JP2005516973A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2005516973A5 JP2005516973A5 JP2003562121A JP2003562121A JP2005516973A5 JP 2005516973 A5 JP2005516973 A5 JP 2005516973A5 JP 2003562121 A JP2003562121 A JP 2003562121A JP 2003562121 A JP2003562121 A JP 2003562121A JP 2005516973 A5 JP2005516973 A5 JP 2005516973A5
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- haloalkyl
- alkoxy
- alkenyl
- heteroaryl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 125000000217 alkyl group Chemical group 0.000 claims 24
- 125000001072 heteroaryl group Chemical group 0.000 claims 17
- 125000006374 C2-C10 alkenyl group Chemical group 0.000 claims 16
- 125000005865 C2-C10alkynyl group Chemical group 0.000 claims 16
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 16
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 16
- 229910052760 oxygen Inorganic materials 0.000 claims 16
- 239000001301 oxygen Chemical group 0.000 claims 16
- 125000001188 haloalkyl group Chemical group 0.000 claims 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 15
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 14
- 229910052736 halogen Inorganic materials 0.000 claims 14
- 150000002367 halogens Chemical class 0.000 claims 14
- 125000004093 cyano group Chemical group *C#N 0.000 claims 13
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 13
- 125000005452 alkenyloxyalkyl group Chemical group 0.000 claims 12
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims 12
- 229910052757 nitrogen Inorganic materials 0.000 claims 12
- 239000011593 sulfur Chemical group 0.000 claims 12
- 229910052717 sulfur Chemical group 0.000 claims 12
- 125000000753 cycloalkyl group Chemical group 0.000 claims 11
- 125000005842 heteroatom Chemical group 0.000 claims 11
- 125000004687 alkyl sulfinyl alkyl group Chemical group 0.000 claims 10
- 125000004688 alkyl sulfonyl alkyl group Chemical group 0.000 claims 10
- 125000003118 aryl group Chemical group 0.000 claims 10
- 125000004429 atom Chemical group 0.000 claims 10
- 229910052739 hydrogen Inorganic materials 0.000 claims 10
- 239000001257 hydrogen Substances 0.000 claims 10
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 10
- 125000001424 substituent group Chemical group 0.000 claims 10
- 125000006677 (C1-C3) haloalkoxy group Chemical group 0.000 claims 9
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 9
- 125000005093 alkyl carbonyl alkyl group Chemical group 0.000 claims 7
- -1 C 2 -C 5 haloalkenyl Chemical group 0.000 claims 6
- 125000004103 aminoalkyl group Chemical group 0.000 claims 4
- 125000004966 cyanoalkyl group Chemical group 0.000 claims 4
- 125000006310 cycloalkyl amino group Chemical group 0.000 claims 4
- 125000004438 haloalkoxy group Chemical group 0.000 claims 4
- 125000005241 heteroarylamino group Chemical group 0.000 claims 4
- 125000004971 nitroalkyl group Chemical group 0.000 claims 4
- 229920006395 saturated elastomer Polymers 0.000 claims 4
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims 3
- RGTVXXNMOGHRAY-WDSKDSINSA-N Cys-Arg Chemical group SC[C@H](N)C(=O)N[C@H](C(O)=O)CCCN=C(N)N RGTVXXNMOGHRAY-WDSKDSINSA-N 0.000 claims 3
- 125000003545 alkoxy group Chemical group 0.000 claims 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 3
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims 3
- 125000005553 heteroaryloxy group Chemical group 0.000 claims 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 3
- 125000004434 sulfur atom Chemical group 0.000 claims 3
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 2
- 125000006729 (C2-C5) alkenyl group Chemical group 0.000 claims 2
- 125000003342 alkenyl group Chemical group 0.000 claims 2
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 2
- 150000001875 compounds Chemical class 0.000 claims 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims 2
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 claims 2
- 125000005240 diheteroarylamino group Chemical group 0.000 claims 2
- 125000004995 haloalkylthio group Chemical group 0.000 claims 2
- 230000002363 herbicidal effect Effects 0.000 claims 2
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims 2
- 125000005359 phenoxyalkyl group Chemical group 0.000 claims 2
- 125000003884 phenylalkyl group Chemical group 0.000 claims 2
- 125000004001 thioalkyl group Chemical group 0.000 claims 2
- 125000000027 (C1-C10) alkoxy group Chemical group 0.000 claims 1
- 125000004737 (C1-C6) haloalkoxy group Chemical group 0.000 claims 1
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 1
- 125000004450 alkenylene group Chemical group 0.000 claims 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000004689 alkyl amino carbonyl alkyl group Chemical group 0.000 claims 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims 1
- 125000002947 alkylene group Chemical group 0.000 claims 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 125000000000 cycloalkoxy group Chemical group 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims 1
- 125000004969 haloethyl group Chemical group 0.000 claims 1
- 239000004009 herbicide Substances 0.000 claims 1
- 125000005326 heteroaryloxy alkyl group Chemical group 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims 1
- 230000002401 inhibitory effect Effects 0.000 claims 1
- 125000004437 phosphorous atom Chemical group 0.000 claims 1
- 230000008635 plant growth Effects 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- 125000003003 spiro group Chemical group 0.000 claims 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1192002 | 2002-01-22 | ||
| PCT/EP2003/000555 WO2003062244A1 (en) | 2002-01-22 | 2003-01-21 | Phenyl substituted heterocyclic compounds useful as herbicides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2005516973A JP2005516973A (ja) | 2005-06-09 |
| JP2005516973A5 true JP2005516973A5 (cg-RX-API-DMAC10.html) | 2005-12-22 |
Family
ID=27587784
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2003562121A Pending JP2005516973A (ja) | 2002-01-22 | 2003-01-21 | 除草剤として有用なフェニル置換ヘテロ環化合物 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US20050090399A1 (cg-RX-API-DMAC10.html) |
| EP (1) | EP1468000A1 (cg-RX-API-DMAC10.html) |
| JP (1) | JP2005516973A (cg-RX-API-DMAC10.html) |
| CN (1) | CN1615310A (cg-RX-API-DMAC10.html) |
| BR (1) | BR0306957A (cg-RX-API-DMAC10.html) |
| CA (1) | CA2470674A1 (cg-RX-API-DMAC10.html) |
| HU (1) | HUP0402592A2 (cg-RX-API-DMAC10.html) |
| MX (1) | MXPA04006991A (cg-RX-API-DMAC10.html) |
| RU (1) | RU2004125878A (cg-RX-API-DMAC10.html) |
| WO (1) | WO2003062244A1 (cg-RX-API-DMAC10.html) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10311300A1 (de) * | 2003-03-14 | 2004-09-23 | Bayer Cropscience Ag | 2,4,6-Phenylsubstituierte cyclische Ketoenole |
| DE10326386A1 (de) * | 2003-06-12 | 2004-12-30 | Bayer Cropscience Ag | N-Heterocyclyl-phenylsubstituierte cyclische Ketoenole |
| DE10337497A1 (de) | 2003-08-14 | 2005-03-10 | Bayer Cropscience Ag | 4-Biphenylsubstituierte-Pyrazolidin-3,5-dion-Derivate |
| JP2005154298A (ja) * | 2003-11-21 | 2005-06-16 | Idemitsu Kosan Co Ltd | 第三級カルボン酸 |
| DE102004014620A1 (de) * | 2004-03-25 | 2005-10-06 | Bayer Cropscience Ag | 2,4,6-phenylsubstituierte cyclische Ketoenole |
| DE102004035133A1 (de) | 2004-07-20 | 2006-02-16 | Bayer Cropscience Ag | Selektive Insektizide auf Basis von substituierten, cyclischen Ketoenolen und Safenern |
| DE102004044827A1 (de) | 2004-09-16 | 2006-03-23 | Bayer Cropscience Ag | Jod-phenylsubstituierte cyclische Ketoenole |
| DE102005008021A1 (de) | 2005-02-22 | 2006-08-24 | Bayer Cropscience Ag | Spiroketal-substituierte cyclische Ketoenole |
| DE102005059469A1 (de) | 2005-12-13 | 2007-06-14 | Bayer Cropscience Ag | Insektizide Zusammensetzungen mit verbesserter Wirkung |
| DE102006000971A1 (de) * | 2006-01-07 | 2007-07-12 | Bayer Cropscience Ag | 2,4,6-Trialkylphenylsubstituierte Cyclopentan-1,3-dione |
| DE102006007882A1 (de) * | 2006-02-21 | 2007-08-30 | Bayer Cropscience Ag | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
| DE102006018828A1 (de) | 2006-04-22 | 2007-10-25 | Bayer Cropscience Ag | Alkoxyalkyl-substituierte cyclische Ketoenole |
| DE102006025874A1 (de) | 2006-06-02 | 2007-12-06 | Bayer Cropscience Ag | Alkoxyalkyl-substituierte cyclische Ketoenole |
| EP2014169A1 (de) | 2007-07-09 | 2009-01-14 | Bayer CropScience AG | Wasserlösliche Konzentrate von 3-(2-Alkoxy-4-chlor-6-alkyl-phenyl)-substituierten Tetramaten und ihren korrespondierenden Enolen |
| EP2020413A1 (de) | 2007-08-02 | 2009-02-04 | Bayer CropScience AG | Oxaspirocyclische-spiro-substituierte Tetram- und Tetronsäure-Derivate |
| EP2045240A1 (de) | 2007-09-25 | 2009-04-08 | Bayer CropScience AG | Halogenalkoxyspirocyclische Tetram- und Tetronsäure-Derivate |
| EP2095710A1 (de) * | 2008-02-27 | 2009-09-02 | Bayer CropScience AG | Herbizid-Kombinationen enthaltend Diflufenican |
| EP2103615A1 (de) | 2008-03-19 | 2009-09-23 | Bayer CropScience AG | 4'4'-Dioxaspiro-spirocyclisch substituierte Tetramate |
| EP2127522A1 (de) | 2008-05-29 | 2009-12-02 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| US8367873B2 (en) * | 2008-10-10 | 2013-02-05 | Bayer Cropscience Ag | Phenyl-substituted bicyclooctane-1,3-dione derivatives |
| TW201031327A (en) | 2008-11-14 | 2010-09-01 | Bayer Cropscience Ag | Active compound combinations having insecticidal and acaricidal properties |
| US8389443B2 (en) * | 2008-12-02 | 2013-03-05 | Bayer Cropscience Ag | Geminal alkoxy/alkylspirocyclic substituted tetramate derivatives |
| US8846946B2 (en) | 2008-12-02 | 2014-09-30 | Bayer Cropscience Ag | Germinal alkoxy/alkylspirocyclic substituted tetramate derivatives |
| ES2342997B1 (es) * | 2008-12-09 | 2011-06-06 | Universitat De Les Illes Balears | Alpha derivados de acidos grasos cis-monoinsaturados para ser usados como medicamento. |
| AR075126A1 (es) | 2009-01-29 | 2011-03-09 | Bayer Cropscience Ag | Metodo para el mejor uso del potencial de produccion de plantas transgenicas |
| WO2010102758A2 (de) | 2009-03-11 | 2010-09-16 | Bayer Cropscience Ag | Halogenalkylmethylenoxy-phenyl-substituierte ketoenole |
| DE102009028001A1 (de) | 2009-07-24 | 2011-01-27 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| EP2534133B1 (de) | 2010-02-10 | 2018-09-05 | Bayer CropScience Aktiengesellschaft | Biphenylsubstituierte cyclische ketoenole |
| CN103068825A (zh) | 2010-02-10 | 2013-04-24 | 拜耳知识产权有限责任公司 | 螺杂环取代的特特拉姆酸衍生物 |
| DE102010008644A1 (de) | 2010-02-15 | 2011-08-18 | Bayer Schering Pharma Aktiengesellschaft, 13353 | Zyklische Ketoenole zur Therapie |
| DE102010008642A1 (de) | 2010-02-15 | 2011-08-18 | Bayer Schering Pharma Aktiengesellschaft, 13353 | Zyklische Ketoenole zur Therapie |
| DE102010008643A1 (de) | 2010-02-15 | 2011-08-18 | Bayer Schering Pharma Aktiengesellschaft, 13353 | Zyklische Ketoenole zur Therapie |
| EP2560487A1 (de) | 2010-04-20 | 2013-02-27 | Bayer Intellectual Property GmbH | Insektizide und/oder herbizide zusammensetzung mit verbesserter wirkung auf basis von spiroheterocyclisch-substituierten tetramsäure-derivaten |
| RU2013114184A (ru) * | 2010-09-01 | 2014-10-10 | Байер Интеллектуэль Проперти Гмбх | Гербицидно-активные кетосультамы и дикетопиридины |
| CN103339096A (zh) | 2010-11-02 | 2013-10-02 | 拜耳知识产权有限责任公司 | 苯基取代的二环辛烷-1,3-二酮衍生物 |
| DK2668158T3 (en) | 2011-01-25 | 2018-10-15 | Bayer Cropscience Ag | PROCEDURE FOR PREPARING 1-H-PYRROLIDINE-2,4-DION DERIVATIVES |
| DE102011011040A1 (de) | 2011-02-08 | 2012-08-09 | Bayer Pharma Aktiengesellschaft | (5s,8s)-3-(4'-Chlor-3'-fluor-4-methylbiphenyl-3-yl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-on (Verbindung A) zur Therapie |
| WO2012110518A1 (de) | 2011-02-17 | 2012-08-23 | Bayer Pharma Aktiengesellschaft | Substituierte 3-(biphenyl-3-yl)-8,8-difluor-4-hydroxy-1-azaspiro[4.5]dec-3-en-2-one zur therapie |
| DE102011080405A1 (de) | 2011-08-04 | 2013-02-07 | Bayer Pharma AG | Substituierte 3-(Biphenyl-3-yl)-8,8-difluor-4-hydroxy-1-azaspiro[4.5]dec-3-en-2-one zur Therapie |
| WO2012116960A1 (de) | 2011-03-01 | 2012-09-07 | Bayer Cropscience Ag | 2-acyloxy-pyrrolin-4-one |
| DE102011080406A1 (de) | 2011-08-04 | 2013-02-07 | Bayer Pharma AG | Substituierte 3-(Biphenyl-3-yl)-4-hydroxy-8-methoxy-1-azaspiro8[4.5]dec-3-en-2-one |
| DK2806741T3 (da) | 2012-01-26 | 2020-05-18 | Bayer Ip Gmbh | Phenylsubstituerede ketoenoler til bekæmpelse af fiskeparasitter |
| CA2971558C (en) | 2014-12-18 | 2023-03-07 | Nissan Chemical Industries, Ltd. | Ketone or oxime compound, and herbicide |
| US10519085B2 (en) | 2016-01-15 | 2019-12-31 | Bayer Cropscience Aktiengesellschaft | Process for preparing substituted 2-arylethanols |
| WO2019197620A1 (de) | 2018-04-13 | 2019-10-17 | Bayer Cropscience Aktiengesellschaft | Verwendung von tetramsäurederivaten zur bekämpfung von speziellen insekten |
| WO2019197617A1 (de) | 2018-04-13 | 2019-10-17 | Bayer Cropscience Aktiengesellschaft | Verwendung von tetramsäurederivaten zur bekämpfung von tierischen schädlingen durch angiessen, tröpfchenapplikation. pflanzlochbehandlung oder furchenapplikation |
| WO2019197618A1 (de) | 2018-04-13 | 2019-10-17 | Bayer Cropscience Aktiengesellschaft | Verwendung von tetramsäurederivaten zur bekämpfung von speziellen insekten |
| WO2019197652A1 (de) | 2018-04-13 | 2019-10-17 | Bayer Aktiengesellschaft | Feststoff-formulierung insektizider mischungen |
| AU2019250592B2 (en) | 2018-04-13 | 2024-06-27 | Bayer Aktiengesellschaft | Use of tetramic acid derivatives for controlling pests by watering or droplet application |
| AU2020244063A1 (en) * | 2019-03-15 | 2021-10-07 | Bayer Aktiengesellschaft | Specifically substituted 3-(2-alkoxy-6-alkyl-4-propinylphenyl)-3-pyrrolin-2-ones and their use as herbicides |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4386086A (en) * | 1978-08-24 | 1983-05-31 | Union Carbide Corporation | Method for controlling ectoparasitic Acarina |
| US4351666A (en) * | 1980-06-27 | 1982-09-28 | Union Carbide Corporation | Enol derivatives of 2-aryl-1,3-cyclohexanedione compound as sugar enhancer for plants |
| DE4004496A1 (de) * | 1990-02-14 | 1991-08-22 | Bayer Ag | 3-aryl-pyrrolidin-2,4-dion-derivate |
| WO1996020196A1 (de) * | 1994-12-23 | 1996-07-04 | Bayer Aktiengesellschaft | 3-aryl-tetronsäure-derivate, deren herstellung und deren verwendung als schädlingsbekämpfungsmittel |
| BR0011702B1 (pt) * | 1999-06-16 | 2011-01-25 | processo para preparação de derivados herbicidas. | |
| WO2001017973A2 (de) * | 1999-09-07 | 2001-03-15 | Syngenta Participations Ag | Neue herbizide |
| PT1481970E (pt) * | 1999-09-07 | 2006-07-31 | Syngenta Participations Ag | Novos herbicidas |
-
2003
- 2003-01-21 JP JP2003562121A patent/JP2005516973A/ja active Pending
- 2003-01-21 HU HU0402592A patent/HUP0402592A2/hu unknown
- 2003-01-21 CN CN03802204.4A patent/CN1615310A/zh active Pending
- 2003-01-21 EP EP03702483A patent/EP1468000A1/en not_active Withdrawn
- 2003-01-21 US US10/502,564 patent/US20050090399A1/en not_active Abandoned
- 2003-01-21 BR BR0306957-5A patent/BR0306957A/pt not_active Application Discontinuation
- 2003-01-21 MX MXPA04006991A patent/MXPA04006991A/es not_active Application Discontinuation
- 2003-01-21 CA CA002470674A patent/CA2470674A1/en not_active Abandoned
- 2003-01-21 WO PCT/EP2003/000555 patent/WO2003062244A1/en not_active Ceased
- 2003-01-21 RU RU2004125878/04A patent/RU2004125878A/ru not_active Application Discontinuation
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2005516973A5 (cg-RX-API-DMAC10.html) | ||
| RU2004125878A (ru) | Фенилзамещенные гетероциклические соединения, пригодные для применения в качестве гербицидов | |
| RU2222536C2 (ru) | Производные пиримидинилбензимидазола и триазинилбензимидазола и содержащий их фунгицид для сельского хозяйства/садоводства | |
| JP2010520866A5 (cg-RX-API-DMAC10.html) | ||
| JP2005522484A5 (cg-RX-API-DMAC10.html) | ||
| JP2004501144A5 (cg-RX-API-DMAC10.html) | ||
| RU2005108046A (ru) | 1, 2, 3-триазольные производные, обладающие бактерицидной (например, фунгицидной)активностью | |
| AR045246A1 (es) | Derivados de pirazolidin-3,5-diona 4-bifenil-substituidos | |
| RU99111264A (ru) | Производные пиримидинилоксиалканамидов и фунгициды для сельского хозяйства или садоводства | |
| RU2002116255A (ru) | Аминогетероцикламидные производные, обладающие пестицидной активностью | |
| KR920004357A (ko) | 살충제 | |
| AR028821A1 (es) | Compuestos derivados de azina y azol; un proceso para preparar dichos compuestos; una composicion fungicida, insecticida, acaricida, molusquicida o nematicida que los comprende; un metodo para combatir y controlar hongos insectos, acaros, nematodos o moluscos | |
| RU2008119994A (ru) | Ингибиторы калиевых каналов | |
| RU2004120790A (ru) | Аминоацетонитрильные производные и их применение для борьбы с паразитами | |
| MX9205016A (es) | N-alcanoilaminometil y n-aroilaminometil pirrol y procedimiento para su preparacion. | |
| RU2004137657A (ru) | Органические соединения | |
| KR900012903A (ko) | 피롤리딘 화합물 및 약제학적 용도 | |
| BR9100013A (pt) | Compostos,processo para a preparacao dos mesmos,composicao fungicida e processo para combater fungos | |
| DE69625709D1 (de) | Alpha-substituierte heterozyklische benzylderivate, zwischenverbindungen zu ihrer herstellung und pestizide die diese als aktiver bestandteil enthalten | |
| KR970702850A (ko) | 알파-(피라졸-3-일)-옥시메틸렌-페닐부텐산 메틸 에스테르 및 유해 진균 또는 동물 해충에 대한 그의 용도(Alpha-(Pyrazol-3-yl)-Oxymethylene-Phenylbutenic Acid Methyl Esters and the Use Thereof Against Harmful Fungi or Animal Pests) | |
| ATE129237T1 (de) | 3,3-bis(alkylthio>-2-pyridylacrylsäurederivate als fungizide. | |
| JP2003500481A5 (cg-RX-API-DMAC10.html) | ||
| AR035526A1 (es) | Acidos homotetramicos y homotetronicos hetaril-substituidos; procedimiento para su preparacion; compuestos intermediarios; agentes pesticidas, microbicidas y herbicidas; metodo para el control de las pestes animales; uso de estos compuestos para el control de las pestes animales, del crecimiento ind | |
| EA200801567A1 (ru) | Малононитрильные соединения | |
| KR950704231A (ko) | 치환된 오르토-에테닐페닐아세트산 유도체(Substituted Ortho-Ethenylphenyl Acetic Acid Derivatives) |