JP2005529079A - 細胞増殖性疾患を処置する化合物および方法 - Google Patents
細胞増殖性疾患を処置する化合物および方法 Download PDFInfo
- Publication number
- JP2005529079A JP2005529079A JP2003572976A JP2003572976A JP2005529079A JP 2005529079 A JP2005529079 A JP 2005529079A JP 2003572976 A JP2003572976 A JP 2003572976A JP 2003572976 A JP2003572976 A JP 2003572976A JP 2005529079 A JP2005529079 A JP 2005529079A
- Authority
- JP
- Japan
- Prior art keywords
- pyran
- group
- pentyloxy
- tetrahydro
- indol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 301
- 238000000034 method Methods 0.000 title abstract description 55
- 230000002062 proliferating effect Effects 0.000 title description 3
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 45
- 201000011510 cancer Diseases 0.000 claims abstract description 30
- 238000011282 treatment Methods 0.000 claims abstract description 27
- 201000010099 disease Diseases 0.000 claims abstract description 13
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 13
- 230000002159 abnormal effect Effects 0.000 claims abstract description 10
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 9
- -1 polycyclic hydrocarbon Chemical class 0.000 claims description 141
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 94
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 57
- 239000000460 chlorine Substances 0.000 claims description 53
- 125000004432 carbon atom Chemical group C* 0.000 claims description 48
- 125000003118 aryl group Chemical group 0.000 claims description 47
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 42
- 125000000217 alkyl group Chemical group 0.000 claims description 39
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 28
- 125000005843 halogen group Chemical group 0.000 claims description 23
- 125000005647 linker group Chemical group 0.000 claims description 21
- 229910052799 carbon Inorganic materials 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 20
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims description 20
- 229910052717 sulfur Inorganic materials 0.000 claims description 20
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 19
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 18
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 17
- 229910052757 nitrogen Inorganic materials 0.000 claims description 17
- 229910052801 chlorine Inorganic materials 0.000 claims description 16
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 16
- 229910052760 oxygen Inorganic materials 0.000 claims description 16
- 125000003545 alkoxy group Chemical group 0.000 claims description 15
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 14
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 14
- 239000001301 oxygen Substances 0.000 claims description 14
- 125000003342 alkenyl group Chemical group 0.000 claims description 13
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 13
- 125000001424 substituent group Chemical group 0.000 claims description 13
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 12
- 125000002950 monocyclic group Chemical group 0.000 claims description 12
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 12
- 125000002256 xylenyl group Chemical group C1(C(C=CC=C1)C)(C)* 0.000 claims description 12
- 125000002252 acyl group Chemical group 0.000 claims description 11
- 125000000623 heterocyclic group Chemical group 0.000 claims description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 10
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 10
- 229910052794 bromium Inorganic materials 0.000 claims description 10
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 10
- 229910052731 fluorine Inorganic materials 0.000 claims description 10
- 125000005842 heteroatom Chemical group 0.000 claims description 10
- 125000003367 polycyclic group Chemical group 0.000 claims description 10
- 239000011593 sulfur Substances 0.000 claims description 10
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 9
- 150000001721 carbon Chemical group 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000004434 sulfur atom Chemical group 0.000 claims description 8
- KEWLTESZYVDDAA-UHFFFAOYSA-N 2-(hydroxymethyl)-5-(5-indol-1-ylpentoxy)pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCN2C3=CC=CC=C3C=C2)=C1 KEWLTESZYVDDAA-UHFFFAOYSA-N 0.000 claims description 7
- 230000004663 cell proliferation Effects 0.000 claims description 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims description 5
- 125000001072 heteroaryl group Chemical group 0.000 claims description 5
- 201000005202 lung cancer Diseases 0.000 claims description 5
- 208000020816 lung neoplasm Diseases 0.000 claims description 5
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 5
- 229930192474 thiophene Natural products 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- WNCCQRCJKQOTFB-UHFFFAOYSA-N 5-[5-(2,5-dimethylfuran-3-yl)sulfanylpentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O1C(C)=CC(SCCCCCOC=2C(C=C(COC3OCCCC3)OC=2)=O)=C1C WNCCQRCJKQOTFB-UHFFFAOYSA-N 0.000 claims description 4
- PNUQNJXUWVNTGK-UHFFFAOYSA-N 5-[5-(2-ethoxyphenoxy)pentoxy]-4-oxopyran-2-carboxylic acid Chemical compound CCOC1=CC=CC=C1OCCCCCOC1=COC(C(O)=O)=CC1=O PNUQNJXUWVNTGK-UHFFFAOYSA-N 0.000 claims description 4
- KVNLVXHNZGHFKY-RUDMXATFSA-N 5-[5-(3,4-dichloro-2-propylphenoxy)pentoxy]-4-oxo-6-[(e)-prop-1-enyl]pyran-2-carboxylic acid Chemical compound C1=CC(Cl)=C(Cl)C(CCC)=C1OCCCCCOC1=C(\C=C\C)OC(C(O)=O)=CC1=O KVNLVXHNZGHFKY-RUDMXATFSA-N 0.000 claims description 4
- FHWFEEJJISOSEQ-QHHAFSJGSA-N 5-[5-(3,4-dichlorophenoxy)pentoxy]-4-oxo-6-[(e)-prop-1-enyl]pyran-2-carboxylic acid Chemical compound O1C(C(O)=O)=CC(=O)C(OCCCCCOC=2C=C(Cl)C(Cl)=CC=2)=C1/C=C/C FHWFEEJJISOSEQ-QHHAFSJGSA-N 0.000 claims description 4
- 206010006187 Breast cancer Diseases 0.000 claims description 4
- 208000026310 Breast neoplasm Diseases 0.000 claims description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 4
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims description 4
- 125000001589 carboacyl group Chemical group 0.000 claims description 4
- 125000004475 heteroaralkyl group Chemical group 0.000 claims description 4
- 125000005223 heteroarylcarbonyl group Chemical group 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 230000003287 optical effect Effects 0.000 claims description 4
- 125000004950 trifluoroalkyl group Chemical group 0.000 claims description 4
- ATLXOZZZXNJWFG-UHFFFAOYSA-N 2-(hydroxymethyl)-5-(4-indol-1-ylbutoxy)pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCN2C3=CC=CC=C3C=C2)=C1 ATLXOZZZXNJWFG-UHFFFAOYSA-N 0.000 claims description 3
- WPFZBDPDUYZDJV-UHFFFAOYSA-N 2-(hydroxymethyl)-5-(5-phenoxypentoxy)pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCOC=2C=CC=CC=2)=C1 WPFZBDPDUYZDJV-UHFFFAOYSA-N 0.000 claims description 3
- MBKYUHQVYXHKDQ-UHFFFAOYSA-N 2-(hydroxymethyl)-5-(5-phenylsulfanylpentoxy)pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCSC=2C=CC=CC=2)=C1 MBKYUHQVYXHKDQ-UHFFFAOYSA-N 0.000 claims description 3
- HJYJUTABGCMNOO-UHFFFAOYSA-N 2-(hydroxymethyl)-5-[5-(3-methylindol-1-yl)pentoxy]pyran-4-one Chemical compound C12=CC=CC=C2C(C)=CN1CCCCCOC1=COC(CO)=CC1=O HJYJUTABGCMNOO-UHFFFAOYSA-N 0.000 claims description 3
- ILQZUNJJAMYYJI-UHFFFAOYSA-N 2-(oxan-2-yloxymethyl)-5-(5-phenoxypentoxy)pyran-4-one Chemical compound O1C=C(OCCCCCOC=2C=CC=CC=2)C(=O)C=C1COC1CCCCO1 ILQZUNJJAMYYJI-UHFFFAOYSA-N 0.000 claims description 3
- LJTYKQBHRZCGOY-UHFFFAOYSA-N 2-(oxan-2-yloxymethyl)-5-(5-phenylsulfanylpentoxy)pyran-4-one Chemical compound O1C=C(OCCCCCSC=2C=CC=CC=2)C(=O)C=C1COC1CCCCO1 LJTYKQBHRZCGOY-UHFFFAOYSA-N 0.000 claims description 3
- CDPKDRARXBWESO-UHFFFAOYSA-N 2-(oxan-2-yloxymethyl)-5-[5-(2-phenylindol-1-yl)pentoxy]pyran-4-one Chemical compound O1C=C(OCCCCCN2C3=CC=CC=C3C=C2C=2C=CC=CC=2)C(=O)C=C1COC1CCCCO1 CDPKDRARXBWESO-UHFFFAOYSA-N 0.000 claims description 3
- QGDINGHTQSXITG-UHFFFAOYSA-N 2-(oxan-2-yloxymethyl)-5-[5-[5-(trifluoromethyl)pyridin-2-yl]oxypentoxy]pyran-4-one Chemical compound N1=CC(C(F)(F)F)=CC=C1OCCCCCOC1=COC(COC2OCCCC2)=CC1=O QGDINGHTQSXITG-UHFFFAOYSA-N 0.000 claims description 3
- IKMWSXCDQPKFPO-QHHAFSJGSA-N 2-fluoro-4-[5-[6-(hydroxymethyl)-4-oxo-2-[(e)-prop-1-enyl]pyran-3-yl]oxypentoxy]benzonitrile Chemical compound O1C(CO)=CC(=O)C(OCCCCCOC=2C=C(F)C(C#N)=CC=2)=C1/C=C/C IKMWSXCDQPKFPO-QHHAFSJGSA-N 0.000 claims description 3
- GPANJJYVNMOHHK-RUDMXATFSA-N 3-[5-(3,5-dichloro-2-propylphenoxy)pentoxy]-6-(hydroxymethyl)-2-[(e)-prop-1-enyl]pyran-4-one Chemical compound CCCC1=C(Cl)C=C(Cl)C=C1OCCCCCOC1=C(\C=C\C)OC(CO)=CC1=O GPANJJYVNMOHHK-RUDMXATFSA-N 0.000 claims description 3
- HIUHFPFCMURAGO-QHHAFSJGSA-N 3-[5-[3,5-bis(trifluoromethyl)phenoxy]pentoxy]-6-(hydroxymethyl)-2-[(e)-prop-1-enyl]pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCOC=2C=C(C=C(C=2)C(F)(F)F)C(F)(F)F)=C1/C=C/C HIUHFPFCMURAGO-QHHAFSJGSA-N 0.000 claims description 3
- YFSKGEFABCZKIK-UHFFFAOYSA-N 5-(4-indol-1-ylbutoxy)-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O1C=C(OCCCCN2C3=CC=CC=C3C=C2)C(=O)C=C1COC1CCCCO1 YFSKGEFABCZKIK-UHFFFAOYSA-N 0.000 claims description 3
- NDYUXUXEQPEYGN-UHFFFAOYSA-N 5-(5-indol-1-ylhexoxy)-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C1=CC2=CC=CC=C2N1C(C)CCCCOC(C(C=1)=O)=COC=1COC1CCCCO1 NDYUXUXEQPEYGN-UHFFFAOYSA-N 0.000 claims description 3
- SYLFNJPOIVEHDD-UHFFFAOYSA-N 5-(5-indol-1-ylpentoxy)-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O1C=C(OCCCCCN2C3=CC=CC=C3C=C2)C(=O)C=C1COC1CCCCO1 SYLFNJPOIVEHDD-UHFFFAOYSA-N 0.000 claims description 3
- OYNMGWUGNAKGHF-UHFFFAOYSA-N 5-(8-indol-1-yloctoxy)-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O1C=C(OCCCCCCCCN2C3=CC=CC=C3C=C2)C(=O)C=C1COC1CCCCO1 OYNMGWUGNAKGHF-UHFFFAOYSA-N 0.000 claims description 3
- WGIQTQQKEMBPTO-GQCTYLIASA-N 5-[(e)-4-indol-1-ylbut-2-enoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O1C=C(OC\C=C\CN2C3=CC=CC=C3C=C2)C(=O)C=C1COC1CCCCO1 WGIQTQQKEMBPTO-GQCTYLIASA-N 0.000 claims description 3
- RIKGOTANDQESMU-UHFFFAOYSA-N 5-[5-(3,4-dimethoxyphenyl)sulfanylpentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C1=C(OC)C(OC)=CC=C1SCCCCCOC1=COC(COC2OCCCC2)=CC1=O RIKGOTANDQESMU-UHFFFAOYSA-N 0.000 claims description 3
- NDWCKEYPGBYTKJ-UHFFFAOYSA-N 5-[5-(3,5-dichloro-2-propylphenoxy)pentoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound CCCC1=C(Cl)C=C(Cl)C=C1OCCCCCOC1=COC(CO)=CC1=O NDWCKEYPGBYTKJ-UHFFFAOYSA-N 0.000 claims description 3
- BFKVXSRJPOEQJZ-UHFFFAOYSA-N 5-[5-(4-acetyl-3-amino-2-propylphenoxy)pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C1=CC(C(C)=O)=C(N)C(CCC)=C1OCCCCCOC1=COC(COC2OCCCC2)=CC1=O BFKVXSRJPOEQJZ-UHFFFAOYSA-N 0.000 claims description 3
- PNKQZFHDWHPQOP-UHFFFAOYSA-N 5-[5-(4-butoxy-3-nitroanilino)pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C1=C([N+]([O-])=O)C(OCCCC)=CC=C1NCCCCCOC1=COC(COC2OCCCC2)=CC1=O PNKQZFHDWHPQOP-UHFFFAOYSA-N 0.000 claims description 3
- APKHALVMMXPMRQ-UHFFFAOYSA-N 5-[5-(4-chloro-2-propylphenoxy)pentoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound CCCC1=CC(Cl)=CC=C1OCCCCCOC1=COC(CO)=CC1=O APKHALVMMXPMRQ-UHFFFAOYSA-N 0.000 claims description 3
- NDZZLYXULDVFDC-UHFFFAOYSA-N 5-[5-(5-chloroindol-1-yl)pentoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCN2C3=CC=C(Cl)C=C3C=C2)=C1 NDZZLYXULDVFDC-UHFFFAOYSA-N 0.000 claims description 3
- OEASCNGWBAFSQD-UHFFFAOYSA-N 5-[5-(5-chloropyridin-2-yl)oxypentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound N1=CC(Cl)=CC=C1OCCCCCOC1=COC(COC2OCCCC2)=CC1=O OEASCNGWBAFSQD-UHFFFAOYSA-N 0.000 claims description 3
- XREFZLVDXYXGKJ-UHFFFAOYSA-N 5-[5-(6-chloropurin-9-yl)pentoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCN2C3=NC=NC(Cl)=C3N=C2)=C1 XREFZLVDXYXGKJ-UHFFFAOYSA-N 0.000 claims description 3
- OHVDITUMTAJDTJ-UHFFFAOYSA-N 5-[5-[4-acetyl-3-(ethylamino)-2-propylphenoxy]pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C1=CC(C(C)=O)=C(NCC)C(CCC)=C1OCCCCCOC1=COC(COC2OCCCC2)=CC1=O OHVDITUMTAJDTJ-UHFFFAOYSA-N 0.000 claims description 3
- GNSYSPLOVFDSMT-UHFFFAOYSA-N 5-[5-[6-acetyl-3-(ethylamino)-2-propylphenoxy]pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound CCCC1=C(NCC)C=CC(C(C)=O)=C1OCCCCCOC1=COC(COC2OCCCC2)=CC1=O GNSYSPLOVFDSMT-UHFFFAOYSA-N 0.000 claims description 3
- XLCKPNFYQWENSO-UHFFFAOYSA-N 5-[[2-(indol-1-ylmethyl)phenyl]methoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O1C=C(OCC=2C(=CC=CC=2)CN2C3=CC=CC=C3C=C2)C(=O)C=C1COC1CCCCO1 XLCKPNFYQWENSO-UHFFFAOYSA-N 0.000 claims description 3
- BKVZUOIUESNDED-KRXBUXKQSA-N 6-(hydroxymethyl)-3-(5-indol-1-ylpentoxy)-2-[(e)-prop-1-enyl]pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCN2C3=CC=CC=C3C=C2)=C1/C=C/C BKVZUOIUESNDED-KRXBUXKQSA-N 0.000 claims description 3
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 claims description 3
- 206010060862 Prostate cancer Diseases 0.000 claims description 3
- 208000000236 Prostatic Neoplasms Diseases 0.000 claims description 3
- CSUPWSHZNGPDOD-UHFFFAOYSA-N [5-(5-indol-1-ylpentoxy)-4-oxopyran-2-yl]methyl 2-phenylacetate Chemical compound C=1C(=O)C(OCCCCCN2C3=CC=CC=C3C=C2)=COC=1COC(=O)CC1=CC=CC=C1 CSUPWSHZNGPDOD-UHFFFAOYSA-N 0.000 claims description 3
- GPMGCSJJUBLSPP-UHFFFAOYSA-N [5-(5-indol-1-ylpentoxy)-4-oxopyran-2-yl]methyl 4-chlorobenzoate Chemical compound C1=CC(Cl)=CC=C1C(=O)OCC1=CC(=O)C(OCCCCCN2C3=CC=CC=C3C=C2)=CO1 GPMGCSJJUBLSPP-UHFFFAOYSA-N 0.000 claims description 3
- JWONPPLDIILJEY-UHFFFAOYSA-N [5-(5-indol-1-ylpentoxy)-4-oxopyran-2-yl]methyl benzoate Chemical compound C=1C(=O)C(OCCCCCN2C3=CC=CC=C3C=C2)=COC=1COC(=O)C1=CC=CC=C1 JWONPPLDIILJEY-UHFFFAOYSA-N 0.000 claims description 3
- MCMVLKKUHMERDX-UHFFFAOYSA-N [5-(5-indol-1-ylpentoxy)-4-oxopyran-2-yl]methyl butanoate Chemical compound O1C(COC(=O)CCC)=CC(=O)C(OCCCCCN2C3=CC=CC=C3C=C2)=C1 MCMVLKKUHMERDX-UHFFFAOYSA-N 0.000 claims description 3
- MWQQEJAJJXATII-UHFFFAOYSA-N [5-(5-indol-1-ylpentoxy)-4-oxopyran-2-yl]methyl cyclohexanecarboxylate Chemical compound C=1C(=O)C(OCCCCCN2C3=CC=CC=C3C=C2)=COC=1COC(=O)C1CCCCC1 MWQQEJAJJXATII-UHFFFAOYSA-N 0.000 claims description 3
- QOVFYFKZMLYVDC-UHFFFAOYSA-N [5-(5-indol-1-ylpentoxy)-4-oxopyran-2-yl]methyl furan-3-carboxylate Chemical compound C=1C(=O)C(OCCCCCN2C3=CC=CC=C3C=C2)=COC=1COC(=O)C=1C=COC=1 QOVFYFKZMLYVDC-UHFFFAOYSA-N 0.000 claims description 3
- NSLCJUZWEYQPMR-UHFFFAOYSA-N [5-(5-indol-1-ylpentoxy)-4-oxopyran-2-yl]methyl n-(4-chlorophenyl)carbamate Chemical compound C1=CC(Cl)=CC=C1NC(=O)OCC1=CC(=O)C(OCCCCCN2C3=CC=CC=C3C=C2)=CO1 NSLCJUZWEYQPMR-UHFFFAOYSA-N 0.000 claims description 3
- ICRUQQLGUHSQHP-UHFFFAOYSA-N [5-(5-indol-1-ylpentoxy)-4-oxopyran-2-yl]methyl n-(4-nitrophenyl)carbamate Chemical compound C1=CC([N+](=O)[O-])=CC=C1NC(=O)OCC1=CC(=O)C(OCCCCCN2C3=CC=CC=C3C=C2)=CO1 ICRUQQLGUHSQHP-UHFFFAOYSA-N 0.000 claims description 3
- HGWNLSFHGVOKLU-UHFFFAOYSA-N [5-(5-indol-1-ylpentoxy)-4-oxopyran-2-yl]methyl n-cyclohexylcarbamate Chemical compound C=1C(=O)C(OCCCCCN2C3=CC=CC=C3C=C2)=COC=1COC(=O)NC1CCCCC1 HGWNLSFHGVOKLU-UHFFFAOYSA-N 0.000 claims description 3
- IKYCCVMWIGMMNE-UHFFFAOYSA-N [5-(5-indol-1-ylpentoxy)-4-oxopyran-2-yl]methyl n-ethylcarbamate Chemical compound O1C(COC(=O)NCC)=CC(=O)C(OCCCCCN2C3=CC=CC=C3C=C2)=C1 IKYCCVMWIGMMNE-UHFFFAOYSA-N 0.000 claims description 3
- DICYANPOGCKGFJ-UHFFFAOYSA-N [5-(5-indol-1-ylpentoxy)-4-oxopyran-2-yl]methyl n-phenylcarbamate Chemical compound C=1C(=O)C(OCCCCCN2C3=CC=CC=C3C=C2)=COC=1COC(=O)NC1=CC=CC=C1 DICYANPOGCKGFJ-UHFFFAOYSA-N 0.000 claims description 3
- 208000029742 colonic neoplasm Diseases 0.000 claims description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- SURCEZAAXDSVEQ-UHFFFAOYSA-N ethyl 3-(cyclopropylmethoxy)-4-[5-[6-(oxan-2-yloxymethyl)-4-oxopyran-3-yl]oxypentoxy]benzoate Chemical compound C1CC1COC1=CC(C(=O)OCC)=CC=C1OCCCCCOC(C(C=1)=O)=COC=1COC1CCCCO1 SURCEZAAXDSVEQ-UHFFFAOYSA-N 0.000 claims description 3
- 201000001441 melanoma Diseases 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000000027 (C1-C10) alkoxy group Chemical group 0.000 claims description 2
- KJRQDRYVUJQRGG-QHHAFSJGSA-N 3-[5-(3,4-difluorophenoxy)pentoxy]-6-(hydroxymethyl)-2-[(e)-prop-1-enyl]pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCOC=2C=C(F)C(F)=CC=2)=C1/C=C/C KJRQDRYVUJQRGG-QHHAFSJGSA-N 0.000 claims description 2
- GTXSNLBWIGYTKH-UHFFFAOYSA-N 5-[5-(2,3-dihydroindol-1-yl)pentoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCN2C3=CC=CC=C3CC2)=C1 GTXSNLBWIGYTKH-UHFFFAOYSA-N 0.000 claims description 2
- 206010005003 Bladder cancer Diseases 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- VJGPREURDVTXFX-UHFFFAOYSA-N ClC=1C(=C(C=CC1Cl)OCCCCCOC=1C(C=C(OC1)C(=O)O)=O)CCC.ClC=1C=C(C=CC1Cl)OCCCCOC=1C(C=C(OC1)C(=O)O)=O Chemical compound ClC=1C(=C(C=CC1Cl)OCCCCCOC=1C(C=C(OC1)C(=O)O)=O)CCC.ClC=1C=C(C=CC1Cl)OCCCCOC=1C(C=C(OC1)C(=O)O)=O VJGPREURDVTXFX-UHFFFAOYSA-N 0.000 claims description 2
- JOVVDERQOLBITN-UHFFFAOYSA-N ClC=1C=C(C=CC1Cl)OCCCCCOC=1C(C=C(OC1)C(=O)O)=O.ClC=1C=C(C=CC1)OCCCCCOC=1C(C=C(OC1)C(=O)O)=O Chemical compound ClC=1C=C(C=CC1Cl)OCCCCCOC=1C(C=C(OC1)C(=O)O)=O.ClC=1C=C(C=CC1)OCCCCCOC=1C(C=C(OC1)C(=O)O)=O JOVVDERQOLBITN-UHFFFAOYSA-N 0.000 claims description 2
- 206010009944 Colon cancer Diseases 0.000 claims description 2
- 206010033128 Ovarian cancer Diseases 0.000 claims description 2
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 2
- 206010061902 Pancreatic neoplasm Diseases 0.000 claims description 2
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
- 150000002240 furans Chemical class 0.000 claims description 2
- 201000010536 head and neck cancer Diseases 0.000 claims description 2
- 208000014829 head and neck neoplasm Diseases 0.000 claims description 2
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 claims description 2
- 150000004677 hydrates Chemical class 0.000 claims description 2
- 201000007270 liver cancer Diseases 0.000 claims description 2
- 208000014018 liver neoplasm Diseases 0.000 claims description 2
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 claims description 2
- VEGYRKYWPNSEKH-UHFFFAOYSA-N methyl 4-bromo-3-[5-[6-(oxan-2-yloxymethyl)-4-oxopyran-3-yl]oxypentoxy]thiophene-2-carboxylate Chemical compound S1C=C(Br)C(OCCCCCOC=2C(C=C(COC3OCCCC3)OC=2)=O)=C1C(=O)OC VEGYRKYWPNSEKH-UHFFFAOYSA-N 0.000 claims description 2
- KZJIQVVWVWCCQE-UHFFFAOYSA-N n-[3-[5-[6-(oxan-2-yloxymethyl)-4-oxopyran-3-yl]oxypentoxy]-4-propylphenyl]acetamide Chemical compound CCCC1=CC=C(NC(C)=O)C=C1OCCCCCOC1=COC(COC2OCCCC2)=CC1=O KZJIQVVWVWCCQE-UHFFFAOYSA-N 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 201000002528 pancreatic cancer Diseases 0.000 claims description 2
- 208000008443 pancreatic carcinoma Diseases 0.000 claims description 2
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 claims description 2
- 150000003222 pyridines Chemical class 0.000 claims description 2
- 208000037803 restenosis Diseases 0.000 claims description 2
- 150000003577 thiophenes Chemical class 0.000 claims description 2
- 201000005112 urinary bladder cancer Diseases 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 2
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- 229930195733 hydrocarbon Natural products 0.000 claims 1
- 230000010261 cell growth Effects 0.000 abstract description 7
- 230000001028 anti-proliverative effect Effects 0.000 abstract description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 98
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 85
- 210000004027 cell Anatomy 0.000 description 70
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 66
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 48
- 239000011541 reaction mixture Substances 0.000 description 47
- 239000003921 oil Substances 0.000 description 42
- 235000019198 oils Nutrition 0.000 description 42
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 38
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 36
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- 239000000377 silicon dioxide Substances 0.000 description 33
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 32
- 239000000243 solution Substances 0.000 description 31
- 238000004440 column chromatography Methods 0.000 description 30
- 238000004587 chromatography analysis Methods 0.000 description 29
- 230000000694 effects Effects 0.000 description 27
- 239000003480 eluent Substances 0.000 description 27
- 238000000746 purification Methods 0.000 description 25
- 239000007787 solid Substances 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 23
- 239000002253 acid Substances 0.000 description 22
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 230000015572 biosynthetic process Effects 0.000 description 21
- 235000019439 ethyl acetate Nutrition 0.000 description 21
- 239000002609 medium Substances 0.000 description 21
- 239000002904 solvent Substances 0.000 description 21
- 238000003786 synthesis reaction Methods 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- 238000001704 evaporation Methods 0.000 description 19
- 230000008020 evaporation Effects 0.000 description 19
- 239000012044 organic layer Substances 0.000 description 19
- 210000004881 tumor cell Anatomy 0.000 description 19
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 18
- 229910000104 sodium hydride Inorganic materials 0.000 description 18
- 239000012298 atmosphere Substances 0.000 description 17
- 239000012267 brine Substances 0.000 description 17
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 239000000725 suspension Substances 0.000 description 16
- 235000002639 sodium chloride Nutrition 0.000 description 15
- 229920001817 Agar Polymers 0.000 description 14
- 239000008272 agar Substances 0.000 description 14
- 235000010419 agar Nutrition 0.000 description 14
- WNRZHQBJSXRYJK-UHFFFAOYSA-N carboxyamidotriazole Chemical compound NC1=C(C(=O)N)N=NN1CC(C=C1Cl)=CC(Cl)=C1C(=O)C1=CC=C(Cl)C=C1 WNRZHQBJSXRYJK-UHFFFAOYSA-N 0.000 description 14
- 229910004298 SiO 2 Inorganic materials 0.000 description 13
- RAXXDUFDJJNHTI-UHFFFAOYSA-N 5-hydroxy-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O=C1C(O)=COC(COC2OCCCC2)=C1 RAXXDUFDJJNHTI-UHFFFAOYSA-N 0.000 description 12
- 238000007429 general method Methods 0.000 description 12
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 12
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 12
- 235000009518 sodium iodide Nutrition 0.000 description 12
- 238000003556 assay Methods 0.000 description 11
- 239000000543 intermediate Substances 0.000 description 11
- 229910000027 potassium carbonate Inorganic materials 0.000 description 11
- WDCVFEWCPUVNAG-UHFFFAOYSA-N 5-(5-bromopentoxy)-2-(hydroxymethyl)pyran-4-one Chemical compound OCC1=CC(=O)C(OCCCCCBr)=CO1 WDCVFEWCPUVNAG-UHFFFAOYSA-N 0.000 description 10
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 230000012010 growth Effects 0.000 description 10
- BEJNERDRQOWKJM-UHFFFAOYSA-N kojic acid Chemical compound OCC1=CC(=O)C(O)=CO1 BEJNERDRQOWKJM-UHFFFAOYSA-N 0.000 description 10
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000002474 experimental method Methods 0.000 description 9
- 239000012091 fetal bovine serum Substances 0.000 description 9
- 150000002430 hydrocarbons Chemical group 0.000 description 9
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical compound BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 8
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 8
- 102000034348 GTPases Human genes 0.000 description 8
- 108091006109 GTPases Proteins 0.000 description 8
- 239000012043 crude product Substances 0.000 description 8
- 239000006185 dispersion Substances 0.000 description 8
- 231100000673 dose–response relationship Toxicity 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 230000000259 anti-tumor effect Effects 0.000 description 7
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 7
- 229960004705 kojic acid Drugs 0.000 description 7
- WZNJWVWKTVETCG-UHFFFAOYSA-N kojic acid Natural products OC(=O)C(N)CN1C=CC(=O)C(O)=C1 WZNJWVWKTVETCG-UHFFFAOYSA-N 0.000 description 7
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- BWPIYSDFLPTJPU-UHFFFAOYSA-N 1-(5-bromopentyl)indole Chemical compound C1=CC=C2N(CCCCCBr)C=CC2=C1 BWPIYSDFLPTJPU-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 102000007469 Actins Human genes 0.000 description 6
- 108010085238 Actins Proteins 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 230000003833 cell viability Effects 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000000499 gel Substances 0.000 description 6
- 125000001041 indolyl group Chemical group 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 230000005012 migration Effects 0.000 description 6
- 235000018102 proteins Nutrition 0.000 description 6
- 108090000623 proteins and genes Proteins 0.000 description 6
- 102000004169 proteins and genes Human genes 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 5
- 231100000002 MTT assay Toxicity 0.000 description 5
- 238000000134 MTT assay Methods 0.000 description 5
- 230000029936 alkylation Effects 0.000 description 5
- 238000005804 alkylation reaction Methods 0.000 description 5
- 239000000824 cytostatic agent Substances 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 238000000338 in vitro Methods 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- 238000002347 injection Methods 0.000 description 5
- 239000007924 injection Substances 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 108010082117 matrigel Proteins 0.000 description 5
- 238000013508 migration Methods 0.000 description 5
- 238000010232 migration assay Methods 0.000 description 5
- 239000004533 oil dispersion Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 5
- FFLXNBKXBLRZOL-UHFFFAOYSA-N 1-(5-bromopentoxy)-3,5-bis(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC(OCCCCCBr)=CC(C(F)(F)F)=C1 FFLXNBKXBLRZOL-UHFFFAOYSA-N 0.000 description 4
- KZBVVROROFKLFD-RUDMXATFSA-N 3-[5-(3,4-dichloro-2-propylphenoxy)pentoxy]-6-(hydroxymethyl)-2-[(e)-prop-1-enyl]pyran-4-one Chemical compound CCCC1=C(Cl)C(Cl)=CC=C1OCCCCCOC1=C(\C=C\C)OC(CO)=CC1=O KZBVVROROFKLFD-RUDMXATFSA-N 0.000 description 4
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
- 108010010803 Gelatin Proteins 0.000 description 4
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 4
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 239000013543 active substance Substances 0.000 description 4
- 210000000481 breast Anatomy 0.000 description 4
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 4
- 229910000024 caesium carbonate Inorganic materials 0.000 description 4
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 4
- 238000001516 cell proliferation assay Methods 0.000 description 4
- 230000005754 cellular signaling Effects 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 239000010779 crude oil Substances 0.000 description 4
- 230000001085 cytostatic effect Effects 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000008273 gelatin Substances 0.000 description 4
- 229920000159 gelatin Polymers 0.000 description 4
- 229940014259 gelatin Drugs 0.000 description 4
- 235000019322 gelatine Nutrition 0.000 description 4
- 235000011852 gelatine desserts Nutrition 0.000 description 4
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 230000009545 invasion Effects 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 230000008707 rearrangement Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 4
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical class SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- 0 *CC(OC=C1OCC[n]2c3ccccc3cc2)=CC1=O Chemical compound *CC(OC=C1OCC[n]2c3ccccc3cc2)=CC1=O 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- LLQLTXXWIKRBNE-UHFFFAOYSA-N 1-(2-chloroethyl)indole Chemical compound C1=CC=C2N(CCCl)C=CC2=C1 LLQLTXXWIKRBNE-UHFFFAOYSA-N 0.000 description 3
- NEJQSVVTNBJXKD-UHFFFAOYSA-N 1-[[3-(bromomethyl)phenyl]methyl]indole Chemical compound BrCC1=CC=CC(CN2C3=CC=CC=C3C=C2)=C1 NEJQSVVTNBJXKD-UHFFFAOYSA-N 0.000 description 3
- LCHYEKKJCUJAKN-UHFFFAOYSA-N 2-propylphenol Chemical compound CCCC1=CC=CC=C1O LCHYEKKJCUJAKN-UHFFFAOYSA-N 0.000 description 3
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical class O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 description 3
- BXLCWQHAWVIRIL-UHFFFAOYSA-N 3,5-dichloro-2-propylphenol Chemical compound CCCC1=C(O)C=C(Cl)C=C1Cl BXLCWQHAWVIRIL-UHFFFAOYSA-N 0.000 description 3
- IUNBOWVXYCGSHD-UHFFFAOYSA-N 3-(5-bromopentoxy)-6-(hydroxymethyl)-2-prop-1-enylpyran-4-one Chemical compound CC=CC=1OC(CO)=CC(=O)C=1OCCCCCBr IUNBOWVXYCGSHD-UHFFFAOYSA-N 0.000 description 3
- RHFBEUKODPFGCG-UHFFFAOYSA-N 4-(5-bromopentoxy)-1,2-difluorobenzene Chemical compound FC1=CC=C(OCCCCCBr)C=C1F RHFBEUKODPFGCG-UHFFFAOYSA-N 0.000 description 3
- WJYAMFCPJJZHLV-UHFFFAOYSA-N 4-(5-bromopentoxy)-2-fluorobenzonitrile Chemical compound FC1=CC(OCCCCCBr)=CC=C1C#N WJYAMFCPJJZHLV-UHFFFAOYSA-N 0.000 description 3
- NQZKLVHWFYHXGH-UHFFFAOYSA-N 4-chloro-2-prop-2-enylphenol Chemical compound OC1=CC=C(Cl)C=C1CC=C NQZKLVHWFYHXGH-UHFFFAOYSA-N 0.000 description 3
- GLXDMSOEJKXENG-UHFFFAOYSA-N 4-chloro-2-propylphenol Chemical compound CCCC1=CC(Cl)=CC=C1O GLXDMSOEJKXENG-UHFFFAOYSA-N 0.000 description 3
- AQKLGILTWAYNAY-UHFFFAOYSA-N 5-(5-bromopentoxy)-2-(2-tert-butylsilyloxypropan-2-yl)pyran-4-one Chemical compound BrCCCCCOC=1C(C=C(OC1)C(O[SiH2]C(C)(C)C)(C)C)=O AQKLGILTWAYNAY-UHFFFAOYSA-N 0.000 description 3
- DJFYTZFALRGCIU-UHFFFAOYSA-N 5-(5-bromopentoxy)-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O=C1C(OCCCCCBr)=COC(COC2OCCCC2)=C1 DJFYTZFALRGCIU-UHFFFAOYSA-N 0.000 description 3
- QSEPVXCFDIFAGU-UHFFFAOYSA-N 5-[[4-(bromomethyl)phenyl]methoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C1=CC(CBr)=CC=C1COC1=COC(COC2OCCCC2)=CC1=O QSEPVXCFDIFAGU-UHFFFAOYSA-N 0.000 description 3
- MYTGFBZJLDLWQG-UHFFFAOYSA-N 5-chloro-1h-indole Chemical compound ClC1=CC=C2NC=CC2=C1 MYTGFBZJLDLWQG-UHFFFAOYSA-N 0.000 description 3
- 102100026802 72 kDa type IV collagenase Human genes 0.000 description 3
- 101710151806 72 kDa type IV collagenase Proteins 0.000 description 3
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 102100030412 Matrix metalloproteinase-9 Human genes 0.000 description 3
- 108010015302 Matrix metalloproteinase-9 Proteins 0.000 description 3
- 238000010934 O-alkylation reaction Methods 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 102100027609 Rho-related GTP-binding protein RhoD Human genes 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 238000004113 cell culture Methods 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 229940125904 compound 1 Drugs 0.000 description 3
- 230000034994 death Effects 0.000 description 3
- 231100000517 death Toxicity 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 230000003247 decreasing effect Effects 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000012636 effector Substances 0.000 description 3
- 210000002950 fibroblast Anatomy 0.000 description 3
- MHMNJMPURVTYEJ-UHFFFAOYSA-N fluorescein-5-isothiocyanate Chemical compound O1C(=O)C2=CC(N=C=S)=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 MHMNJMPURVTYEJ-UHFFFAOYSA-N 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000011534 incubation Methods 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 208000037819 metastatic cancer Diseases 0.000 description 3
- 208000011575 metastatic malignant neoplasm Diseases 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 210000004882 non-tumor cell Anatomy 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 239000002953 phosphate buffered saline Substances 0.000 description 3
- 230000003389 potentiating effect Effects 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000002265 prevention Effects 0.000 description 3
- 230000035755 proliferation Effects 0.000 description 3
- 239000012679 serum free medium Substances 0.000 description 3
- 238000010186 staining Methods 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 3
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- MVXVYAKCVDQRLW-UHFFFAOYSA-N 1h-pyrrolo[2,3-b]pyridine Chemical compound C1=CN=C2NC=CC2=C1 MVXVYAKCVDQRLW-UHFFFAOYSA-N 0.000 description 2
- QIRNGVVZBINFMX-UHFFFAOYSA-N 2-allylphenol Chemical compound OC1=CC=CC=C1CC=C QIRNGVVZBINFMX-UHFFFAOYSA-N 0.000 description 2
- BHNHHSOHWZKFOX-UHFFFAOYSA-N 2-methyl-1H-indole Chemical compound C1=CC=C2NC(C)=CC2=C1 BHNHHSOHWZKFOX-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 2
- OHSOALLQPJBDGF-FARCUNLSSA-N 3-[5-(3-chlorophenoxy)pentoxy]-6-(hydroxymethyl)-2-[(e)-prop-1-enyl]pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCOC=2C=C(Cl)C=CC=2)=C1/C=C/C OHSOALLQPJBDGF-FARCUNLSSA-N 0.000 description 2
- GRKWNJIIVRKPJG-QHHAFSJGSA-N 3-[5-(4-chlorophenoxy)pentoxy]-6-(hydroxymethyl)-2-[(e)-prop-1-enyl]pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCOC=2C=CC(Cl)=CC=2)=C1/C=C/C GRKWNJIIVRKPJG-QHHAFSJGSA-N 0.000 description 2
- IHCCAYCGZOLTEU-UHFFFAOYSA-N 3-furoic acid Chemical compound OC(=O)C=1C=COC=1 IHCCAYCGZOLTEU-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical group OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 2
- CDNKLGWYOBTRKP-NYYWCZLTSA-N 4-oxo-6-[(e)-prop-1-enyl]-5-[5-(2-propylphenoxy)pentoxy]pyran-2-carboxylic acid Chemical compound CCCC1=CC=CC=C1OCCCCCOC1=C(\C=C\C)OC(C(O)=O)=CC1=O CDNKLGWYOBTRKP-NYYWCZLTSA-N 0.000 description 2
- RWBPXPKVPXLDKW-UHFFFAOYSA-N 5-[5-(2-ethoxyphenoxy)pentoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound CCOC1=CC=CC=C1OCCCCCOC1=COC(CO)=CC1=O RWBPXPKVPXLDKW-UHFFFAOYSA-N 0.000 description 2
- BNQAOPXCIHHTRY-UHFFFAOYSA-N 5-[5-(3,4-dichlorophenoxy)pentoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCOC=2C=C(Cl)C(Cl)=CC=2)=C1 BNQAOPXCIHHTRY-UHFFFAOYSA-N 0.000 description 2
- JJVWYDHXODAVIS-UHFFFAOYSA-N 5-[5-(3,4-dichlorophenoxy)pentoxy]-2-(phenylmethoxymethyl)pyran-4-one Chemical compound C1=C(Cl)C(Cl)=CC=C1OCCCCCOC1=COC(COCC=2C=CC=CC=2)=CC1=O JJVWYDHXODAVIS-UHFFFAOYSA-N 0.000 description 2
- RAJXDOBEOWWBGQ-FARCUNLSSA-N 5-[5-(3-chlorophenoxy)pentoxy]-4-oxo-6-[(e)-prop-1-enyl]pyran-2-carboxylic acid Chemical compound O1C(C(O)=O)=CC(=O)C(OCCCCCOC=2C=C(Cl)C=CC=2)=C1/C=C/C RAJXDOBEOWWBGQ-FARCUNLSSA-N 0.000 description 2
- AZHASNAIYSNOAV-QHHAFSJGSA-N 5-[5-(4-chlorophenoxy)pentoxy]-4-oxo-6-[(e)-prop-1-enyl]pyran-2-carboxylic acid Chemical compound O1C(C(O)=O)=CC(=O)C(OCCCCCOC=2C=CC(Cl)=CC=2)=C1/C=C/C AZHASNAIYSNOAV-QHHAFSJGSA-N 0.000 description 2
- AYCGRBJSMSDFIT-UHFFFAOYSA-N 5-[[2-(bromomethyl)phenyl]methoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound BrCC1=CC=CC=C1COC1=COC(COC2OCCCC2)=CC1=O AYCGRBJSMSDFIT-UHFFFAOYSA-N 0.000 description 2
- ZNXHYWMATUGUMF-NYYWCZLTSA-N 6-(hydroxymethyl)-2-[(e)-prop-1-enyl]-3-[5-(2-propylphenoxy)pentoxy]pyran-4-one Chemical compound CCCC1=CC=CC=C1OCCCCCOC1=C(\C=C\C)OC(CO)=CC1=O ZNXHYWMATUGUMF-NYYWCZLTSA-N 0.000 description 2
- ZKBQDFAWXLTYKS-UHFFFAOYSA-N 6-Chloro-1H-purine Chemical compound ClC1=NC=NC2=C1NC=N2 ZKBQDFAWXLTYKS-UHFFFAOYSA-N 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 239000004475 Arginine Substances 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- OHPJLIQMIZGBKM-UHFFFAOYSA-N C(C)(C)(C)[SiH2]OC(C=1OC=C(C(C1)=O)OCCCCCN1C=CC2=CC(=CC=C12)Cl)(C)C Chemical compound C(C)(C)(C)[SiH2]OC(C=1OC=C(C(C1)=O)OCCCCCN1C=CC2=CC(=CC=C12)Cl)(C)C OHPJLIQMIZGBKM-UHFFFAOYSA-N 0.000 description 2
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 108091006027 G proteins Proteins 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 102000016805 Guanine Nucleotide Dissociation Inhibitors Human genes 0.000 description 2
- 108010092964 Guanine Nucleotide Dissociation Inhibitors Proteins 0.000 description 2
- 102000016285 Guanine Nucleotide Exchange Factors Human genes 0.000 description 2
- 108010067218 Guanine Nucleotide Exchange Factors Proteins 0.000 description 2
- 239000012981 Hank's balanced salt solution Substances 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000003810 Jones reagent Substances 0.000 description 2
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 2
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 2
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 2
- 239000004472 Lysine Substances 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 102000005741 Metalloproteases Human genes 0.000 description 2
- 108010006035 Metalloproteases Proteins 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 2
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- 235000021314 Palmitic acid Nutrition 0.000 description 2
- KPKZJLCSROULON-QKGLWVMZSA-N Phalloidin Chemical compound N1C(=O)[C@@H]([C@@H](O)C)NC(=O)[C@H](C)NC(=O)[C@H](C[C@@](C)(O)CO)NC(=O)[C@H](C2)NC(=O)[C@H](C)NC(=O)[C@@H]3C[C@H](O)CN3C(=O)[C@@H]1CSC1=C2C2=CC=CC=C2N1 KPKZJLCSROULON-QKGLWVMZSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- VOLMSPGWNYJHQQ-UHFFFAOYSA-N Pyranone Natural products CC1=C(O)C(=O)C(O)CO1 VOLMSPGWNYJHQQ-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- GLNADSQYFUSGOU-GPTZEZBUSA-J Trypan blue Chemical compound [Na+].[Na+].[Na+].[Na+].C1=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(/N=N/C3=CC=C(C=C3C)C=3C=C(C(=CC=3)\N=N\C=3C(=CC4=CC(=CC(N)=C4C=3O)S([O-])(=O)=O)S([O-])(=O)=O)C)=C(O)C2=C1N GLNADSQYFUSGOU-GPTZEZBUSA-J 0.000 description 2
- 238000002835 absorbance Methods 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 230000001464 adherent effect Effects 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 150000001347 alkyl bromides Chemical class 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 2
- 239000012300 argon atmosphere Substances 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- 229960005070 ascorbic acid Drugs 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000008238 biochemical pathway Effects 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000012292 cell migration Effects 0.000 description 2
- 230000010307 cell transformation Effects 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000002975 chemoattractant Substances 0.000 description 2
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 2
- 229960001231 choline Drugs 0.000 description 2
- WDECIBYCCFPHNR-UHFFFAOYSA-N chrysene Chemical compound C1=CC=CC2=CC=C3C4=CC=CC=C4C=CC3=C21 WDECIBYCCFPHNR-UHFFFAOYSA-N 0.000 description 2
- 235000015165 citric acid Nutrition 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- OQQXGCLLMDQESN-UHFFFAOYSA-N cyclohexylcarbamic acid Chemical compound OC(=O)NC1CCCCC1 OQQXGCLLMDQESN-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 230000003436 cytoskeletal effect Effects 0.000 description 2
- 210000004292 cytoskeleton Anatomy 0.000 description 2
- 230000001472 cytotoxic effect Effects 0.000 description 2
- 231100000135 cytotoxicity Toxicity 0.000 description 2
- 230000003013 cytotoxicity Effects 0.000 description 2
- 231100000263 cytotoxicity test Toxicity 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 2
- 229940038472 dicalcium phosphate Drugs 0.000 description 2
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 230000000477 gelanolytic effect Effects 0.000 description 2
- BRZYSWJRSDMWLG-CAXSIQPQSA-N geneticin Chemical compound O1C[C@@](O)(C)[C@H](NC)[C@@H](O)[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](C(C)O)O2)N)[C@@H](N)C[C@H]1N BRZYSWJRSDMWLG-CAXSIQPQSA-N 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 125000000593 indol-1-yl group Chemical group [H]C1=C([H])C([H])=C2N([*])C([H])=C([H])C2=C1[H] 0.000 description 2
- 150000002475 indoles Chemical class 0.000 description 2
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical compound C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 230000003211 malignant effect Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- VMGAPWLDMVPYIA-HIDZBRGKSA-N n'-amino-n-iminomethanimidamide Chemical compound N\N=C\N=N VMGAPWLDMVPYIA-HIDZBRGKSA-N 0.000 description 2
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 239000002667 nucleating agent Substances 0.000 description 2
- 230000002246 oncogenic effect Effects 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- 235000011837 pasties Nutrition 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000013612 plasmid Substances 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- BOLDJAUMGUJJKM-LSDHHAIUSA-N renifolin D Natural products CC(=C)[C@@H]1Cc2c(O)c(O)ccc2[C@H]1CC(=O)c3ccc(O)cc3O BOLDJAUMGUJJKM-LSDHHAIUSA-N 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 229960004889 salicylic acid Drugs 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- 230000019491 signal transduction Effects 0.000 description 2
- ZFRKQXVRDFCRJG-UHFFFAOYSA-N skatole Chemical compound C1=CC=C2C(C)=CNC2=C1 ZFRKQXVRDFCRJG-UHFFFAOYSA-N 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 125000003831 tetrazolyl group Chemical group 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 238000001890 transfection Methods 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 230000035899 viability Effects 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- DAXJNUBSBFUTRP-RTQNCGMRSA-N (8r,9s,10r,13s,14s)-6-(hydroxymethyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6h-cyclopenta[a]phenanthrene-3,17-dione Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(CO)C2=C1 DAXJNUBSBFUTRP-RTQNCGMRSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- RMXLHIUHKIVPAB-OWOJBTEDSA-N (e)-1,4-dibromobut-2-ene Chemical compound BrC\C=C\CBr RMXLHIUHKIVPAB-OWOJBTEDSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- KGKAYWMGPDWLQZ-UHFFFAOYSA-N 1,2-bis(bromomethyl)benzene Chemical compound BrCC1=CC=CC=C1CBr KGKAYWMGPDWLQZ-UHFFFAOYSA-N 0.000 description 1
- OXHOPZLBSSTTBU-UHFFFAOYSA-N 1,3-bis(bromomethyl)benzene Chemical compound BrCC1=CC=CC(CBr)=C1 OXHOPZLBSSTTBU-UHFFFAOYSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- RBZMSGOBSOCYHR-UHFFFAOYSA-N 1,4-bis(bromomethyl)benzene Chemical compound BrCC1=CC=C(CBr)C=C1 RBZMSGOBSOCYHR-UHFFFAOYSA-N 0.000 description 1
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- SGRHVVLXEBNBDV-UHFFFAOYSA-N 1,6-dibromohexane Chemical compound BrCCCCCCBr SGRHVVLXEBNBDV-UHFFFAOYSA-N 0.000 description 1
- LVWSZGCVEZRFBT-UHFFFAOYSA-N 1,7-dibromoheptane Chemical compound BrCCCCCCCBr LVWSZGCVEZRFBT-UHFFFAOYSA-N 0.000 description 1
- DKEGCUDAFWNSSO-UHFFFAOYSA-N 1,8-dibromooctane Chemical compound BrCCCCCCCCBr DKEGCUDAFWNSSO-UHFFFAOYSA-N 0.000 description 1
- DCWMBYCEMSKLFA-UHFFFAOYSA-N 1-(2-amino-4-hydroxy-3-propylphenyl)ethanone Chemical compound CCCC1=C(O)C=CC(C(C)=O)=C1N DCWMBYCEMSKLFA-UHFFFAOYSA-N 0.000 description 1
- UEUBXQBWTJARQS-UHFFFAOYSA-N 1-[2-(ethylamino)-4-hydroxy-3-propylphenyl]ethanone Chemical compound CCCC1=C(O)C=CC(C(C)=O)=C1NCC UEUBXQBWTJARQS-UHFFFAOYSA-N 0.000 description 1
- UWWBBPLMOICDBT-UHFFFAOYSA-N 1-[4-(ethylamino)-2-hydroxy-3-propylphenyl]ethanone Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1NCC UWWBBPLMOICDBT-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- KWXDOKLIYYAHJN-UHFFFAOYSA-N 1-chloro-4-prop-2-enoxybenzene Chemical compound ClC1=CC=C(OCC=C)C=C1 KWXDOKLIYYAHJN-UHFFFAOYSA-N 0.000 description 1
- 125000006039 1-hexenyl group Chemical group 0.000 description 1
- GFNKTLQTQSALEJ-UHFFFAOYSA-N 1-isocyanato-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(N=C=O)C=C1 GFNKTLQTQSALEJ-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- GVLRTOYGRNLSDW-UHFFFAOYSA-N 1h-pyrazolo[3,4-b]pyridine Chemical compound C1=CC=C2C=NNC2=N1 GVLRTOYGRNLSDW-UHFFFAOYSA-N 0.000 description 1
- ZLWQHIQNOCASNW-UHFFFAOYSA-N 2,4-dimethyl-6,7,8,9-tetrahydro-5h-pyrido[2,3-b]indole Chemical compound C1CCCC2=C1C1=C(C)C=C(C)N=C1N2 ZLWQHIQNOCASNW-UHFFFAOYSA-N 0.000 description 1
- BZDDKRSSKMTRDZ-UHFFFAOYSA-N 2,4-dimethyl-9h-pyrido[2,3-b]indole Chemical compound C1=CC=C2C3=C(C)C=C(C)N=C3NC2=C1 BZDDKRSSKMTRDZ-UHFFFAOYSA-N 0.000 description 1
- ZVBCOAMWIIZBSO-UHFFFAOYSA-N 2,5-dimethyl-3h-furan-2-thiol Chemical compound CC1=CCC(C)(S)O1 ZVBCOAMWIIZBSO-UHFFFAOYSA-N 0.000 description 1
- ONHFZHGGCJUHJT-UHFFFAOYSA-N 2-(2-tert-butylsilyloxypropan-2-yl)-5-hydroxypyran-4-one Chemical compound C(C)(C)(C)[SiH2]OC(C=1OC=C(C(C1)=O)O)(C)C ONHFZHGGCJUHJT-UHFFFAOYSA-N 0.000 description 1
- VMBYIYRGGXCVOP-UHFFFAOYSA-N 2-(hydroxymethyl)-5-[5-(2-propylphenoxy)pentoxy]pyran-4-one Chemical compound CCCC1=CC=CC=C1OCCCCCOC1=COC(CO)=CC1=O VMBYIYRGGXCVOP-UHFFFAOYSA-N 0.000 description 1
- QGMUQNGCHMXCKJ-UHFFFAOYSA-N 2-(hydroxymethyl)pyran-4-one Chemical compound OCC1=CC(=O)C=CO1 QGMUQNGCHMXCKJ-UHFFFAOYSA-N 0.000 description 1
- MUKUURPJHRJMOF-UHFFFAOYSA-N 2-(oxan-2-yloxymethyl)-5-(5-pyrrolo[2,3-b]pyridin-1-ylpentoxy)pyran-4-one Chemical compound O1C=C(OCCCCCN2C3=NC=CC=C3C=C2)C(=O)C=C1COC1CCCCO1 MUKUURPJHRJMOF-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- JBMBVWROWJGFMG-UHFFFAOYSA-N 2-chloro-7h-purine Chemical compound ClC1=NC=C2NC=NC2=N1 JBMBVWROWJGFMG-UHFFFAOYSA-N 0.000 description 1
- DTJZYCPCMLBJFB-UHFFFAOYSA-N 2-fluoro-4-[5-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxypentoxy]benzonitrile Chemical compound O1C(CO)=CC(=O)C(OCCCCCOC=2C=C(F)C(C#N)=CC=2)=C1 DTJZYCPCMLBJFB-UHFFFAOYSA-N 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- KPGXRSRHYNQIFN-UHFFFAOYSA-L 2-oxoglutarate(2-) Chemical compound [O-]C(=O)CCC(=O)C([O-])=O KPGXRSRHYNQIFN-UHFFFAOYSA-L 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- KLLLJCACIRKBDT-UHFFFAOYSA-N 2-phenyl-1H-indole Chemical compound N1C2=CC=CC=C2C=C1C1=CC=CC=C1 KLLLJCACIRKBDT-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- NTIGNJOEVBTPJJ-UHFFFAOYSA-N 3,3-dibromopentane Chemical compound CCC(Br)(Br)CC NTIGNJOEVBTPJJ-UHFFFAOYSA-N 0.000 description 1
- WDNBURPWRNALGP-UHFFFAOYSA-N 3,4-Dichlorophenol Chemical compound OC1=CC=C(Cl)C(Cl)=C1 WDNBURPWRNALGP-UHFFFAOYSA-N 0.000 description 1
- HNJZDPKMMZXSKT-UHFFFAOYSA-N 3,4-dichlorobenzenethiol Chemical compound SC1=CC=C(Cl)C(Cl)=C1 HNJZDPKMMZXSKT-UHFFFAOYSA-N 0.000 description 1
- MTKAJLNGIVXZIS-UHFFFAOYSA-N 3,4-dimethoxybenzenethiol Chemical compound COC1=CC=C(S)C=C1OC MTKAJLNGIVXZIS-UHFFFAOYSA-N 0.000 description 1
- VPOMSPZBQMDLTM-UHFFFAOYSA-N 3,5-dichlorophenol Chemical compound OC1=CC(Cl)=CC(Cl)=C1 VPOMSPZBQMDLTM-UHFFFAOYSA-N 0.000 description 1
- GBXGFKMOGSFCNU-QHHAFSJGSA-N 3-[5-(3,4-dichlorophenoxy)pentoxy]-6-(hydroxymethyl)-2-[(e)-prop-1-enyl]pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCOC=2C=C(Cl)C(Cl)=CC=2)=C1/C=C/C GBXGFKMOGSFCNU-QHHAFSJGSA-N 0.000 description 1
- MBOMGIVPMLLFLT-RUDMXATFSA-N 3-[5-(4-chloro-2-propylphenoxy)pentoxy]-6-(hydroxymethyl)-2-[(e)-prop-1-enyl]pyran-4-one Chemical compound CCCC1=CC(Cl)=CC=C1OCCCCCOC1=C(\C=C\C)OC(CO)=CC1=O MBOMGIVPMLLFLT-RUDMXATFSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- ALKYHXVLJMQRLQ-UHFFFAOYSA-M 3-carboxynaphthalen-2-olate Chemical compound C1=CC=C2C=C(C([O-])=O)C(O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-M 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- MKLIFIVLVIFYIO-NSCUHMNNSA-N 3-hydroxy-6-(hydroxymethyl)-2-[(e)-prop-1-enyl]pyran-4-one Chemical compound C\C=C\C=1OC(CO)=CC(=O)C=1O MKLIFIVLVIFYIO-NSCUHMNNSA-N 0.000 description 1
- MKLIFIVLVIFYIO-UHFFFAOYSA-N 3-hydroxy-6-(hydroxymethyl)-2-prop-1-enylpyran-4-one Chemical compound CC=CC=1OC(CO)=CC(=O)C=1O MKLIFIVLVIFYIO-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- AXDJCCTWPBKUKL-UHFFFAOYSA-N 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydron;chloride Chemical compound Cl.C1=CC(=N)C(C)=CC1=C(C=1C=CC(N)=CC=1)C1=CC=C(N)C=C1 AXDJCCTWPBKUKL-UHFFFAOYSA-N 0.000 description 1
- XOQGCSUIKIRRRV-UHFFFAOYSA-N 4-butoxy-3-nitroaniline Chemical compound CCCCOC1=CC=C(N)C=C1[N+]([O-])=O XOQGCSUIKIRRRV-UHFFFAOYSA-N 0.000 description 1
- XRHGYUZYPHTUJZ-UHFFFAOYSA-N 4-chlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- LUNOXNMCFPFPMO-UHFFFAOYSA-N 4-methoxy-1h-indole Chemical compound COC1=CC=CC2=C1C=CN2 LUNOXNMCFPFPMO-UHFFFAOYSA-N 0.000 description 1
- NYLATWKTSBGTLP-UHFFFAOYSA-N 4-oxo-5-[5-(2-propylphenoxy)pentoxy]pyran-2-carboxylic acid Chemical compound CCCC1=CC=CC=C1OCCCCCOC1=COC(C(O)=O)=CC1=O NYLATWKTSBGTLP-UHFFFAOYSA-N 0.000 description 1
- 150000000530 4H-pyran-4-ones Chemical class 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- QODBZRNBPUPLEZ-UHFFFAOYSA-N 5,6-dimethoxy-1h-indole Chemical compound C1=C(OC)C(OC)=CC2=C1NC=C2 QODBZRNBPUPLEZ-UHFFFAOYSA-N 0.000 description 1
- NOMRWJNERLSUMR-UHFFFAOYSA-N 5-(3-bromopropoxy)-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O=C1C(OCCCBr)=COC(COC2OCCCC2)=C1 NOMRWJNERLSUMR-UHFFFAOYSA-N 0.000 description 1
- LBEZSTNLUPUJFG-UHFFFAOYSA-N 5-(3-indol-1-ylpropoxy)-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O1C=C(OCCCN2C3=CC=CC=C3C=C2)C(=O)C=C1COC1CCCCO1 LBEZSTNLUPUJFG-UHFFFAOYSA-N 0.000 description 1
- URVWYEIONTZHBL-UHFFFAOYSA-N 5-(4-bromobut-2-enoxy)-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O=C1C(OCC=CCBr)=COC(COC2OCCCC2)=C1 URVWYEIONTZHBL-UHFFFAOYSA-N 0.000 description 1
- ZDRGENNPEUFQKH-UHFFFAOYSA-N 5-(4-bromobutoxy)-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O=C1C(OCCCCBr)=COC(COC2OCCCC2)=C1 ZDRGENNPEUFQKH-UHFFFAOYSA-N 0.000 description 1
- KDKJKNDKXCCBIQ-UHFFFAOYSA-N 5-(5-bromohexoxy)-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O=C1C(OCCCCC(Br)C)=COC(COC2OCCCC2)=C1 KDKJKNDKXCCBIQ-UHFFFAOYSA-N 0.000 description 1
- PFVIAFHDMWVUPA-UHFFFAOYSA-N 5-(6-bromohexoxy)-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O=C1C(OCCCCCCBr)=COC(COC2OCCCC2)=C1 PFVIAFHDMWVUPA-UHFFFAOYSA-N 0.000 description 1
- JDSQAZZTEPKNKC-UHFFFAOYSA-N 5-(7-bromoheptoxy)-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O=C1C(OCCCCCCCBr)=COC(COC2OCCCC2)=C1 JDSQAZZTEPKNKC-UHFFFAOYSA-N 0.000 description 1
- LKUIYIGWWVPBHN-UHFFFAOYSA-N 5-(8-bromooctoxy)-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O=C1C(OCCCCCCCCBr)=COC(COC2OCCCC2)=C1 LKUIYIGWWVPBHN-UHFFFAOYSA-N 0.000 description 1
- BYRJSCNPUHYZQE-UHFFFAOYSA-N 5-(trifluoromethyl)-1h-pyridin-2-one Chemical compound OC1=CC=C(C(F)(F)F)C=N1 BYRJSCNPUHYZQE-UHFFFAOYSA-N 0.000 description 1
- URVWYEIONTZHBL-DUXPYHPUSA-N 5-[(e)-4-bromobut-2-enoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound O=C1C(OC/C=C/CBr)=COC(COC2OCCCC2)=C1 URVWYEIONTZHBL-DUXPYHPUSA-N 0.000 description 1
- CYNNRLFZICVQDL-UHFFFAOYSA-N 5-[4-(3,4-dichlorophenoxy)butoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCOC=2C=C(Cl)C(Cl)=CC=2)=C1 CYNNRLFZICVQDL-UHFFFAOYSA-N 0.000 description 1
- WLRWNMWQQOAQDS-UHFFFAOYSA-N 5-[4-(3,4-dichlorophenoxy)butoxy]-4-oxopyran-2-carboxylic acid Chemical compound O1C(C(=O)O)=CC(=O)C(OCCCCOC=2C=C(Cl)C(Cl)=CC=2)=C1 WLRWNMWQQOAQDS-UHFFFAOYSA-N 0.000 description 1
- SOGSTZYSQPIMJO-UHFFFAOYSA-N 5-[5-(2,4-dimethyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-9-yl)pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C12=NC(C)=CC(C)=C2C=2CCCCC=2N1CCCCCOC(C(C=1)=O)=COC=1COC1CCCCO1 SOGSTZYSQPIMJO-UHFFFAOYSA-N 0.000 description 1
- IYMARZZPBBWELE-UHFFFAOYSA-N 5-[5-(2,4-dimethylpyrido[2,3-b]indol-9-yl)pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C12=NC(C)=CC(C)=C2C2=CC=CC=C2N1CCCCCOC(C(C=1)=O)=COC=1COC1CCCCO1 IYMARZZPBBWELE-UHFFFAOYSA-N 0.000 description 1
- NNGDEOGHPPPXGP-UHFFFAOYSA-N 5-[5-(2-methoxy-4-propylphenoxy)pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound COC1=CC(CCC)=CC=C1OCCCCCOC1=COC(COC2OCCCC2)=CC1=O NNGDEOGHPPPXGP-UHFFFAOYSA-N 0.000 description 1
- UYKPWLTZSXEJQW-UHFFFAOYSA-N 5-[5-(2-methylindol-1-yl)pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound CC1=CC2=CC=CC=C2N1CCCCCOC(C(C=1)=O)=COC=1COC1CCCCO1 UYKPWLTZSXEJQW-UHFFFAOYSA-N 0.000 description 1
- YAICDQLWMUPITC-UHFFFAOYSA-N 5-[5-(3,4-dichloro-2-propylphenoxy)pentoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound CCCC1=C(Cl)C(Cl)=CC=C1OCCCCCOC1=COC(CO)=CC1=O YAICDQLWMUPITC-UHFFFAOYSA-N 0.000 description 1
- OPEKXSMKHLDVRO-UHFFFAOYSA-N 5-[5-(3,4-dichloro-2-propylphenoxy)pentoxy]-4-oxopyran-2-carboxylic acid Chemical compound C1=CC(Cl)=C(Cl)C(CCC)=C1OCCCCCOC1=COC(C(O)=O)=CC1=O OPEKXSMKHLDVRO-UHFFFAOYSA-N 0.000 description 1
- MTDQISRRBKTQNH-UHFFFAOYSA-N 5-[5-(3,4-dichlorophenoxy)pentoxy]-4-oxopyran-2-carboxylic acid Chemical compound O1C(C(=O)O)=CC(=O)C(OCCCCCOC=2C=C(Cl)C(Cl)=CC=2)=C1 MTDQISRRBKTQNH-UHFFFAOYSA-N 0.000 description 1
- XGIQTXJJRLFSFS-UHFFFAOYSA-N 5-[5-(3-chlorophenoxy)pentoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCOC=2C=C(Cl)C=CC=2)=C1 XGIQTXJJRLFSFS-UHFFFAOYSA-N 0.000 description 1
- NWVLGFCVHJQJKU-UHFFFAOYSA-N 5-[5-(3-chlorophenoxy)pentoxy]-4-oxopyran-2-carboxylic acid Chemical compound O1C(C(=O)O)=CC(=O)C(OCCCCCOC=2C=C(Cl)C=CC=2)=C1 NWVLGFCVHJQJKU-UHFFFAOYSA-N 0.000 description 1
- OFARYDMSBDSQRM-UHFFFAOYSA-N 5-[5-(4,5-dichloro-2-propylphenoxy)pentoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound CCCC1=CC(Cl)=C(Cl)C=C1OCCCCCOC1=COC(CO)=CC1=O OFARYDMSBDSQRM-UHFFFAOYSA-N 0.000 description 1
- ZREPZXAHSQCJOX-UHFFFAOYSA-N 5-[5-(4-chlorophenoxy)pentoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCOC=2C=CC(Cl)=CC=2)=C1 ZREPZXAHSQCJOX-UHFFFAOYSA-N 0.000 description 1
- HXZUDZIISAWLPJ-UHFFFAOYSA-N 5-[5-(4-chlorophenoxy)pentoxy]-4-oxopyran-2-carboxylic acid Chemical compound O1C(C(=O)O)=CC(=O)C(OCCCCCOC=2C=CC(Cl)=CC=2)=C1 HXZUDZIISAWLPJ-UHFFFAOYSA-N 0.000 description 1
- OZMKZNOVLUARQY-UHFFFAOYSA-N 5-[5-(4-methoxyindol-1-yl)pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C1=CC=2C(OC)=CC=CC=2N1CCCCCOC(C(C=1)=O)=COC=1COC1CCCCO1 OZMKZNOVLUARQY-UHFFFAOYSA-N 0.000 description 1
- BVONMAVEIYDTHI-UHFFFAOYSA-N 5-[5-(5,6-dimethoxyindol-1-yl)pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C1=2C=C(OC)C(OC)=CC=2C=CN1CCCCCOC(C(C=1)=O)=COC=1COC1CCCCO1 BVONMAVEIYDTHI-UHFFFAOYSA-N 0.000 description 1
- ABSIQFQITCJLPS-UHFFFAOYSA-N 5-[5-(5-chloroindol-1-yl)pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C1=CC2=CC(Cl)=CC=C2N1CCCCCOC(C(C=1)=O)=COC=1COC1CCCCO1 ABSIQFQITCJLPS-UHFFFAOYSA-N 0.000 description 1
- YIPZJMUSMKRFQE-UHFFFAOYSA-N 5-[5-(5-fluoroindol-1-yl)pentoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCN2C3=CC=C(F)C=C3C=C2)=C1 YIPZJMUSMKRFQE-UHFFFAOYSA-N 0.000 description 1
- BKEXJPXDMQFICA-UHFFFAOYSA-N 5-[5-(5-fluoroindol-1-yl)pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C1=CC2=CC(F)=CC=C2N1CCCCCOC(C(C=1)=O)=COC=1COC1CCCCO1 BKEXJPXDMQFICA-UHFFFAOYSA-N 0.000 description 1
- OWSHEBWWAOOOPH-UHFFFAOYSA-N 5-[5-(5-methoxyindol-1-yl)pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C1=CC2=CC(OC)=CC=C2N1CCCCCOC(C(C=1)=O)=COC=1COC1CCCCO1 OWSHEBWWAOOOPH-UHFFFAOYSA-N 0.000 description 1
- NSYOEGSWOGLDAW-UHFFFAOYSA-N 5-[5-(6-chloroindol-1-yl)pentoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound O1C(CO)=CC(=O)C(OCCCCCN2C3=CC(Cl)=CC=C3C=C2)=C1 NSYOEGSWOGLDAW-UHFFFAOYSA-N 0.000 description 1
- UUAISMNCXMRSKX-UHFFFAOYSA-N 5-[5-(6-chloroindol-1-yl)pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C12=CC(Cl)=CC=C2C=CN1CCCCCOC(C(C=1)=O)=COC=1COC1CCCCO1 UUAISMNCXMRSKX-UHFFFAOYSA-N 0.000 description 1
- DJJDLRWNEUOPAE-UHFFFAOYSA-N 5-[5-(6-methoxyindol-1-yl)pentoxy]-2-(oxan-2-yloxymethyl)pyran-4-one Chemical compound C12=CC(OC)=CC=C2C=CN1CCCCCOC(C(C=1)=O)=COC=1COC1CCCCO1 DJJDLRWNEUOPAE-UHFFFAOYSA-N 0.000 description 1
- UXMYPDPNRSMFLU-UHFFFAOYSA-N 5-[6-(3,4-dichloro-2-propylphenoxy)hexoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound CCCC1=C(Cl)C(Cl)=CC=C1OCCCCCCOC1=COC(CO)=CC1=O UXMYPDPNRSMFLU-UHFFFAOYSA-N 0.000 description 1
- MOLHADLXCDBRPE-UHFFFAOYSA-N 5-[7-(3,4-dichloro-2-propylphenoxy)heptoxy]-2-(hydroxymethyl)pyran-4-one Chemical compound CCCC1=C(Cl)C(Cl)=CC=C1OCCCCCCCOC1=COC(CO)=CC1=O MOLHADLXCDBRPE-UHFFFAOYSA-N 0.000 description 1
- SZFUWUOHDRMCKD-UHFFFAOYSA-N 5-chloro-1h-pyridin-2-one Chemical compound OC1=CC=C(Cl)C=N1 SZFUWUOHDRMCKD-UHFFFAOYSA-N 0.000 description 1
- ODFFPRGJZRXNHZ-UHFFFAOYSA-N 5-fluoroindole Chemical compound FC1=CC=C2NC=CC2=C1 ODFFPRGJZRXNHZ-UHFFFAOYSA-N 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- DWAQDRSOVMLGRQ-UHFFFAOYSA-N 5-methoxyindole Chemical compound COC1=CC=C2NC=CC2=C1 DWAQDRSOVMLGRQ-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- YTYIMDRWPTUAHP-UHFFFAOYSA-N 6-Chloroindole Chemical compound ClC1=CC=C2C=CNC2=C1 YTYIMDRWPTUAHP-UHFFFAOYSA-N 0.000 description 1
- QJRWYBIKLXNYLF-UHFFFAOYSA-N 6-methoxy-1h-indole Chemical compound COC1=CC=C2C=CNC2=C1 QJRWYBIKLXNYLF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- IUNBOWVXYCGSHD-QHHAFSJGSA-N C/C=C/C(OC(CO)=CC1=O)=C1OCCCCCBr Chemical compound C/C=C/C(OC(CO)=CC1=O)=C1OCCCCCBr IUNBOWVXYCGSHD-QHHAFSJGSA-N 0.000 description 1
- BWEQOPDESQWYQZ-UHFFFAOYSA-N C1C=CC=C2NC=CC12 Chemical compound C1C=CC=C2NC=CC12 BWEQOPDESQWYQZ-UHFFFAOYSA-N 0.000 description 1
- WOKMWXZWBBKBEB-UHFFFAOYSA-N CC(C)(C)[Si](C)(C)OCC(OC=C1OCCCCCBr)=CC1=O Chemical compound CC(C)(C)[Si](C)(C)OCC(OC=C1OCCCCCBr)=CC1=O WOKMWXZWBBKBEB-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 102000011068 Cdc42 Human genes 0.000 description 1
- 108050001278 Cdc42 Proteins 0.000 description 1
- 229920002101 Chitin Polymers 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 206010048832 Colon adenoma Diseases 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- PXIKRTCSSLJURC-UHFFFAOYSA-N Dihydroeugenol Chemical compound CCCC1=CC=C(O)C(OC)=C1 PXIKRTCSSLJURC-UHFFFAOYSA-N 0.000 description 1
- 102000034286 G proteins Human genes 0.000 description 1
- 102000030782 GTP binding Human genes 0.000 description 1
- 108091000058 GTP-Binding Proteins 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 229920002907 Guar gum Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 206010025323 Lymphomas Diseases 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 238000007807 Matrigel invasion assay Methods 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-O Methylammonium ion Chemical compound [NH3+]C BAVYZALUXZFZLV-UHFFFAOYSA-O 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 206010061309 Neoplasm progression Diseases 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 108010009711 Phalloidine Proteins 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102000001253 Protein Kinase Human genes 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 108010042291 Serum Response Factor Proteins 0.000 description 1
- 102000004446 Serum Response Factor Human genes 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 229920004890 Triton X-100 Polymers 0.000 description 1
- YVNQAIFQFWTPLQ-UHFFFAOYSA-O [4-[[4-(4-ethoxyanilino)phenyl]-[4-[ethyl-[(3-sulfophenyl)methyl]amino]-2-methylphenyl]methylidene]-3-methylcyclohexa-2,5-dien-1-ylidene]-ethyl-[(3-sulfophenyl)methyl]azanium Chemical compound C1=CC(OCC)=CC=C1NC1=CC=C(C(=C2C(=CC(C=C2)=[N+](CC)CC=2C=C(C=CC=2)S(O)(=O)=O)C)C=2C(=CC(=CC=2)N(CC)CC=2C=C(C=CC=2)S(O)(=O)=O)C)C=C1 YVNQAIFQFWTPLQ-UHFFFAOYSA-O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 125000003670 adamantan-2-yl group Chemical group [H]C1([H])C(C2([H])[H])([H])C([H])([H])C3([H])C([*])([H])C1([H])C([H])([H])C2([H])C3([H])[H] 0.000 description 1
- 238000004115 adherent culture Methods 0.000 description 1
- 229940023476 agar Drugs 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 238000005937 allylation reaction Methods 0.000 description 1
- AWUCVROLDVIAJX-UHFFFAOYSA-N alpha-glycerophosphate Natural products OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 239000000420 anogeissus latifolia wall. gum Substances 0.000 description 1
- 230000002095 anti-migrative effect Effects 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 101150010487 are gene Proteins 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000003855 balanced salt solution Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 239000007975 buffered saline Substances 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-O butylazanium Chemical compound CCCC[NH3+] HQABUPZFAYXKJW-UHFFFAOYSA-O 0.000 description 1
- DEGAKNSWVGKMLS-UHFFFAOYSA-N calcein Chemical group O1C(=O)C2=CC=CC=C2C21C1=CC(CN(CC(O)=O)CC(O)=O)=C(O)C=C1OC1=C2C=C(CN(CC(O)=O)CC(=O)O)C(O)=C1 DEGAKNSWVGKMLS-UHFFFAOYSA-N 0.000 description 1
- BQRGNLJZBFXNCZ-UHFFFAOYSA-N calcein am Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC(CN(CC(=O)OCOC(C)=O)CC(=O)OCOC(C)=O)=C(OC(C)=O)C=C1OC1=C2C=C(CN(CC(=O)OCOC(C)=O)CC(=O)OCOC(=O)C)C(OC(C)=O)=C1 BQRGNLJZBFXNCZ-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 230000009702 cancer cell proliferation Effects 0.000 description 1
- 229960001631 carbomer Drugs 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000006369 cell cycle progression Effects 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 230000009087 cell motility Effects 0.000 description 1
- 230000036978 cell physiology Effects 0.000 description 1
- 238000003570 cell viability assay Methods 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 231100000196 chemotoxic Toxicity 0.000 description 1
- 230000002604 chemotoxic effect Effects 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 229940018557 citraconic acid Drugs 0.000 description 1
- 238000010367 cloning Methods 0.000 description 1
- 238000009643 clonogenic assay Methods 0.000 description 1
- 231100000096 clonogenic assay Toxicity 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 201000010897 colon adenocarcinoma Diseases 0.000 description 1
- 238000010293 colony formation assay Methods 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 238000009109 curative therapy Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- NZNMSOFKMUBTKW-UHFFFAOYSA-M cyclohexanecarboxylate Chemical compound [O-]C(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-M 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- 231100000433 cytotoxic Toxicity 0.000 description 1
- 239000002254 cytotoxic agent Substances 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 231100000599 cytotoxic agent Toxicity 0.000 description 1
- 238000002784 cytotoxicity assay Methods 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-O diethylammonium Chemical compound CC[NH2+]CC HPNMFZURTQLUMO-UHFFFAOYSA-O 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 230000000857 drug effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000002900 effect on cell Effects 0.000 description 1
- 238000001962 electrophoresis Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-N ethanedisulfonic acid Chemical compound OS(=O)(=O)CCS(O)(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-N 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- FPIQZBQZKBKLEI-UHFFFAOYSA-N ethyl 1-[[2-chloroethyl(nitroso)carbamoyl]amino]cyclohexane-1-carboxylate Chemical compound ClCCN(N=O)C(=O)NC1(C(=O)OCC)CCCCC1 FPIQZBQZKBKLEI-UHFFFAOYSA-N 0.000 description 1
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical group CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-O ethylaminium Chemical compound CC[NH3+] QUSNBJAOOMFDIB-UHFFFAOYSA-O 0.000 description 1
- KWBIXTIBYFUAGV-UHFFFAOYSA-N ethylcarbamic acid Chemical compound CCNC(O)=O KWBIXTIBYFUAGV-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 238000013265 extended release Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 238000001506 fluorescence spectroscopy Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000007804 gelatin zymography Methods 0.000 description 1
- 238000009650 gentamicin protection assay Methods 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 229960002989 glutamic acid Drugs 0.000 description 1
- 229960004275 glycolic acid Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 239000000665 guar gum Substances 0.000 description 1
- 235000010417 guar gum Nutrition 0.000 description 1
- 229960002154 guar gum Drugs 0.000 description 1
- 235000019314 gum ghatti Nutrition 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 210000005260 human cell Anatomy 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000008595 infiltration Effects 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 230000002601 intratumoral effect Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- 230000001394 metastastic effect Effects 0.000 description 1
- 206010061289 metastatic neoplasm Diseases 0.000 description 1
- JDFVSSCQAPWJEQ-UHFFFAOYSA-N methyl 3-(cyclopropylmethoxy)-4-hydroxybenzoate Chemical compound COC(=O)C1=CC=C(O)C(OCC2CC2)=C1 JDFVSSCQAPWJEQ-UHFFFAOYSA-N 0.000 description 1
- UFTXASQYKJFRKI-UHFFFAOYSA-N methyl 4-bromo-3-hydroxythiophene-2-carboxylate Chemical compound COC(=O)C=1SC=C(Br)C=1O UFTXASQYKJFRKI-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 230000002297 mitogenic effect Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000035772 mutation Effects 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- WEIMMECSAQVSGO-UHFFFAOYSA-N n-(3-hydroxy-4-propylphenyl)acetamide Chemical compound CCCC1=CC=C(NC(C)=O)C=C1O WEIMMECSAQVSGO-UHFFFAOYSA-N 0.000 description 1
- BXYQDMMTLWDNEX-UHFFFAOYSA-N n-benzyl-5-[5-(4-chlorophenoxy)pentoxy]-4-oxopyran-2-carboxamide Chemical compound C1=CC(Cl)=CC=C1OCCCCCOC1=COC(C(=O)NCC=2C=CC=CC=2)=CC1=O BXYQDMMTLWDNEX-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 230000013152 negative regulation of cell migration Effects 0.000 description 1
- 229960004927 neomycin Drugs 0.000 description 1
- 210000005170 neoplastic cell Anatomy 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002773 nucleotide Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N o-dimethylbenzene Natural products CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229960002378 oftasceine Drugs 0.000 description 1
- 231100000590 oncogenic Toxicity 0.000 description 1
- 238000011275 oncology therapy Methods 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229940116315 oxalic acid Drugs 0.000 description 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 238000003068 pathway analysis Methods 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 230000010412 perfusion Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 238000009522 phase III clinical trial Methods 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical compound OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 150000004804 polysaccharides Chemical class 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000013641 positive control Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000012925 reference material Substances 0.000 description 1
- 230000022983 regulation of cell cycle Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 102000007268 rho GTP-Binding Proteins Human genes 0.000 description 1
- 108010033674 rho GTP-Binding Proteins Proteins 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- 102000030938 small GTPase Human genes 0.000 description 1
- 108060007624 small GTPase Proteins 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- AWUCVROLDVIAJX-GSVOUGTGSA-N sn-glycerol 3-phosphate Chemical compound OC[C@@H](O)COP(O)(O)=O AWUCVROLDVIAJX-GSVOUGTGSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 210000003518 stress fiber Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000012622 synthetic inhibitor Substances 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical class C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- DBDCNCCRPKTRSD-UHFFFAOYSA-N thieno[3,2-b]pyridine Chemical compound C1=CC=C2SC=CC2=N1 DBDCNCCRPKTRSD-UHFFFAOYSA-N 0.000 description 1
- 239000002175 thienopyridine Substances 0.000 description 1
- 229940125670 thienopyridine Drugs 0.000 description 1
- 231100000820 toxicity test Toxicity 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 229950002929 trinitrophenol Drugs 0.000 description 1
- 230000004565 tumor cell growth Effects 0.000 description 1
- 230000010304 tumor cell viability Effects 0.000 description 1
- 230000005751 tumor progression Effects 0.000 description 1
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000007805 zymography Methods 0.000 description 1
Images
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/335—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin
- A61K31/35—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin having six-membered rings with one oxygen as the only ring hetero atom
- A61K31/351—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin having six-membered rings with one oxygen as the only ring hetero atom not condensed with another ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/34—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D309/36—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with oxygen atoms directly attached to ring carbon atoms
- C07D309/40—Oxygen atoms attached in positions 3 and 4, e.g. maltol
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Epidemiology (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Cardiology (AREA)
- Urology & Nephrology (AREA)
- Vascular Medicine (AREA)
- Heart & Thoracic Surgery (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrane Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US10/085,141 US6552073B1 (en) | 2002-03-01 | 2002-03-01 | Compounds and methods of treating cell proliferative diseases |
| PCT/IB2003/001050 WO2003074508A1 (en) | 2002-03-01 | 2003-02-28 | Compounds and methods of treating cell proliferative diseases |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2005529079A true JP2005529079A (ja) | 2005-09-29 |
| JP2005529079A5 JP2005529079A5 (enExample) | 2006-04-06 |
Family
ID=22189708
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2003572976A Pending JP2005529079A (ja) | 2002-03-01 | 2003-02-28 | 細胞増殖性疾患を処置する化合物および方法 |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US6552073B1 (enExample) |
| EP (1) | EP1480966A1 (enExample) |
| JP (1) | JP2005529079A (enExample) |
| AU (1) | AU2003209924A1 (enExample) |
| CA (1) | CA2477003A1 (enExample) |
| WO (1) | WO2003074508A1 (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2006519221A (ja) * | 2003-02-28 | 2006-08-24 | エグゾニ・テラピューティック・ソシエテ・アノニム | 化合物並びに細胞増殖性疾患、網膜症及び関節炎を処置する方法 |
| JP2019524797A (ja) * | 2016-08-23 | 2019-09-05 | ニューリム・ファーマシューティカルズ・リミテッドNeurim Pharmaceuticals Ltd. | 掻痒症および/または痒みの治療方法 |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6552073B1 (en) * | 2002-03-01 | 2003-04-22 | Exonhit Therapeutics Sa | Compounds and methods of treating cell proliferative diseases |
| WO2005110399A2 (en) * | 2004-04-29 | 2005-11-24 | The Regents Of The University Of California | Zinc-binding groups for metalloprotein inhibitors |
| EP1755586A2 (en) * | 2004-04-29 | 2007-02-28 | The Regents of the University of California | Hydroxypyridinone, hydroxypyridinethione, pyrone, and thiopyrone metalloprotein inhibitors |
| DE102007002260A1 (de) | 2007-01-16 | 2008-07-31 | Sanofi-Aventis | Verwendung von substituierten Pyranonsäurederivaten zur Herstellung von Medikamenten zur Behandlung des Metabolischen Syndroms |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4812584A (en) * | 1984-07-11 | 1989-03-14 | G. D. Searle & Co. | Aralkoxy and aryloxyalkoxy kojic acid derivatives |
| US4644071A (en) * | 1984-07-11 | 1987-02-17 | G. D. Searle & Co. | Aralkoxy and aryloxyalkoxy kojic acid derivatives |
| US4705871A (en) * | 1984-07-11 | 1987-11-10 | G. D. Searle & Co. | Aralkoxy and aryloxyalkoxy kojic acid derivatives |
| PH22520A (en) * | 1984-11-12 | 1988-10-17 | Yamanouchi Pharma Co Ltd | Heterocyclic compounds having 4-lover alkyl-3-hydroxy-2-lower alkyl phenoxy-lower alkylene-y-group, and process of producing them |
| US6552073B1 (en) * | 2002-03-01 | 2003-04-22 | Exonhit Therapeutics Sa | Compounds and methods of treating cell proliferative diseases |
-
2002
- 2002-03-01 US US10/085,141 patent/US6552073B1/en not_active Expired - Fee Related
-
2003
- 2003-02-28 US US10/502,625 patent/US20050054629A1/en not_active Abandoned
- 2003-02-28 JP JP2003572976A patent/JP2005529079A/ja active Pending
- 2003-02-28 AU AU2003209924A patent/AU2003209924A1/en not_active Abandoned
- 2003-02-28 EP EP03743474A patent/EP1480966A1/en not_active Withdrawn
- 2003-02-28 WO PCT/IB2003/001050 patent/WO2003074508A1/en not_active Ceased
- 2003-02-28 CA CA002477003A patent/CA2477003A1/en not_active Abandoned
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2006519221A (ja) * | 2003-02-28 | 2006-08-24 | エグゾニ・テラピューティック・ソシエテ・アノニム | 化合物並びに細胞増殖性疾患、網膜症及び関節炎を処置する方法 |
| JP2019524797A (ja) * | 2016-08-23 | 2019-09-05 | ニューリム・ファーマシューティカルズ・リミテッドNeurim Pharmaceuticals Ltd. | 掻痒症および/または痒みの治療方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| US6552073B1 (en) | 2003-04-22 |
| EP1480966A1 (en) | 2004-12-01 |
| WO2003074508A1 (en) | 2003-09-12 |
| AU2003209924A1 (en) | 2003-09-16 |
| US20050054629A1 (en) | 2005-03-10 |
| WO2003074508B1 (en) | 2003-11-27 |
| CA2477003A1 (en) | 2003-09-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP6231226B2 (ja) | ピロリジン−2,5−ジオン誘導体、医薬組成物およびido1阻害剤としての使用のための方法 | |
| US9890168B2 (en) | 2,4-disubstituted 7H-pyrrolo[2,3-d]pyrimidine derivative, preparation method and medicinal use thereof | |
| CN101817833B (zh) | Dpp-iv抑制剂 | |
| US20170152226A1 (en) | Functionalised and substituted indoles as anti-cancer agents | |
| CA3035860A1 (en) | Pyridine compound | |
| KR20020068388A (ko) | 술폰아미드 함유 복소환 화합물 | |
| JP5778297B2 (ja) | 癌治療用のhdac阻害剤としての新規4−アミノ−n−ヒドロキシ−ベンズアミド | |
| US20220098178A1 (en) | Preparation Method for Amide Compound and Application Thereof in Field of Medicine | |
| CA2561406C (en) | Heterocyclic compound and anti-malignant-tumor agent comprising the same as effective component | |
| WO2015021894A1 (zh) | 新型羟肟酸衍生物及其医疗应用 | |
| JP2005529079A (ja) | 細胞増殖性疾患を処置する化合物および方法 | |
| WO2018229139A1 (en) | Novel compounds for use in cancer | |
| CN109748914B (zh) | 吡啶并嘧啶类化合物及其应用 | |
| KR20100132553A (ko) | 신규한 n-(2-아미노-페닐)-아크릴아미드 | |
| KR20250023339A (ko) | 페닐 트라이아졸 mll1-wdr5 단백질-단백질 상호작용 저해제 | |
| US20070117860A1 (en) | Bicyclic indolinesulphonamide derivatives | |
| EP3628664A1 (en) | Irreversible inhibitors of kras g12c mutant | |
| CN102311447B (zh) | 杂环并嘧啶酮类dpp-iv抑制剂 | |
| CN114616234B (zh) | 磷咪唑并喹啉胺衍生物、及其药物组合物和应用 | |
| CN102584679B (zh) | 一类苯并咔唑酰胺类化合物、其制备方法和用途 | |
| JP2022516922A (ja) | フッ素含有置換ベンゾチオフェン化合物ならびにその医薬組成物および応用 | |
| JP2025509830A (ja) | 血液脳関門を通過するmll1-wdr5タンパク質間相互作用阻害剤化合物及びそれらの使用 | |
| CN108912035B (zh) | 一种具备抗肿瘤活性的吲哚酰胺类化合物 | |
| WO2003053440A1 (en) | Medicinal composition | |
| WO2018201939A1 (zh) | 苯并吲唑类衍生物的前药及其制备方法、应用 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20060214 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20060214 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20090908 |
|
| A977 | Report on retrieval |
Free format text: JAPANESE INTERMEDIATE CODE: A971007 Effective date: 20090909 |
|
| A02 | Decision of refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A02 Effective date: 20100223 |