JP2017521480A - ベンゼンスルホンアミド誘導体及びrorcモデュレーターとしてのその使用 - Google Patents
ベンゼンスルホンアミド誘導体及びrorcモデュレーターとしてのその使用 Download PDFInfo
- Publication number
- JP2017521480A JP2017521480A JP2017513345A JP2017513345A JP2017521480A JP 2017521480 A JP2017521480 A JP 2017521480A JP 2017513345 A JP2017513345 A JP 2017513345A JP 2017513345 A JP2017513345 A JP 2017513345A JP 2017521480 A JP2017521480 A JP 2017521480A
- Authority
- JP
- Japan
- Prior art keywords
- methylsulfonyl
- isobutyl
- alkyl
- piperidin
- oxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229940124824 RORC modulator Drugs 0.000 title 1
- 150000008331 benzenesulfonamides Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 125
- 238000000034 method Methods 0.000 claims abstract description 75
- 150000003839 salts Chemical class 0.000 claims abstract description 18
- 206010003246 arthritis Diseases 0.000 claims abstract description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 192
- -1 di-C 1-6 alkyl-amino Chemical group 0.000 claims description 181
- 229910052739 hydrogen Inorganic materials 0.000 claims description 79
- 239000001257 hydrogen Substances 0.000 claims description 77
- 125000005843 halogen group Chemical group 0.000 claims description 72
- 229910052757 nitrogen Inorganic materials 0.000 claims description 60
- 239000000203 mixture Substances 0.000 claims description 53
- NKFLEFWUYAUDJV-UHFFFAOYSA-N pyridine-3-sulfonamide Chemical compound NS(=O)(=O)C1=CC=CN=C1 NKFLEFWUYAUDJV-UHFFFAOYSA-N 0.000 claims description 47
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 43
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 claims description 34
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 33
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 31
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 claims description 28
- 125000003545 alkoxy group Chemical group 0.000 claims description 27
- 125000004429 atom Chemical group 0.000 claims description 27
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 27
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 21
- 229910052760 oxygen Inorganic materials 0.000 claims description 20
- DWJMBQYORXLGAE-UHFFFAOYSA-N pyridine-2-sulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=N1 DWJMBQYORXLGAE-UHFFFAOYSA-N 0.000 claims description 20
- 229910052717 sulfur Inorganic materials 0.000 claims description 20
- 125000005842 heteroatom Chemical group 0.000 claims description 18
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 17
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 17
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 16
- 238000002360 preparation method Methods 0.000 claims description 16
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims description 14
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 claims description 14
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 14
- 125000002837 carbocyclic group Chemical group 0.000 claims description 13
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 12
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 10
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims description 10
- 125000005144 cycloalkylsulfonyl group Chemical group 0.000 claims description 10
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 claims description 9
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 7
- LJVFCGKVAXNHDU-UHFFFAOYSA-N 2-methyl-1-[4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]sulfonyl-3,4-dihydro-2H-quinoline Chemical compound CC1CCC2=C(C=CC=C2)N1S(=O)(=O)C1=CC=C(OC2CCN(CC2)S(C)(=O)=O)C=C1 LJVFCGKVAXNHDU-UHFFFAOYSA-N 0.000 claims description 6
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 6
- 125000004043 oxo group Chemical group O=* 0.000 claims description 6
- NIRIGNIPEFMZHT-UHFFFAOYSA-N pyrimidine-5-sulfonamide Chemical compound NS(=O)(=O)C1=CN=CN=C1 NIRIGNIPEFMZHT-UHFFFAOYSA-N 0.000 claims description 6
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 5
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims description 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 4
- JOVVLGPCSQCBBU-UHFFFAOYSA-N 1-[4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]sulfonyl-2,3,4,5-tetrahydro-1-benzazepine Chemical compound CS(=O)(=O)N1CCC(CC1)OC1=CC=C(C=C1)S(=O)(=O)N1C2=C(CCCC1)C=CC=C2 JOVVLGPCSQCBBU-UHFFFAOYSA-N 0.000 claims description 3
- HGKUMNWJDULGOK-UHFFFAOYSA-N 1-[4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]sulfonyl-2,3-dihydroindole Chemical compound CS(=O)(=O)N1CCC(CC1)OC1=CC=C(C=C1)S(=O)(=O)N1CCC2=CC=CC=C12 HGKUMNWJDULGOK-UHFFFAOYSA-N 0.000 claims description 3
- QTZUJNYPCIRQCZ-UHFFFAOYSA-N 1-[4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]sulfonyl-3,4-dihydro-2H-quinoline Chemical compound CS(=O)(=O)N1CCC(CC1)OC1=CC=C(C=C1)S(=O)(=O)N1CCCC2=C1C=CC=C2 QTZUJNYPCIRQCZ-UHFFFAOYSA-N 0.000 claims description 3
- MOKROUGCQSXKPR-UHFFFAOYSA-N 1-[4-[(2-chlorophenyl)-(2-methylpropyl)sulfamoyl]phenyl]piperidine-4-carboxylic acid Chemical compound CC(C)CN(C1=C(Cl)C=CC=C1)S(=O)(=O)C1=CC=C(C=C1)N1CCC(CC1)C(O)=O MOKROUGCQSXKPR-UHFFFAOYSA-N 0.000 claims description 3
- GQEPWCJKHBONAE-UHFFFAOYSA-N 11-[4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]sulfonyl-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene Chemical compound CS(=O)(=O)N1CCC(CC1)OC1=CC=C(C=C1)S(=O)(=O)N1C2CCC1C1=CC=CC=C21 GQEPWCJKHBONAE-UHFFFAOYSA-N 0.000 claims description 3
- AHNSFKQIQNCSLL-UHFFFAOYSA-N 2-fluoro-N-(2-methylpropyl)-4-(4-methylsulfonylpiperazin-1-yl)-N-(2-phenylethyl)benzenesulfonamide Chemical compound FC1=C(C=CC(=C1)N1CCN(CC1)S(=O)(=O)C)S(=O)(=O)N(CCC1=CC=CC=C1)CC(C)C AHNSFKQIQNCSLL-UHFFFAOYSA-N 0.000 claims description 3
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 3
- FXZRFZMZPMIHCM-UHFFFAOYSA-N 2-methyl-1-[4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]sulfonyl-2,3-dihydroindole Chemical compound CC1N(C2=CC=CC=C2C1)S(=O)(=O)C1=CC=C(C=C1)OC1CCN(CC1)S(=O)(=O)C FXZRFZMZPMIHCM-UHFFFAOYSA-N 0.000 claims description 3
- NEMHNVNNMYKZAI-UHFFFAOYSA-N 3-benzyl-1-[4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]sulfonylazepane Chemical compound C(C1=CC=CC=C1)C1CN(CCCC1)S(=O)(=O)C1=CC=C(C=C1)OC1CCN(CC1)S(=O)(=O)C NEMHNVNNMYKZAI-UHFFFAOYSA-N 0.000 claims description 3
- ZCTFXAPEEKBHAC-UHFFFAOYSA-N 3-fluoro-N-(2-methylpropyl)-4-(4-methylsulfonylpiperazin-1-yl)-N-(2-phenylethyl)benzenesulfonamide Chemical compound FC=1C=C(C=CC1N1CCN(CC1)S(=O)(=O)C)S(=O)(=O)N(CCC1=CC=CC=C1)CC(C)C ZCTFXAPEEKBHAC-UHFFFAOYSA-N 0.000 claims description 3
- QJPHKCIZBABCGO-UHFFFAOYSA-N 3-methyl-1-[4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]sulfonyl-2,3,4,5-tetrahydro-1-benzazepine Chemical compound CC1CCC2=C(N(C1)S(=O)(=O)C1=CC=C(C=C1)OC1CCN(CC1)S(=O)(=O)C)C=CC=C2 QJPHKCIZBABCGO-UHFFFAOYSA-N 0.000 claims description 3
- FEEDSYTZNJYBBU-UHFFFAOYSA-N 3-methyl-1-[4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]sulfonyl-3,4-dihydro-2H-quinoline Chemical compound CC1CN(C2=C(C1)C=CC=C2)S(=O)(=O)C1=CC=C(OC2CCN(CC2)S(C)(=O)=O)C=C1 FEEDSYTZNJYBBU-UHFFFAOYSA-N 0.000 claims description 3
- PSBKKICRGWQAAH-UHFFFAOYSA-N 4-(4-acetylpiperazin-1-yl)-N-(5-fluoropyridin-2-yl)-N-(2-methylpropyl)benzenesulfonamide Chemical compound C(C)(=O)N1CCN(CC1)C1=CC=C(C=C1)S(=O)(=O)N(CC(C)C)C1=NC=C(C=C1)F PSBKKICRGWQAAH-UHFFFAOYSA-N 0.000 claims description 3
- NBHNCBNDFSXYCZ-UHFFFAOYSA-N 4-(4-acetylpiperazin-1-yl)-N-[(4-fluorophenyl)methyl]-N-(2-methylpropyl)benzenesulfonamide Chemical compound C(C)(=O)N1CCN(CC1)C1=CC=C(C=C1)S(=O)(=O)N(CC(C)C)CC1=CC=C(C=C1)F NBHNCBNDFSXYCZ-UHFFFAOYSA-N 0.000 claims description 3
- AQWGHENWBXBJNK-UHFFFAOYSA-N 4-[1-(cyanomethylsulfonyl)piperidin-4-yl]oxy-N-(5-fluoropyridin-2-yl)-N-(2-methylpropyl)benzenesulfonamide Chemical compound C(#N)CS(=O)(=O)N1CCC(CC1)OC1=CC=C(C=C1)S(=O)(=O)N(CC(C)C)C1=NC=C(C=C1)F AQWGHENWBXBJNK-UHFFFAOYSA-N 0.000 claims description 3
- ZDZLYIANTIWBNN-UHFFFAOYSA-N 4-[4-[3-(4-chlorophenyl)pyrrolidin-1-yl]sulfonylphenoxy]-1-methylsulfonylpiperidine Chemical compound ClC1=CC=C(C=C1)C1CN(CC1)S(=O)(=O)C1=CC=C(OC2CCN(CC2)S(=O)(=O)C)C=C1 ZDZLYIANTIWBNN-UHFFFAOYSA-N 0.000 claims description 3
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 claims description 3
- TZJHHIALLMHTHE-UHFFFAOYSA-N 5-methyl-1-[4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]sulfonyl-2,3,4,5-tetrahydro-1-benzazepine Chemical compound CC1C2=C(N(CCC1)S(=O)(=O)C1=CC=C(C=C1)OC1CCN(CC1)S(=O)(=O)C)C=CC=C2 TZJHHIALLMHTHE-UHFFFAOYSA-N 0.000 claims description 3
- HFEYUGMUFQSEGA-UHFFFAOYSA-N 6-(4-acetylpiperazin-1-yl)-N-[(4-fluorophenyl)methyl]-N-(2-methylpropyl)pyridine-3-sulfonamide Chemical compound C(C)(=O)N1CCN(CC1)C1=CC=C(C=N1)S(=O)(=O)N(CC(C)C)CC1=CC=C(C=C1)F HFEYUGMUFQSEGA-UHFFFAOYSA-N 0.000 claims description 3
- UUKXVYAQBHTTCV-UHFFFAOYSA-N 6-[4-(2-cyanoacetyl)piperazin-1-yl]-N-(4-fluorophenyl)-N-(2-methylpropyl)pyridine-3-sulfonamide Chemical compound C(#N)CC(=O)N1CCN(CC1)C1=CC=C(C=N1)S(=O)(=O)N(CC(C)C)C1=CC=C(C=C1)F UUKXVYAQBHTTCV-UHFFFAOYSA-N 0.000 claims description 3
- GQZSDYMFKQPRDI-UHFFFAOYSA-N 6-fluoro-2-methyl-1-[4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]sulfonyl-3,4-dihydro-2H-quinoline Chemical compound FC=1C=C2CCC(N(C2=CC1)S(=O)(=O)C1=CC=C(C=C1)OC1CCN(CC1)S(=O)(=O)C)C GQZSDYMFKQPRDI-UHFFFAOYSA-N 0.000 claims description 3
- KZMMTBNGDZUTHC-UHFFFAOYSA-N N-(2-methylpropyl)-3-(4-methylsulfonylpiperazin-1-yl)-N-(2-phenylethyl)benzenesulfonamide Chemical compound C(C(C)C)N(S(=O)(=O)C1=CC(=CC=C1)N1CCN(CC1)S(=O)(=O)C)CCC1=CC=CC=C1 KZMMTBNGDZUTHC-UHFFFAOYSA-N 0.000 claims description 3
- YXQTUZBZOIRWAM-UHFFFAOYSA-N N-(2-methylpropyl)-4-(4-methylsulfonylpiperazin-1-yl)-N-(2-phenylethyl)benzenesulfonamide Chemical compound C(C(C)C)N(S(=O)(=O)C1=CC=C(C=C1)N1CCN(CC1)S(=O)(=O)C)CCC1=CC=CC=C1 YXQTUZBZOIRWAM-UHFFFAOYSA-N 0.000 claims description 3
- OQQIUFAVSJAIJX-UHFFFAOYSA-N N-(2-methylpropyl)-5-(4-methylsulfonylpiperazin-1-yl)-N-(2-phenylethyl)pyridine-2-sulfonamide Chemical compound C(C(C)C)N(S(=O)(=O)C1=NC=C(C=C1)N1CCN(CC1)S(=O)(=O)C)CCC1=CC=CC=C1 OQQIUFAVSJAIJX-UHFFFAOYSA-N 0.000 claims description 3
- GHQZDNUYKXKRSE-UHFFFAOYSA-N N-(2-methylpropyl)-6-(4-methylsulfonylpiperazin-1-yl)-N-(2-phenylethyl)pyridine-3-sulfonamide Chemical compound C(C(C)C)N(S(=O)(=O)C=1C=NC(=CC1)N1CCN(CC1)S(=O)(=O)C)CCC1=CC=CC=C1 GHQZDNUYKXKRSE-UHFFFAOYSA-N 0.000 claims description 3
- PRRHYVZWOQNREY-UHFFFAOYSA-N N-(4-fluorophenyl)-6-[(3-hydroxy-1-methylsulfonylpiperidin-4-yl)amino]-N-(2-methylpropyl)pyridine-3-sulfonamide Chemical compound FC1=CC=C(C=C1)N(S(=O)(=O)C=1C=NC(=CC1)NC1C(CN(CC1)S(=O)(=O)C)O)CC(C)C PRRHYVZWOQNREY-UHFFFAOYSA-N 0.000 claims description 3
- DWBXEOYJVRLGKA-KRWDZBQOSA-N N-(4-fluorophenyl)-6-[4-[(2S)-2-hydroxypropanoyl]piperazin-1-yl]-N-(2-methylpropyl)pyridine-3-sulfonamide Chemical compound FC1=CC=C(C=C1)N(S(=O)(=O)C=1C=NC(=CC1)N1CCN(CC1)C([C@H](C)O)=O)CC(C)C DWBXEOYJVRLGKA-KRWDZBQOSA-N 0.000 claims description 3
- QPCFFUNICNWRAE-KRWDZBQOSA-N N-(5-fluoropyridin-2-yl)-4-[1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-N-(2-methylpropyl)benzenesulfonamide Chemical compound FC=1C=CC(=NC1)N(S(=O)(=O)C1=CC=C(C=C1)OC1CCN(CC1)C([C@H](C)O)=O)CC(C)C QPCFFUNICNWRAE-KRWDZBQOSA-N 0.000 claims description 3
- OSARHBSZZXGTNZ-UHFFFAOYSA-N N-[(4-chlorophenyl)methyl]-5-(3-hydroxy-1-methylsulfonylpiperidin-4-yl)oxy-N-(2-methylpropyl)pyridine-2-sulfonamide Chemical compound ClC1=CC=C(CN(S(=O)(=O)C2=NC=C(C=C2)OC2C(CN(CC2)S(=O)(=O)C)O)CC(C)C)C=C1 OSARHBSZZXGTNZ-UHFFFAOYSA-N 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 239000013543 active substance Substances 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 7
- 208000027866 inflammatory disease Diseases 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 168
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 117
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 102
- 238000006243 chemical reaction Methods 0.000 description 78
- 239000000243 solution Substances 0.000 description 61
- 235000019439 ethyl acetate Nutrition 0.000 description 58
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 55
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 55
- 238000010898 silica gel chromatography Methods 0.000 description 45
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 39
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- 239000011734 sodium Substances 0.000 description 36
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 33
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 32
- 125000002947 alkylene group Chemical group 0.000 description 31
- 239000012267 brine Substances 0.000 description 30
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 30
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 29
- 229920006395 saturated elastomer Polymers 0.000 description 27
- 239000002904 solvent Substances 0.000 description 26
- 201000010099 disease Diseases 0.000 description 23
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 18
- 239000012071 phase Substances 0.000 description 18
- 239000012131 assay buffer Substances 0.000 description 17
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 17
- 238000000746 purification Methods 0.000 description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 15
- 239000004480 active ingredient Substances 0.000 description 15
- 239000007787 solid Substances 0.000 description 15
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 14
- 208000002193 Pain Diseases 0.000 description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 13
- 125000003118 aryl group Chemical group 0.000 description 13
- 239000000843 powder Substances 0.000 description 13
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 12
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 11
- 108020003175 receptors Proteins 0.000 description 11
- 102000005962 receptors Human genes 0.000 description 11
- 239000002552 dosage form Substances 0.000 description 10
- 239000000284 extract Substances 0.000 description 10
- 125000001072 heteroaryl group Chemical group 0.000 description 10
- 208000002551 irritable bowel syndrome Diseases 0.000 description 10
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 10
- 239000008194 pharmaceutical composition Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000003556 assay Methods 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 239000007788 liquid Substances 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- 239000003826 tablet Substances 0.000 description 9
- UWTNIJUJUKUAEZ-UHFFFAOYSA-N 4-fluoro-n-(2-methylpropyl)aniline Chemical compound CC(C)CNC1=CC=C(F)C=C1 UWTNIJUJUKUAEZ-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 8
- 239000002775 capsule Substances 0.000 description 8
- 239000006185 dispersion Substances 0.000 description 8
- 125000000623 heterocyclic group Chemical group 0.000 description 8
- 239000002480 mineral oil Substances 0.000 description 8
- 235000010446 mineral oil Nutrition 0.000 description 8
- 239000000523 sample Substances 0.000 description 8
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 8
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 8
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 7
- 208000035475 disorder Diseases 0.000 description 7
- 238000009472 formulation Methods 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- 150000002430 hydrocarbons Chemical group 0.000 description 6
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 6
- 230000009871 nonspecific binding Effects 0.000 description 6
- 201000008482 osteoarthritis Diseases 0.000 description 6
- 206010039073 rheumatoid arthritis Diseases 0.000 description 6
- 239000012453 solvate Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- INBGSXNNRGWLJU-ZHHJOTBYSA-N 25-hydroxycholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@@H](CCCC(C)(C)O)C)[C@@]1(C)CC2 INBGSXNNRGWLJU-ZHHJOTBYSA-N 0.000 description 5
- INBGSXNNRGWLJU-UHFFFAOYSA-N 25epsilon-Hydroxycholesterin Natural products C1C=C2CC(O)CCC2(C)C2C1C1CCC(C(CCCC(C)(C)O)C)C1(C)CC2 INBGSXNNRGWLJU-UHFFFAOYSA-N 0.000 description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 5
- KRZCOLNOCZKSDF-UHFFFAOYSA-N 4-fluoroaniline Chemical compound NC1=CC=C(F)C=C1 KRZCOLNOCZKSDF-UHFFFAOYSA-N 0.000 description 5
- AZZLZCIHVSDNCM-UHFFFAOYSA-N 6-chloro-n-(4-fluorophenyl)-n-(2-methylpropyl)pyridine-3-sulfonamide Chemical compound C=1C=C(Cl)N=CC=1S(=O)(=O)N(CC(C)C)C1=CC=C(F)C=C1 AZZLZCIHVSDNCM-UHFFFAOYSA-N 0.000 description 5
- 201000004681 Psoriasis Diseases 0.000 description 5
- 239000000839 emulsion Substances 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 235000019253 formic acid Nutrition 0.000 description 5
- 239000007937 lozenge Substances 0.000 description 5
- 125000006239 protecting group Chemical group 0.000 description 5
- 238000004007 reversed phase HPLC Methods 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- 238000001665 trituration Methods 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- 208000023275 Autoimmune disease Diseases 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 description 4
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- 201000001263 Psoriatic Arthritis Diseases 0.000 description 4
- 208000036824 Psoriatic arthropathy Diseases 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 208000006673 asthma Diseases 0.000 description 4
- 230000027455 binding Effects 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 235000008504 concentrate Nutrition 0.000 description 4
- 125000001188 haloalkyl group Chemical group 0.000 description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 4
- 238000001802 infusion Methods 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 125000006413 ring segment Chemical group 0.000 description 4
- 201000005671 spondyloarthropathy Diseases 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- 238000007920 subcutaneous administration Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000375 suspending agent Substances 0.000 description 4
- 238000013268 sustained release Methods 0.000 description 4
- 239000012730 sustained-release form Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 239000002562 thickening agent Substances 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- IXRAQYMAEVFORF-UTLNTRLCSA-N (3S,8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC(O)[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 IXRAQYMAEVFORF-UTLNTRLCSA-N 0.000 description 3
- HLVFKOKELQSXIQ-UHFFFAOYSA-N 1-bromo-2-methylpropane Chemical compound CC(C)CBr HLVFKOKELQSXIQ-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- DUEPAIQFKGJSSK-UHFFFAOYSA-N 4-amino-n-(2-methylpropyl)-n-[2-(trifluoromethyl)phenyl]benzenesulfonamide Chemical compound C=1C=C(N)C=CC=1S(=O)(=O)N(CC(C)C)C1=CC=CC=C1C(F)(F)F DUEPAIQFKGJSSK-UHFFFAOYSA-N 0.000 description 3
- XVXBTVORNAFQBR-UHFFFAOYSA-N 4-fluoro-n-(2-methylpropyl)benzenesulfonamide Chemical compound CC(C)CNS(=O)(=O)C1=CC=C(F)C=C1 XVXBTVORNAFQBR-UHFFFAOYSA-N 0.000 description 3
- 241000220479 Acacia Species 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- 206010064584 Myosclerosis Diseases 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000004471 alkyl aminosulfonyl group Chemical group 0.000 description 3
- 125000004103 aminoalkyl group Chemical group 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 125000002619 bicyclic group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 238000005191 phase separation Methods 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- KRTXWFPVIBMGFF-UHFFFAOYSA-N s-[(4-bromophenyl)methyl] ethanethioate Chemical compound CC(=O)SCC1=CC=C(Br)C=C1 KRTXWFPVIBMGFF-UHFFFAOYSA-N 0.000 description 3
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- JHAVCMXISUZPLR-JWQCQUIFSA-N tert-butyl (3r,4r)-4-[4-[(4-chlorophenyl)methyl-(2-methylpropyl)sulfamoyl]phenoxy]-3-hydroxypiperidine-1-carboxylate Chemical compound C=1C=C(O[C@H]2[C@@H](CN(CC2)C(=O)OC(C)(C)C)O)C=CC=1S(=O)(=O)N(CC(C)C)CC1=CC=C(Cl)C=C1 JHAVCMXISUZPLR-JWQCQUIFSA-N 0.000 description 3
- QGWLYJDHBHLAQT-UHFFFAOYSA-N tert-butyl 4-[4-[(4-fluorophenyl)methyl-(2-methylpropyl)sulfamoyl]anilino]piperidine-1-carboxylate Chemical compound C=1C=C(NC2CCN(CC2)C(=O)OC(C)(C)C)C=CC=1S(=O)(=O)N(CC(C)C)CC1=CC=C(F)C=C1 QGWLYJDHBHLAQT-UHFFFAOYSA-N 0.000 description 3
- BIQWPTWGGNMLEF-UHFFFAOYSA-N tert-butyl 4-[4-[cyclobutyl-(3-fluorophenyl)sulfamoyl]phenoxy]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1OC1=CC=C(S(=O)(=O)N(C2CCC2)C=2C=C(F)C=CC=2)C=C1 BIQWPTWGGNMLEF-UHFFFAOYSA-N 0.000 description 3
- CKMRQDHKJMCSHK-UHFFFAOYSA-N tert-butyl 4-[[5-[(4-fluorophenyl)-(2-methylpropyl)sulfamoyl]pyridin-2-yl]amino]piperidine-1-carboxylate Chemical compound C=1C=C(NC2CCN(CC2)C(=O)OC(C)(C)C)N=CC=1S(=O)(=O)N(CC(C)C)C1=CC=C(F)C=C1 CKMRQDHKJMCSHK-UHFFFAOYSA-N 0.000 description 3
- 239000003643 water by type Substances 0.000 description 3
- ZWVWFWGJZPHCHF-UHFFFAOYSA-N (4-bromophenyl)methanesulfonyl chloride Chemical compound ClS(=O)(=O)CC1=CC=C(Br)C=C1 ZWVWFWGJZPHCHF-UHFFFAOYSA-N 0.000 description 2
- 125000004845 (C1-C6) alkylsulfonylamino group Chemical group 0.000 description 2
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 2
- NBRQYFKXWDJGBD-UHFFFAOYSA-N 1-(4-bromophenyl)-n-(3-chlorophenyl)-n-(2-methylpropyl)methanesulfonamide Chemical compound C=1C=C(Br)C=CC=1CS(=O)(=O)N(CC(C)C)C1=CC=CC(Cl)=C1 NBRQYFKXWDJGBD-UHFFFAOYSA-N 0.000 description 2
- KSAGVKZMUDBEEV-UHFFFAOYSA-N 1-(4-bromophenyl)-n-(3-chlorophenyl)methanesulfonamide Chemical compound ClC1=CC=CC(NS(=O)(=O)CC=2C=CC(Br)=CC=2)=C1 KSAGVKZMUDBEEV-UHFFFAOYSA-N 0.000 description 2
- TXVVVEUSVBLDED-UHFFFAOYSA-N 1-(bromomethyl)-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1CBr TXVVVEUSVBLDED-UHFFFAOYSA-N 0.000 description 2
- ZDDMZEROICPDPZ-UHFFFAOYSA-N 1-[4-(4-acetylpiperazin-1-yl)phenyl]-n-(3-chlorophenyl)-n-(2-methylpropyl)methanesulfonamide Chemical compound C=1C=C(N2CCN(CC2)C(C)=O)C=CC=1CS(=O)(=O)N(CC(C)C)C1=CC=CC(Cl)=C1 ZDDMZEROICPDPZ-UHFFFAOYSA-N 0.000 description 2
- AXTGDCSMTYGJND-UHFFFAOYSA-N 1-dodecylazepan-2-one Chemical compound CCCCCCCCCCCCN1CCCCCC1=O AXTGDCSMTYGJND-UHFFFAOYSA-N 0.000 description 2
- FLQSRSQNICPZIH-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-amine Chemical compound CS(=O)(=O)N1CCC(N)CC1 FLQSRSQNICPZIH-UHFFFAOYSA-N 0.000 description 2
- UPEFDWJLNXWMOW-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-ol Chemical compound CS(=O)(=O)N1CCC(O)CC1 UPEFDWJLNXWMOW-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 2
- GWTXCDXWHWHKFZ-UHFFFAOYSA-N 2-benzylsulfanyl-5-(1-methylsulfonylpiperidin-4-yl)oxypyridine Chemical compound C1CN(S(=O)(=O)C)CCC1OC(C=N1)=CC=C1SCC1=CC=CC=C1 GWTXCDXWHWHKFZ-UHFFFAOYSA-N 0.000 description 2
- KAPIWWOMVTWLQA-UHFFFAOYSA-N 2-chloro-5-(1-methylsulfonylpiperidin-4-yl)oxypyridine Chemical compound C1CN(S(=O)(=O)C)CCC1OC1=CC=C(Cl)N=C1 KAPIWWOMVTWLQA-UHFFFAOYSA-N 0.000 description 2
- HFQGHKMNBNRFCI-UHFFFAOYSA-N 4-(4-acetylpiperazin-1-yl)-n-(2-methylpropyl)benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCC(C)C)=CC=C1N1CCN(C(C)=O)CC1 HFQGHKMNBNRFCI-UHFFFAOYSA-N 0.000 description 2
- VJIFUWGBPKWBKI-UHFFFAOYSA-N 4-(bromomethyl)-n-(2-methylpropyl)benzenesulfonamide Chemical compound CC(C)CNS(=O)(=O)C1=CC=C(CBr)C=C1 VJIFUWGBPKWBKI-UHFFFAOYSA-N 0.000 description 2
- IEMMKEBKJLWUIR-UHFFFAOYSA-N 4-[(4-fluorophenyl)-(2-methylpropyl)sulfamoyl]-n-(1-methylsulfonylpiperidin-4-yl)benzamide Chemical compound C=1C=C(C(=O)NC2CCN(CC2)S(C)(=O)=O)C=CC=1S(=O)(=O)N(CC(C)C)C1=CC=C(F)C=C1 IEMMKEBKJLWUIR-UHFFFAOYSA-N 0.000 description 2
- ADKBLQZUNFFNSI-UHFFFAOYSA-N 4-bromo-n-(2-methylpropyl)benzenesulfonamide Chemical compound CC(C)CNS(=O)(=O)C1=CC=C(Br)C=C1 ADKBLQZUNFFNSI-UHFFFAOYSA-N 0.000 description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 2
- FTAXPMDJWXSBJF-UHFFFAOYSA-N 4-fluoro-n-(4-fluorophenyl)-n-(2-methylpropyl)benzenesulfonamide Chemical compound C=1C=C(F)C=CC=1S(=O)(=O)N(CC(C)C)C1=CC=C(F)C=C1 FTAXPMDJWXSBJF-UHFFFAOYSA-N 0.000 description 2
- VZBCYMGTJFEUCK-UHFFFAOYSA-N 4-fluoro-n-(4-fluorophenyl)benzenesulfonamide Chemical compound C1=CC(F)=CC=C1NS(=O)(=O)C1=CC=C(F)C=C1 VZBCYMGTJFEUCK-UHFFFAOYSA-N 0.000 description 2
- BFXHJFKKRGVUMU-UHFFFAOYSA-N 4-fluorobenzenesulfonyl chloride Chemical compound FC1=CC=C(S(Cl)(=O)=O)C=C1 BFXHJFKKRGVUMU-UHFFFAOYSA-N 0.000 description 2
- ACRLUTQHDWRXRK-UHFFFAOYSA-N 4-methoxy-n-(2-methylpropyl)benzenesulfonamide Chemical compound COC1=CC=C(S(=O)(=O)NCC(C)C)C=C1 ACRLUTQHDWRXRK-UHFFFAOYSA-N 0.000 description 2
- PTWORNXXBADGBC-UHFFFAOYSA-N 5-(1-methylsulfonylpiperidin-4-yl)oxypyridine-2-sulfonyl chloride Chemical compound C1CN(S(=O)(=O)C)CCC1OC1=CC=C(S(Cl)(=O)=O)N=C1 PTWORNXXBADGBC-UHFFFAOYSA-N 0.000 description 2
- IOFXRTJAGZAKSV-UHFFFAOYSA-N 5-bromo-n-(4-fluorophenyl)-n-(2-methylpropyl)pyridine-2-sulfonamide Chemical compound C=1C=C(Br)C=NC=1S(=O)(=O)N(CC(C)C)C1=CC=C(F)C=C1 IOFXRTJAGZAKSV-UHFFFAOYSA-N 0.000 description 2
- QXZKKHONVQGXAK-UHFFFAOYSA-N 6-chloropyridine-3-sulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)C=N1 QXZKKHONVQGXAK-UHFFFAOYSA-N 0.000 description 2
- 208000004998 Abdominal Pain Diseases 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- 206010053555 Arthritis bacterial Diseases 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 2
- 206010004663 Biliary colic Diseases 0.000 description 2
- 208000009079 Bronchial Spasm Diseases 0.000 description 2
- 208000014181 Bronchial disease Diseases 0.000 description 2
- 206010006482 Bronchospasm Diseases 0.000 description 2
- 206010058019 Cancer Pain Diseases 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 208000006561 Cluster Headache Diseases 0.000 description 2
- 208000002881 Colic Diseases 0.000 description 2
- 206010012735 Diarrhoea Diseases 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- 208000018522 Gastrointestinal disease Diseases 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 239000007821 HATU Substances 0.000 description 2
- 239000007995 HEPES buffer Substances 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 206010065390 Inflammatory pain Diseases 0.000 description 2
- 102000015696 Interleukins Human genes 0.000 description 2
- 108010063738 Interleukins Proteins 0.000 description 2
- 208000005615 Interstitial Cystitis Diseases 0.000 description 2
- 208000003456 Juvenile Arthritis Diseases 0.000 description 2
- 206010059176 Juvenile idiopathic arthritis Diseases 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 208000019695 Migraine disease Diseases 0.000 description 2
- 208000028389 Nerve injury Diseases 0.000 description 2
- 206010029240 Neuritis Diseases 0.000 description 2
- 102000016978 Orphan receptors Human genes 0.000 description 2
- 108070000031 Orphan receptors Proteins 0.000 description 2
- 208000030852 Parasitic disease Diseases 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 206010065347 Premenstrual pain Diseases 0.000 description 2
- 108091008773 RAR-related orphan receptors γ Proteins 0.000 description 2
- 206010038419 Renal colic Diseases 0.000 description 2
- 208000021386 Sjogren Syndrome Diseases 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 210000000068 Th17 cell Anatomy 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 208000036142 Viral infection Diseases 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- WFKAJVHLWXSISD-UHFFFAOYSA-N anhydrous dimethyl-acetamide Natural products CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 230000002917 arthritic effect Effects 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 125000002785 azepinyl group Chemical group 0.000 description 2
- 208000022362 bacterial infectious disease Diseases 0.000 description 2
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 208000018912 cluster headache syndrome Diseases 0.000 description 2
- 229940110456 cocoa butter Drugs 0.000 description 2
- 235000019868 cocoa butter Nutrition 0.000 description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 230000009977 dual effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 125000004438 haloalkoxy group Chemical group 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 208000014674 injury Diseases 0.000 description 2
- 208000037906 ischaemic injury Diseases 0.000 description 2
- 210000001503 joint Anatomy 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- 206010025135 lupus erythematosus Diseases 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- NSMOWINMWYUVNC-UHFFFAOYSA-N methyl 4-[(4-fluorophenyl)sulfamoyl]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1S(=O)(=O)NC1=CC=C(F)C=C1 NSMOWINMWYUVNC-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 206010027599 migraine Diseases 0.000 description 2
- BRBBNYJZJCYWFP-UHFFFAOYSA-N n-(2-methylpropyl)-4-piperazin-1-ylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCC(C)C)=CC=C1N1CCNCC1 BRBBNYJZJCYWFP-UHFFFAOYSA-N 0.000 description 2
- OEVBZJRMGQUWSV-UHFFFAOYSA-N n-(4-fluorophenyl)-n-(2-methylpropyl)-4-(1-methylsulfonylpiperidin-4-yl)oxybenzenesulfonamide Chemical compound C=1C=C(OC2CCN(CC2)S(C)(=O)=O)C=CC=1S(=O)(=O)N(CC(C)C)C1=CC=C(F)C=C1 OEVBZJRMGQUWSV-UHFFFAOYSA-N 0.000 description 2
- TYLBWBCGTYWSLQ-UHFFFAOYSA-N n-(4-fluorophenyl)-n-(2-methylpropyl)-6-(piperidin-4-ylamino)pyridine-3-sulfonamide Chemical compound C=1C=C(NC2CCNCC2)N=CC=1S(=O)(=O)N(CC(C)C)C1=CC=C(F)C=C1 TYLBWBCGTYWSLQ-UHFFFAOYSA-N 0.000 description 2
- DGENAMJYJSUMHK-UHFFFAOYSA-N n-[(4-chlorophenyl)methyl]-4-hydroxy-n-(2-methylpropyl)benzenesulfonamide Chemical compound C=1C=C(O)C=CC=1S(=O)(=O)N(CC(C)C)CC1=CC=C(Cl)C=C1 DGENAMJYJSUMHK-UHFFFAOYSA-N 0.000 description 2
- KCBXZKDFKNAIBX-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-n-(2-methylpropyl)-4-[(1-methylsulfonylpiperidin-4-yl)amino]benzenesulfonamide Chemical compound C=1C=C(NC2CCN(CC2)S(C)(=O)=O)C=CC=1S(=O)(=O)N(CC(C)C)CC1=CC=C(F)C=C1 KCBXZKDFKNAIBX-UHFFFAOYSA-N 0.000 description 2
- KFUHREDXJWKVAJ-UHFFFAOYSA-N n-cyclobutyl-3-fluoroaniline Chemical compound FC1=CC=CC(NC2CCC2)=C1 KFUHREDXJWKVAJ-UHFFFAOYSA-N 0.000 description 2
- BBMLOIDFXWPGQV-UHFFFAOYSA-N n-cyclobutyl-4-fluoro-n-(3-fluorophenyl)benzenesulfonamide Chemical compound C1=CC(F)=CC=C1S(=O)(=O)N(C=1C=C(F)C=CC=1)C1CCC1 BBMLOIDFXWPGQV-UHFFFAOYSA-N 0.000 description 2
- WMANBQXDEMYOFN-UHFFFAOYSA-N n-cyclobutyl-n-(3-fluorophenyl)-4-(1-methylsulfonylpiperidin-4-yl)oxybenzenesulfonamide Chemical compound C1CN(S(=O)(=O)C)CCC1OC1=CC=C(S(=O)(=O)N(C2CCC2)C=2C=C(F)C=CC=2)C=C1 WMANBQXDEMYOFN-UHFFFAOYSA-N 0.000 description 2
- 210000003928 nasal cavity Anatomy 0.000 description 2
- 230000008764 nerve damage Effects 0.000 description 2
- 208000004296 neuralgia Diseases 0.000 description 2
- 239000012454 non-polar solvent Substances 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 230000003071 parasitic effect Effects 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 239000003880 polar aprotic solvent Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 208000023504 respiratory system disease Diseases 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 2
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
- LZRDHSFPLUWYAX-UHFFFAOYSA-N tert-butyl 4-aminopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(N)CC1 LZRDHSFPLUWYAX-UHFFFAOYSA-N 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 208000004371 toothache Diseases 0.000 description 2
- 238000011200 topical administration Methods 0.000 description 2
- 239000000196 tragacanth Substances 0.000 description 2
- 235000010487 tragacanth Nutrition 0.000 description 2
- 229940116362 tragacanth Drugs 0.000 description 2
- LHJCZOXMCGQVDQ-UHFFFAOYSA-N tri(propan-2-yl)silyl trifluoromethanesulfonate Chemical compound CC(C)[Si](C(C)C)(C(C)C)OS(=O)(=O)C(F)(F)F LHJCZOXMCGQVDQ-UHFFFAOYSA-N 0.000 description 2
- 230000003612 virological effect Effects 0.000 description 2
- 208000009935 visceral pain Diseases 0.000 description 2
- 239000011534 wash buffer Substances 0.000 description 2
- XFQNWPYGEGCIMF-HCUGAJCMSA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].[Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 XFQNWPYGEGCIMF-HCUGAJCMSA-N 0.000 description 1
- GLGNXYJARSMNGJ-VKTIVEEGSA-N (1s,2s,3r,4r)-3-[[5-chloro-2-[(1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3h-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide Chemical compound CCN1C(=O)CCCC2=C(OC)C(NC=3N=C(C(=CN=3)Cl)N[C@H]3[C@H]([C@@]4([H])C[C@@]3(C=C4)[H])C(N)=O)=CC=C21 GLGNXYJARSMNGJ-VKTIVEEGSA-N 0.000 description 1
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- MWYGZNDEZYRDCC-UHFFFAOYSA-N (4-bromophenyl)methyl methanesulfonate Chemical compound CS(=O)(=O)OCC1=CC=C(Br)C=C1 MWYGZNDEZYRDCC-UHFFFAOYSA-N 0.000 description 1
- KZEDPVFJLQLDIZ-UHFFFAOYSA-N (5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-diphenylphosphane Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1.C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZEDPVFJLQLDIZ-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- KQNBRMUBPRGXSL-UHFFFAOYSA-N 1-(bromomethyl)-4-chlorobenzene Chemical compound ClC1=CC=C(CBr)C=C1 KQNBRMUBPRGXSL-UHFFFAOYSA-N 0.000 description 1
- NVNPLEPBDPJYRZ-UHFFFAOYSA-N 1-(bromomethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CBr)C=C1 NVNPLEPBDPJYRZ-UHFFFAOYSA-N 0.000 description 1
- MICMHFIQSAMEJG-UHFFFAOYSA-N 1-bromopyrrolidine-2,5-dione Chemical compound BrN1C(=O)CCC1=O.BrN1C(=O)CCC1=O MICMHFIQSAMEJG-UHFFFAOYSA-N 0.000 description 1
- DFPYXQYWILNVAU-UHFFFAOYSA-N 1-hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1.C1=CC=C2N(O)N=NC2=C1 DFPYXQYWILNVAU-UHFFFAOYSA-N 0.000 description 1
- BTUGGGLMQBJCBN-UHFFFAOYSA-N 1-iodo-2-methylpropane Chemical compound CC(C)CI BTUGGGLMQBJCBN-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- JJWOMLRJNXMLSO-UHFFFAOYSA-N 1-methylsulfonylpiperidine Chemical compound CS(=O)(=O)N1CCCCC1 JJWOMLRJNXMLSO-UHFFFAOYSA-N 0.000 description 1
- NUDMYXJXBUZNNO-UHFFFAOYSA-N 1-methylsulfonylpiperidine-4-carbonyl chloride Chemical compound CS(=O)(=O)N1CCC(C(Cl)=O)CC1 NUDMYXJXBUZNNO-UHFFFAOYSA-N 0.000 description 1
- SUGDSKDKCOFIQN-UHFFFAOYSA-N 1-methylsulfonylpiperidine-4-carboxylic acid Chemical compound CS(=O)(=O)N1CCC(C(O)=O)CC1 SUGDSKDKCOFIQN-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- JYWKEVKEKOTYEX-UHFFFAOYSA-N 2,6-dibromo-4-chloroiminocyclohexa-2,5-dien-1-one Chemical compound ClN=C1C=C(Br)C(=O)C(Br)=C1 JYWKEVKEKOTYEX-UHFFFAOYSA-N 0.000 description 1
- ZEMZPXWZVTUONV-UHFFFAOYSA-N 2-(2-dicyclohexylphosphanylphenyl)-n,n-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 ZEMZPXWZVTUONV-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- IPUYKEFHJBBTAW-UHFFFAOYSA-N 2-chloro-5-piperidin-4-yloxypyridine Chemical compound C1=NC(Cl)=CC=C1OC1CCNCC1 IPUYKEFHJBBTAW-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- UMCMPZBLKLEWAF-BCTGSCMUSA-N 3-[(3-cholamidopropyl)dimethylammonio]propane-1-sulfonate Chemical compound C([C@H]1C[C@H]2O)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(=O)NCCC[N+](C)(C)CCCS([O-])(=O)=O)C)[C@@]2(C)[C@@H](O)C1 UMCMPZBLKLEWAF-BCTGSCMUSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- PZYGNMWOOHESPU-UHFFFAOYSA-N 4-(4-acetylpiperazin-1-yl)-n-(2-methylpropyl)-n-[[2-(trifluoromethyl)phenyl]methyl]benzenesulfonamide Chemical compound C=1C=C(N2CCN(CC2)C(C)=O)C=CC=1S(=O)(=O)N(CC(C)C)CC1=CC=CC=C1C(F)(F)F PZYGNMWOOHESPU-UHFFFAOYSA-N 0.000 description 1
- JPTPUKWWNHHGTG-UHFFFAOYSA-N 4-[(4-fluorophenyl)-(2-methylpropyl)sulfamoyl]benzoic acid Chemical compound C=1C=C(C(O)=O)C=CC=1S(=O)(=O)N(CC(C)C)C1=CC=C(F)C=C1 JPTPUKWWNHHGTG-UHFFFAOYSA-N 0.000 description 1
- BMEJBQAATXBRHZ-UHFFFAOYSA-N 4-bromo-n-[(4-fluorophenyl)methyl]-n-(2-methylpropyl)benzenesulfonamide Chemical compound C=1C=C(Br)C=CC=1S(=O)(=O)N(CC(C)C)CC1=CC=C(F)C=C1 BMEJBQAATXBRHZ-UHFFFAOYSA-N 0.000 description 1
- KMMHZIBWCXYAAH-UHFFFAOYSA-N 4-bromobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C(Br)C=C1 KMMHZIBWCXYAAH-UHFFFAOYSA-N 0.000 description 1
- DTJVECUKADWGMO-UHFFFAOYSA-N 4-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(S(Cl)(=O)=O)C=C1 DTJVECUKADWGMO-UHFFFAOYSA-N 0.000 description 1
- UKJHDYLALDMMHL-UHFFFAOYSA-N 4-nitro-N-[2-(trifluoromethyl)phenyl]benzenesulfonamide 2-(trifluoromethyl)aniline Chemical compound FC(C1=C(N)C=CC=C1)(F)F.[N+](=O)([O-])C1=CC=C(C=C1)S(=O)(=O)NC1=C(C=CC=C1)C(F)(F)F UKJHDYLALDMMHL-UHFFFAOYSA-N 0.000 description 1
- RTVHCUSSDGMZKG-UHFFFAOYSA-N 4-nitro-n-[2-(trifluoromethyl)phenyl]benzenesulfonamide Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=CC=C1C(F)(F)F RTVHCUSSDGMZKG-UHFFFAOYSA-N 0.000 description 1
- JXRGUPLJCCDGKG-UHFFFAOYSA-N 4-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=C(S(Cl)(=O)=O)C=C1 JXRGUPLJCCDGKG-UHFFFAOYSA-N 0.000 description 1
- FTIBGHOWVJVQPO-UHFFFAOYSA-N 5-[2-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophene-2-sulfonyl chloride Chemical compound CN1N=C(C(F)(F)F)C=C1C1=CC=C(S(Cl)(=O)=O)S1 FTIBGHOWVJVQPO-UHFFFAOYSA-N 0.000 description 1
- CZPJXSLJOVFCOH-UHFFFAOYSA-N 5-bromopyridine-2-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C(Br)C=N1 CZPJXSLJOVFCOH-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 208000006820 Arthralgia Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- GXWDHAXQMBGQCE-UHFFFAOYSA-N BrC1=CC=C(C=C1)S(=O)(=O)NCC(C)C.BrC1=CC=C(C=C1)S(=O)(=O)N(CC(C)C)CC1=CC=C(C=C1)F Chemical compound BrC1=CC=C(C=C1)S(=O)(=O)NCC(C)C.BrC1=CC=C(C=C1)S(=O)(=O)N(CC(C)C)CC1=CC=C(C=C1)F GXWDHAXQMBGQCE-UHFFFAOYSA-N 0.000 description 1
- QBGVRHFJMQMQER-UHFFFAOYSA-N BrCC1=CC=C(C=C1)S(=O)(=O)NCC(C)C.[Br-].C(C(C)C)NS(=O)(=O)C1=CC=C(C[PH3+])C=C1 Chemical compound BrCC1=CC=C(C=C1)S(=O)(=O)NCC(C)C.[Br-].C(C(C)C)NS(=O)(=O)C1=CC=C(C[PH3+])C=C1 QBGVRHFJMQMQER-UHFFFAOYSA-N 0.000 description 1
- FUXBYGLLESRFQC-UHFFFAOYSA-N C(C(C)C)NS(=O)(=O)C1=CC=C(C=C1)N1CCNCC1.C(C)(=O)N1CCN(CC1)C1=CC=C(C=C1)S(=O)(=O)NCC(C)C Chemical compound C(C(C)C)NS(=O)(=O)C1=CC=C(C=C1)N1CCNCC1.C(C)(=O)N1CCN(CC1)C1=CC=C(C=C1)S(=O)(=O)NCC(C)C FUXBYGLLESRFQC-UHFFFAOYSA-N 0.000 description 1
- QXSYXWFJAQLQSR-UHFFFAOYSA-N C(C(C)C)NS(=O)(=O)C1=CC=C(C=C1)OC.ClC1=CC=C(CN(S(=O)(=O)C2=CC=C(C=C2)OC)CC(C)C)C=C1 Chemical compound C(C(C)C)NS(=O)(=O)C1=CC=C(C=C1)OC.ClC1=CC=C(CN(S(=O)(=O)C2=CC=C(C=C2)OC)CC(C)C)C=C1 QXSYXWFJAQLQSR-UHFFFAOYSA-N 0.000 description 1
- QZCRADMOOQQBFU-UHFFFAOYSA-N C(C)(C)(C)OC(=O)N1CCC(CC1)OC=1C=NC(=CC1)Cl.ClC1=NC=C(C=C1)OC1CCNCC1 Chemical compound C(C)(C)(C)OC(=O)N1CCC(CC1)OC=1C=NC(=CC1)Cl.ClC1=NC=C(C=C1)OC1CCNCC1 QZCRADMOOQQBFU-UHFFFAOYSA-N 0.000 description 1
- TUPDGUSSVJWFMO-UHFFFAOYSA-N COC(C1=CC=C(C=C1)S(N(CC(C)C)C1=CC=C(C=C1)F)(=O)=O)=O.FC1=CC=C(C=C1)N(S(=O)(=O)C1=CC=C(C(=O)O)C=C1)CC(C)C Chemical compound COC(C1=CC=C(C=C1)S(N(CC(C)C)C1=CC=C(C=C1)F)(=O)=O)=O.FC1=CC=C(C=C1)N(S(=O)(=O)C1=CC=C(C(=O)O)C=C1)CC(C)C TUPDGUSSVJWFMO-UHFFFAOYSA-N 0.000 description 1
- UMPNGXICPOSSIJ-UHFFFAOYSA-N COC(C1=CC=C(C=C1)S(NC1=CC=C(C=C1)F)(=O)=O)=O.COC(C1=CC=C(C=C1)S(N(CC(C)C)C1=CC=C(C=C1)F)(=O)=O)=O Chemical compound COC(C1=CC=C(C=C1)S(NC1=CC=C(C=C1)F)(=O)=O)=O.COC(C1=CC=C(C=C1)S(N(CC(C)C)C1=CC=C(C=C1)F)(=O)=O)=O UMPNGXICPOSSIJ-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- PFCUUYJJXKSHBD-UHFFFAOYSA-N ClC1=NC=C(C=C1)O.C(C)(C)(C)OC(=O)N1CCC(CC1)OC=1C=NC(=CC1)Cl Chemical compound ClC1=NC=C(C=C1)O.C(C)(C)(C)OC(=O)N1CCC(CC1)OC=1C=NC(=CC1)Cl PFCUUYJJXKSHBD-UHFFFAOYSA-N 0.000 description 1
- DOUFUXCAVLMELQ-UHFFFAOYSA-N ClC1=NC=C(C=C1)OC1CCNCC1.ClC1=NC=C(C=C1)OC1CCN(CC1)S(=O)(=O)C Chemical compound ClC1=NC=C(C=C1)OC1CCNCC1.ClC1=NC=C(C=C1)OC1CCN(CC1)S(=O)(=O)C DOUFUXCAVLMELQ-UHFFFAOYSA-N 0.000 description 1
- 108020004414 DNA Proteins 0.000 description 1
- 206010012335 Dependence Diseases 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- NVONVPKWXKBEGR-UHFFFAOYSA-N FC(F)(F)C(C1=CC=CC=C1)C1=C(C=CC=C1)S(=O)(=O)N Chemical compound FC(F)(F)C(C1=CC=CC=C1)C1=C(C=CC=C1)S(=O)(=O)N NVONVPKWXKBEGR-UHFFFAOYSA-N 0.000 description 1
- MYERCIHKAAWGDS-UHFFFAOYSA-N FC1=CC=C(C=C1)S(=O)(=O)NC1=CC=C(C=C1)F.FC1=CC=C(C=C1)S(=O)(=O)N(CC(C)C)C1=CC=C(C=C1)F Chemical compound FC1=CC=C(C=C1)S(=O)(=O)NC1=CC=C(C=C1)F.FC1=CC=C(C=C1)S(=O)(=O)N(CC(C)C)C1=CC=C(C=C1)F MYERCIHKAAWGDS-UHFFFAOYSA-N 0.000 description 1
- KNZURXUCIUJZON-UHFFFAOYSA-N FC=1C=C(C=CC1)I.C1(CCC1)NC1=CC(=CC=C1)F Chemical compound FC=1C=C(C=CC1)I.C1(CCC1)NC1=CC(=CC=C1)F KNZURXUCIUJZON-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 230000005526 G1 to G0 transition Effects 0.000 description 1
- 241001272567 Hominoidea Species 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000610640 Homo sapiens U4/U6 small nuclear ribonucleoprotein Prp3 Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 208000004575 Infectious Arthritis Diseases 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 108090001090 Lectins Proteins 0.000 description 1
- 102000004856 Lectins Human genes 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920000881 Modified starch Polymers 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- ZKGNPQKYVKXMGJ-UHFFFAOYSA-N N,N-dimethylacetamide Chemical compound CN(C)C(C)=O.CN(C)C(C)=O ZKGNPQKYVKXMGJ-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 241000282579 Pan Species 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 208000005374 Poisoning Diseases 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 108091008731 RAR-related orphan receptors α Proteins 0.000 description 1
- 108091008730 RAR-related orphan receptors β Proteins 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- 101001110823 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) 60S ribosomal protein L6-A Proteins 0.000 description 1
- 101000712176 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) 60S ribosomal protein L6-B Proteins 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 210000001744 T-lymphocyte Anatomy 0.000 description 1
- 108091023040 Transcription factor Proteins 0.000 description 1
- 102000040945 Transcription factor Human genes 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- 102100040374 U4/U6 small nuclear ribonucleoprotein Prp3 Human genes 0.000 description 1
- VSERDNUVPOIOAN-UHFFFAOYSA-N [4-(2-methylpropylsulfamoyl)phenyl]methylphosphanium;bromide Chemical compound [Br-].CC(C)CNS(=O)(=O)C1=CC=C(C[PH3+])C=C1 VSERDNUVPOIOAN-UHFFFAOYSA-N 0.000 description 1
- VQXPDHLTVVUXSL-UHFFFAOYSA-N [Br-].C(C(C)C)NS(=O)(=O)C1=CC=C(C[PH3+])C=C1.C(C(C)C)NS(=O)(=O)C1=CC=C(C=C1)C=C1CCN(CC1)S(=O)(=O)C Chemical compound [Br-].C(C(C)C)NS(=O)(=O)C1=CC=C(C[PH3+])C=C1.C(C(C)C)NS(=O)(=O)C1=CC=C(C=C1)C=C1CCN(CC1)S(=O)(=O)C VQXPDHLTVVUXSL-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- YBCVMFKXIKNREZ-UHFFFAOYSA-N acoh acetic acid Chemical compound CC(O)=O.CC(O)=O YBCVMFKXIKNREZ-UHFFFAOYSA-N 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 125000000033 alkoxyamino group Chemical group 0.000 description 1
- 125000005085 alkoxycarbonylalkoxy group Chemical group 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 125000003418 alkyl amino alkoxy group Chemical group 0.000 description 1
- 125000005093 alkyl carbonyl alkyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004688 alkyl sulfonyl alkyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000002431 aminoalkoxy group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 239000008365 aqueous carrier Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 235000021311 artificial sweeteners Nutrition 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 125000004421 aryl sulphonamide group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000003828 azulenyl group Chemical group 0.000 description 1
- 208000025255 bacterial arthritis Diseases 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004600 benzothiopyranyl group Chemical group S1C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004622 benzoxazinyl group Chemical group O1NC(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 229920002988 biodegradable polymer Polymers 0.000 description 1
- 239000004621 biodegradable polymer Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- KYKAJFCTULSVSH-UHFFFAOYSA-N chloro(fluoro)methane Chemical compound F[C]Cl KYKAJFCTULSVSH-UHFFFAOYSA-N 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Natural products C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940125758 compound 15 Drugs 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000005112 cycloalkylalkoxy group Chemical group 0.000 description 1
- KZZKOVLJUKWSKX-UHFFFAOYSA-N cyclobutanamine Chemical compound NC1CCC1 KZZKOVLJUKWSKX-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 125000004984 dialkylaminoalkoxy group Chemical group 0.000 description 1
- 125000002576 diazepinyl group Chemical group N1N=C(C=CC=C1)* 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940042935 dichlorodifluoromethane Drugs 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical group C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical group C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000009429 distress Effects 0.000 description 1
- UZZWBUYVTBPQIV-UHFFFAOYSA-N dme dimethoxyethane Chemical compound COCCOC.COCCOC UZZWBUYVTBPQIV-UHFFFAOYSA-N 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 210000002615 epidermis Anatomy 0.000 description 1
- OLAMWIPURJGSKE-UHFFFAOYSA-N et2o diethylether Chemical compound CCOCC.CCOCC OLAMWIPURJGSKE-UHFFFAOYSA-N 0.000 description 1
- LHWWETDBWVTKJO-UHFFFAOYSA-N et3n triethylamine Chemical compound CCN(CC)CC.CCN(CC)CC LHWWETDBWVTKJO-UHFFFAOYSA-N 0.000 description 1
- OCLXJTCGWSSVOE-UHFFFAOYSA-N ethanol etoh Chemical compound CCO.CCO OCLXJTCGWSSVOE-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- OJCSPXHYDFONPU-UHFFFAOYSA-N etoac etoac Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000013100 final test Methods 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004475 heteroaralkyl group Chemical group 0.000 description 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 1
- 125000005553 heteroaryloxy group Chemical group 0.000 description 1
- 125000005143 heteroarylsulfonyl group Chemical group 0.000 description 1
- 125000004476 heterocycloamino group Chemical group 0.000 description 1
- 125000004415 heterocyclylalkyl group Chemical group 0.000 description 1
- 125000005844 heterocyclyloxy group Chemical group 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical group O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 description 1
- 125000005113 hydroxyalkoxy group Chemical group 0.000 description 1
- 125000005191 hydroxyalkylamino group Chemical group 0.000 description 1
- 125000005181 hydroxyalkylaminoalkyl group Chemical group 0.000 description 1
- 125000005350 hydroxycycloalkyl group Chemical group 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 208000026278 immune system disease Diseases 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 229940030980 inova Drugs 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000001361 intraarterial administration Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 239000002523 lectin Substances 0.000 description 1
- 238000000670 ligand binding assay Methods 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 244000144972 livestock Species 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- COTNUBDHGSIOTA-UHFFFAOYSA-N meoh methanol Chemical compound OC.OC COTNUBDHGSIOTA-UHFFFAOYSA-N 0.000 description 1
- IAXMBWBDZPRSMI-UHFFFAOYSA-N methyl 4-[(4-fluorophenyl)-(2-methylpropyl)sulfamoyl]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1S(=O)(=O)N(CC(C)C)C1=CC=C(F)C=C1 IAXMBWBDZPRSMI-UHFFFAOYSA-N 0.000 description 1
- 125000006533 methyl amino methyl group Chemical group [H]N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 235000019426 modified starch Nutrition 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- PEECTLLHENGOKU-UHFFFAOYSA-N n,n-dimethylpyridin-4-amine Chemical compound CN(C)C1=CC=NC=C1.CN(C)C1=CC=NC=C1 PEECTLLHENGOKU-UHFFFAOYSA-N 0.000 description 1
- QGSATISDRXSPPS-UHFFFAOYSA-N n-(2-methylpropyl)-4-[(1-methylsulfonylpiperidin-4-ylidene)methyl]benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCC(C)C)=CC=C1C=C1CCN(S(C)(=O)=O)CC1 QGSATISDRXSPPS-UHFFFAOYSA-N 0.000 description 1
- BKTCAAVFPDEKBE-UHFFFAOYSA-N n-(2-methylpropyl)-4-nitro-n-[2-(trifluoromethyl)phenyl]benzenesulfonamide Chemical compound C=1C=C([N+]([O-])=O)C=CC=1S(=O)(=O)N(CC(C)C)C1=CC=CC=C1C(F)(F)F BKTCAAVFPDEKBE-UHFFFAOYSA-N 0.000 description 1
- IKIQKDFNKVLPJC-UHFFFAOYSA-N n-(4-fluorophenyl)-n-(2-methylpropyl)-6-(1-methylsulfonylpiperidin-4-yl)oxypyridine-3-sulfonamide Chemical compound C=1C=C(OC2CCN(CC2)S(C)(=O)=O)N=CC=1S(=O)(=O)N(CC(C)C)C1=CC=C(F)C=C1 IKIQKDFNKVLPJC-UHFFFAOYSA-N 0.000 description 1
- YHLUYRQYEGCINH-UHFFFAOYSA-N n-[(4-chlorophenyl)methyl]-4-methoxy-n-(2-methylpropyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)N(CC(C)C)CC1=CC=C(Cl)C=C1 YHLUYRQYEGCINH-UHFFFAOYSA-N 0.000 description 1
- SOUYVJATMXDMQK-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-2-methylpropan-1-amine Chemical compound CC(C)CNCC1=CC=C(F)C=C1 SOUYVJATMXDMQK-UHFFFAOYSA-N 0.000 description 1
- YSDMDFHORFJNJH-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-n-(2-methylpropyl)-4-(piperidin-4-ylamino)benzenesulfonamide Chemical compound C=1C=C(NC2CCNCC2)C=CC=1S(=O)(=O)N(CC(C)C)CC1=CC=C(F)C=C1 YSDMDFHORFJNJH-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- VPEXLCVCUWWWHI-UHFFFAOYSA-N n-[4-[2-methylpropyl-[2-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-1-methylsulfonylpiperidine-4-carboxamide Chemical compound C=1C=C(NC(=O)C2CCN(CC2)S(C)(=O)=O)C=CC=1S(=O)(=O)N(CC(C)C)C1=CC=CC=C1C(F)(F)F VPEXLCVCUWWWHI-UHFFFAOYSA-N 0.000 description 1
- PQYANRVHRQDAJM-UHFFFAOYSA-N n-cyclobutyl-n-(3-fluorophenyl)-4-piperidin-4-yloxybenzenesulfonamide Chemical compound FC1=CC=CC(N(C2CCC2)S(=O)(=O)C=2C=CC(OC3CCNCC3)=CC=2)=C1 PQYANRVHRQDAJM-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 235000021096 natural sweeteners Nutrition 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 108091008607 nuclear receptor subfamilies Proteins 0.000 description 1
- 102000027419 nuclear receptor subfamilies Human genes 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- VEDDBHYQWFOITD-UHFFFAOYSA-N para-bromobenzyl alcohol Chemical compound OCC1=CC=C(Br)C=C1 VEDDBHYQWFOITD-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000003961 penetration enhancing agent Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 231100000572 poisoning Toxicity 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000747 poly(lactic acid) Polymers 0.000 description 1
- 239000004626 polylactic acid Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- VVWRJUBEIPHGQF-MDZDMXLPSA-N propan-2-yl (ne)-n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)\N=N\C(=O)OC(C)C VVWRJUBEIPHGQF-MDZDMXLPSA-N 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002287 radioligand Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 229930002330 retinoic acid Natural products 0.000 description 1
- 108091008679 retinoid hormone receptors Proteins 0.000 description 1
- 102000027483 retinoid hormone receptors Human genes 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000003248 secreting effect Effects 0.000 description 1
- 125000003748 selenium group Chemical group *[Se]* 0.000 description 1
- 201000001223 septic arthritis Diseases 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940001593 sodium carbonate Drugs 0.000 description 1
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 230000000153 supplemental effect Effects 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- FLSQYNASYVVZSB-UHFFFAOYSA-N tert-butyl 4-(6-chloropyridin-3-yl)oxypiperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1OC1=CC=C(Cl)N=C1 FLSQYNASYVVZSB-UHFFFAOYSA-N 0.000 description 1
- PWQLFIKTGRINFF-UHFFFAOYSA-N tert-butyl 4-hydroxypiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(O)CC1 PWQLFIKTGRINFF-UHFFFAOYSA-N 0.000 description 1
- MMPWHAJQEZIIEH-UHFFFAOYSA-N tert-butyl 7-oxa-4-azabicyclo[4.1.0]heptane-4-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC2OC21 MMPWHAJQEZIIEH-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- PHCBRBWANGJMHS-UHFFFAOYSA-J tetrasodium;disulfate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O PHCBRBWANGJMHS-UHFFFAOYSA-J 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000005297 thienyloxy group Chemical group S1C(=CC=C1)O* 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 230000037317 transdermal delivery Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 230000008736 traumatic injury Effects 0.000 description 1
- 229960001727 tretinoin Drugs 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- WCTAGTRAWPDFQO-UHFFFAOYSA-K trisodium;hydrogen carbonate;carbonate Chemical compound [Na+].[Na+].[Na+].OC([O-])=O.[O-]C([O-])=O WCTAGTRAWPDFQO-UHFFFAOYSA-K 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- 238000004704 ultra performance liquid chromatography Methods 0.000 description 1
- 239000006216 vaginal suppository Substances 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 230000003519 ventilatory effect Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
- A61K31/4468—Non condensed piperidines, e.g. piperocaine having a nitrogen directly attached in position 4, e.g. clebopride, fentanyl
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
- A61K31/4523—Non condensed piperidines, e.g. piperocaine containing further heterocyclic ring systems
- A61K31/454—Non condensed piperidines, e.g. piperocaine containing further heterocyclic ring systems containing a five-membered ring with nitrogen as a ring hetero atom, e.g. pimozide, domperidone
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/02—Drugs for skeletal disorders for joint disorders, e.g. arthritis, arthrosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D211/62—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/92—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with a hetero atom directly attached to the ring nitrogen atom
- C07D211/96—Sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
- C07D213/71—Sulfur atoms to which a second hetero atom is attached
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/76—Nitrogen atoms to which a second hetero atom is attached
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
- C07D295/26—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Engineering & Computer Science (AREA)
- Orthopedic Medicine & Surgery (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Physical Education & Sports Medicine (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Rheumatology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Immunology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Hydrogenated Pyridines (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US201462002339P | 2014-05-23 | 2014-05-23 | |
US62/002,339 | 2014-05-23 | ||
PCT/EP2015/061347 WO2015177325A1 (en) | 2014-05-23 | 2015-05-22 | Benzene sulfonamide derivatives and their use as rorc modulators |
Publications (1)
Publication Number | Publication Date |
---|---|
JP2017521480A true JP2017521480A (ja) | 2017-08-03 |
Family
ID=53264662
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP2017513345A Pending JP2017521480A (ja) | 2014-05-23 | 2015-05-22 | ベンゼンスルホンアミド誘導体及びrorcモデュレーターとしてのその使用 |
Country Status (8)
Country | Link |
---|---|
EP (1) | EP3145912A1 (es) |
JP (1) | JP2017521480A (es) |
KR (1) | KR20170007816A (es) |
CN (1) | CN106458991A (es) |
CA (1) | CA2949229A1 (es) |
MX (1) | MX2016015247A (es) |
RU (1) | RU2016149804A (es) |
WO (1) | WO2015177325A1 (es) |
Families Citing this family (9)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
MA45189A (fr) | 2016-06-07 | 2019-04-10 | Jacobio Pharmaceuticals Co Ltd | Nouveaux dérivés hétérocycliques utiles en tant qu'inhibiteurs de shp2 |
CN108503584B (zh) * | 2017-02-27 | 2021-05-04 | 复旦大学 | 一种1,2,3,4-四氢喹啉磺酰胺类化合物及其应用 |
KR20220113545A (ko) | 2017-03-23 | 2022-08-12 | 자코바이오 파마슈티칼스 컴퍼니 리미티드 | Shp2 억제제로서 유용한 신규한 헤테로환형 유도체 |
EP3689860A4 (en) * | 2017-09-30 | 2021-06-02 | Chia Tai Tianqing Pharmaceutical Group Co., Ltd. | SULFONYL-SUBSTITUTED BICYCLIC COMPOUNDS AS ROR INHIBITOR |
CN109896998B (zh) * | 2017-12-10 | 2022-06-07 | 复旦大学 | 一种3,4-二氢异喹啉磺酰胺类化合物及其应用 |
WO2020108538A1 (zh) * | 2018-11-27 | 2020-06-04 | 正大天晴药业集团股份有限公司 | 含有磺酰基结构的RORγ抑制剂 |
KR20210145787A (ko) | 2019-04-02 | 2021-12-02 | 알리고스 테라퓨틱스 인코포레이티드 | Prmt5를 표적으로 하는 화합물 |
CN112830893A (zh) * | 2019-10-28 | 2021-05-25 | 成都倍特药业股份有限公司 | 一类RORγ抑制剂、其制备方法及其在医药上的应用 |
WO2022143911A1 (zh) * | 2020-12-31 | 2022-07-07 | 赛诺哈勃药业(成都)有限公司 | 一种纤溶酶抑制剂、其制备方法及应用 |
Family Cites Families (7)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
TW200522944A (en) * | 2003-12-23 | 2005-07-16 | Lilly Co Eli | CB1 modulator compounds |
WO2008109154A1 (en) * | 2007-03-08 | 2008-09-12 | Altiris Therapeutics, Inc. | Chemokine receptor modulators |
CU20080028A6 (es) * | 2008-02-29 | 2011-02-24 | Ct Ingenieria Genetica Biotech | Compuestos químicos obtenidos in silico para la preparación de composiciones farmacéuticas para atenuar o inhibir la infección por virus dengue y otros flavivirus |
US9216988B2 (en) * | 2011-12-22 | 2015-12-22 | Genentech, Inc. | Benzyl sulfonamide derivatives as RORc modulators |
US9403800B2 (en) * | 2012-01-24 | 2016-08-02 | Chemregen, Inc. | Compounds for inhibition of cancer cell proliferation |
PE20142400A1 (es) * | 2012-04-27 | 2015-02-04 | Glaxo Group Ltd | Compuestos novedosos |
MX2015006926A (es) * | 2012-12-10 | 2015-09-16 | Hoffmann La Roche | Derivados de bencil sulfonamida como moduladores del receptor huerfano relacionado con el receptor retinoide (rorc). |
-
2015
- 2015-05-22 EP EP15724296.7A patent/EP3145912A1/en not_active Withdrawn
- 2015-05-22 WO PCT/EP2015/061347 patent/WO2015177325A1/en active Application Filing
- 2015-05-22 MX MX2016015247A patent/MX2016015247A/es unknown
- 2015-05-22 RU RU2016149804A patent/RU2016149804A/ru unknown
- 2015-05-22 CA CA2949229A patent/CA2949229A1/en not_active Abandoned
- 2015-05-22 KR KR1020167035789A patent/KR20170007816A/ko unknown
- 2015-05-22 CN CN201580025888.7A patent/CN106458991A/zh active Pending
- 2015-05-22 JP JP2017513345A patent/JP2017521480A/ja active Pending
Also Published As
Publication number | Publication date |
---|---|
KR20170007816A (ko) | 2017-01-20 |
MX2016015247A (es) | 2017-02-23 |
EP3145912A1 (en) | 2017-03-29 |
WO2015177325A1 (en) | 2015-11-26 |
CN106458991A (zh) | 2017-02-22 |
RU2016149804A (ru) | 2018-06-26 |
CA2949229A1 (en) | 2015-11-26 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US9382222B2 (en) | Benzyl sulfonamide derivatives as RORc modulators | |
JP2017521480A (ja) | ベンゼンスルホンアミド誘導体及びrorcモデュレーターとしてのその使用 | |
US8912219B2 (en) | Aryl sulfamide and sulfamate derivatives as RORc modulators | |
JP2015506923A (ja) | RORcモジュレーターとしてのベンジルスルホンアミド誘導体 | |
JP2015507622A (ja) | RORcモジュレーターとしてのベンジルスルホンアミド誘導体 | |
EP3010919B1 (en) | Aryl sultam derivatives as ror-c modulators | |
KR20160142365A (ko) | Cb2 작용제로서 유용한 피리딘-2-아미드 | |
NO327221B1 (no) | Piperidinderivater, fremgangsmate for deres fremstilling, farmasoytisk preparat, anvendelser og mellomprodukter | |
JP6367823B2 (ja) | RORcモジュレーターとしてのベンジルスルホンアミド誘導体 | |
WO2023150201A2 (en) | Sodium channel blocking compounds, derivatives thereof, and methods of their use | |
US20080096885A1 (en) | Quinoline Derivatives as Neurokinin Receptor Antagonists |