JPH0115499B2 - - Google Patents
Info
- Publication number
- JPH0115499B2 JPH0115499B2 JP55055570A JP5557080A JPH0115499B2 JP H0115499 B2 JPH0115499 B2 JP H0115499B2 JP 55055570 A JP55055570 A JP 55055570A JP 5557080 A JP5557080 A JP 5557080A JP H0115499 B2 JPH0115499 B2 JP H0115499B2
- Authority
- JP
- Japan
- Prior art keywords
- diamine
- reaction
- parts
- urea
- alcohol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims abstract description 48
- 239000004202 carbamide Substances 0.000 claims abstract description 43
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims abstract description 42
- 238000000034 method Methods 0.000 claims abstract description 28
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 25
- 229910021529 ammonia Inorganic materials 0.000 claims abstract description 24
- 229920002635 polyurethane Polymers 0.000 claims abstract description 19
- 239000004814 polyurethane Substances 0.000 claims abstract description 19
- 229920000768 polyamine Polymers 0.000 claims abstract description 16
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 claims description 52
- 238000006243 chemical reaction Methods 0.000 claims description 46
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 41
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 claims description 38
- -1 heterocyclic diamines Chemical class 0.000 claims description 33
- 239000011541 reaction mixture Substances 0.000 claims description 31
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 18
- 238000004519 manufacturing process Methods 0.000 claims description 17
- 239000000203 mixture Substances 0.000 claims description 16
- 150000004985 diamines Chemical class 0.000 claims description 15
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 13
- 150000001298 alcohols Chemical class 0.000 claims description 13
- YIWUKEYIRIRTPP-UHFFFAOYSA-N 2-ethylhexan-1-ol Chemical compound CCCCC(CC)CO YIWUKEYIRIRTPP-UHFFFAOYSA-N 0.000 claims description 12
- 150000001412 amines Chemical class 0.000 claims description 12
- 125000000623 heterocyclic group Chemical group 0.000 claims description 10
- BBMCTIGTTCKYKF-UHFFFAOYSA-N 1-heptanol Chemical compound CCCCCCCO BBMCTIGTTCKYKF-UHFFFAOYSA-N 0.000 claims description 6
- QPRQEDXDYOZYLA-UHFFFAOYSA-N 2-methylbutan-1-ol Chemical compound CCC(C)CO QPRQEDXDYOZYLA-UHFFFAOYSA-N 0.000 claims description 6
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 claims description 6
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 claims description 6
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 claims description 6
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 claims description 5
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 claims description 4
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 claims description 4
- PFNHSEQQEPMLNI-UHFFFAOYSA-N 2-methyl-1-pentanol Chemical compound CCCC(C)CO PFNHSEQQEPMLNI-UHFFFAOYSA-N 0.000 claims description 3
- IWTBVKIGCDZRPL-LURJTMIESA-N 3-Methylbutanol Natural products CC[C@H](C)CCO IWTBVKIGCDZRPL-LURJTMIESA-N 0.000 claims description 3
- 125000002723 alicyclic group Chemical group 0.000 claims description 3
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 claims description 3
- RTWNYYOXLSILQN-UHFFFAOYSA-N methanediamine Chemical compound NCN RTWNYYOXLSILQN-UHFFFAOYSA-N 0.000 claims description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 claims description 3
- TZYRSLHNPKPEFV-UHFFFAOYSA-N 2-ethyl-1-butanol Chemical compound CCC(CC)CO TZYRSLHNPKPEFV-UHFFFAOYSA-N 0.000 claims description 2
- BDBZTOMUANOKRT-UHFFFAOYSA-N 4-[2-(4-aminocyclohexyl)propan-2-yl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1C(C)(C)C1CCC(N)CC1 BDBZTOMUANOKRT-UHFFFAOYSA-N 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- FVCWZBVQRLEGDH-UHFFFAOYSA-N 1,2,2-trimethylcyclohexan-1-amine Chemical compound CC1(C)CCCCC1(C)N FVCWZBVQRLEGDH-UHFFFAOYSA-N 0.000 claims 1
- BDYVWDMHYNGVGE-UHFFFAOYSA-N [2-(aminomethyl)cyclohexyl]methanamine Chemical compound NCC1CCCCC1CN BDYVWDMHYNGVGE-UHFFFAOYSA-N 0.000 claims 1
- 239000000047 product Substances 0.000 abstract description 11
- 239000006227 byproduct Substances 0.000 abstract description 4
- 238000002360 preparation method Methods 0.000 abstract description 3
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical group C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 abstract 1
- 235000013877 carbamide Nutrition 0.000 description 42
- 238000010992 reflux Methods 0.000 description 24
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- 239000003054 catalyst Substances 0.000 description 15
- 238000002844 melting Methods 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- TVMXDCGIABBOFY-UHFFFAOYSA-N n-Octanol Natural products CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 13
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 11
- 238000001816 cooling Methods 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 238000004821 distillation Methods 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- 230000035484 reaction time Effects 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000001914 filtration Methods 0.000 description 5
- 239000012948 isocyanate Substances 0.000 description 5
- 150000002513 isocyanates Chemical class 0.000 description 5
- 150000003672 ureas Chemical class 0.000 description 5
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 5
- MQWCXKGKQLNYQG-UHFFFAOYSA-N 4-methylcyclohexan-1-ol Chemical compound CC1CCC(O)CC1 MQWCXKGKQLNYQG-UHFFFAOYSA-N 0.000 description 4
- 229910015900 BF3 Inorganic materials 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 229920002396 Polyurea Polymers 0.000 description 3
- 229910052796 boron Inorganic materials 0.000 description 3
- AOGYCOYQMAVAFD-UHFFFAOYSA-M carbonochloridate Chemical compound [O-]C(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-M 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- YVLHRYOHNHUVOA-UHFFFAOYSA-N 2,2-dimethylpropane-1,1-diamine Chemical compound CC(C)(C)C(N)N YVLHRYOHNHUVOA-UHFFFAOYSA-N 0.000 description 2
- RNLHGQLZWXBQNY-UHFFFAOYSA-N 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine Chemical compound CC1(C)CC(N)CC(C)(CN)C1 RNLHGQLZWXBQNY-UHFFFAOYSA-N 0.000 description 2
- OCUAIBMOJSJVLU-UHFFFAOYSA-N 3-[4-(3-amino-2,2-dimethylpropyl)piperazin-1-yl]-2,2-dimethylpropan-1-amine Chemical compound NCC(C)(C)CN1CCN(CC(C)(C)CN)CC1 OCUAIBMOJSJVLU-UHFFFAOYSA-N 0.000 description 2
- HTSABYAWKQAHBT-UHFFFAOYSA-N 3-methylcyclohexanol Chemical compound CC1CCCC(O)C1 HTSABYAWKQAHBT-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052787 antimony Inorganic materials 0.000 description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 2
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 239000011733 molybdenum Substances 0.000 description 2
- KPSSIOMAKSHJJG-UHFFFAOYSA-N neopentyl alcohol Chemical compound CC(C)(C)CO KPSSIOMAKSHJJG-UHFFFAOYSA-N 0.000 description 2
- ZWRUINPWMLAQRD-UHFFFAOYSA-N nonan-1-ol Chemical compound CCCCCCCCCO ZWRUINPWMLAQRD-UHFFFAOYSA-N 0.000 description 2
- 229920001228 polyisocyanate Polymers 0.000 description 2
- 239000005056 polyisocyanate Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- 229910052720 vanadium Inorganic materials 0.000 description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- XMKLTEGSALONPH-UHFFFAOYSA-N 1,2,4,5-tetrazinane-3,6-dione Chemical compound O=C1NNC(=O)NN1 XMKLTEGSALONPH-UHFFFAOYSA-N 0.000 description 1
- PWGJDPKCLMLPJW-UHFFFAOYSA-N 1,8-diaminooctane Chemical compound NCCCCCCCCN PWGJDPKCLMLPJW-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- IHBLBMDDUQOYLA-UHFFFAOYSA-N 1-octadecyl-3-[4-[[4-(octadecylcarbamoylamino)phenyl]methyl]phenyl]urea Chemical compound C1=CC(NC(=O)NCCCCCCCCCCCCCCCCCC)=CC=C1CC1=CC=C(NC(=O)NCCCCCCCCCCCCCCCCCC)C=C1 IHBLBMDDUQOYLA-UHFFFAOYSA-N 0.000 description 1
- DDHUNHGZUHZNKB-UHFFFAOYSA-N 2,2-dimethylpropane-1,3-diamine Chemical compound NCC(C)(C)CN DDHUNHGZUHZNKB-UHFFFAOYSA-N 0.000 description 1
- RNDNSYIPLPAXAZ-UHFFFAOYSA-N 2-Phenyl-1-propanol Chemical compound OCC(C)C1=CC=CC=C1 RNDNSYIPLPAXAZ-UHFFFAOYSA-N 0.000 description 1
- VAUPDSFQEVCBIE-UHFFFAOYSA-N 2-butoxyethyl n-[6-(2-butoxyethoxycarbonylamino)hexyl]carbamate Chemical compound CCCCOCCOC(=O)NCCCCCCNC(=O)OCCOCCCC VAUPDSFQEVCBIE-UHFFFAOYSA-N 0.000 description 1
- KRPRVQWGKLEFKN-UHFFFAOYSA-N 3-(3-aminopropoxy)propan-1-amine Chemical compound NCCCOCCCN KRPRVQWGKLEFKN-UHFFFAOYSA-N 0.000 description 1
- DLYLVPHSKJVGLG-UHFFFAOYSA-N 4-(cyclohexylmethyl)cyclohexane-1,1-diamine Chemical compound C1CC(N)(N)CCC1CC1CCCCC1 DLYLVPHSKJVGLG-UHFFFAOYSA-N 0.000 description 1
- XNFYEILJPMDXQD-UHFFFAOYSA-N 5,5-dimethyl-1,3-diazinane Chemical compound CC1(C)CNCNC1 XNFYEILJPMDXQD-UHFFFAOYSA-N 0.000 description 1
- ZMGMDXCADSRNCX-UHFFFAOYSA-N 5,6-dihydroxy-1,3-diazepan-2-one Chemical compound OC1CNC(=O)NCC1O ZMGMDXCADSRNCX-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 1
- NGUSOHMOAPFAPE-UHFFFAOYSA-N butyl n-[1-(butoxycarbonylamino)hexyl]carbamate Chemical compound CCCCOC(=O)NC(CCCCC)NC(=O)OCCCC NGUSOHMOAPFAPE-UHFFFAOYSA-N 0.000 description 1
- ILPOVPZIWGHRLX-UHFFFAOYSA-N butyl n-[6-(butoxycarbonylamino)hexyl]carbamate Chemical compound CCCCOC(=O)NCCCCCCNC(=O)OCCCC ILPOVPZIWGHRLX-UHFFFAOYSA-N 0.000 description 1
- VHRGRCVQAFMJIZ-UHFFFAOYSA-N cadaverine Chemical compound NCCCCCN VHRGRCVQAFMJIZ-UHFFFAOYSA-N 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- SSJXIUAHEKJCMH-UHFFFAOYSA-N cyclohexane-1,2-diamine Chemical compound NC1CCCCC1N SSJXIUAHEKJCMH-UHFFFAOYSA-N 0.000 description 1
- GEQHKFFSPGPGLN-UHFFFAOYSA-N cyclohexane-1,3-diamine Chemical compound NC1CCCC(N)C1 GEQHKFFSPGPGLN-UHFFFAOYSA-N 0.000 description 1
- BQHPPENJOCUCJR-UHFFFAOYSA-N cyclohexyl n-[6-(cyclohexyloxycarbonylamino)hexyl]carbamate Chemical compound C1CCCCC1OC(=O)NCCCCCCNC(=O)OC1CCCCC1 BQHPPENJOCUCJR-UHFFFAOYSA-N 0.000 description 1
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- YQLZOAVZWJBZSY-UHFFFAOYSA-N decane-1,10-diamine Chemical compound NCCCCCCCCCCN YQLZOAVZWJBZSY-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000001470 diamides Chemical class 0.000 description 1
- KEIQPMUPONZJJH-UHFFFAOYSA-N dicyclohexylmethanediamine Chemical compound C1CCCCC1C(N)(N)C1CCCCC1 KEIQPMUPONZJJH-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- QFTYSVGGYOXFRQ-UHFFFAOYSA-N dodecane-1,12-diamine Chemical compound NCCCCCCCCCCCCN QFTYSVGGYOXFRQ-UHFFFAOYSA-N 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000003912 environmental pollution Methods 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- FWKGEANWQNXYRM-UHFFFAOYSA-N ethyl n-[6-(ethoxycarbonylamino)hexyl]carbamate Chemical compound CCOC(=O)NCCCCCCNC(=O)OCC FWKGEANWQNXYRM-UHFFFAOYSA-N 0.000 description 1
- CTEPBUFYCZLELZ-UHFFFAOYSA-N ethyl n-hexylcarbamate Chemical compound CCCCCCNC(=O)OCC CTEPBUFYCZLELZ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- KYHZADRYEIFQKT-UHFFFAOYSA-N hexadecyl n-[6-(hexadecoxycarbonylamino)hexyl]carbamate Chemical compound CCCCCCCCCCCCCCCCOC(=O)NCCCCCCNC(=O)OCCCCCCCCCCCCCCCC KYHZADRYEIFQKT-UHFFFAOYSA-N 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical group C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- IAGUPODHENSJEZ-UHFFFAOYSA-N methyl n-phenylcarbamate Chemical compound COC(=O)NC1=CC=CC=C1 IAGUPODHENSJEZ-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- YPNZTHVEMNUDND-UHFFFAOYSA-N octyl carbamate Chemical compound CCCCCCCCOC(N)=O YPNZTHVEMNUDND-UHFFFAOYSA-N 0.000 description 1
- IXUNJXLMGFKCHW-UHFFFAOYSA-N octyl n-[2,2-dimethyl-1-(octoxycarbonylamino)propyl]carbamate Chemical compound CCCCCCCCOC(=O)NC(C(C)(C)C)NC(=O)OCCCCCCCC IXUNJXLMGFKCHW-UHFFFAOYSA-N 0.000 description 1
- RURCHJQJCVWZIA-UHFFFAOYSA-N octyl n-hexylcarbamate Chemical compound CCCCCCCCOC(=O)NCCCCCC RURCHJQJCVWZIA-UHFFFAOYSA-N 0.000 description 1
- 150000005677 organic carbonates Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 238000011403 purification operation Methods 0.000 description 1
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- KRZQYDMOEZDDGE-UHFFFAOYSA-N sodium;octan-1-olate Chemical compound [Na+].CCCCCCCC[O-] KRZQYDMOEZDDGE-UHFFFAOYSA-N 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- ATVLVRVBCRICNU-UHFFFAOYSA-N trifluorosilicon Chemical compound F[Si](F)F ATVLVRVBCRICNU-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/06—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D239/08—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms directly attached in position 2
- C07D239/10—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/70—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the isocyanates or isothiocyanates used
- C08G18/701—Compounds forming isocyanates or isothiocyanates in situ
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Polyurethanes Or Polyureas (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792917493 DE2917493A1 (de) | 1979-04-30 | 1979-04-30 | Verfahren zur herstellung von aliphatischen und cycloaliphatischen di- und polyurethanen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS55145657A JPS55145657A (en) | 1980-11-13 |
| JPH0115499B2 true JPH0115499B2 (OSRAM) | 1989-03-17 |
Family
ID=6069633
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP5557080A Granted JPS55145657A (en) | 1979-04-30 | 1980-04-28 | Manufacture of aliphatic and alicyclic diurethane and polyurethane |
| JP63095805A Granted JPS6438055A (en) | 1979-04-30 | 1988-04-20 | Manufacture of fatty, alicyclic and heterocyclicdi- and/or polyurethane |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP63095805A Granted JPS6438055A (en) | 1979-04-30 | 1988-04-20 | Manufacture of fatty, alicyclic and heterocyclicdi- and/or polyurethane |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4713476A (OSRAM) |
| EP (1) | EP0018586B2 (OSRAM) |
| JP (2) | JPS55145657A (OSRAM) |
| AT (1) | ATE1945T1 (OSRAM) |
| BR (1) | BR8002598A (OSRAM) |
| CA (1) | CA1117968A (OSRAM) |
| DE (2) | DE2917493A1 (OSRAM) |
| ZA (1) | ZA802579B (OSRAM) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2943481A1 (de) * | 1979-10-27 | 1981-05-07 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von urethanen und ihre verwendung zur herstellung von isocyanaten |
| US4375539A (en) * | 1981-07-22 | 1983-03-01 | Eastman Kodak Company | Solid blocked crosslinking agents based on 1,4-cyclohexane bis(methylisocyanate) |
| DE3314788A1 (de) * | 1983-04-23 | 1984-10-25 | Basf Ag, 6700 Ludwigshafen | Mehrstufenverfahren zur herstellung von hexamethylendiisocyanat-1,6 und/oder isomeren aliphatischen diisocyanaten mit 6 kohlenstoffatomen im alkylenrest |
| DE3632010A1 (de) * | 1986-09-20 | 1988-04-07 | Basf Ag | Neue 2-(alkoxymethyl)-pentan-1,5-diisocyanate, -diurethane und -dicarbamidsaeurechloride, verfahren zu ihrer herstellung und deren verwendung |
| US4925971A (en) * | 1987-12-08 | 1990-05-15 | Asahi Kasei Kogyo Kabushiki Kaisha | Method for producing aliphatic o-arylurethanes |
| DE4002555C1 (OSRAM) * | 1990-01-30 | 1991-05-29 | Adolf Hottinger Maschinenbau Gmbh, 6800 Mannheim, De | |
| US5179223A (en) * | 1990-12-13 | 1993-01-12 | Union Carbide Chemicals & Plastics Technology Corporation | Process for producing carbamates from oximes |
| DE4231417A1 (de) * | 1992-05-05 | 1993-11-11 | Huels Chemische Werke Ag | Kontinuierliches mehrstufiges Verfahren zur Herstellung von (cyclo)aliphatischen Diisocyanaten |
| DE4342426A1 (de) * | 1993-12-13 | 1995-06-14 | Bayer Ag | Verfahren zur Herstellung von Diurethanen und ihre Verwendung zur Herstellung von Diisocyanaten |
| DE19523386A1 (de) * | 1995-06-23 | 1997-01-09 | Bayer Ag | Verfahren zur Entfernung von Nebenprodukten aus Diurethanen |
| DE19541384A1 (de) * | 1995-11-07 | 1997-05-15 | Basf Ag | Verfahren zur Herstellung von organischen Diurethanen und/oder Polyurethanen und ihre Verwendung zur Herstellung von Di- und/oder Polyisocyanaten |
| DE19813107A1 (de) | 1998-03-25 | 1999-09-30 | Basf Ag | Verfahren zur Herstellung von Polyurethanschaumstoffen |
| WO2001047870A2 (en) * | 1999-12-27 | 2001-07-05 | Huntsman International Llc | Process for the production of aromatic polycarbamates |
| US6781010B1 (en) | 2000-09-19 | 2004-08-24 | Lyondell Chemical Company | Non-phosgene route to the manufacture of organic isocyanates |
| DE10260092A1 (de) | 2002-12-19 | 2004-07-01 | Basf Ag | Verfahren zur Reinigung von Isocyanaten |
| DE10338511A1 (de) * | 2003-08-22 | 2005-03-17 | Degussa Ag | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von cycloaliphatischen Diisocyanaten |
| DE10338508A1 (de) * | 2003-08-22 | 2005-03-17 | Degussa Ag | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von cycloaliphatischen Diisocyanaten |
| DE10338509A1 (de) | 2003-08-22 | 2005-03-17 | Degussa Ag | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von cycloaliphatischen Diisocyanaten |
| DE102004022626A1 (de) | 2004-05-07 | 2005-12-15 | Degussa Ag | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von cycloaliphatischen Diisocyanaten |
| DE102004026451A1 (de) * | 2004-05-29 | 2005-12-15 | Degussa Ag | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von cycloaliphatischen Diisocyanaten |
| DE102004036499A1 (de) * | 2004-07-28 | 2006-03-23 | Degussa Ag | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von cycloaliphatischen Diisocyanaten |
| DE102008002002A1 (de) | 2008-05-27 | 2009-12-03 | Evonik Degussa Gmbh | Chlor armes mehrstufiges Verfahren zur Herstellung von cycloaliphatischen Diisocyanaten |
| EP2439191B1 (en) | 2009-08-21 | 2017-01-25 | Asahi Kasei Kabushiki Kaisha | Method for producing n-substituted carbamic acid ester, method for producing isocyanate using n-substituted carbamic acid ester, and composition for transferring and storing n-substituted carbamic acid ester containing n-substituted carbamic acid ester and aromatic hydroxy compound |
| KR20120114234A (ko) | 2009-11-27 | 2012-10-16 | 바스프 에스이 | 낮은 용해도의 활성 물질을 가용화시키기 위한 수지상 폴리우레아 |
| DE102009054749A1 (de) | 2009-12-16 | 2011-06-22 | Evonik Degussa GmbH, 45128 | Zusammensetzung aus (cyclo)aliphatischen Diisocyanaten und aromatischen Säurehalogeniden |
| TWI504584B (zh) * | 2011-02-21 | 2015-10-21 | Asahi Kasei Chemicals Corp | 羰基化合物之製造方法 |
| WO2013020820A1 (en) | 2011-08-05 | 2013-02-14 | Basf Se | Associative thickeners based on hyperbranched polymers |
| DE102012219324A1 (de) | 2012-10-23 | 2014-04-24 | Evonik Industries Ag | Zusammensetzungen umfassend alkoxysilanhaltige Isocyanateund saure Stabilisatoren |
| US9006478B2 (en) * | 2013-01-28 | 2015-04-14 | Xerox Corporation | Diurethane gelators for curable ink applications |
| EP2979851A1 (de) * | 2014-07-28 | 2016-02-03 | Evonik Degussa GmbH | Effiziente Herstellung von Composite-Halbzeugen und -Bauteilen im Nasspressverfahren unter Einsatz von hydroxyfunktionalisierten (Meth) Acrylaten, die mittels Isocyanaten oder Uretdionen duroplastisch vernetzt werden |
| EP3795561B1 (en) | 2018-05-15 | 2024-11-06 | Asahi Kasei Kabushiki Kaisha | Method for producing carbamate and method for producing isocyanate |
| EP4431490A4 (en) | 2021-11-08 | 2025-03-05 | Asahi Kasei Kabushiki Kaisha | PROCESS FOR PRODUCING ISOCYANATE COMPOUNDS, PROCESS FOR PRODUCING CARBAMATE COMPOUNDS, PROCESS FOR RECOVERING AMINE COMPOUNDS AND ISOCYANATE COMPOSITION |
Family Cites Families (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2181663A (en) * | 1938-05-10 | 1939-11-28 | Du Pont | Diurethane-diamine polymeric materials |
| GB528437A (en) * | 1938-05-10 | 1940-10-29 | Du Pont | Polycarbamides |
| GB530267A (en) * | 1938-06-24 | 1940-12-09 | Du Pont | Improvements in or relating to the production of condensation polymers |
| DE896412C (de) * | 1938-09-21 | 1953-11-12 | Basf Ag | Verfahren zur Herstellung hochmolekularer Kondensationsprodukte |
| US2568885A (en) * | 1939-01-23 | 1951-09-25 | Celanese Corp | Manufacture of high polymeric compounds from n, n'-dicarbophenoxy-2, 4-diamino toluene and hexamethylene glycol |
| US2623867A (en) * | 1939-01-23 | 1952-12-30 | Celanese Corp | Manufacture of polyurea-urethanes |
| US2343808A (en) * | 1939-05-17 | 1944-03-07 | Schlack Paul | Nitrogenous condensation products |
| US2409712A (en) * | 1944-02-03 | 1946-10-22 | Du Pont | Chemical process and products |
| US2653144A (en) * | 1950-08-03 | 1953-09-22 | American Viscose Corp | Stabilized polyheptamethyleneurea and process for making the same |
| US2828291A (en) * | 1953-06-29 | 1958-03-25 | Monsanto Chemicals | Resinous condensation products of a glycol, a diamine, and a urea or derivative thereof |
| US2817684A (en) * | 1954-06-03 | 1957-12-24 | Rohm & Haas | N, n'-disubstituted monoureas |
| US2806051A (en) * | 1955-11-01 | 1957-09-10 | Goodrich Co B F | Method for preparing urethanes by reacting urea, amines and an alcohol |
| US2973342A (en) * | 1957-10-09 | 1961-02-28 | Toyo Koatsu Ind Inc | Process for preparing linear polyureas |
| US3223682A (en) * | 1958-04-01 | 1965-12-14 | Grace W R & Co | Preparation of linear polyurea polymers from urea and an alicyclic diamine |
| US3054777A (en) * | 1958-05-16 | 1962-09-18 | Toyo Koatsu Ind Inc | Linear polyureas |
| US3054819A (en) * | 1958-08-29 | 1962-09-18 | Union Carbide Corp | Preparation of organic isocyanates |
| US3119793A (en) * | 1958-10-22 | 1964-01-28 | Toyo Koatsu Ind Inc | Linear polyureas prepared from the reaction of urea and two different alkylene diamines |
| US3185656A (en) * | 1960-03-29 | 1965-05-25 | Grace W R & Co | Preparation of linear polyureas utilizing a cyclic amide solvent |
| US3046254A (en) * | 1960-06-02 | 1962-07-24 | Toyo Koatsu Ind Inc | Method for the preparation of polyureas |
| NL285972A (OSRAM) * | 1961-11-28 | 1900-01-01 | ||
| BE651876A (OSRAM) * | 1963-09-13 | 1965-02-15 | ||
| US3366662A (en) * | 1964-03-02 | 1968-01-30 | Olin Mathieson | Process for preparing isocyanates |
| US3461149A (en) * | 1964-12-28 | 1969-08-12 | American Cyanamid Co | Isocyanate process |
| US3412072A (en) * | 1964-12-30 | 1968-11-19 | Exxon Research Engineering Co | Polyureas |
| US3388103A (en) * | 1965-07-28 | 1968-06-11 | Schering Ag | Thermoplastic polyureas prepared from araliphatic diamines |
| US3390137A (en) * | 1965-10-18 | 1968-06-25 | Exxon Research Engineering Co | Flexible polyureas |
| US3481967A (en) * | 1966-04-01 | 1969-12-02 | Olin Mathieson | Process for preparing aromatic isocyanates |
| US3467688A (en) * | 1966-07-05 | 1969-09-16 | American Cyanamid Co | Conversion of azo or azoxy compounds to isocyanates |
| US3523962A (en) * | 1967-04-06 | 1970-08-11 | Olin Corp | Process for preparing organic isocyanates |
| US3734941A (en) * | 1968-09-06 | 1973-05-22 | American Cyanamid Co | Process for converting urethanes to isocyanates |
| US3763217A (en) * | 1970-12-03 | 1973-10-02 | Halcon International Inc | Preparation of carbamates |
| US3895054A (en) * | 1972-08-30 | 1975-07-15 | Atlantic Richfield Co | Process for the manufacture of urethanes |
| JPS5219624A (en) * | 1975-08-07 | 1977-02-15 | Mitsui Toatsu Chem Inc | Process for preparation of isocyanates |
| US3992430A (en) * | 1975-09-11 | 1976-11-16 | Chevron Research Company | Process for preparing aromatic isocyanates |
| GB1554362A (en) * | 1977-02-03 | 1979-10-17 | Ici Ltd | Manufacture of isocyanates from substituted ureas |
| US4260781A (en) * | 1979-05-25 | 1981-04-07 | Halcon Research And Development Corp. | Process for the manufacture of carbamates |
| DE2937331A1 (de) * | 1979-09-14 | 1981-04-02 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von alkylharnstoffen |
| DE2943480A1 (de) * | 1979-10-27 | 1981-05-07 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von n,o-disubstituierten urethanen, sowie ihre verwendung als ausgangsmaterial zur herstellung von isocyanaten |
| DE2943551A1 (de) * | 1979-10-27 | 1981-05-07 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von n,o-disubstituierten urethanen, sowie ihre verwendung zur herstellung von isocyanaten |
-
1979
- 1979-04-30 DE DE19792917493 patent/DE2917493A1/de not_active Withdrawn
-
1980
- 1980-04-14 CA CA000349775A patent/CA1117968A/en not_active Expired
- 1980-04-23 DE DE8080102182T patent/DE3061256D1/de not_active Expired
- 1980-04-23 EP EP80102182A patent/EP0018586B2/de not_active Expired
- 1980-04-23 AT AT80102182T patent/ATE1945T1/de not_active IP Right Cessation
- 1980-04-28 BR BR8002598A patent/BR8002598A/pt unknown
- 1980-04-28 JP JP5557080A patent/JPS55145657A/ja active Granted
- 1980-04-29 ZA ZA00802579A patent/ZA802579B/xx unknown
-
1986
- 1986-06-26 US US06/879,025 patent/US4713476A/en not_active Expired - Lifetime
-
1988
- 1988-04-20 JP JP63095805A patent/JPS6438055A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6438055A (en) | 1989-02-08 |
| US4713476A (en) | 1987-12-15 |
| ZA802579B (en) | 1981-06-24 |
| DE2917493A1 (de) | 1980-11-13 |
| EP0018586B1 (de) | 1982-12-08 |
| ATE1945T1 (de) | 1982-12-15 |
| JPS55145657A (en) | 1980-11-13 |
| CA1117968A (en) | 1982-02-09 |
| BR8002598A (pt) | 1980-12-09 |
| DE3061256D1 (en) | 1983-01-13 |
| EP0018586B2 (de) | 1987-01-07 |
| JPH0248539B2 (OSRAM) | 1990-10-25 |
| EP0018586A1 (de) | 1980-11-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0115499B2 (OSRAM) | ||
| JPH0250106B2 (OSRAM) | ||
| CA2094484C (en) | Multistep, continuous preparation of organic polyisocyanates | |
| US4388238A (en) | Process for the preparation of N,O-disubstituted urethanes suitable as a starting material for the preparation of isocyanates | |
| JPS6317820B2 (OSRAM) | ||
| CA1144564A (en) | Process for the preparation of n,o- disubstituted urethanes useful for the preparation of isocyanates | |
| JPH0114218B2 (OSRAM) | ||
| EP0018581B1 (de) | Verfahren zur Herstellung von Aryl-mono- und/oder -polyurethanen | |
| US4851565A (en) | Catalyzed process for the preparation of an aliphatic, cycloaliphatic, arylaliphatic or aliphatic-cycloaliphatic di- or polyurethane | |
| US5347034A (en) | Process for the production of poly(O-alkylurethanes) of the diphenyl methane series | |
| EP0018583B1 (de) | Verfahren zur Herstellung von Aryl-mono-,-di- und/oder-polyurethanen | |
| US8871969B2 (en) | Process for the production of polyisocyanates | |
| JPS6412266B2 (OSRAM) | ||
| US4490551A (en) | Process for the production of urethanes | |
| US4879409A (en) | Cycloaliphatic diisocyanates, optionally in the form of isomeric mixtures and a process for their preparation | |
| US4230876A (en) | Process for the preparation of urethanes | |
| JPS60246355A (ja) | トリイソシアネートおよびその製造方法 | |
| JPH0152387B2 (OSRAM) | ||
| EP0128382A1 (de) | 1-Alkyl-2-isocyanatomethyl-isocyanato-cyclohexane und/oder 1-Alkyl-4-isocyanatomethyl-isocyanato-cyclohexane sowie die entsprechenden Diamine, Verfahren zu deren Herstellung und Verwendung | |
| US4267353A (en) | Preparation of aromatic urethanes | |
| CN103596920A (zh) | 制备多异氰酸酯的方法 | |
| JPH0245617B2 (OSRAM) | ||
| DE2942511A1 (de) | Verfahren zur hertellung von arylmono- und polyurethanen | |
| DD281377A5 (de) | Verfahren zur herstellung von isoprophylharnstoffen | |
| HU185613B (en) | Process for preparing n-acyl-n'-/mono- or disubstituted/-carbamides |