JP3714978B2 - ホスホリパーゼa2阻害活性を有する新規カルボン酸誘導体 - Google Patents
ホスホリパーゼa2阻害活性を有する新規カルボン酸誘導体 Download PDFInfo
- Publication number
- JP3714978B2 JP3714978B2 JP23682494A JP23682494A JP3714978B2 JP 3714978 B2 JP3714978 B2 JP 3714978B2 JP 23682494 A JP23682494 A JP 23682494A JP 23682494 A JP23682494 A JP 23682494A JP 3714978 B2 JP3714978 B2 JP 3714978B2
- Authority
- JP
- Japan
- Prior art keywords
- methoxy
- compound
- cdcl
- hexane
- ethyl acetate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 230000002401 inhibitory effect Effects 0.000 title abstract description 10
- 102100037611 Lysophospholipase Human genes 0.000 title abstract 2
- 108010058864 Phospholipases A2 Proteins 0.000 title abstract 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 71
- -1 hydroxy, amino Chemical group 0.000 claims abstract description 69
- 125000003118 aryl group Chemical group 0.000 claims abstract description 23
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 15
- 239000001257 hydrogen Substances 0.000 claims abstract description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 11
- 150000003839 salts Chemical class 0.000 claims abstract description 10
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 7
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 6
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 6
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 239000001301 oxygen Substances 0.000 claims abstract description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims abstract description 3
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 3
- 239000011593 sulfur Substances 0.000 claims abstract description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims abstract 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- 150000001721 carbon Chemical group 0.000 claims description 5
- 125000005018 aryl alkenyl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical group C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 claims description 2
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 claims description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 239000003358 phospholipase A2 inhibitor Substances 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 150000007942 carboxylates Chemical class 0.000 abstract 1
- 230000001747 exhibiting effect Effects 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 132
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 120
- 238000005160 1H NMR spectroscopy Methods 0.000 description 106
- 238000000921 elemental analysis Methods 0.000 description 66
- 238000002844 melting Methods 0.000 description 60
- 230000008018 melting Effects 0.000 description 60
- 238000004519 manufacturing process Methods 0.000 description 53
- 239000012043 crude product Substances 0.000 description 52
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 49
- 238000010898 silica gel chromatography Methods 0.000 description 44
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 39
- 238000004809 thin layer chromatography Methods 0.000 description 35
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 34
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 32
- 238000000034 method Methods 0.000 description 31
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 27
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 230000015572 biosynthetic process Effects 0.000 description 24
- 238000003786 synthesis reaction Methods 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 23
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 20
- 239000013078 crystal Substances 0.000 description 20
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 17
- 229910000104 sodium hydride Inorganic materials 0.000 description 17
- 238000003756 stirring Methods 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 16
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- YZXBAPSDXZZRGB-DOFZRALJSA-N arachidonic acid Chemical compound CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O YZXBAPSDXZZRGB-DOFZRALJSA-N 0.000 description 12
- 229910052681 coesite Inorganic materials 0.000 description 12
- 229910052906 cristobalite Inorganic materials 0.000 description 12
- 239000000377 silicon dioxide Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 229910052682 stishovite Inorganic materials 0.000 description 12
- 229910052905 tridymite Inorganic materials 0.000 description 12
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 11
- ZIIUUSVHCHPIQD-UHFFFAOYSA-N 2,4,6-trimethyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide Chemical compound CC1=CC(C)=CC(C)=C1S(=O)(=O)NC1=CC=CC(C(F)(F)F)=C1 ZIIUUSVHCHPIQD-UHFFFAOYSA-N 0.000 description 11
- 102000015439 Phospholipases Human genes 0.000 description 11
- 108010064785 Phospholipases Proteins 0.000 description 11
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 11
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- 239000000460 chlorine Substances 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 10
- 229910052938 sodium sulfate Inorganic materials 0.000 description 10
- 235000011152 sodium sulphate Nutrition 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- 102000004190 Enzymes Human genes 0.000 description 9
- 108090000790 Enzymes Proteins 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 8
- 229910052736 halogen Inorganic materials 0.000 description 8
- 150000002367 halogens Chemical class 0.000 description 8
- 239000003112 inhibitor Substances 0.000 description 8
- 230000003834 intracellular effect Effects 0.000 description 8
- 230000003248 secreting effect Effects 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- 238000001816 cooling Methods 0.000 description 7
- 238000010511 deprotection reaction Methods 0.000 description 7
- 239000005457 ice water Substances 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 0 Cc1c(*)c(OC)c(C)c(*c(c(OC)c2C)c(C)c(*)c2OCCCCCCSc(cc2)ccc2F)c1C Chemical compound Cc1c(*)c(OC)c(C)c(*c(c(OC)c2C)c(C)c(*)c2OCCCCCCSc(cc2)ccc2F)c1C 0.000 description 6
- 229940114079 arachidonic acid Drugs 0.000 description 6
- 235000021342 arachidonic acid Nutrition 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 6
- SGRHVVLXEBNBDV-UHFFFAOYSA-N 1,6-dibromohexane Chemical compound BrCCCCCCBr SGRHVVLXEBNBDV-UHFFFAOYSA-N 0.000 description 5
- QWHOLOPGKYDPHX-UHFFFAOYSA-N 2-methoxy-4-[2-methoxy-3,5,6-trimethyl-4-[3-[4-(trifluoromethyl)phenoxy]propoxy]phenoxy]carbonyl-3,5,6-trimethylbenzoic acid Chemical compound CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCCCOC1=CC=C(C(F)(F)F)C=C1 QWHOLOPGKYDPHX-UHFFFAOYSA-N 0.000 description 5
- YGMQDBCXHASOHO-UHFFFAOYSA-N 3-bromopropan-1-amine;hydrochloride Chemical compound Cl.NCCCBr YGMQDBCXHASOHO-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 238000002835 absorbance Methods 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 230000008859 change Effects 0.000 description 5
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 5
- 238000003818 flash chromatography Methods 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 5
- 150000003904 phospholipids Chemical class 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- ZLSQEHZJVWITKD-UHFFFAOYSA-N 2-methoxy-4-[2-methoxy-3,5,6-trimethyl-4-[6-[4-(trifluoromethyl)phenoxy]hexoxy]phenoxy]carbonyl-3,5,6-trimethylbenzoic acid Chemical compound CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCCCCCCOC1=CC=C(C(F)(F)F)C=C1 ZLSQEHZJVWITKD-UHFFFAOYSA-N 0.000 description 4
- GLPYNNMHRBKYQK-UHFFFAOYSA-N 4-[4-[3-(2,4-difluorophenoxy)propoxy]-2-methoxy-3,5,6-trimethylphenoxy]carbonyl-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCCCOC1=CC=C(F)C=C1F GLPYNNMHRBKYQK-UHFFFAOYSA-N 0.000 description 4
- QIJCKMXOGJQLID-UHFFFAOYSA-N 4-[4-[3-(4-fluorophenoxy)propoxy]-2-methoxy-3,5,6-trimethylphenoxy]carbonyl-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCCCOC1=CC=C(F)C=C1 QIJCKMXOGJQLID-UHFFFAOYSA-N 0.000 description 4
- YSRZRJSHSXSPQJ-UHFFFAOYSA-N 4-[4-[6-(4-fluorophenoxy)hexoxy]-2-methoxy-3,5,6-trimethylphenoxy]carbonyl-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCCCCCCOC1=CC=C(F)C=C1 YSRZRJSHSXSPQJ-UHFFFAOYSA-N 0.000 description 4
- IARBTEJUBWWUKF-UHFFFAOYSA-N 4-[4-[6-(4-fluorophenyl)sulfanylhexoxy]-2-methoxy-3,5,6-trimethylphenoxy]carbonyl-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCCCCCCSC1=CC=C(F)C=C1 IARBTEJUBWWUKF-UHFFFAOYSA-N 0.000 description 4
- 206010030113 Oedema Diseases 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 238000007796 conventional method Methods 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical class SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 4
- SLYKUFAUNULPLK-UHFFFAOYSA-N (4-carbamoyl-3-methoxy-2,5,6-trimethylphenyl) 2-methoxy-4-[3-(4-methoxycarbonylphenoxy)propoxy]-3,5,6-trimethylbenzoate Chemical compound C1=CC(C(=O)OC)=CC=C1OCCCOC(C(=C1OC)C)=C(C)C(C)=C1C(=O)OC1=C(C)C(C)=C(C(N)=O)C(OC)=C1C SLYKUFAUNULPLK-UHFFFAOYSA-N 0.000 description 3
- NJGLDMAKUORRRO-UHFFFAOYSA-N (4-carbamoyl-3-methoxy-2,5,6-trimethylphenyl) 4-[3-(4-carbamoylphenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoate Chemical compound CC1=C(C(N)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C=CC(=CC=3)C(N)=O)=C(C)C=2C)OC)=C1C NJGLDMAKUORRRO-UHFFFAOYSA-N 0.000 description 3
- SSAMXZDLPSKXHU-UHFFFAOYSA-N (4-carbamoyl-3-methoxy-2,5,6-trimethylphenyl) 4-[3-(4-fluorophenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoate Chemical compound CC1=C(C(N)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C=CC(F)=CC=3)=C(C)C=2C)OC)=C1C SSAMXZDLPSKXHU-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- LQHDXIHLHYYXIN-UHFFFAOYSA-N 2-methoxy-3,5,6-trimethyl-4-(3-naphthalen-2-yloxypropoxy)benzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OCCCOC=2C=C3C=CC=CC3=CC=2)=C1C LQHDXIHLHYYXIN-UHFFFAOYSA-N 0.000 description 3
- XIIKCVHIGLALBZ-UHFFFAOYSA-N 2-methoxy-4-(2-methoxy-3,5,6-trimethyl-4-phenylmethoxyphenoxy)carbonyl-3,5,6-trimethylbenzoic acid Chemical compound CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCC1=CC=CC=C1 XIIKCVHIGLALBZ-UHFFFAOYSA-N 0.000 description 3
- DJFVOQIAECVJSI-UHFFFAOYSA-N 2-methoxy-4-[2-methoxy-3,5,6-trimethyl-4-(3-naphthalen-2-yloxypropoxy)phenoxy]carbonyl-3,5,6-trimethylbenzoic acid Chemical compound COC1=C(C)C(OCCCOC=2C=C3C=CC=CC3=CC=2)=C(C)C(C)=C1OC(=O)C1=C(C)C(C)=C(C(O)=O)C(OC)=C1C DJFVOQIAECVJSI-UHFFFAOYSA-N 0.000 description 3
- PIZPSYWBSCGWCQ-UHFFFAOYSA-N 2-methoxy-4-[2-methoxy-3,5,6-trimethyl-4-[3-[4-(trifluoromethyl)anilino]propoxy]phenoxy]carbonyl-3,5,6-trimethylbenzoic acid;hydrochloride Chemical compound Cl.CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCCCNC1=CC=C(C(F)(F)F)C=C1 PIZPSYWBSCGWCQ-UHFFFAOYSA-N 0.000 description 3
- FPGZNRCXYXFEOF-UHFFFAOYSA-N 2-methoxy-4-[2-methoxy-4-[3-(4-methoxyphenoxy)propoxy]-3,5,6-trimethylphenoxy]carbonyl-3,5,6-trimethylbenzoic acid Chemical compound C1=CC(OC)=CC=C1OCCCOC(C(=C1OC)C)=C(C)C(C)=C1OC(=O)C1=C(C)C(C)=C(C(O)=O)C(OC)=C1C FPGZNRCXYXFEOF-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- VJFPJXZLLPBLTQ-UHFFFAOYSA-N 4-[3-(3,5-ditert-butyl-4-methoxyphenyl)sulfanylpropoxy]-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OCCCSC=2C=C(C(OC)=C(C=2)C(C)(C)C)C(C)(C)C)=C1C VJFPJXZLLPBLTQ-UHFFFAOYSA-N 0.000 description 3
- YVLCXANGDHIQSE-UHFFFAOYSA-N 4-[3-(4-fluorophenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OCCCOC=2C=CC(F)=CC=2)=C1C YVLCXANGDHIQSE-UHFFFAOYSA-N 0.000 description 3
- GJWMCECWTQJRTJ-UHFFFAOYSA-N 4-[3-[4-(4-carbamoyl-3-methoxy-2,5,6-trimethylphenoxy)carbonyl-3-methoxy-2,5,6-trimethylphenoxy]propoxy]benzoic acid Chemical compound CC1=C(C(N)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C=CC(=CC=3)C(O)=O)=C(C)C=2C)OC)=C1C GJWMCECWTQJRTJ-UHFFFAOYSA-N 0.000 description 3
- QVCQWSGPEKSKKR-UHFFFAOYSA-N 4-[4-(4,4-diphenylbut-3-enoxy)-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCC=C(C=3C=CC=CC=3)C=3C=CC=CC=3)=C(C)C=2C)OC)=C1C QVCQWSGPEKSKKR-UHFFFAOYSA-N 0.000 description 3
- PMPWGHARIVAAJR-UHFFFAOYSA-N 4-[4-[(4-fluorophenyl)methoxy]-2-methoxy-3,5,6-trimethylphenoxy]carbonyl-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCC1=CC=C(F)C=C1 PMPWGHARIVAAJR-UHFFFAOYSA-N 0.000 description 3
- YFHHKVSSTKWHGU-UHFFFAOYSA-N 4-[4-[3-(1,1-dihydroxy-3-oxo-1,2-benzothiazol-2-yl)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCN3S(C4=CC=CC=C4C3=O)(O)O)=C(C)C=2C)OC)=C1C YFHHKVSSTKWHGU-UHFFFAOYSA-N 0.000 description 3
- IWRRQAFALXUNDM-UHFFFAOYSA-N 4-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCN3C(C4=CC=CC=C4C3=O)=O)=C(C)C=2C)OC)=C1C IWRRQAFALXUNDM-UHFFFAOYSA-N 0.000 description 3
- YTTOBKAHHOKPRZ-UHFFFAOYSA-N 4-[4-[3-(3,4-dimethoxyphenoxy)propoxy]-2-methoxy-3,5,6-trimethylphenoxy]carbonyl-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound C1=C(OC)C(OC)=CC=C1OCCCOC(C(=C1OC)C)=C(C)C(C)=C1OC(=O)C1=C(C)C(C)=C(C(O)=O)C(OC)=C1C YTTOBKAHHOKPRZ-UHFFFAOYSA-N 0.000 description 3
- PFZDLSYUCXGPEF-UHFFFAOYSA-N 4-[4-[3-(3,5-ditert-butyl-4-methoxyphenyl)sulfanylpropoxy]-2-methoxy-3,5,6-trimethylphenoxy]carbonyl-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCCCSC1=CC(C(C)(C)C)=C(OC)C(C(C)(C)C)=C1 PFZDLSYUCXGPEF-UHFFFAOYSA-N 0.000 description 3
- TXIUJODIDGAKCW-UHFFFAOYSA-N 4-[4-[3-(4-fluorophenyl)sulfanylpropoxy]-2-methoxy-3,5,6-trimethylphenoxy]carbonyl-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCCCSC1=CC=C(F)C=C1 TXIUJODIDGAKCW-UHFFFAOYSA-N 0.000 description 3
- GIBQNQQXHUFEOR-UHFFFAOYSA-N 4-[4-[3-(4-fluorophenyl)sulfonylpropoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCS(=O)(=O)C=3C=CC(F)=CC=3)=C(C)C=2C)OC)=C1C GIBQNQQXHUFEOR-UHFFFAOYSA-N 0.000 description 3
- FFTWWBABYUCXCJ-UHFFFAOYSA-N 4-[4-[6-(3,5-ditert-butyl-4-methoxyphenyl)sulfanylhexoxy]-2-methoxy-3,5,6-trimethylphenoxy]carbonyl-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCCCCCCSC1=CC(C(C)(C)C)=C(OC)C(C(C)(C)C)=C1 FFTWWBABYUCXCJ-UHFFFAOYSA-N 0.000 description 3
- VHBUKUNZHAEGBB-UHFFFAOYSA-N 4-[4-[6-(4-chlorophenoxy)hexoxy]-2-methoxy-3,5,6-trimethylphenoxy]carbonyl-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCCCCCCOC1=CC=C(Cl)C=C1 VHBUKUNZHAEGBB-UHFFFAOYSA-N 0.000 description 3
- VBJQGVGIMINNBI-UHFFFAOYSA-N 4-[4-[6-(4-fluorophenyl)sulfonylhexoxy]-2-methoxy-3,5,6-trimethylphenoxy]carbonyl-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC=1C(C)=C(OC(=O)C=2C(=C(OC)C(C(O)=O)=C(C)C=2C)C)C(OC)=C(C)C=1OCCCCCCS(=O)(=O)C1=CC=C(F)C=C1 VBJQGVGIMINNBI-UHFFFAOYSA-N 0.000 description 3
- OPVKRMSAFPBXPB-UHFFFAOYSA-N 4-[6-(3,5-ditert-butyl-4-methoxyphenyl)sulfanylhexoxy]-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OCCCCCCSC=2C=C(C(OC)=C(C=2)C(C)(C)C)C(C)(C)C)=C1C OPVKRMSAFPBXPB-UHFFFAOYSA-N 0.000 description 3
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium on carbon Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 239000002671 adjuvant Substances 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 125000005530 alkylenedioxy group Chemical group 0.000 description 3
- 206010003246 arthritis Diseases 0.000 description 3
- 238000003556 assay Methods 0.000 description 3
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000007257 deesterification reaction Methods 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000010408 film Substances 0.000 description 3
- 235000021588 free fatty acids Nutrition 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 230000002757 inflammatory effect Effects 0.000 description 3
- 230000028709 inflammatory response Effects 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- XSXHWVKGUXMUQE-UHFFFAOYSA-N osmium dioxide Inorganic materials O=[Os]=O XSXHWVKGUXMUQE-UHFFFAOYSA-N 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical group CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 2
- LXSKZPJIDJYWOT-UHFFFAOYSA-N 2-methoxy-4-[2-methoxy-3,5,6-trimethyl-4-[3-(4-methylphenoxy)propoxy]benzoyl]oxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C=CC(C)=CC=3)=C(C)C=2C)OC)=C1C LXSKZPJIDJYWOT-UHFFFAOYSA-N 0.000 description 2
- RMHCBLJWZOYHTG-UHFFFAOYSA-N 2-methoxy-4-[2-methoxy-3,5,6-trimethyl-4-[3-[(3-methylphenyl)sulfonylamino]propoxy]benzoyl]oxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCNS(=O)(=O)C=3C=C(C)C=CC=3)=C(C)C=2C)OC)=C1C RMHCBLJWZOYHTG-UHFFFAOYSA-N 0.000 description 2
- JNVKRPQKSWGTEZ-UHFFFAOYSA-N 2-methoxy-4-[2-methoxy-3,5,6-trimethyl-4-[3-[(3-methylsulfonylphenyl)sulfonylamino]propoxy]benzoyl]oxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCNS(=O)(=O)C=3C=C(C=CC=3)S(C)(=O)=O)=C(C)C=2C)OC)=C1C JNVKRPQKSWGTEZ-UHFFFAOYSA-N 0.000 description 2
- XYMSRJJQSJCKFU-UHFFFAOYSA-N 2-methoxy-4-[2-methoxy-3,5,6-trimethyl-4-[3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfonylamino]propoxy]benzoyl]oxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCNS(=O)(=O)CC(=O)OC(C)(C)C)=C(C)C=2C)OC)=C1C XYMSRJJQSJCKFU-UHFFFAOYSA-N 0.000 description 2
- BOTXAFXHSKFJCN-UHFFFAOYSA-N 2-methoxy-4-[2-methoxy-4-[3-(2-methoxyphenoxy)propoxy]-3,5,6-trimethylbenzoyl]oxy-3,5,6-trimethylbenzoic acid Chemical compound COC1=CC=CC=C1OCCCOC(C(=C1OC)C)=C(C)C(C)=C1C(=O)OC1=C(C)C(C)=C(C(O)=O)C(OC)=C1C BOTXAFXHSKFJCN-UHFFFAOYSA-N 0.000 description 2
- IWWFQUFWHDXEJJ-UHFFFAOYSA-N 2-methoxy-4-[2-methoxy-4-[3-(4-methoxycarbonylphenoxy)propoxy]-3,5,6-trimethylbenzoyl]oxy-3,5,6-trimethylbenzoic acid Chemical compound C1=CC(C(=O)OC)=CC=C1OCCCOC(C(=C1OC)C)=C(C)C(C)=C1C(=O)OC1=C(C)C(C)=C(C(O)=O)C(OC)=C1C IWWFQUFWHDXEJJ-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- BAYGVMXZJBFEMB-UHFFFAOYSA-N 4-(trifluoromethyl)phenol Chemical compound OC1=CC=C(C(F)(F)F)C=C1 BAYGVMXZJBFEMB-UHFFFAOYSA-N 0.000 description 2
- OKIHXNKYYGUVTE-UHFFFAOYSA-N 4-Fluorothiophenol Chemical compound FC1=CC=C(S)C=C1 OKIHXNKYYGUVTE-UHFFFAOYSA-N 0.000 description 2
- VBBWWVDNRMOPHO-UHFFFAOYSA-N 4-[4-(3,7-dimethyloctoxy)-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCC(C)CCCC(C)C)=C(C)C=2C)OC)=C1C VBBWWVDNRMOPHO-UHFFFAOYSA-N 0.000 description 2
- IUSNTGDKUOYTCN-UHFFFAOYSA-N 4-[4-[2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCC=3C4CC(C4(C)C)CC=3)=C(C)C=2C)OC)=C1C IUSNTGDKUOYTCN-UHFFFAOYSA-N 0.000 description 2
- KMZRGFBNRNFSQH-UHFFFAOYSA-N 4-[4-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C=C4OCOC4=CC=3)=C(C)C=2C)OC)=C1C KMZRGFBNRNFSQH-UHFFFAOYSA-N 0.000 description 2
- FLBZZRHTCCKPHB-UHFFFAOYSA-N 4-[4-[3-(2,3-difluorophenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C(=C(F)C=CC=3)F)=C(C)C=2C)OC)=C1C FLBZZRHTCCKPHB-UHFFFAOYSA-N 0.000 description 2
- UKIGFFQJIDMBLD-UHFFFAOYSA-N 4-[4-[3-(2,4-dibromophenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C(=CC(Br)=CC=3)Br)=C(C)C=2C)OC)=C1C UKIGFFQJIDMBLD-UHFFFAOYSA-N 0.000 description 2
- NZYJNLKVQXSRCV-UHFFFAOYSA-N 4-[4-[3-(2,4-dichlorophenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C(=CC(Cl)=CC=3)Cl)=C(C)C=2C)OC)=C1C NZYJNLKVQXSRCV-UHFFFAOYSA-N 0.000 description 2
- QJKOYNPDIRLOLW-UHFFFAOYSA-N 4-[4-[3-(2,6-dimethoxyphenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound COC1=CC=CC(OC)=C1OCCCOC(C(=C1OC)C)=C(C)C(C)=C1C(=O)OC1=C(C)C(C)=C(C(O)=O)C(OC)=C1C QJKOYNPDIRLOLW-UHFFFAOYSA-N 0.000 description 2
- VTQDXNRKVOIRKV-UHFFFAOYSA-N 4-[4-[3-(2-benzhydrylpiperazin-1-yl)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCN3C(CNCC3)C(C=3C=CC=CC=3)C=3C=CC=CC=3)=C(C)C=2C)OC)=C1C VTQDXNRKVOIRKV-UHFFFAOYSA-N 0.000 description 2
- ZTTJTVMCDLXNQT-UHFFFAOYSA-N 4-[4-[3-(2-fluorophenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C(=CC=CC=3)F)=C(C)C=2C)OC)=C1C ZTTJTVMCDLXNQT-UHFFFAOYSA-N 0.000 description 2
- DYVPNGWPSHVHID-UHFFFAOYSA-N 4-[4-[3-(3,5-dimethoxyphenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound COC1=CC(OC)=CC(OCCCOC=2C(=C(OC)C(C(=O)OC=3C(=C(OC)C(C(O)=O)=C(C)C=3C)C)=C(C)C=2C)C)=C1 DYVPNGWPSHVHID-UHFFFAOYSA-N 0.000 description 2
- QCCVUNBSTPKACR-UHFFFAOYSA-N 4-[4-[3-(3-fluorophenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C=C(F)C=CC=3)=C(C)C=2C)OC)=C1C QCCVUNBSTPKACR-UHFFFAOYSA-N 0.000 description 2
- WSRUSQAYAORQQE-UHFFFAOYSA-N 4-[4-[3-(4-acetylphenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C=CC(=CC=3)C(C)=O)=C(C)C=2C)OC)=C1C WSRUSQAYAORQQE-UHFFFAOYSA-N 0.000 description 2
- GBHLHAOREJRHJD-UHFFFAOYSA-N 4-[4-[3-(4-bromophenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C=CC(Br)=CC=3)=C(C)C=2C)OC)=C1C GBHLHAOREJRHJD-UHFFFAOYSA-N 0.000 description 2
- DAZUWLYJLLUBOG-UHFFFAOYSA-N 4-[4-[3-(4-carbamoylphenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C=CC(=CC=3)C(N)=O)=C(C)C=2C)OC)=C1C DAZUWLYJLLUBOG-UHFFFAOYSA-N 0.000 description 2
- CDQGIGXLKHIZMB-UHFFFAOYSA-N 4-[4-[3-(4-carboxyphenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C=CC(=CC=3)C(O)=O)=C(C)C=2C)OC)=C1C CDQGIGXLKHIZMB-UHFFFAOYSA-N 0.000 description 2
- YIVRPDAFFMXDDH-UHFFFAOYSA-N 4-[4-[3-(4-chlorophenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C=CC(Cl)=CC=3)=C(C)C=2C)OC)=C1C YIVRPDAFFMXDDH-UHFFFAOYSA-N 0.000 description 2
- RTHZYWJLNGRMBD-UHFFFAOYSA-N 4-[4-[3-(4-ethylphenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound C1=CC(CC)=CC=C1OCCCOC(C(=C1OC)C)=C(C)C(C)=C1C(=O)OC1=C(C)C(C)=C(C(O)=O)C(OC)=C1C RTHZYWJLNGRMBD-UHFFFAOYSA-N 0.000 description 2
- POQTYDVGGZJMJK-UHFFFAOYSA-N 4-[4-[3-(4-fluorophenyl)sulfanylpropoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCSC=3C=CC(F)=CC=3)=C(C)C=2C)OC)=C1C POQTYDVGGZJMJK-UHFFFAOYSA-N 0.000 description 2
- JSRGEJQFSGCSBL-UHFFFAOYSA-N 4-[4-[3-(dibenzylamino)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCN(CC=3C=CC=CC=3)CC=3C=CC=CC=3)=C(C)C=2C)OC)=C1C JSRGEJQFSGCSBL-UHFFFAOYSA-N 0.000 description 2
- JODFJACEGDGJFK-UHFFFAOYSA-N 4-[4-[3-[(4-fluorophenyl)sulfonylamino]-3-methylsulfonylpropoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCC(NS(=O)(=O)C=3C=CC(F)=CC=3)S(C)(=O)=O)=C(C)C=2C)OC)=C1C JODFJACEGDGJFK-UHFFFAOYSA-N 0.000 description 2
- QJBHGRHBJUJWQP-UHFFFAOYSA-N 4-[4-[3-[(4-fluorophenyl)sulfonylamino]butoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCC(C)NS(=O)(=O)C=3C=CC(F)=CC=3)=C(C)C=2C)OC)=C1C QJBHGRHBJUJWQP-UHFFFAOYSA-N 0.000 description 2
- QDYSIVCUTLCUQV-UHFFFAOYSA-N 4-[4-[3-[(4-fluorophenyl)sulfonylamino]propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCNS(=O)(=O)C=3C=CC(F)=CC=3)=C(C)C=2C)OC)=C1C QDYSIVCUTLCUQV-UHFFFAOYSA-N 0.000 description 2
- HUQRIZIUBNBSIS-UHFFFAOYSA-N 4-[4-[3-[(6-benzhydryl-1,3-benzodioxol-5-yl)oxy]propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C(=CC=4OCOC=4C=3)C(C=3C=CC=CC=3)C=3C=CC=CC=3)=C(C)C=2C)OC)=C1C HUQRIZIUBNBSIS-UHFFFAOYSA-N 0.000 description 2
- YTDLZUQTMPFIPL-UHFFFAOYSA-N 4-[4-[3-[4-(4-fluorophenyl)piperazin-1-yl]propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCN3CCN(CC3)C=3C=CC(F)=CC=3)=C(C)C=2C)OC)=C1C YTDLZUQTMPFIPL-UHFFFAOYSA-N 0.000 description 2
- BFXHJFKKRGVUMU-UHFFFAOYSA-N 4-fluorobenzenesulfonyl chloride Chemical compound FC1=CC=C(S(Cl)(=O)=O)C=C1 BFXHJFKKRGVUMU-UHFFFAOYSA-N 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 2
- 208000009386 Experimental Arthritis Diseases 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 208000004756 Respiratory Insufficiency Diseases 0.000 description 2
- 206010040047 Sepsis Diseases 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 229940126543 compound 14 Drugs 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 150000002066 eicosanoids Chemical class 0.000 description 2
- OAMZXMDZZWGPMH-UHFFFAOYSA-N ethyl acetate;toluene Chemical compound CCOC(C)=O.CC1=CC=CC=C1 OAMZXMDZZWGPMH-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 239000002502 liposome Substances 0.000 description 2
- 210000002540 macrophage Anatomy 0.000 description 2
- GRWIABMEEKERFV-UHFFFAOYSA-N methanol;oxolane Chemical compound OC.C1CCOC1 GRWIABMEEKERFV-UHFFFAOYSA-N 0.000 description 2
- HUNUAFNLLYVTQD-UHFFFAOYSA-N methyl 2-chlorosulfonylbenzoate Chemical compound COC(=O)C1=CC=CC=C1S(Cl)(=O)=O HUNUAFNLLYVTQD-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 210000000496 pancreas Anatomy 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 201000004193 respiratory failure Diseases 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 238000001308 synthesis method Methods 0.000 description 2
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- ROKSAUSPJGWCSM-UWVGGRQHSA-N (-)-Nopol Chemical compound C1[C@@H]2C(C)(C)[C@H]1CC=C2CCO ROKSAUSPJGWCSM-UWVGGRQHSA-N 0.000 description 1
- AOSZTAHDEDLTLQ-AZKQZHLXSA-N (1S,2S,4R,8S,9S,11S,12R,13S,19S)-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one Chemical compound C([C@@H]1C[C@H]2[C@H]3[C@]([C@]4(C=CC(=O)C=C4[C@@H](F)C3)C)(F)[C@@H](O)C[C@@]2([C@@]1(C1)C(=O)CO)C)N1CC1=CC=CC(Cl)=C1 AOSZTAHDEDLTLQ-AZKQZHLXSA-N 0.000 description 1
- ABJSOROVZZKJGI-OCYUSGCXSA-N (1r,2r,4r)-2-(4-bromophenyl)-n-[(4-chlorophenyl)-(2-fluoropyridin-4-yl)methyl]-4-morpholin-4-ylcyclohexane-1-carboxamide Chemical compound C1=NC(F)=CC(C(NC(=O)[C@H]2[C@@H](C[C@@H](CC2)N2CCOCC2)C=2C=CC(Br)=CC=2)C=2C=CC(Cl)=CC=2)=C1 ABJSOROVZZKJGI-OCYUSGCXSA-N 0.000 description 1
- WLAUCMCTKPXDIY-JXMROGBWSA-N (2e)-1-chloro-3,7-dimethylocta-2,6-diene Chemical compound CC(C)=CCC\C(C)=C\CCl WLAUCMCTKPXDIY-JXMROGBWSA-N 0.000 description 1
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 description 1
- VIJSPAIQWVPKQZ-BLECARSGSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-4,4-dimethylpentanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid Chemical compound NC(=N)NCCC[C@@H](C(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(C)=O VIJSPAIQWVPKQZ-BLECARSGSA-N 0.000 description 1
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- SAWCWRKKWROPRB-UHFFFAOYSA-N 1,1-dibromohexane Chemical compound CCCCCC(Br)Br SAWCWRKKWROPRB-UHFFFAOYSA-N 0.000 description 1
- ATWLRNODAYAMQS-UHFFFAOYSA-N 1,1-dibromopropane Chemical compound CCC(Br)Br ATWLRNODAYAMQS-UHFFFAOYSA-N 0.000 description 1
- AFSHUZFNMVJNKX-LLWMBOQKSA-N 1,2-dioleoyl-sn-glycerol Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCC\C=C/CCCCCCCC AFSHUZFNMVJNKX-LLWMBOQKSA-N 0.000 description 1
- WJKPUMBLABGUCQ-UHFFFAOYSA-N 1-(4-bromophenyl)-4-chlorobutan-1-one Chemical compound ClCCCC(=O)C1=CC=C(Br)C=C1 WJKPUMBLABGUCQ-UHFFFAOYSA-N 0.000 description 1
- AVJKDKWRVSSJPK-UHFFFAOYSA-N 1-(4-fluorophenyl)piperazine Chemical compound C1=CC(F)=CC=C1N1CCNCC1 AVJKDKWRVSSJPK-UHFFFAOYSA-N 0.000 description 1
- NVNPLEPBDPJYRZ-UHFFFAOYSA-N 1-(bromomethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CBr)C=C1 NVNPLEPBDPJYRZ-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- JCERKCRUSDOWLT-UHFFFAOYSA-N 1-bromopropan-1-ol Chemical compound CCC(O)Br JCERKCRUSDOWLT-UHFFFAOYSA-N 0.000 description 1
- 125000001617 2,3-dimethoxy phenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- NVWVWEWVLBKPSM-UHFFFAOYSA-N 2,4-difluorophenol Chemical compound OC1=CC=C(F)C=C1F NVWVWEWVLBKPSM-UHFFFAOYSA-N 0.000 description 1
- KLIDCXVFHGNTTM-UHFFFAOYSA-N 2,6-dimethoxyphenol Chemical group COC1=CC=CC(OC)=C1O KLIDCXVFHGNTTM-UHFFFAOYSA-N 0.000 description 1
- NQTRUVBEEHAYQZ-UHFFFAOYSA-N 2-[(3-methylphenyl)sulfonylamino]-2-methylsulfonylpropanoic acid Chemical compound CC1=CC=CC(S(=O)(=O)NC(C)(C(O)=O)S(C)(=O)=O)=C1 NQTRUVBEEHAYQZ-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- JPTUMLVXAMVSHG-UHFFFAOYSA-N 2-[[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]sulfonylamino]-2-methylsulfonylpropanoic acid Chemical compound CC(C)(C)OC(=O)C1=CC=CC(S(=O)(=O)NC(C)(C(O)=O)S(C)(=O)=O)=C1 JPTUMLVXAMVSHG-UHFFFAOYSA-N 0.000 description 1
- FMKGJQHNYMWDFJ-CVEARBPZSA-N 2-[[4-(2,2-difluoropropoxy)pyrimidin-5-yl]methylamino]-4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]pyrimidine-5-carbonitrile Chemical compound FC(COC1=NC=NC=C1CNC1=NC=C(C(=N1)N[C@H]1CC([C@H](CC1)O)(C)C)C#N)(C)F FMKGJQHNYMWDFJ-CVEARBPZSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- LEVLQLXRRMWUCS-UHFFFAOYSA-N 2-methylsulfonyl-2-[(3-methylsulfonylphenyl)sulfonylamino]propanoic acid Chemical compound OC(=O)C(S(C)(=O)=O)(C)NS(=O)(=O)C1=CC=CC(S(C)(=O)=O)=C1 LEVLQLXRRMWUCS-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- KIUMMUBSPKGMOY-UHFFFAOYSA-N 3,3'-Dithiobis(6-nitrobenzoic acid) Chemical compound C1=C([N+]([O-])=O)C(C(=O)O)=CC(SSC=2C=C(C(=CC=2)[N+]([O-])=O)C(O)=O)=C1 KIUMMUBSPKGMOY-UHFFFAOYSA-N 0.000 description 1
- SMFFZOQLHYIRDA-UHFFFAOYSA-N 3,4-dimethoxyphenol Chemical compound COC1=CC=C(O)C=C1OC SMFFZOQLHYIRDA-UHFFFAOYSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- RQFUZUMFPRMVDX-UHFFFAOYSA-N 3-Bromo-1-propanol Chemical compound OCCCBr RQFUZUMFPRMVDX-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- USWINTIHFQKJTR-UHFFFAOYSA-N 3-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(O)=CC2=C1 USWINTIHFQKJTR-UHFFFAOYSA-N 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- WDBQJSCPCGTAFG-QHCPKHFHSA-N 4,4-difluoro-N-[(1S)-3-[4-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)piperidin-1-yl]-1-pyridin-3-ylpropyl]cyclohexane-1-carboxamide Chemical compound FC1(CCC(CC1)C(=O)N[C@@H](CCN1CCC(CC1)N1C(=NN=C1C)C(C)C)C=1C=NC=CC=1)F WDBQJSCPCGTAFG-QHCPKHFHSA-N 0.000 description 1
- OEOXPGBGNHRJGK-UHFFFAOYSA-N 4-[4-[3-(2,6-difluorophenoxy)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCOC=3C(=CC=CC=3F)F)=C(C)C=2C)OC)=C1C OEOXPGBGNHRJGK-UHFFFAOYSA-N 0.000 description 1
- SNJIROXFEAZXPI-UHFFFAOYSA-N 4-[4-[3-(4-benzhydrylidenepiperidin-1-yl)propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=C(C)C(OC(=O)C=2C(=C(C)C(OCCCN3CCC(CC3)=C(C=3C=CC=CC=3)C=3C=CC=CC=3)=C(C)C=2C)OC)=C1C SNJIROXFEAZXPI-UHFFFAOYSA-N 0.000 description 1
- NLQOKCKCAKNXFS-UHFFFAOYSA-N 4-[bis(4-fluorophenyl)methyl]piperidine Chemical compound C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)C1CCNCC1 NLQOKCKCAKNXFS-UHFFFAOYSA-N 0.000 description 1
- UNPKOFGAQOEDMF-UHFFFAOYSA-N 4-benzhydrylidenepiperidine Chemical compound C1CNCCC1=C(C=1C=CC=CC=1)C1=CC=CC=C1 UNPKOFGAQOEDMF-UHFFFAOYSA-N 0.000 description 1
- LUYLEMZRJQTGPM-UHFFFAOYSA-N 4-benzhydrylpiperidine Chemical compound C1CNCCC1C(C=1C=CC=CC=1)C1=CC=CC=C1 LUYLEMZRJQTGPM-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- JVVRCYWZTJLJSG-UHFFFAOYSA-N 4-dimethylaminophenol Chemical compound CN(C)C1=CC=C(O)C=C1 JVVRCYWZTJLJSG-UHFFFAOYSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-dimethylaminopyridine Substances CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 1
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- VOHRIBRQYLSFCF-UHFFFAOYSA-N BrCCCOc1cc2ccccc2cc1 Chemical compound BrCCCOc1cc2ccccc2cc1 VOHRIBRQYLSFCF-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 206010006482 Bronchospasm Diseases 0.000 description 1
- MHBLDYLMCMMDGY-KJNQDQIDSA-N CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(C[N+](C)(C)C)OP([O-])(OC[C@@H](CO)O)=O Chemical compound CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(C[N+](C)(C)C)OP([O-])(OC[C@@H](CO)O)=O MHBLDYLMCMMDGY-KJNQDQIDSA-N 0.000 description 1
- BQXUPNKLZNSUMC-YUQWMIPFSA-N CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 Chemical compound CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 BQXUPNKLZNSUMC-YUQWMIPFSA-N 0.000 description 1
- ZXLYYQUMYFHCLQ-UHFFFAOYSA-N CN(C(c1c2cccc1)=O)C2=O Chemical compound CN(C(c1c2cccc1)=O)C2=O ZXLYYQUMYFHCLQ-UHFFFAOYSA-N 0.000 description 1
- DDIIAJRLFATEEE-UHFFFAOYSA-N CN(C(c1c2cccc1)=O)S2(=O)=O Chemical compound CN(C(c1c2cccc1)=O)S2(=O)=O DDIIAJRLFATEEE-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229940126657 Compound 17 Drugs 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- VKNUENLPKPOOPS-UHFFFAOYSA-N Fc(cc1)ccc1OCCCBr Chemical compound Fc(cc1)ccc1OCCCBr VKNUENLPKPOOPS-UHFFFAOYSA-N 0.000 description 1
- PYPCIOWTSGJQHX-UHFFFAOYSA-N Fc(cc1)ccc1SCCCCCCBr Chemical compound Fc(cc1)ccc1SCCCCCCBr PYPCIOWTSGJQHX-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000186359 Mycobacterium Species 0.000 description 1
- LVDRREOUMKACNJ-BKMJKUGQSA-N N-[(2R,3S)-2-(4-chlorophenyl)-1-(1,4-dimethyl-2-oxoquinolin-7-yl)-6-oxopiperidin-3-yl]-2-methylpropane-1-sulfonamide Chemical compound CC(C)CS(=O)(=O)N[C@H]1CCC(=O)N([C@@H]1c1ccc(Cl)cc1)c1ccc2c(C)cc(=O)n(C)c2c1 LVDRREOUMKACNJ-BKMJKUGQSA-N 0.000 description 1
- LFZAGIJXANFPFN-UHFFFAOYSA-N N-[3-[4-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)piperidin-1-yl]-1-thiophen-2-ylpropyl]acetamide Chemical compound C(C)(C)C1=NN=C(N1C1CCN(CC1)CCC(C=1SC=CC=1)NC(C)=O)C LFZAGIJXANFPFN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 238000000692 Student's t-test Methods 0.000 description 1
- 241000183072 Thielavia terricola Species 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 229920004890 Triton X-100 Polymers 0.000 description 1
- 206010047139 Vasoconstriction Diseases 0.000 description 1
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 description 1
- DRAWQKGUORNASA-XPWSMXQVSA-N [2-hydroxy-3-[(e)-octadec-9-enoyl]oxypropyl] (e)-octadec-9-enoate Chemical compound CCCCCCCC\C=C\CCCCCCCC(=O)OCC(O)COC(=O)CCCCCCC\C=C\CCCCCCCC DRAWQKGUORNASA-XPWSMXQVSA-N 0.000 description 1
- ITLHXEGAYQFOHJ-UHFFFAOYSA-N [diazo(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(=[N+]=[N-])C1=CC=CC=C1 ITLHXEGAYQFOHJ-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- NHCGQXPQGHFCPN-UHFFFAOYSA-N amino methanesulfonate Chemical compound CS(=O)(=O)ON NHCGQXPQGHFCPN-UHFFFAOYSA-N 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 230000007885 bronchoconstriction Effects 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940127204 compound 29 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940127573 compound 38 Drugs 0.000 description 1
- 229940126540 compound 41 Drugs 0.000 description 1
- 229940127113 compound 57 Drugs 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 210000000805 cytoplasm Anatomy 0.000 description 1
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 1
- 230000001079 digestive effect Effects 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- VHJLVAABSRFDPM-QWWZWVQMSA-N dithiothreitol Chemical compound SC[C@@H](O)[C@H](O)CS VHJLVAABSRFDPM-QWWZWVQMSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- 210000000416 exudates and transudate Anatomy 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000001434 glomerular Effects 0.000 description 1
- 150000002327 glycerophospholipids Chemical class 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 210000002216 heart Anatomy 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000000687 hydroquinonyl group Chemical class C1(O)=C(C=C(O)C=C1)* 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 210000001503 joint Anatomy 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 150000002617 leukotrienes Chemical class 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- RENRQMCACQEWFC-UGKGYDQZSA-N lnp023 Chemical compound C1([C@H]2N(CC=3C=4C=CNC=4C(C)=CC=3OC)CC[C@@H](C2)OCC)=CC=C(C(O)=O)C=C1 RENRQMCACQEWFC-UGKGYDQZSA-N 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 238000003328 mesylation reaction Methods 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 210000003003 monocyte-macrophage precursor cell Anatomy 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- PIDFDZJZLOTZTM-KHVQSSSXSA-N ombitasvir Chemical compound COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)NC1=CC=C([C@H]2N([C@@H](CC2)C=2C=CC(NC(=O)[C@H]3N(CCC3)C(=O)[C@@H](NC(=O)OC)C(C)C)=CC=2)C=2C=CC(=CC=2)C(C)(C)C)C=C1 PIDFDZJZLOTZTM-KHVQSSSXSA-N 0.000 description 1
- 201000008482 osteoarthritis Diseases 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- WTJKGGKOPKCXLL-RRHRGVEJSA-N phosphatidylcholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC WTJKGGKOPKCXLL-RRHRGVEJSA-N 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 238000009790 rate-determining step (RDS) Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000003998 snake venom Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 210000002536 stromal cell Anatomy 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 210000001179 synovial fluid Anatomy 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- QENJZWZWAWWESF-UHFFFAOYSA-N tri-methylbenzoic acid Natural products CC1=CC(C)=C(C(O)=O)C=C1C QENJZWZWAWWESF-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 230000025033 vasoconstriction Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/14—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring
- C07C217/18—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
- C07C217/22—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted by carbon atoms having at least two bonds to oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/64—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings
- C07C233/67—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
- C07C233/68—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
- C07C233/69—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom of an acyclic saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/90—Carboxylic acid amides having nitrogen atoms of carboxamide groups further acylated
- C07C233/92—Carboxylic acid amides having nitrogen atoms of carboxamide groups further acylated with at least one carbon atom of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/46—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/58—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/60—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/16—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
- C07C311/17—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom to an acyclic carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/48—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups having nitrogen atoms of sulfonamide groups further bound to another hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/16—Sulfones; Sulfoxides having sulfone or sulfoxide groups and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C317/18—Sulfones; Sulfoxides having sulfone or sulfoxide groups and singly-bound oxygen atoms bound to the same carbon skeleton with sulfone or sulfoxide groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/01—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and halogen atoms, or nitro or nitroso groups bound to the same carbon skeleton
- C07C323/02—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and halogen atoms, or nitro or nitroso groups bound to the same carbon skeleton having sulfur atoms of thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/03—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and halogen atoms, or nitro or nitroso groups bound to the same carbon skeleton having sulfur atoms of thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/76—Esters of carboxylic acids having a carboxyl group bound to a carbon atom of a six-membered aromatic ring
- C07C69/84—Esters of carboxylic acids having a carboxyl group bound to a carbon atom of a six-membered aromatic ring of monocyclic hydroxy carboxylic acids, the hydroxy groups and the carboxyl groups of which are bound to carbon atoms of a six-membered aromatic ring
- C07C69/92—Esters of carboxylic acids having a carboxyl group bound to a carbon atom of a six-membered aromatic ring of monocyclic hydroxy carboxylic acids, the hydroxy groups and the carboxyl groups of which are bound to carbon atoms of a six-membered aromatic ring with etherified hydroxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
- C07D275/06—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to the ring sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Rheumatology (AREA)
- Engineering & Computer Science (AREA)
- Pain & Pain Management (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Enzymes And Modification Thereof (AREA)
- Quinoline Compounds (AREA)
- Pyridine Compounds (AREA)
- Indole Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Pyrane Compounds (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP23682494A JP3714978B2 (ja) | 1993-10-01 | 1994-09-30 | ホスホリパーゼa2阻害活性を有する新規カルボン酸誘導体 |
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5-246732 | 1993-10-01 | ||
| JP24673293 | 1993-10-01 | ||
| JP15493794 | 1994-07-06 | ||
| JP6-154937 | 1994-07-06 | ||
| JP23682494A JP3714978B2 (ja) | 1993-10-01 | 1994-09-30 | ホスホリパーゼa2阻害活性を有する新規カルボン酸誘導体 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPH0873404A JPH0873404A (ja) | 1996-03-19 |
| JP3714978B2 true JP3714978B2 (ja) | 2005-11-09 |
Family
ID=26483074
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP23682494A Expired - Fee Related JP3714978B2 (ja) | 1993-10-01 | 1994-09-30 | ホスホリパーゼa2阻害活性を有する新規カルボン酸誘導体 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US5534533A (enExample) |
| EP (1) | EP0646569B1 (enExample) |
| JP (1) | JP3714978B2 (enExample) |
| CN (1) | CN1071738C (enExample) |
| AT (1) | ATE161820T1 (enExample) |
| AU (1) | AU674779B2 (enExample) |
| CA (1) | CA2133115A1 (enExample) |
| DE (1) | DE69407709T2 (enExample) |
| DK (1) | DK0646569T3 (enExample) |
| ES (1) | ES2112489T3 (enExample) |
| GR (1) | GR3025911T3 (enExample) |
| TW (1) | TW307757B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4323409A1 (de) * | 1993-07-13 | 1995-01-19 | Boehringer Mannheim Gmbh | Verwendung von Cumarinen und Carbostyrilen als PLA¶2¶-Inhibitoren, neue Cumarine und Carbostyrile, Verfahren zu ihrer Herstellung und Arzneimittel |
| WO1997043241A1 (en) * | 1996-05-13 | 1997-11-20 | Nippon Shinyaku Co., Ltd. | Substituted ethylene compounds and drugs |
| US5888721A (en) * | 1996-07-03 | 1999-03-30 | Millennium Pharmaceuticals, Inc. | Antibacterial compounds |
| WO1999009978A1 (en) * | 1997-08-28 | 1999-03-04 | Eli Lilly And Company | Method for treatment of non-rheumatoid athritis |
| US6861448B2 (en) * | 1998-01-14 | 2005-03-01 | Virtual Drug Development, Inc. | NAD synthetase inhibitors and uses thereof |
| WO2005095327A1 (ja) * | 2004-03-31 | 2005-10-13 | Ajinomoto Co., Inc. | アニリン誘導体 |
| DE112022004333T5 (de) | 2021-09-09 | 2024-07-04 | Asahi Kasei Kabushiki Kaisha | Substrat mit aufgebrachter haftschicht, laminat und beschichtungsmaterialzusammensetzung |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL45396A0 (en) * | 1973-08-23 | 1974-11-29 | Beecham Group Ltd | Pharmaceutical compositions containing aryl aralkyl ether and thioether derivatives,certain such novel compounds and their preparation |
| US4098816A (en) * | 1973-08-23 | 1978-07-04 | Beecham Group Limited | Polycyclic oxy-aromatic acid |
| DK0547231T3 (da) * | 1991-07-03 | 1996-09-16 | Shionogi & Co | Phospholipase-A2-inhibitor |
-
1994
- 1994-09-28 CA CA002133115A patent/CA2133115A1/en not_active Abandoned
- 1994-09-28 AU AU74285/94A patent/AU674779B2/en not_active Ceased
- 1994-09-28 US US08/313,890 patent/US5534533A/en not_active Expired - Lifetime
- 1994-09-29 AT AT94307136T patent/ATE161820T1/de not_active IP Right Cessation
- 1994-09-29 DK DK94307136.5T patent/DK0646569T3/da active
- 1994-09-29 TW TW083109006A patent/TW307757B/zh active
- 1994-09-29 EP EP94307136A patent/EP0646569B1/en not_active Expired - Lifetime
- 1994-09-29 ES ES94307136T patent/ES2112489T3/es not_active Expired - Lifetime
- 1994-09-29 DE DE69407709T patent/DE69407709T2/de not_active Expired - Fee Related
- 1994-09-30 JP JP23682494A patent/JP3714978B2/ja not_active Expired - Fee Related
- 1994-09-30 CN CN94118648A patent/CN1071738C/zh not_active Expired - Fee Related
-
1998
- 1998-01-15 GR GR980400079T patent/GR3025911T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK0646569T3 (da) | 1998-02-09 |
| TW307757B (enExample) | 1997-06-11 |
| US5534533A (en) | 1996-07-09 |
| ES2112489T3 (es) | 1998-04-01 |
| AU7428594A (en) | 1995-04-13 |
| CA2133115A1 (en) | 1995-04-02 |
| GR3025911T3 (en) | 1998-04-30 |
| EP0646569A1 (en) | 1995-04-05 |
| CN1107137A (zh) | 1995-08-23 |
| EP0646569B1 (en) | 1998-01-07 |
| JPH0873404A (ja) | 1996-03-19 |
| DE69407709T2 (de) | 1998-04-23 |
| AU674779B2 (en) | 1997-01-09 |
| CN1071738C (zh) | 2001-09-26 |
| DE69407709D1 (de) | 1998-02-12 |
| ATE161820T1 (de) | 1998-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6316503B1 (en) | LXR modulators | |
| US4258058A (en) | Phenoxyalkylcarboxylic acid compounds and thrombocyte-aggregation inhibition | |
| DE69624262T2 (de) | Sulfonamidinhibitoren von matrix metalloproteinasen | |
| US6214877B1 (en) | 2,3,5-substituted biphenyls useful in the treatment of insulin resistance and hyperglycemia | |
| EP0261254B1 (en) | 3,4-dihydro-4-oxo-2h-1-benzopyranyloxy alkanoic acid derivatives | |
| JPH0123462B2 (enExample) | ||
| US6414179B1 (en) | Alpha-and beta-substituted trifluoromethyl ketones as phospholipase inhibitors | |
| US6890932B2 (en) | Anthranilic acid derivative | |
| JPH0710827B2 (ja) | 新規のスルホニル―フェニルアルキルアミン、及びこれを含有する、高められた血小板凝集又は腎臓機能の病理学的変化に基づく疾病の治療剤 | |
| BG63940B1 (bg) | Бифенилсулфонамидни инхибитори на металопротеиназата на матрикса | |
| JP3004678B2 (ja) | 置換(キノリン―2―イル―メトキシ)フエニル―アシル―スルホンアミド類及び―シアナミド類 | |
| US20040002493A1 (en) | Benzoic acid derivatives and pharmaceutical agents comprising the same as active ingredient | |
| JPH0819040B2 (ja) | フェニルアルカン(ケン)酸 | |
| JP3714978B2 (ja) | ホスホリパーゼa2阻害活性を有する新規カルボン酸誘導体 | |
| CS271469B2 (en) | Method of phenoxyalkylcarboxyl acid's derivatives production | |
| SU664561A3 (ru) | Способ получени производных 2-/4(ациламиноалкил)-фенокси/-алкилкарбоновой кислоты или их солей | |
| JP3933244B2 (ja) | アルキレンジアミン誘導体及び抗潰瘍剤、抗菌剤 | |
| JPH0610174B2 (ja) | アミノフエノ−ル誘導体 | |
| US4999345A (en) | Sulfonamide derivatives and drugs obtained therefrom | |
| CA2202704A1 (en) | Benzyloxy-substituted phenylglycinolamides | |
| US7419974B2 (en) | Cyclohexyl(alkyl)propanolamines, preparation method and pharmaceutical compositions containing same | |
| US4657916A (en) | Quinoline-N-oxide derivative and pharmaceutical composition | |
| RU2103261C1 (ru) | Изобутилзамещенные амиды метансульфонилхинолилметоксифенилциклоалкилуксусной кислоты или их фармацевтически приемлемые соли | |
| KR100362789B1 (ko) | 5-리폭시게네이즈 저해제를 제조하기 위한 방법 및 중간체 | |
| ES2391265T3 (es) | Derivados del ácido butírico |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20050510 |
|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20050705 |
|
| TRDD | Decision of grant or rejection written | ||
| A01 | Written decision to grant a patent or to grant a registration (utility model) |
Free format text: JAPANESE INTERMEDIATE CODE: A01 Effective date: 20050802 |
|
| A61 | First payment of annual fees (during grant procedure) |
Free format text: JAPANESE INTERMEDIATE CODE: A61 Effective date: 20050824 |
|
| R150 | Certificate of patent or registration of utility model |
Free format text: JAPANESE INTERMEDIATE CODE: R150 |
|
| LAPS | Cancellation because of no payment of annual fees |