSA-L 0.000 description 1
- 150000003608 titanium Chemical class 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- LSZKGNJKKQYFLR-UHFFFAOYSA-J tri(butanoyloxy)stannyl butanoate Chemical compound [Sn+4].CCCC([O-])=O.CCCC([O-])=O.CCCC([O-])=O.CCCC([O-])=O LSZKGNJKKQYFLR-UHFFFAOYSA-J 0.000 description 1
- 239000005052 trichlorosilane Substances 0.000 description 1
- PBCOGINAGIMDDC-UHFFFAOYSA-N triethoxy(3-phenylmethoxypropyl)silane Chemical compound CCO[Si](OCC)(OCC)CCCOCC1=CC=CC=C1 PBCOGINAGIMDDC-UHFFFAOYSA-N 0.000 description 1
- CPUDPFPXCZDNGI-UHFFFAOYSA-N triethoxy(methyl)silane Chemical compound CCO[Si](C)(OCC)OCC CPUDPFPXCZDNGI-UHFFFAOYSA-N 0.000 description 1
- UMFJXASDGBJDEB-UHFFFAOYSA-N triethoxy(prop-2-enyl)silane Chemical compound CCO[Si](CC=C)(OCC)OCC UMFJXASDGBJDEB-UHFFFAOYSA-N 0.000 description 1
- UDUKMRHNZZLJRB-UHFFFAOYSA-N triethoxy-[2-(7-oxabicyclo[4.1.0]heptan-4-yl)ethyl]silane Chemical compound C1C(CC[Si](OCC)(OCC)OCC)CCC2OC21 UDUKMRHNZZLJRB-UHFFFAOYSA-N 0.000 description 1
- JXUKBNICSRJFAP-UHFFFAOYSA-N triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane Chemical compound CCO[Si](OCC)(OCC)CCCOCC1CO1 JXUKBNICSRJFAP-UHFFFAOYSA-N 0.000 description 1
- QJJNJSHHGURSNG-UHFFFAOYSA-N trimethoxy(3-phenylmethoxypropyl)silane Chemical compound CO[Si](OC)(OC)CCCOCC1=CC=CC=C1 QJJNJSHHGURSNG-UHFFFAOYSA-N 0.000 description 1
- LFRDHGNFBLIJIY-UHFFFAOYSA-N trimethoxy(prop-2-enyl)silane Chemical compound CO[Si](OC)(OC)CC=C LFRDHGNFBLIJIY-UHFFFAOYSA-N 0.000 description 1
- LQZHZFUSFHLGHE-UHFFFAOYSA-N trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-4-yl)propyl]silane Chemical compound C1C(C(C)C[Si](OC)(OC)OC)CCC2OC21 LQZHZFUSFHLGHE-UHFFFAOYSA-N 0.000 description 1
- SDDVFEDYRCTTKO-UHFFFAOYSA-N trimethyl prop-1-en-2-yl silicate Chemical compound CO[Si](OC)(OC)OC(C)=C SDDVFEDYRCTTKO-UHFFFAOYSA-N 0.000 description 1
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical compound [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 1
- IFNXAMCERSVZCV-UHFFFAOYSA-L zinc;2-ethylhexanoate Chemical compound [Zn+2].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O IFNXAMCERSVZCV-UHFFFAOYSA-L 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8487683A JPS59213760A (ja) | 1983-05-13 | 1983-05-13 | 一液型ｒｔｖシリコ−ン組成物用粘着促進剤 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8487683A JPS59213760A (ja) | 1983-05-13 | 1983-05-13 | 一液型ｒｔｖシリコ−ン組成物用粘着促進剤 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS59213760A JPS59213760A (ja) | 1984-12-03 |
| JPH0521939B2 true JPH0521939B2 (fr) | 1993-03-26 |
Family
ID=13842988
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP8487683A Granted JPS59213760A (ja) | 1983-05-13 | 1983-05-13 | 一液型ｒｔｖシリコ−ン組成物用粘着促進剤 |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS59213760A (fr) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS61247756A (ja) * | 1985-04-26 | 1986-11-05 | Toray Silicone Co Ltd | 室温硬化性オルガノポリシロキサン組成物 |
| CA1266149A (fr) * | 1985-06-18 | 1990-02-20 | Gary Morgan Lucas | Compositions au silicone vulcanisables a la temperature ambiante d'interieur, caracterisees par leur pouvoir d'adherence accru |
| CA2056569A1 (fr) * | 1990-12-17 | 1992-06-18 | Gary M. Lucas | Compositions de silicone reticulables a la temperature de la piece |
| JPH04359058A (ja) * | 1991-06-03 | 1992-12-11 | Shin Etsu Chem Co Ltd | 室温硬化性オルガノポリシロキサン組成物の製造方法 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3888815A (en) * | 1973-08-20 | 1975-06-10 | Gen Electric | Self-bonding two-package room temperature vulcanizable silicone rubber compositions |
| JPS51140950A (en) * | 1975-05-19 | 1976-12-04 | Gen Electric | Curing compound |
| US4273698A (en) * | 1979-02-28 | 1981-06-16 | General Electric Company | Self-bonding room temperature vulcanizable silicone rubber compositions |
| JPS5699253A (en) * | 1980-01-04 | 1981-08-10 | Gen Electric | Selffbindable addition curable silicone composition |
-
1983
- 1983-05-13 JP JP8487683A patent/JPS59213760A/ja active Granted
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3888815A (en) * | 1973-08-20 | 1975-06-10 | Gen Electric | Self-bonding two-package room temperature vulcanizable silicone rubber compositions |
| JPS51140950A (en) * | 1975-05-19 | 1976-12-04 | Gen Electric | Curing compound |
| US4273698A (en) * | 1979-02-28 | 1981-06-16 | General Electric Company | Self-bonding room temperature vulcanizable silicone rubber compositions |
| JPS5699253A (en) * | 1980-01-04 | 1981-08-10 | Gen Electric | Selffbindable addition curable silicone composition |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS59213760A (ja) | 1984-12-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4528353A (en) | Adhesion promoters for one-component RTV silicone compositions | |
| US4483973A (en) | Adhesion promoters for one-component RTV silicone compositions | |
| KR100194303B1 (ko) | 개선된 실온 경화성 실리콘 조성물 | |
| US4525400A (en) | Composition for promoting adhesion of curable silicones to substrates | |
| US4461867A (en) | Composition for promoting adhesion of curable silicones to substrates | |
| KR101226373B1 (ko) | 실온 경화성 오르가노폴리실록산 조성물 | |
| US4513115A (en) | Low modulus one component RTV compositions processes | |
| EP0104179A1 (fr) | Coprecipitateurs pour des compositions rtv alkoxy-fonctionnelles a un composant et procedes. | |
| US4506058A (en) | Self-bonding room temperature vulcanizable silicone compositions | |
| EP0178751B1 (fr) | Elastomères de silicones avec un bon pouvoir adhésif | |
| JPS58501040A (ja) | 一液性の安定な、湿分硬化性ポリアルコキシ末端オルガノポリシロキサン組成物及びその製造法 | |
| JPH0479384B2 (fr) | ||
| US4489191A (en) | Silane scavengers for hydroxy radicals containing silicon-hydrogen bonds | |
| JPS6352059B2 (fr) | ||
| JPH0378431B2 (fr) | ||
| US5300611A (en) | Room temperature curable organopolysiloxane compositions | |
| JPH0513990B2 (fr) | ||
| JP2914838B2 (ja) | 室温硬化性シリコーン組成物 | |
| US4539367A (en) | Low modulus one-component RTV compositions and processes | |
| JPH02151659A (ja) | 室温硬化性シリコーンゴム組成物 | |
| JPH0521939B2 (fr) | ||
| JPH0521940B2 (fr) | ||
| JPH038657B2 (fr) | ||
| JPH0455225B2 (fr) | ||
| JPH04300964A (ja) | 改善された低モジュラス性をもつ室温硬化性シリコーン組成物 |