JP2016506403A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2016506403A5 JP2016506403A5 JP2015548610A JP2015548610A JP2016506403A5 JP 2016506403 A5 JP2016506403 A5 JP 2016506403A5 JP 2015548610 A JP2015548610 A JP 2015548610A JP 2015548610 A JP2015548610 A JP 2015548610A JP 2016506403 A5 JP2016506403 A5 JP 2016506403A5
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- alkoxy
- fluoroalkyl
- independently
- fluoroalkoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 125000000217 alkyl group Chemical group 0.000 claims 209
- 125000003545 alkoxy group Chemical group 0.000 claims 69
- 125000003709 fluoroalkyl group Chemical group 0.000 claims 67
- 125000004428 fluoroalkoxy group Chemical group 0.000 claims 50
- 125000004093 cyano group Chemical group *C#N 0.000 claims 46
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 46
- 229910052736 halogen Inorganic materials 0.000 claims 43
- 150000002367 halogens Chemical class 0.000 claims 42
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 33
- 125000001072 heteroaryl group Chemical group 0.000 claims 29
- 150000001875 compounds Chemical class 0.000 claims 23
- 229910052739 hydrogen Inorganic materials 0.000 claims 23
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims 22
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims 22
- 125000004414 alkyl thio group Chemical group 0.000 claims 22
- 239000001257 hydrogen Substances 0.000 claims 22
- 125000000753 cycloalkyl group Chemical group 0.000 claims 18
- -1 fluorine halogen Chemical class 0.000 claims 18
- 229910052801 chlorine Chemical group 0.000 claims 17
- 239000000460 chlorine Chemical group 0.000 claims 17
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 15
- 229910052717 sulfur Inorganic materials 0.000 claims 13
- 125000003282 alkyl amino group Chemical group 0.000 claims 12
- 229910052757 nitrogen Inorganic materials 0.000 claims 11
- 125000003342 alkenyl group Chemical group 0.000 claims 10
- 125000000304 alkynyl group Chemical group 0.000 claims 10
- 150000002431 hydrogen Chemical class 0.000 claims 10
- 229910052760 oxygen Inorganic materials 0.000 claims 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 9
- 125000001424 substituent group Chemical group 0.000 claims 7
- 125000003302 alkenyloxy group Chemical group 0.000 claims 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 6
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims 6
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims 6
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims 6
- 125000005133 alkynyloxy group Chemical group 0.000 claims 6
- 125000004103 aminoalkyl group Chemical group 0.000 claims 6
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 6
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims 6
- 125000004966 cyanoalkyl group Chemical group 0.000 claims 6
- 125000004663 dialkyl amino group Chemical group 0.000 claims 6
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 claims 6
- 125000005240 diheteroarylamino group Chemical group 0.000 claims 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 6
- 229910052731 fluorine Inorganic materials 0.000 claims 6
- 239000011737 fluorine Substances 0.000 claims 6
- 125000004991 fluoroalkenyl group Chemical group 0.000 claims 6
- 125000005241 heteroarylamino group Chemical group 0.000 claims 6
- 125000004971 nitroalkyl group Chemical group 0.000 claims 6
- 239000001301 oxygen Substances 0.000 claims 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 5
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 5
- 229910052794 bromium Inorganic materials 0.000 claims 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 5
- 150000003839 salts Chemical class 0.000 claims 5
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims 5
- 229920002554 vinyl polymer Polymers 0.000 claims 5
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 4
- 229910052799 carbon Inorganic materials 0.000 claims 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 4
- 125000004434 sulfur atom Chemical group 0.000 claims 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 3
- 125000000000 cycloalkoxy group Chemical group 0.000 claims 3
- 125000006310 cycloalkyl amino group Chemical group 0.000 claims 3
- 230000002363 herbicidal effect Effects 0.000 claims 3
- 125000005842 heteroatom Chemical group 0.000 claims 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 3
- 239000002184 metal Substances 0.000 claims 3
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 claims 3
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims 2
- 239000011593 sulfur Substances 0.000 claims 2
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims 1
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 claims 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 125000006163 5-membered heteroaryl group Chemical group 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 claims 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 1
- 125000004687 alkyl sulfinyl alkyl group Chemical group 0.000 claims 1
- 125000004688 alkyl sulfonyl alkyl group Chemical group 0.000 claims 1
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims 1
- 150000001721 carbon Chemical group 0.000 claims 1
- 244000038559 crop plants Species 0.000 claims 1
- 125000000392 cycloalkenyl group Chemical group 0.000 claims 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims 1
- 239000004009 herbicide Substances 0.000 claims 1
- 125000005553 heteroaryloxy group Chemical group 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 1
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims 1
- 239000002904 solvent Substances 0.000 claims 1
- 0 *c1cc(C#C*)cc(*)c1C(C(CC(CC1CCOCC1)C1)=O)C1=O Chemical compound *c1cc(C#C*)cc(*)c1C(C(CC(CC1CCOCC1)C1)=O)C1=O 0.000 description 14
- KHMCNRADTZTNBF-UHFFFAOYSA-N CC#Cc1cc(Cl)c(C(C(CC(C2)C3CCOCC3)=O)C2=O)c(OC)c1 Chemical compound CC#Cc1cc(Cl)c(C(C(CC(C2)C3CCOCC3)=O)C2=O)c(OC)c1 KHMCNRADTZTNBF-UHFFFAOYSA-N 0.000 description 1
- BVANXMHYDYPGBW-UHFFFAOYSA-N CC#Cc1cc(Cl)c(C(C(CC2(CCOCC2)C2)=O)C2=O)c(OC)c1 Chemical compound CC#Cc1cc(Cl)c(C(C(CC2(CCOCC2)C2)=O)C2=O)c(OC)c1 BVANXMHYDYPGBW-UHFFFAOYSA-N 0.000 description 1
- RJDNKNSAOYQCON-UHFFFAOYSA-N CC#Cc1cc(Cl)c(C(C(CCC2)=O)C2=O)c(OC)c1 Chemical compound CC#Cc1cc(Cl)c(C(C(CCC2)=O)C2=O)c(OC)c1 RJDNKNSAOYQCON-UHFFFAOYSA-N 0.000 description 1
- SPKLIWJDHAMGQY-UHFFFAOYSA-N CC(C)(C(C1c(c(C)c2)ccc2C#CC)=O)OC(C)(C)C1=O Chemical compound CC(C)(C(C1c(c(C)c2)ccc2C#CC)=O)OC(C)(C)C1=O SPKLIWJDHAMGQY-UHFFFAOYSA-N 0.000 description 1
- CIVCUPJWQBLXLO-UHFFFAOYSA-N CCCc1cc(C#CC)cc(C)c1C(C(C1CC2CC1)O)C2=O Chemical compound CCCc1cc(C#CC)cc(C)c1C(C(C1CC2CC1)O)C2=O CIVCUPJWQBLXLO-UHFFFAOYSA-N 0.000 description 1
- ZXVGRQBBTHNTPP-UHFFFAOYSA-N CCSC(C)CC(CC(C1C(C(CC(C#CC)=C2)Cl)=C2OC)=O)CC1=O Chemical compound CCSC(C)CC(CC(C1C(C(CC(C#CC)=C2)Cl)=C2OC)=O)CC1=O ZXVGRQBBTHNTPP-UHFFFAOYSA-N 0.000 description 1
- CYQIDUSWWUACCX-UHFFFAOYSA-N CCSC(C)CC(CC(C1c(c(C)c2)c(C)cc2C#CC)=O)CC1=O Chemical compound CCSC(C)CC(CC(C1c(c(C)c2)c(C)cc2C#CC)=O)CC1=O CYQIDUSWWUACCX-UHFFFAOYSA-N 0.000 description 1
- VGMRLMAWXFYUHQ-UHFFFAOYSA-N CCSC(C)CC(CC(C1c(c(C)c2)c(C)cc2C#CCl)=O)CC1=O Chemical compound CCSC(C)CC(CC(C1c(c(C)c2)c(C)cc2C#CCl)=O)CC1=O VGMRLMAWXFYUHQ-UHFFFAOYSA-N 0.000 description 1
- RFIPGJIPOQOJTJ-UHFFFAOYSA-N CCc1cc(C#CC)cc(N)c1C(C(C1CC2CC1)=O)C2=O Chemical compound CCc1cc(C#CC)cc(N)c1C(C(C1CC2CC1)=O)C2=O RFIPGJIPOQOJTJ-UHFFFAOYSA-N 0.000 description 1
- FZPDKOWYJTXCCN-UHFFFAOYSA-N Cc1cc(C#CC)cc(C)c1C(C(C1CC2CC1)=O)C2=O Chemical compound Cc1cc(C#CC)cc(C)c1C(C(C1CC2CC1)=O)C2=O FZPDKOWYJTXCCN-UHFFFAOYSA-N 0.000 description 1
- IQAXVPFYGPUPKH-UHFFFAOYSA-N Cc1cc(C#CC)cc(C)c1C(C(CC(C1)C2CCOCC2)=O)C1=O Chemical compound Cc1cc(C#CC)cc(C)c1C(C(CC(C1)C2CCOCC2)=O)C1=O IQAXVPFYGPUPKH-UHFFFAOYSA-N 0.000 description 1
- BVYVRNGTUMGQKZ-UHFFFAOYSA-N Cc1cc(C#CC)ccc1C(C(C1CC2CC1)=O)C2=O Chemical compound Cc1cc(C#CC)ccc1C(C(C1CC2CC1)=O)C2=O BVYVRNGTUMGQKZ-UHFFFAOYSA-N 0.000 description 1
- CHNXHDWQVHEDBU-UHFFFAOYSA-N Cc1cc(C#CCl)cc(C)c1C(C(CCC1)=O)C1=O Chemical compound Cc1cc(C#CCl)cc(C)c1C(C(CCC1)=O)C1=O CHNXHDWQVHEDBU-UHFFFAOYSA-N 0.000 description 1
- OIXCHKNJDAZVTI-UHFFFAOYSA-N Cc1cc(C#CN)cc(C)c1C(C(C1CC2CC1)=O)C2=O Chemical compound Cc1cc(C#CN)cc(C)c1C(C(C1CC2CC1)=O)C2=O OIXCHKNJDAZVTI-UHFFFAOYSA-N 0.000 description 1
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1223429.0 | 2012-12-21 | ||
| GBGB1223429.0A GB201223429D0 (en) | 2012-12-21 | 2012-12-21 | Compounds |
| GB1309728.2 | 2013-05-31 | ||
| GB201309728A GB201309728D0 (en) | 2013-05-31 | 2013-05-31 | Compounds |
| GB201321553A GB201321553D0 (en) | 2013-12-04 | 2013-12-04 | Compounds |
| GB1321553.8 | 2013-12-04 | ||
| PCT/EP2013/077541 WO2014096289A2 (en) | 2012-12-21 | 2013-12-19 | Herbicidally active cyclic dione compounds, or derivatives thereof, substituted by a phenyl which has an alkynyl-containing substituent |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JP2016506403A JP2016506403A (ja) | 2016-03-03 |
| JP2016506403A5 true JP2016506403A5 (enExample) | 2017-02-02 |
| JP6339096B2 JP6339096B2 (ja) | 2018-06-06 |
Family
ID=49880785
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2015548610A Active JP6339096B2 (ja) | 2012-12-21 | 2013-12-19 | アルキニル含有置換基を有するフェニルで置換される、除草活性環状ジオン化合物、またはその誘導体 |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US9615577B2 (enExample) |
| EP (1) | EP2935230B1 (enExample) |
| JP (1) | JP6339096B2 (enExample) |
| KR (1) | KR102205973B1 (enExample) |
| CN (1) | CN104870430B (enExample) |
| AR (1) | AR094272A1 (enExample) |
| AU (1) | AU2013366561B2 (enExample) |
| BR (1) | BR112015014455B1 (enExample) |
| CA (1) | CA2892076C (enExample) |
| DK (1) | DK2935230T3 (enExample) |
| EA (1) | EA028826B1 (enExample) |
| ES (1) | ES2665568T3 (enExample) |
| HU (1) | HUE036815T2 (enExample) |
| MY (1) | MY175084A (enExample) |
| PL (1) | PL2935230T3 (enExample) |
| RS (1) | RS57084B1 (enExample) |
| UA (1) | UA115160C2 (enExample) |
| UY (1) | UY35229A (enExample) |
| WO (1) | WO2014096289A2 (enExample) |
| ZA (1) | ZA201504054B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2911092C (en) * | 2013-05-30 | 2021-08-03 | Syngenta Limited | Herbicidally active (alkynyl-phenyl)-substituted cyclic dione compounds and derivatives thereof |
| GB201411418D0 (en) * | 2014-06-26 | 2014-08-13 | Syngenta Participations Ag | Compounds |
| GB201802558D0 (en) * | 2018-02-16 | 2018-04-04 | Syngenta Participations Ag | Improvements in or relating to organic compounds |
| GB201803736D0 (en) * | 2018-03-08 | 2018-04-25 | Syngenta Participations Ag | Improvements in or relating to organic compounds |
| GB201804002D0 (en) * | 2018-03-13 | 2018-04-25 | Syngenta Participations Ag | Improvements in or relating to organic compounds |
| EP4509118A3 (en) * | 2018-09-19 | 2025-05-14 | ModernaTX, Inc. | High-purity peg lipids and uses thereof |
| GB201816459D0 (en) * | 2018-10-09 | 2018-11-28 | Syngenta Participations Ag | Improvements in or relating to organic compounds |
| GB201901878D0 (en) | 2019-02-11 | 2019-04-03 | Syngenta Crop Protection Ag | Improvements in or relating to organic compounds |
| GB201901961D0 (en) * | 2019-02-13 | 2019-04-03 | Syngenta Crop Protection Ag | Improvements in or relating to organic compounds |
| GB201902438D0 (en) * | 2019-02-22 | 2019-04-10 | Syngenta Crop Protection Ag | Improvements in or relating to organic compounds |
| GB201910040D0 (en) * | 2019-07-12 | 2019-08-28 | Syngenta Crop Protection Ag | Improvements in or relating to organic compounds |
| GB201910168D0 (en) * | 2019-07-16 | 2019-08-28 | Syngenta Crop Protection Ag | Improvements in or relating to organic compounds |
| GB201910166D0 (en) * | 2019-07-16 | 2019-08-28 | Syngenta Crop Protection Ag | Improvements in or relating to organic compounds |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4659372A (en) * | 1977-03-28 | 1987-04-21 | Union Carbide Corporation | Biocidal 2-aryl-1,3-cyclohexanedione enol ester compounds |
| US4678501A (en) * | 1981-07-30 | 1987-07-07 | Union Carbide Corporation | Certain pyrazinyl 1,3 cycloalkanedione derivatives having herbicidal activity |
| DE50008690D1 (de) * | 1999-09-07 | 2004-12-23 | Syngenta Participations Ag | p-Tolyl-Heterocyclen als Herbizide |
| DE10139465A1 (de) * | 2001-08-10 | 2003-02-20 | Bayer Cropscience Ag | Selektive Herbizide auf Basis von substituierten, cayclischen Ketoenolen und Safenern |
| DE102005059471A1 (de) | 2005-12-13 | 2007-07-12 | Bayer Cropscience Ag | Herbizide Zusammensetzungen mit verbesserter Wirkung |
| TWI417048B (zh) * | 2006-12-14 | 2013-12-01 | Syngenta Participations Ag | 新穎的除草劑 |
| GB0704653D0 (en) * | 2007-03-09 | 2007-04-18 | Syngenta Participations Ag | Novel herbicides |
| GB0704652D0 (en) * | 2007-03-09 | 2007-04-18 | Syngenta Participations Ag | Novel herbicides |
| GB0710223D0 (en) * | 2007-05-29 | 2007-07-11 | Syngenta Ltd | Novel Herbicides |
| KR20100100965A (ko) * | 2007-12-13 | 2010-09-15 | 신젠타 리미티드 | 제초제로서의 4-페닐피란-3,5-디온, 4-페닐티오피란-3,5-디온 및 2-페닐사이클로헥산-1,3,5-트리온 |
| GB0810728D0 (en) * | 2008-06-11 | 2008-07-16 | Syngenta Ltd | Novel herbicides |
| GB0810815D0 (en) * | 2008-06-12 | 2008-07-23 | Syngenta Ltd | Novel herbicides |
| GB0819205D0 (en) * | 2008-10-20 | 2008-11-26 | Syngenta Ltd | Novel herbicides |
| GB0900641D0 (en) * | 2009-01-15 | 2009-02-25 | Syngenta Ltd | Novel herbicides |
| WO2010081689A2 (en) * | 2009-01-19 | 2010-07-22 | Bayer Cropscience Ag | Cyclic diones and their use as insecticides, acaricides and/or fungicides |
| ES2466918T3 (es) * | 2009-01-19 | 2014-06-11 | Bayer Cropscience Ag | Uso de compuestos de 2-aril-5-heterociclil-ciclohexano-1,3-diona como insecticidas y/o acaricidas |
| GB0901086D0 (en) * | 2009-01-22 | 2009-03-11 | Syngenta Ltd | Novel herbicides |
| GB0901834D0 (en) * | 2009-02-04 | 2009-03-11 | Syngenta Ltd | Novel herbicides |
| GB0901835D0 (en) * | 2009-02-04 | 2009-03-11 | Syngenta Ltd | Novel herbicides |
| EA201200150A1 (ru) * | 2009-07-17 | 2012-08-30 | Зингента Лимитед | Новые гербициды |
| JP6093367B2 (ja) * | 2011-11-30 | 2017-03-08 | シンジェンタ リミテッド | ２−（置換フェニル）−シクロペンタン−１，３−ジオン化合物、およびその誘導体 |
| CA2911092C (en) * | 2013-05-30 | 2021-08-03 | Syngenta Limited | Herbicidally active (alkynyl-phenyl)-substituted cyclic dione compounds and derivatives thereof |
| GB201411418D0 (en) * | 2014-06-26 | 2014-08-13 | Syngenta Participations Ag | Compounds |
-
2013
- 2013-12-19 PL PL13811960T patent/PL2935230T3/pl unknown
- 2013-12-19 KR KR1020157018960A patent/KR102205973B1/ko active Active
- 2013-12-19 CN CN201380066331.9A patent/CN104870430B/zh active Active
- 2013-12-19 AU AU2013366561A patent/AU2013366561B2/en active Active
- 2013-12-19 WO PCT/EP2013/077541 patent/WO2014096289A2/en not_active Ceased
- 2013-12-19 JP JP2015548610A patent/JP6339096B2/ja active Active
- 2013-12-19 EA EA201500668A patent/EA028826B1/ru not_active IP Right Cessation
- 2013-12-19 RS RS20180430A patent/RS57084B1/sr unknown
- 2013-12-19 EP EP13811960.7A patent/EP2935230B1/en active Active
- 2013-12-19 UA UAA201507294A patent/UA115160C2/uk unknown
- 2013-12-19 CA CA2892076A patent/CA2892076C/en active Active
- 2013-12-19 MY MYPI2015001340A patent/MY175084A/en unknown
- 2013-12-19 BR BR112015014455-1A patent/BR112015014455B1/pt active IP Right Grant
- 2013-12-19 US US14/653,674 patent/US9615577B2/en active Active
- 2013-12-19 ES ES13811960.7T patent/ES2665568T3/es active Active
- 2013-12-19 DK DK13811960.7T patent/DK2935230T3/en active
- 2013-12-19 HU HUE13811960A patent/HUE036815T2/hu unknown
- 2013-12-20 AR ARP130105018A patent/AR094272A1/es active IP Right Grant
- 2013-12-20 UY UY0001035229A patent/UY35229A/es active IP Right Grant
-
2015
- 2015-06-05 ZA ZA2015/04054A patent/ZA201504054B/en unknown