JP2004501904A - Hpve1ヘリカーゼ阻害剤としてのベンゾジアゼピン - Google Patents
Hpve1ヘリカーゼ阻害剤としてのベンゾジアゼピン Download PDFInfo
- Publication number
- JP2004501904A JP2004501904A JP2002505380A JP2002505380A JP2004501904A JP 2004501904 A JP2004501904 A JP 2004501904A JP 2002505380 A JP2002505380 A JP 2002505380A JP 2002505380 A JP2002505380 A JP 2002505380A JP 2004501904 A JP2004501904 A JP 2004501904A
- Authority
- JP
- Japan
- Prior art keywords
- methyl
- dihydro
- formula
- mmol
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 108060004795 Methyltransferase Proteins 0.000 title abstract description 9
- 239000003112 inhibitor Substances 0.000 title abstract description 9
- 229940049706 benzodiazepine Drugs 0.000 title description 4
- 150000001557 benzodiazepines Chemical class 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 64
- 201000010099 disease Diseases 0.000 claims abstract description 9
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 9
- 230000001404 mediated effect Effects 0.000 claims abstract description 9
- -1 heterocyclylamino Chemical group 0.000 claims description 123
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 39
- 125000000217 alkyl group Chemical group 0.000 claims description 29
- 150000003839 salts Chemical class 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 21
- 125000000623 heterocyclic group Chemical group 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 125000003342 alkenyl group Chemical group 0.000 claims description 10
- 125000000304 alkynyl group Chemical group 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 8
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 8
- 239000003814 drug Substances 0.000 claims description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 8
- 125000003107 substituted aryl group Chemical group 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 7
- 125000005100 aryl amino carbonyl group Chemical group 0.000 claims description 7
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 7
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 6
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 6
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 5
- 125000006323 alkenyl amino group Chemical group 0.000 claims description 5
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 5
- 125000004949 alkyl amino carbonyl amino group Chemical group 0.000 claims description 5
- 125000003282 alkyl amino group Chemical group 0.000 claims description 5
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 5
- 125000004414 alkyl thio group Chemical group 0.000 claims description 5
- 125000006319 alkynyl amino group Chemical group 0.000 claims description 5
- 125000001769 aryl amino group Chemical group 0.000 claims description 5
- 125000004658 aryl carbonyl amino group Chemical group 0.000 claims description 5
- 125000005162 aryl oxy carbonyl amino group Chemical group 0.000 claims description 5
- 125000004657 aryl sulfonyl amino group Chemical group 0.000 claims description 5
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 5
- 125000005110 aryl thio group Chemical group 0.000 claims description 5
- 125000004104 aryloxy group Chemical group 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 5
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims description 5
- 125000005167 cycloalkylaminocarbonyl group Chemical group 0.000 claims description 5
- 125000005169 cycloalkylcarbonylamino group Chemical group 0.000 claims description 5
- 125000005170 cycloalkyloxycarbonyl group Chemical group 0.000 claims description 5
- 125000005144 cycloalkylsulfonyl group Chemical group 0.000 claims description 5
- 125000005366 cycloalkylthio group Chemical group 0.000 claims description 5
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- 125000006517 heterocyclyl carbonyl group Chemical group 0.000 claims description 5
- 125000005844 heterocyclyloxy group Chemical group 0.000 claims description 5
- 125000004468 heterocyclylthio group Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 4
- 230000008878 coupling Effects 0.000 claims description 4
- 238000010168 coupling process Methods 0.000 claims description 4
- 238000005859 coupling reaction Methods 0.000 claims description 4
- 125000006310 cycloalkyl amino group Chemical group 0.000 claims description 4
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 4
- 239000013543 active substance Substances 0.000 claims description 3
- 150000004985 diamines Chemical class 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910019142 PO4 Inorganic materials 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims description 2
- 239000010452 phosphate Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000002552 dosage form Substances 0.000 claims 1
- 230000002265 prevention Effects 0.000 claims 1
- 241000701806 Human papillomavirus Species 0.000 abstract description 15
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 abstract 1
- 230000001225 therapeutic effect Effects 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 159
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 155
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 153
- 239000000243 solution Substances 0.000 description 83
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 81
- 239000000203 mixture Substances 0.000 description 78
- 239000007787 solid Substances 0.000 description 65
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 52
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 46
- 239000002904 solvent Substances 0.000 description 46
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 44
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 39
- 239000000047 product Substances 0.000 description 33
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 31
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 31
- 125000005504 styryl group Chemical group 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 27
- 238000004440 column chromatography Methods 0.000 description 27
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 26
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 26
- 235000019341 magnesium sulphate Nutrition 0.000 description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- 238000001704 evaporation Methods 0.000 description 22
- 230000008020 evaporation Effects 0.000 description 22
- 239000007858 starting material Substances 0.000 description 22
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 22
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 21
- 239000006185 dispersion Substances 0.000 description 21
- 239000002480 mineral oil Substances 0.000 description 21
- 235000010446 mineral oil Nutrition 0.000 description 21
- 239000012312 sodium hydride Substances 0.000 description 21
- 229910000104 sodium hydride Inorganic materials 0.000 description 21
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 20
- 239000000741 silica gel Substances 0.000 description 20
- 229910002027 silica gel Inorganic materials 0.000 description 20
- 238000010828 elution Methods 0.000 description 19
- ZWUSBSHBFFPRNE-UHFFFAOYSA-N 3,4-dichlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1Cl ZWUSBSHBFFPRNE-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 18
- 229920002554 vinyl polymer Polymers 0.000 description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 17
- 239000012074 organic phase Substances 0.000 description 15
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 239000003208 petroleum Substances 0.000 description 14
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 13
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 12
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 150000001299 aldehydes Chemical class 0.000 description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- 239000003921 oil Substances 0.000 description 12
- 235000019198 oils Nutrition 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 10
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical group COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 10
- 229920006395 saturated elastomer Polymers 0.000 description 10
- 201000010153 skin papilloma Diseases 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 241001480079 Corymbia calophylla Species 0.000 description 9
- 235000006552 Liquidambar styraciflua Nutrition 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- JXHYCCGOZUGBFD-UHFFFAOYSA-N benzoic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=CC=C1 JXHYCCGOZUGBFD-UHFFFAOYSA-N 0.000 description 9
- KFIGICHILYTCJF-UHFFFAOYSA-N n'-methylethane-1,2-diamine Chemical compound CNCCN KFIGICHILYTCJF-UHFFFAOYSA-N 0.000 description 9
- JPHKMYXKNKLNDF-UHFFFAOYSA-N 3,4-difluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1F JPHKMYXKNKLNDF-UHFFFAOYSA-N 0.000 description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 208000000260 Warts Diseases 0.000 description 8
- MJUJXFBTEFXVKU-UHFFFAOYSA-N diethyl phosphonate Chemical compound CCOP(=O)OCC MJUJXFBTEFXVKU-UHFFFAOYSA-N 0.000 description 8
- 125000003916 ethylene diamine group Chemical group 0.000 description 8
- YOMBUJAFGMOIGS-UHFFFAOYSA-N 2-fluoro-1-phenylethanone Chemical compound FCC(=O)C1=CC=CC=C1 YOMBUJAFGMOIGS-UHFFFAOYSA-N 0.000 description 7
- MQOQWAIWHVZJDV-UHFFFAOYSA-N 5-(diethoxyphosphorylmethylidene)-1-methyl-3,4-dihydro-2h-1,4-benzodiazepine Chemical compound CCOP(=O)(OCC)C=C1NCCN(C)C2=CC=CC=C12 MQOQWAIWHVZJDV-UHFFFAOYSA-N 0.000 description 7
- 102000004190 Enzymes Human genes 0.000 description 7
- 108090000790 Enzymes Proteins 0.000 description 7
- 239000000546 pharmaceutical excipient Substances 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 7
- CQKLAEUCMKGSEQ-UHFFFAOYSA-N 2-(4-chlorophenyl)sulfanylbenzaldehyde Chemical compound C1=CC(Cl)=CC=C1SC1=CC=CC=C1C=O CQKLAEUCMKGSEQ-UHFFFAOYSA-N 0.000 description 6
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 6
- VOLRSQPSJGXRNJ-UHFFFAOYSA-N 4-nitrobenzyl bromide Chemical compound [O-][N+](=O)C1=CC=C(CBr)C=C1 VOLRSQPSJGXRNJ-UHFFFAOYSA-N 0.000 description 6
- 108091006112 ATPases Proteins 0.000 description 6
- 102000057290 Adenosine Triphosphatases Human genes 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- GTDQGKWDWVUKTI-UHFFFAOYSA-N o-aminoacetophenone Chemical group CC(=O)C1=CC=CC=C1N GTDQGKWDWVUKTI-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 5
- NSTREUWFTAOOKS-UHFFFAOYSA-N 2-fluorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1F NSTREUWFTAOOKS-UHFFFAOYSA-N 0.000 description 5
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 5
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 5
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 5
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 5
- 238000003556 assay Methods 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- 239000012230 colorless oil Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000012299 nitrogen atmosphere Substances 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- QNMBSXGYAQZCTN-UHFFFAOYSA-N thiophen-3-ylboronic acid Chemical compound OB(O)C=1C=CSC=1 QNMBSXGYAQZCTN-UHFFFAOYSA-N 0.000 description 5
- CUHJQPWOSWMIAU-UHFFFAOYSA-N 1-[2-(methylamino)phenyl]ethanone Chemical compound CNC1=CC=CC=C1C(C)=O CUHJQPWOSWMIAU-UHFFFAOYSA-N 0.000 description 4
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 4
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 4
- GOUHYARYYWKXHS-UHFFFAOYSA-N 4-formylbenzoic acid Chemical compound OC(=O)C1=CC=C(C=O)C=C1 GOUHYARYYWKXHS-UHFFFAOYSA-N 0.000 description 4
- CGMQYNRPGGSZDE-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepin-7-amine;hydrochloride Chemical compound Cl.C12=CC(N)=CC=C2N(C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 CGMQYNRPGGSZDE-UHFFFAOYSA-N 0.000 description 4
- CEVHCBDOCFIBCU-UHFFFAOYSA-N 8-bromo-5-(diethoxyphosphorylmethylidene)-1-methyl-3,4-dihydro-2h-1,4-benzodiazepine Chemical compound CCOP(=O)(OCC)C=C1NCCN(C)C2=CC(Br)=CC=C12 CEVHCBDOCFIBCU-UHFFFAOYSA-N 0.000 description 4
- 206010059313 Anogenital warts Diseases 0.000 description 4
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000002619 bicyclic group Chemical group 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- VHJLVAABSRFDPM-QWWZWVQMSA-N dithiothreitol Chemical compound SC[C@@H](O)[C@H](O)CS VHJLVAABSRFDPM-QWWZWVQMSA-N 0.000 description 4
- 239000006260 foam Substances 0.000 description 4
- 239000007903 gelatin capsule Substances 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- NLWBJPPMPLPZIE-UHFFFAOYSA-N methyl 4-(bromomethyl)benzoate Chemical group COC(=O)C1=CC=C(CBr)C=C1 NLWBJPPMPLPZIE-UHFFFAOYSA-N 0.000 description 4
- 229940095102 methyl benzoate Drugs 0.000 description 4
- 239000008188 pellet Substances 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 4
- 229920005862 polyol Polymers 0.000 description 4
- 150000003077 polyols Chemical class 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- IDPURXSQCKYKIJ-UHFFFAOYSA-N 1-(4-methoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C=C1 IDPURXSQCKYKIJ-UHFFFAOYSA-N 0.000 description 3
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 3
- QGYMFOOELVGFAE-UHFFFAOYSA-N 1-methyl-2,3-dihydro-1,4-benzodiazepine Chemical compound CN1CCN=CC2=CC=CC=C12 QGYMFOOELVGFAE-UHFFFAOYSA-N 0.000 description 3
- DCQNBXKUNNLSIW-UHFFFAOYSA-N 2-[5-[2-(3,4-dichlorophenyl)ethenyl]-2,3-dihydro-1,4-benzodiazepin-1-yl]acetic acid Chemical compound C12=CC=CC=C2N(CC(=O)O)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 DCQNBXKUNNLSIW-UHFFFAOYSA-N 0.000 description 3
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 3
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 3
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 3
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 3
- YWZOMJHHYPCPHK-MDZDMXLPSA-N 3-[(e)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenol Chemical compound C12=CC=CC=C2N(C)CCN=C1\C=C\C1=CC=CC(O)=C1 YWZOMJHHYPCPHK-MDZDMXLPSA-N 0.000 description 3
- PCOWQWMDARDUBS-UHFFFAOYSA-N 8-chloro-5-(diethoxyphosphorylmethylidene)-1-methyl-3,4-dihydro-2h-1,4-benzodiazepine Chemical compound CCOP(=O)(OCC)C=C1NCCN(C)C2=CC(Cl)=CC=C12 PCOWQWMDARDUBS-UHFFFAOYSA-N 0.000 description 3
- WLHMVWLQOCVSPK-UHFFFAOYSA-N 9-[2-(3,4-dichlorophenyl)ethenyl]-5,7-dihydro-[1,3]dioxolo[4,5-h][1,4]benzodiazepin-6-one Chemical compound C1=C(Cl)C(Cl)=CC=C1C=CC(C1=C2)=NCC(=O)NC1=CC1=C2OCO1 WLHMVWLQOCVSPK-UHFFFAOYSA-N 0.000 description 3
- CNTNCNKXATYBMO-UHFFFAOYSA-N 9-chloro-5-(diethoxyphosphorylmethylidene)-1,2,3,4-tetrahydro-1,4-benzodiazepine Chemical compound CCOP(=O)(OCC)C=C1NCCNC2=C(Cl)C=CC=C12 CNTNCNKXATYBMO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- 101710175625 Maltose/maltodextrin-binding periplasmic protein Proteins 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 3
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- 239000008298 dragée Substances 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- PKPKRCIEFPHBHC-UHFFFAOYSA-N methyl 4-[[5-[2-(3,4-dichlorophenyl)ethenyl]-2,3-dihydro-1,4-benzodiazepin-1-yl]methyl]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1CN1C2=CC=CC=C2C(C=CC=2C=C(Cl)C(Cl)=CC=2)=NCC1 PKPKRCIEFPHBHC-UHFFFAOYSA-N 0.000 description 3
- MZDGXTXYHXDWIM-UHFFFAOYSA-N methyl benzoate;hydrochloride Chemical compound Cl.COC(=O)C1=CC=CC=C1 MZDGXTXYHXDWIM-UHFFFAOYSA-N 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 108090000623 proteins and genes Proteins 0.000 description 3
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 125000000169 tricyclic heterocycle group Chemical group 0.000 description 3
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 3
- 239000011534 wash buffer Substances 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 2
- CEGBRSQPRQXALB-UHFFFAOYSA-N (3,4-dichlorophenyl)methanethiol Chemical compound SCC1=CC=C(Cl)C(Cl)=C1 CEGBRSQPRQXALB-UHFFFAOYSA-N 0.000 description 2
- VLSDXINSOMDCBK-BQYQJAHWSA-N (E)-1,1'-azobis(N,N-dimethylformamide) Chemical compound CN(C)C(=O)\N=N\C(=O)N(C)C VLSDXINSOMDCBK-BQYQJAHWSA-N 0.000 description 2
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 2
- HFTTTXIMZGFYFM-UHFFFAOYSA-N 1-[5-[2-(3,4-dichlorophenyl)ethenyl]-2,3-dihydro-1,4-benzodiazepin-1-yl]ethanone;hydrochloride Chemical compound Cl.C12=CC=CC=C2N(C(=O)C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 HFTTTXIMZGFYFM-UHFFFAOYSA-N 0.000 description 2
- QEHRLRCOYMVAFL-UHFFFAOYSA-N 1-methyl-2,3,4,5-tetrahydro-1,4-benzodiazepine Chemical compound CN1CCNCC2=CC=CC=C12 QEHRLRCOYMVAFL-UHFFFAOYSA-N 0.000 description 2
- 238000005160 1H NMR spectroscopy Methods 0.000 description 2
- IOHPVZBSOKLVMN-UHFFFAOYSA-N 2-(2-phenylethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1CCC1=CC=CC=C1 IOHPVZBSOKLVMN-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- FLJYITGGXKURAU-UHFFFAOYSA-N 2-[5-[2-(3,4-dichlorophenyl)ethenyl]-2,3-dihydro-1,4-benzodiazepin-1-yl]-n-(2-methoxyethyl)acetamide;dihydrochloride Chemical compound Cl.Cl.C12=CC=CC=C2N(CC(=O)NCCOC)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 FLJYITGGXKURAU-UHFFFAOYSA-N 0.000 description 2
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical compound C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 description 2
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 2
- COWMUQNZNYZPLS-UHFFFAOYSA-N 2-benzylsulfanyl-5-nitrobenzaldehyde Chemical compound O=CC1=CC([N+](=O)[O-])=CC=C1SCC1=CC=CC=C1 COWMUQNZNYZPLS-UHFFFAOYSA-N 0.000 description 2
- JYUKWNINFXUSNL-UHFFFAOYSA-N 2-diethoxyphosphoryl-1-(2-fluorophenyl)ethanone Chemical compound CCOP(=O)(OCC)CC(=O)C1=CC=CC=C1F JYUKWNINFXUSNL-UHFFFAOYSA-N 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- VEYIZGZJPYRICS-GVYCEHEKSA-N 3-[(e)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]-4-(3-phenylpropylsulfanyl)aniline;hydrochloride Chemical compound Cl.C12=CC=CC=C2N(C)CCN=C1\C=C\C1=CC(N)=CC=C1SCCCC1=CC=CC=C1 VEYIZGZJPYRICS-GVYCEHEKSA-N 0.000 description 2
- RUROFEVDCUGKHD-UHFFFAOYSA-N 3-bromoprop-1-enylbenzene Chemical compound BrCC=CC1=CC=CC=C1 RUROFEVDCUGKHD-UHFFFAOYSA-N 0.000 description 2
- YAOZCMANASAVFN-UHFFFAOYSA-N 3-chloro-2-fluorobenzaldehyde Chemical compound FC1=C(Cl)C=CC=C1C=O YAOZCMANASAVFN-UHFFFAOYSA-N 0.000 description 2
- QCKOYQXFBZOPNS-UHFFFAOYSA-N 4-[[5-[2-(3,4-dichlorophenyl)ethenyl]-2,3-dihydro-1,4-benzodiazepin-1-yl]methyl]benzoic acid;dihydrochloride Chemical compound Cl.Cl.C1=CC(C(=O)O)=CC=C1CN1C2=CC=CC=C2C(C=CC=2C=C(Cl)C(Cl)=CC=2)=NCC1 QCKOYQXFBZOPNS-UHFFFAOYSA-N 0.000 description 2
- 125000004042 4-aminobutyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])N([H])[H] 0.000 description 2
- HLVNPWZJFANYCG-UAIOKUCGSA-N 4-benzylsulfanyl-3-[(e)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]aniline;dihydrochloride Chemical compound Cl.Cl.C12=CC=CC=C2N(C)CCN=C1\C=C\C1=CC(N)=CC=C1SCC1=CC=CC=C1 HLVNPWZJFANYCG-UAIOKUCGSA-N 0.000 description 2
- UGHXUQWQPUEAIJ-UHFFFAOYSA-N 5-(diethoxyphosphorylmethylidene)-1-methyl-8-thiophen-3-yl-3,4-dihydro-2h-1,4-benzodiazepine Chemical compound C=1C=C2C(=CP(=O)(OCC)OCC)NCCN(C)C2=CC=1C=1C=CSC=1 UGHXUQWQPUEAIJ-UHFFFAOYSA-N 0.000 description 2
- CTNCCQQZTDWUAG-UHFFFAOYSA-N 5-(diethoxyphosphorylmethylidene)-7-fluoro-1-methyl-3,4-dihydro-2h-1,4-benzodiazepine Chemical compound CCOP(=O)(OCC)C=C1NCCN(C)C2=CC=C(F)C=C12 CTNCCQQZTDWUAG-UHFFFAOYSA-N 0.000 description 2
- UCFYVZRAEAFTRM-UHFFFAOYSA-N 5-(diethoxyphosphorylmethylidene)-8-(3-methoxyphenyl)-1-methyl-3,4-dihydro-2h-1,4-benzodiazepine Chemical compound C=1C=C2C(=CP(=O)(OCC)OCC)NCCN(C)C2=CC=1C1=CC=CC(OC)=C1 UCFYVZRAEAFTRM-UHFFFAOYSA-N 0.000 description 2
- YHMYSFOFFGWIRB-UHFFFAOYSA-N 5-(diethoxyphosphorylmethylidene)-8-fluoro-1-methyl-3,4-dihydro-2h-1,4-benzodiazepine Chemical compound CCOP(=O)(OCC)C=C1NCCN(C)C2=CC(F)=CC=C12 YHMYSFOFFGWIRB-UHFFFAOYSA-N 0.000 description 2
- UJPSWQUYZYOMBQ-UHFFFAOYSA-N 5-[2-(2-benzylsulfanylphenyl)ethenyl]-8-fluoro-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC=C(F)C=C2N(C)CCN=C1C=CC1=CC=CC=C1SCC1=CC=CC=C1 UJPSWQUYZYOMBQ-UHFFFAOYSA-N 0.000 description 2
- XFNFHRADTYXTRR-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepin-8-ol hydrochloride Chemical compound Cl.ClC=1C=C(C=CC2=N/CCN(C3=C2C=CC(=C3)O)C)C=CC1Cl XFNFHRADTYXTRR-UHFFFAOYSA-N 0.000 description 2
- ILBHZGOICQUZHV-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-8-(thiophen-2-ylmethoxy)-2,3-dihydro-1,4-benzodiazepine Chemical compound C12=CC=C(OCC=3SC=CC=3)C=C2N(C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 ILBHZGOICQUZHV-UHFFFAOYSA-N 0.000 description 2
- ZMNBBXAWUOJXRR-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-1-propan-2-yl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC=CC=C2N(C(C)C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 ZMNBBXAWUOJXRR-UHFFFAOYSA-N 0.000 description 2
- NIFSNLAIAZONPG-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-2,3-dihydro-1h-1,4-benzodiazepine Chemical compound C1=C(Cl)C(Cl)=CC=C1C=CC1=NCCNC2=CC=CC=C12 NIFSNLAIAZONPG-UHFFFAOYSA-N 0.000 description 2
- GTONUWCACPVIRI-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-2,3-dihydro-1h-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C1=C(Cl)C(Cl)=CC=C1C=CC1=NCCNC2=CC=CC=C12 GTONUWCACPVIRI-UHFFFAOYSA-N 0.000 description 2
- UXCLPVNJULVEAY-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-8-(3-methoxyphenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.COC1=CC=CC(C=2C=C3C(C(=NCCN3C)C=CC=3C=C(Cl)C(Cl)=CC=3)=CC=2)=C1 UXCLPVNJULVEAY-UHFFFAOYSA-N 0.000 description 2
- RQPLLZCGDHDSNU-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-8-(4-methoxyphenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepine Chemical compound C1=CC(OC)=CC=C1C1=CC=C2C(C=CC=3C=C(Cl)C(Cl)=CC=3)=NCCN(C)C2=C1 RQPLLZCGDHDSNU-UHFFFAOYSA-N 0.000 description 2
- GEOFMVQWWBDYTH-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-8-ethenyl-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC=C(C=C)C=C2N(C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 GEOFMVQWWBDYTH-UHFFFAOYSA-N 0.000 description 2
- QBDSXCQIIJTSDL-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-n-ethyl-2,3-dihydro-1,4-benzodiazepine-1-carboxamide Chemical compound C12=CC=CC=C2N(C(=O)NCC)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 QBDSXCQIIJTSDL-UHFFFAOYSA-N 0.000 description 2
- WWEIYRBOYPICBJ-UHFFFAOYSA-N 5-[4-(3-bromophenyl)pyridin-3-yl]-7-fluoro-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC(F)=CC=C2N(C)CCN=C1C1=CN=CC=C1C1=CC=CC(Br)=C1 WWEIYRBOYPICBJ-UHFFFAOYSA-N 0.000 description 2
- XENPPPAJZRTENW-UHFFFAOYSA-N 5-nitro-2-(2-phenylethylamino)benzaldehyde Chemical compound O=CC1=CC([N+](=O)[O-])=CC=C1NCCC1=CC=CC=C1 XENPPPAJZRTENW-UHFFFAOYSA-N 0.000 description 2
- DVGMXGYRROTEGR-UHFFFAOYSA-N 9-chloro-5-[2-(3,4-dichlorophenyl)ethenyl]-2,3-dihydro-1H-1,4-benzodiazepine dihydrochloride Chemical compound Cl.Cl.ClC1=CC=CC=2/C(=N/CCNC21)/C=CC2=CC(=C(C=C2)Cl)Cl DVGMXGYRROTEGR-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- 208000000907 Condylomata Acuminata Diseases 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 208000000901 Focal Epithelial Hyperplasia Diseases 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 102100025912 Melanopsin Human genes 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 2
- OKJIRPAQVSHGFK-UHFFFAOYSA-N N-acetylglycine Chemical compound CC(=O)NCC(O)=O OKJIRPAQVSHGFK-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- HZLGAZIRNRIIAR-YGCVIUNWSA-N acetic acid;4-[(e)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]benzoic acid Chemical compound CC(O)=O.C12=CC=CC=C2N(C)CCN=C1\C=C\C1=CC=C(C(O)=O)C=C1 HZLGAZIRNRIIAR-YGCVIUNWSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 208000025009 anogenital human papillomavirus infection Diseases 0.000 description 2
- 201000004201 anogenital venereal wart Diseases 0.000 description 2
- HUMNYLRZRPPJDN-KWCOIAHCSA-N benzaldehyde Chemical group O=[11CH]C1=CC=CC=C1 HUMNYLRZRPPJDN-KWCOIAHCSA-N 0.000 description 2
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 208000020082 intraepithelial neoplasia Diseases 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 239000013213 metal-organic polyhedra Substances 0.000 description 2
- 238000012011 method of payment Methods 0.000 description 2
- UBRFPKVSAJHOFF-UHFFFAOYSA-N n-(2-acetylphenyl)-2-azido-n-methylacetamide Chemical compound [N-]=[N+]=NCC(=O)N(C)C1=CC=CC=C1C(C)=O UBRFPKVSAJHOFF-UHFFFAOYSA-N 0.000 description 2
- CZSFXUAMMVLHCF-UHFFFAOYSA-N n-(2-acetylphenyl)-2-bromo-n-methylacetamide Chemical compound BrCC(=O)N(C)C1=CC=CC=C1C(C)=O CZSFXUAMMVLHCF-UHFFFAOYSA-N 0.000 description 2
- DYZUVNBTHYUVDG-YFMOEUEHSA-N n-[(4-methoxyphenyl)methyl]-4-[(e)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]benzamide;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1CNC(=O)C(C=C1)=CC=C1\C=C\C1=NCCN(C)C2=CC=CC=C12 DYZUVNBTHYUVDG-YFMOEUEHSA-N 0.000 description 2
- WGLYKZMKHDSFOA-UHFFFAOYSA-N n-[2-(2-acetyl-n-methylanilino)-2-oxoethyl]-2,2-dimethylpropanamide Chemical compound CC(C)(C)C(=O)NCC(=O)N(C)C1=CC=CC=C1C(C)=O WGLYKZMKHDSFOA-UHFFFAOYSA-N 0.000 description 2
- ITASPILCATVQND-ZRDIBKRKSA-N n-[2-[2-[(e)-3-(3,4-dichlorophenyl)prop-2-enoyl]-n-methylanilino]-2-oxoethyl]-2,2-dimethylpropanamide Chemical compound CC(C)(C)C(=O)NCC(=O)N(C)C1=CC=CC=C1C(=O)\C=C\C1=CC=C(Cl)C(Cl)=C1 ITASPILCATVQND-ZRDIBKRKSA-N 0.000 description 2
- ZMWKOJWLIOUWRD-RPVSWQTKSA-N n-[4-[2-[(e)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenyl]sulfanylphenyl]acetamide;dihydrochloride Chemical compound Cl.Cl.C12=CC=CC=C2N(C)CCN=C1\C=C\C1=CC=CC=C1SC1=CC=C(NC(C)=O)C=C1 ZMWKOJWLIOUWRD-RPVSWQTKSA-N 0.000 description 2
- IMCGWBSYIJWUCV-UHFFFAOYSA-N n-[5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepin-7-yl]methanesulfonamide Chemical compound C12=CC(NS(C)(=O)=O)=CC=C2N(C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 IMCGWBSYIJWUCV-UHFFFAOYSA-N 0.000 description 2
- MLWGYEVHOVTFNK-UHFFFAOYSA-N n-methyl-2-[2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]-4-nitroaniline;dihydrochloride Chemical compound Cl.Cl.CNC1=CC=C([N+]([O-])=O)C=C1C=CC1=NCCN(C)C2=CC=CC=C12 MLWGYEVHOVTFNK-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- OVURNWRQBDMPAN-UHFFFAOYSA-N tert-butyl n-(3-acetyl-4-fluorophenyl)carbamate Chemical compound CC(=O)C1=CC(NC(=O)OC(C)(C)C)=CC=C1F OVURNWRQBDMPAN-UHFFFAOYSA-N 0.000 description 2
- ZPHGMBGIFODUMF-UHFFFAOYSA-N thiophen-2-ylmethanol Chemical compound OCC1=CC=CS1 ZPHGMBGIFODUMF-UHFFFAOYSA-N 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 230000029812 viral genome replication Effects 0.000 description 2
- PXJACNDVRNAFHD-UHFFFAOYSA-N (2-methoxyphenyl)methanamine Chemical group COC1=CC=CC=C1CN PXJACNDVRNAFHD-UHFFFAOYSA-N 0.000 description 1
- NLLGFYPSWCMUIV-UHFFFAOYSA-N (3-methoxyphenyl)boronic acid Chemical compound COC1=CC=CC(B(O)O)=C1 NLLGFYPSWCMUIV-UHFFFAOYSA-N 0.000 description 1
- GRRIMVWABNHKBX-UHFFFAOYSA-N (3-methoxyphenyl)methanamine Chemical group COC1=CC=CC(CN)=C1 GRRIMVWABNHKBX-UHFFFAOYSA-N 0.000 description 1
- GKQXPTHQTXCXEV-UHFFFAOYSA-N (4-chlorophenyl)methanethiol Chemical compound SCC1=CC=C(Cl)C=C1 GKQXPTHQTXCXEV-UHFFFAOYSA-N 0.000 description 1
- NQMRYYAAICMHPE-UHFFFAOYSA-N (4-methoxyphenyl)boron Chemical compound [B]C1=CC=C(OC)C=C1 NQMRYYAAICMHPE-UHFFFAOYSA-N 0.000 description 1
- VOAAEKKFGLPLLU-UHFFFAOYSA-N (4-methoxyphenyl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=C1 VOAAEKKFGLPLLU-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- 0 *C1C(CP(O)(O)=O)=NCCN(*)C1* Chemical compound *C1C(CP(O)(O)=O)=NCCN(*)C1* 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 1
- KSSXNHGPIDAUAS-UHFFFAOYSA-N 1,4-benzodiazepin-6-one Chemical compound N1=CC=NC=C2C(=O)C=CC=C21 KSSXNHGPIDAUAS-UHFFFAOYSA-N 0.000 description 1
- JRWQSKXAEUPVNJ-UHFFFAOYSA-N 1-(2-fluoro-4,5-dimethoxyphenyl)ethanone Chemical compound COC1=CC(F)=C(C(C)=O)C=C1OC JRWQSKXAEUPVNJ-UHFFFAOYSA-N 0.000 description 1
- WYTBQTMYNBKLHE-UHFFFAOYSA-N 1-(5-amino-2-fluorophenyl)ethanone Chemical compound CC(=O)C1=CC(N)=CC=C1F WYTBQTMYNBKLHE-UHFFFAOYSA-N 0.000 description 1
- SNKAGDBAMNLDME-UHFFFAOYSA-N 1-(6-fluoro-1,3-benzodioxol-5-yl)ethanone Chemical compound C1=C(F)C(C(=O)C)=CC2=C1OCO2 SNKAGDBAMNLDME-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- FPIRBHDGWMWJEP-UHFFFAOYSA-N 1-hydroxy-7-azabenzotriazole Chemical compound C1=CN=C2N(O)N=NC2=C1 FPIRBHDGWMWJEP-UHFFFAOYSA-N 0.000 description 1
- LXNAMIMYJGVUIL-UHFFFAOYSA-N 1-methyl-5-[2-(4-phenoxyphenyl)ethenyl]-2,3-dihydro-1,4-benzodiazepine;hydrochloride Chemical compound Cl.C12=CC=CC=C2N(C)CCN=C1C=CC(C=C1)=CC=C1OC1=CC=CC=C1 LXNAMIMYJGVUIL-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- OWEGMIWEEQEYGQ-UHFFFAOYSA-N 100676-05-9 Natural products OC1C(O)C(O)C(CO)OC1OCC1C(O)C(O)C(O)C(OC2C(OC(O)C(O)C2O)CO)O1 OWEGMIWEEQEYGQ-UHFFFAOYSA-N 0.000 description 1
- MZHUTGQZAZLFKW-UHFFFAOYSA-N 1H-1,2-benzodiazepine-3-carboxylic acid Chemical compound C1=CC(C(=O)O)=NNC2=CC=CC=C21 MZHUTGQZAZLFKW-UHFFFAOYSA-N 0.000 description 1
- JIVBGAGPUWYUEV-UHFFFAOYSA-N 1h-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.N1C=CN=CC2=CC=CC=C12 JIVBGAGPUWYUEV-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical group CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- YTRBTPSUYDJIMC-UHFFFAOYSA-N 2,2-dimethyl-n-[2-(propan-2-ylamino)ethyl]propanamide Chemical compound CC(C)NCCNC(=O)C(C)(C)C YTRBTPSUYDJIMC-UHFFFAOYSA-N 0.000 description 1
- LLMLNAVBOAMOEE-UHFFFAOYSA-N 2,3-dichlorobenzaldehyde Chemical group ClC1=CC=CC(C=O)=C1Cl LLMLNAVBOAMOEE-UHFFFAOYSA-N 0.000 description 1
- JLZVIWSFUPLSOR-UHFFFAOYSA-N 2,3-difluorobenzoic acid Chemical compound OC(=O)C1=CC=CC(F)=C1F JLZVIWSFUPLSOR-UHFFFAOYSA-N 0.000 description 1
- SGFVOGFSQOYNFY-UHFFFAOYSA-N 2-(2-phenylethenylsulfanyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1SC=CC1=CC=CC=C1 SGFVOGFSQOYNFY-UHFFFAOYSA-N 0.000 description 1
- TWJJUQWNKOILOB-UHFFFAOYSA-N 2-(2-phenylethyl)benzaldehyde Chemical compound O=CC1=CC=CC=C1CCC1=CC=CC=C1 TWJJUQWNKOILOB-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- RUHJZSZTSCSTCC-UHFFFAOYSA-N 2-(bromomethyl)naphthalene Chemical compound C1=CC=CC2=CC(CBr)=CC=C21 RUHJZSZTSCSTCC-UHFFFAOYSA-N 0.000 description 1
- PEEGCTCVIIIEBC-UHFFFAOYSA-N 2-[2-(tert-butyldiazenyl)hydrazinyl]-2-methylpropane Chemical compound CC(C)(C)NN\N=N\C(C)(C)C PEEGCTCVIIIEBC-UHFFFAOYSA-N 0.000 description 1
- REMYJKAIEHCLQP-UHFFFAOYSA-N 2-[5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepin-7-yl]acetamide;hydrochloride Chemical compound Cl.C12=CC(CC(N)=O)=CC=C2N(C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 REMYJKAIEHCLQP-UHFFFAOYSA-N 0.000 description 1
- WRHBAKRBZLELCN-UHFFFAOYSA-N 2-[5-[2-(3,4-dichlorophenyl)ethenyl]-2,3-dihydro-1,4-benzodiazepin-1-yl]ethanol;dihydrochloride Chemical compound Cl.Cl.C12=CC=CC=C2N(CCO)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 WRHBAKRBZLELCN-UHFFFAOYSA-N 0.000 description 1
- QEBPAZIUOHNSNZ-UHFFFAOYSA-N 2-[[5-[2-(3,4-dichlorophenyl)ethenyl]-2,3-dihydro-1,4-benzodiazepin-1-yl]methyl]benzoic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=CC=C1CN1C2=CC=CC=C2C(C=CC=2C=C(Cl)C(Cl)=CC=2)=NCC1 QEBPAZIUOHNSNZ-UHFFFAOYSA-N 0.000 description 1
- QPHOEQKRDUGZKO-QHXCTMFKSA-N 2-acetamido-n-[4-benzylsulfanyl-3-[(e)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenyl]acetamide;dihydrochloride Chemical compound Cl.Cl.C12=CC=CC=C2N(C)CCN=C1\C=C\C1=CC(NC(=O)CNC(C)=O)=CC=C1SCC1=CC=CC=C1 QPHOEQKRDUGZKO-QHXCTMFKSA-N 0.000 description 1
- LSTRKXWIZZZYAS-UHFFFAOYSA-N 2-bromoacetyl bromide Chemical compound BrCC(Br)=O LSTRKXWIZZZYAS-UHFFFAOYSA-N 0.000 description 1
- VFVHWCKUHAEDMY-UHFFFAOYSA-N 2-chloro-5-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(C=O)=C1 VFVHWCKUHAEDMY-UHFFFAOYSA-N 0.000 description 1
- RZDOUWDCYULHJX-UHFFFAOYSA-N 2-chloro-6-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(Cl)=C1C=O RZDOUWDCYULHJX-UHFFFAOYSA-N 0.000 description 1
- RAAGZOYMEQDCTD-UHFFFAOYSA-N 2-fluorobenzoyl chloride Chemical compound FC1=CC=CC=C1C(Cl)=O RAAGZOYMEQDCTD-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- SMQUZDBALVYZAC-HOSYLAQJSA-N 2-hydroxybenzaldehyde Chemical group OC1=CC=CC=C1[13CH]=O SMQUZDBALVYZAC-HOSYLAQJSA-N 0.000 description 1
- KDRUIMNNZBMLJR-UHFFFAOYSA-N 2-isopropylaminoethylamine Chemical compound CC(C)NCCN KDRUIMNNZBMLJR-UHFFFAOYSA-N 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- HBEIOONSCXJXSE-UHFFFAOYSA-N 3-[[5-[2-(3,4-dichlorophenyl)ethenyl]-2,3-dihydro-1,4-benzodiazepin-1-yl]methyl]benzoic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=CC(CN2C3=CC=CC=C3C(C=CC=3C=C(Cl)C(Cl)=CC=3)=NCC2)=C1 HBEIOONSCXJXSE-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- FCSSYEWURMTUSM-UHFFFAOYSA-N 3-chloro-2-fluorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1F FCSSYEWURMTUSM-UHFFFAOYSA-N 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- AXDNWYYNJPTSRH-UHFFFAOYSA-N 4-(3-bromophenyl)pyridine-2-carbaldehyde Chemical compound BrC1=CC=CC(C=2C=C(C=O)N=CC=2)=C1 AXDNWYYNJPTSRH-UHFFFAOYSA-N 0.000 description 1
- XRKWGCMKURRWTH-UHFFFAOYSA-N 4-(3-bromophenyl)pyridine-3-carbaldehyde Chemical compound BrC1=CC=CC(C=2C(=CN=CC=2)C=O)=C1 XRKWGCMKURRWTH-UHFFFAOYSA-N 0.000 description 1
- QDSFNOHWQKVVEB-UHFFFAOYSA-N 4-(diethoxyphosphorylmethyl)morpholine Chemical compound CCOP(=O)(OCC)CN1CCOCC1 QDSFNOHWQKVVEB-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- ZQQSRVPOAHYHEL-UHFFFAOYSA-N 4-bromo-2-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(Br)C=C1F ZQQSRVPOAHYHEL-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- QWLHJVDRPZNVBS-UHFFFAOYSA-N 4-phenoxybenzaldehyde Chemical group C1=CC(C=O)=CC=C1OC1=CC=CC=C1 QWLHJVDRPZNVBS-UHFFFAOYSA-N 0.000 description 1
- XSOOYOJSTVBNMS-UHFFFAOYSA-N 5-(2-phenylethenyl)-1,3-dihydro-1,4-benzodiazepin-2-one Chemical compound C12=CC=CC=C2NC(=O)CN=C1C=CC1=CC=CC=C1 XSOOYOJSTVBNMS-UHFFFAOYSA-N 0.000 description 1
- WTJYNUSYXWVHDI-UHFFFAOYSA-N 5-(diethoxyphosphorylmethylidene)-1-methyl-8-phenyl-3,4-dihydro-2h-1,4-benzodiazepine Chemical compound C=1C=C2C(=CP(=O)(OCC)OCC)NCCN(C)C2=CC=1C1=CC=CC=C1 WTJYNUSYXWVHDI-UHFFFAOYSA-N 0.000 description 1
- QOSXYJXXGXFWBM-UHFFFAOYSA-N 5-[2-(2,3-dichlorophenyl)ethenyl]-1,3-dihydro-1,4-benzodiazepin-2-one Chemical compound ClC1=CC=CC(C=CC=2C3=CC=CC=C3NC(=O)CN=2)=C1Cl QOSXYJXXGXFWBM-UHFFFAOYSA-N 0.000 description 1
- UCQZSCBLWOYZJV-UHFFFAOYSA-N 5-[2-(2-benzylsulfanyl-5-nitrophenyl)ethenyl]-7-fluoro-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC(F)=CC=C2N(C)CCN=C1C=CC1=CC([N+]([O-])=O)=CC=C1SCC1=CC=CC=C1 UCQZSCBLWOYZJV-UHFFFAOYSA-N 0.000 description 1
- KFCOQJWJXXVPSH-UHFFFAOYSA-N 5-[2-(2-benzylsulfanyl-5-nitrophenyl)ethenyl]-8-fluoro-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC=C(F)C=C2N(C)CCN=C1C=CC1=CC([N+]([O-])=O)=CC=C1SCC1=CC=CC=C1 KFCOQJWJXXVPSH-UHFFFAOYSA-N 0.000 description 1
- IZYAMDGHUYSXGV-UHFFFAOYSA-N 5-[2-(2-benzylsulfanylphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC=CC=C2N(C)CCN=C1C=CC1=CC=CC=C1SCC1=CC=CC=C1 IZYAMDGHUYSXGV-UHFFFAOYSA-N 0.000 description 1
- ZHDPKUJPNHETFF-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-1,3-dihydro-1,4-benzodiazepin-2-one Chemical compound C1=C(Cl)C(Cl)=CC=C1C=CC1=NCC(=O)NC2=CC=CC=C12 ZHDPKUJPNHETFF-UHFFFAOYSA-N 0.000 description 1
- HZUKNXOAFOOZSQ-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-1-[(4-nitrophenyl)methyl]-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C1=CC([N+](=O)[O-])=CC=C1CN1C2=CC=CC=C2C(C=CC=2C=C(Cl)C(Cl)=CC=2)=NCC1 HZUKNXOAFOOZSQ-UHFFFAOYSA-N 0.000 description 1
- RBTQHDXZXLTVLC-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC=CC=C2N(C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 RBTQHDXZXLTVLC-UHFFFAOYSA-N 0.000 description 1
- TYGJGMZQFRANDG-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-3h-1,4-benzodiazepin-2-one Chemical compound N=1CC(=O)N(C)C2=CC=CC=C2C=1C=CC1=CC=C(Cl)C(Cl)=C1 TYGJGMZQFRANDG-UHFFFAOYSA-N 0.000 description 1
- TVGGDDPIJVMYPQ-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-6-(trifluoromethyl)-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C1=CC=C(C(F)(F)F)C2=C1N(C)CCN=C2C=CC1=CC=C(Cl)C(Cl)=C1 TVGGDDPIJVMYPQ-UHFFFAOYSA-N 0.000 description 1
- FWVMOKJNOQSETP-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-8-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodiazepine Chemical compound C12=CC=C(OC3OCCCC3)C=C2N(C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 FWVMOKJNOQSETP-UHFFFAOYSA-N 0.000 description 1
- URGOQHOAOSRWCA-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-8-phenyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC=C(C=3C=CC=CC=3)C=C2N(C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 URGOQHOAOSRWCA-UHFFFAOYSA-N 0.000 description 1
- YPZJTYMEGMJKIT-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-8-thiophen-2-yl-2,3-dihydro-1,4-benzodiazepine;hydrochloride Chemical compound Cl.C12=CC=C(C=3SC=CC=3)C=C2N(C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 YPZJTYMEGMJKIT-UHFFFAOYSA-N 0.000 description 1
- STEGCKZKAQDHAN-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-8-thiophen-3-yl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC=C(C3=CSC=C3)C=C2N(C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 STEGCKZKAQDHAN-UHFFFAOYSA-N 0.000 description 1
- KAUUQUHIXZXADC-UHFFFAOYSA-N 5-[2-(3,4-dichlorophenyl)ethenyl]-9-phenyl-2,3-dihydro-1H-1,4-benzodiazepine hydrochloride Chemical compound Cl.ClC=1C=C(C=CC2=N/CCNC3=C2C=CC=C3C3=CC=CC=C3)C=CC1Cl KAUUQUHIXZXADC-UHFFFAOYSA-N 0.000 description 1
- ZULCALJQWQNVKU-UHFFFAOYSA-N 5-[2-(3,4-difluorophenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC=CC=C2N(C)CCN=C1C=CC1=CC=C(F)C(F)=C1 ZULCALJQWQNVKU-UHFFFAOYSA-N 0.000 description 1
- GPVAQYGTDYGTMW-UHFFFAOYSA-N 5-[2-(4-methoxyphenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1C=CC1=NCCN(C)C2=CC=CC=C12 GPVAQYGTDYGTMW-UHFFFAOYSA-N 0.000 description 1
- NTQJCCPKRKGJIT-UHFFFAOYSA-N 5-[2-[2-(4-chlorophenoxy)phenyl]ethenyl]-8-fluoro-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC=C(F)C=C2N(C)CCN=C1C=CC1=CC=CC=C1OC1=CC=C(Cl)C=C1 NTQJCCPKRKGJIT-UHFFFAOYSA-N 0.000 description 1
- ANWFNYVZUVXGCR-UHFFFAOYSA-N 5-[2-[2-(4-chlorophenyl)sulfanylphenyl]ethenyl]-8-(3-methoxyphenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.COC1=CC=CC(C=2C=C3C(C(=NCCN3C)C=CC=3C(=CC=CC=3)SC=3C=CC(Cl)=CC=3)=CC=2)=C1 ANWFNYVZUVXGCR-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- JNGZFHODFOQFQT-UHFFFAOYSA-N 8-bromo-5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC=C(Br)C=C2N(C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 JNGZFHODFOQFQT-UHFFFAOYSA-N 0.000 description 1
- IKENHOASNZWXME-UHFFFAOYSA-N 8-chloro-5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C12=CC=C(Cl)C=C2N(C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 IKENHOASNZWXME-UHFFFAOYSA-N 0.000 description 1
- RWQUWTMOHXGTNN-UHFFFAOYSA-N 9-n,10-n-bis(4-butylphenyl)-9-n,10-n-bis(4-methylphenyl)phenanthrene-9,10-diamine Chemical group C1=CC(CCCC)=CC=C1N(C=1C2=CC=CC=C2C2=CC=CC=C2C=1N(C=1C=CC(C)=CC=1)C=1C=CC(CCCC)=CC=1)C1=CC=C(C)C=C1 RWQUWTMOHXGTNN-UHFFFAOYSA-N 0.000 description 1
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
- 208000030507 AIDS Diseases 0.000 description 1
- 229920000856 Amylose Polymers 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- NSSIPNWAYNRJRR-UHFFFAOYSA-N Cl.Cl.COC(=O)C1=CC=CC=C1 Chemical compound Cl.Cl.COC(=O)C1=CC=CC=C1 NSSIPNWAYNRJRR-UHFFFAOYSA-N 0.000 description 1
- YDPQBXGJUDVSKR-UHFFFAOYSA-N Cl.ClC=1C=C(C=CC2=N/CCNC3=C2C=CC=C3C3=CC=C(C=C3)OC)C=CC1Cl Chemical compound Cl.ClC=1C=C(C=CC2=N/CCNC3=C2C=CC=C3C3=CC=C(C=C3)OC)C=CC1Cl YDPQBXGJUDVSKR-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 241000557626 Corvus corax Species 0.000 description 1
- 102000003844 DNA helicases Human genes 0.000 description 1
- 108090000133 DNA helicases Proteins 0.000 description 1
- 230000004543 DNA replication Effects 0.000 description 1
- 208000012239 Developmental disease Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 101000697544 Homo sapiens SCL-interrupting locus protein Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- GUBGYTABKSRVRQ-PICCSMPSSA-N Maltose Natural products O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-PICCSMPSSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- FGCIWARUTHVIQO-UHFFFAOYSA-N N-phenylacetamide dihydrochloride Chemical compound Cl.Cl.C(C)(=O)NC1=CC=CC=C1 FGCIWARUTHVIQO-UHFFFAOYSA-N 0.000 description 1
- FENRRESBSVWILZ-UHFFFAOYSA-N N=1N=CC=CC=2C1CC(=CC2)O Chemical compound N=1N=CC=CC=2C1CC(=CC2)O FENRRESBSVWILZ-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 208000009608 Papillomavirus Infections Diseases 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229940124158 Protease/peptidase inhibitor Drugs 0.000 description 1
- 101710185720 Putative ethidium bromide resistance protein Proteins 0.000 description 1
- 102100028029 SCL-interrupting locus protein Human genes 0.000 description 1
- 208000019802 Sexually transmitted disease Diseases 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- BPGDAMSIGCZZLK-UHFFFAOYSA-N acetyloxymethyl acetate Chemical compound CC(=O)OCOC(C)=O BPGDAMSIGCZZLK-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- LHIJANUOQQMGNT-UHFFFAOYSA-N aminoethylethanolamine Chemical group NCCNCCO LHIJANUOQQMGNT-UHFFFAOYSA-N 0.000 description 1
- BMJXMAAIWXBKBD-UHFFFAOYSA-N aniline;dihydrochloride Chemical compound Cl.Cl.NC1=CC=CC=C1 BMJXMAAIWXBKBD-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 229940053197 benzodiazepine derivative antiepileptics Drugs 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- SNIABFMMCKVXSY-UHFFFAOYSA-N benzoylazanium;chloride Chemical compound Cl.NC(=O)C1=CC=CC=C1 SNIABFMMCKVXSY-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Chemical group 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 235000013681 dietary sucrose Nutrition 0.000 description 1
- LXCYSACZTOKNNS-UHFFFAOYSA-N diethoxy(oxo)phosphanium Chemical compound CCO[P+](=O)OCC LXCYSACZTOKNNS-UHFFFAOYSA-N 0.000 description 1
- LGTLXDJOAJDFLR-UHFFFAOYSA-N diethyl chlorophosphate Chemical compound CCOP(Cl)(=O)OCC LGTLXDJOAJDFLR-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000005050 dihydrooxazolyl group Chemical group O1C(NC=C1)* 0.000 description 1
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 1
- 125000005056 dihydrothiazolyl group Chemical group S1C(NC=C1)* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- FPULFENIJDPZBX-UHFFFAOYSA-N ethyl 2-isocyanoacetate Chemical compound CCOC(=O)C[N+]#[C-] FPULFENIJDPZBX-UHFFFAOYSA-N 0.000 description 1
- NLNGTXZUJOHILP-UHFFFAOYSA-N ethyl 6-[2-(3,4-dichlorophenyl)ethenyl]-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound CCOC(=O)C=1N=CN(C2=CC=CC=C22)C=1CN=C2C=CC1=CC=C(Cl)C(Cl)=C1 NLNGTXZUJOHILP-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical group CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 108020001507 fusion proteins Proteins 0.000 description 1
- 102000037865 fusion proteins Human genes 0.000 description 1
- 210000004392 genitalia Anatomy 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 229960001031 glucose Drugs 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- AILKHAQXUAOOFU-UHFFFAOYSA-N hexanenitrile Chemical compound CCCCCC#N AILKHAQXUAOOFU-UHFFFAOYSA-N 0.000 description 1
- USZLCYNVCCDPLQ-UHFFFAOYSA-N hydron;n-methoxymethanamine;chloride Chemical compound Cl.CNOC USZLCYNVCCDPLQ-UHFFFAOYSA-N 0.000 description 1
- 230000003463 hyperproliferative effect Effects 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000008011 inorganic excipient Substances 0.000 description 1
- 229960004903 invert sugar Drugs 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- 229910052740 iodine Chemical group 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- QKASDIPENBEWBU-UHFFFAOYSA-N methyl 2-(bromomethyl)benzoate Chemical compound COC(=O)C1=CC=CC=C1CBr QKASDIPENBEWBU-UHFFFAOYSA-N 0.000 description 1
- YUHSMQQNPRLEEJ-UHFFFAOYSA-N methyl 3-(bromomethyl)benzoate Chemical group COC(=O)C1=CC=CC(CBr)=C1 YUHSMQQNPRLEEJ-UHFFFAOYSA-N 0.000 description 1
- FEIOASZZURHTHB-UHFFFAOYSA-N methyl 4-formylbenzoate Chemical group COC(=O)C1=CC=C(C=O)C=C1 FEIOASZZURHTHB-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 210000000214 mouth Anatomy 0.000 description 1
- ACYBVNYNIZTUIL-UHFFFAOYSA-N n'-benzylethane-1,2-diamine Chemical group NCCNCC1=CC=CC=C1 ACYBVNYNIZTUIL-UHFFFAOYSA-N 0.000 description 1
- SCZVXVGZMZRGRU-UHFFFAOYSA-N n'-ethylethane-1,2-diamine Chemical group CCNCCN SCZVXVGZMZRGRU-UHFFFAOYSA-N 0.000 description 1
- CFNHVUGPXZUTRR-UHFFFAOYSA-N n'-propylethane-1,2-diamine Chemical group CCCNCCN CFNHVUGPXZUTRR-UHFFFAOYSA-N 0.000 description 1
- AYEQJLOHMLYKAV-UHFFFAOYSA-N n-(4-sulfanylphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(S)C=C1 AYEQJLOHMLYKAV-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- LVWGTCXZRMPQJC-UHFFFAOYSA-N n-methoxy-n-methyl-2-(2-phenylethyl)benzamide Chemical compound CON(C)C(=O)C1=CC=CC=C1CCC1=CC=CC=C1 LVWGTCXZRMPQJC-UHFFFAOYSA-N 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XBXCNNQPRYLIDE-UHFFFAOYSA-M n-tert-butylcarbamate Chemical compound CC(C)(C)NC([O-])=O XBXCNNQPRYLIDE-UHFFFAOYSA-M 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 210000003928 nasal cavity Anatomy 0.000 description 1
- 229920001206 natural gum Polymers 0.000 description 1
- 230000001613 neoplastic effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000008012 organic excipient Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 239000001301 oxygen Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 208000003154 papilloma Diseases 0.000 description 1
- 208000029211 papillomatosis Diseases 0.000 description 1
- SEVSMVUOKAMPDO-UHFFFAOYSA-N para-Acetoxybenzaldehyde Natural products CC(=O)OC1=CC=C(C=O)C=C1 SEVSMVUOKAMPDO-UHFFFAOYSA-N 0.000 description 1
- 108700038653 parvovirus NS1 Proteins 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 125000005543 phthalimide group Chemical class 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- XIPFMBOWZXULIA-UHFFFAOYSA-N pivalamide Chemical compound CC(C)(C)C(N)=O XIPFMBOWZXULIA-UHFFFAOYSA-N 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- SHNUBALDGXWUJI-UHFFFAOYSA-N pyridin-2-ylmethanol Chemical compound OCC1=CC=CC=N1 SHNUBALDGXWUJI-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000000306 recurrent effect Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- 229910052717 sulfur Chemical group 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- MFPWEWYKQYMWRO-UHFFFAOYSA-N tert-butyl carboxy carbonate Chemical compound CC(C)(C)OC(=O)OC(O)=O MFPWEWYKQYMWRO-UHFFFAOYSA-N 0.000 description 1
- AOCSUUGBCMTKJH-UHFFFAOYSA-N tert-butyl n-(2-aminoethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCN AOCSUUGBCMTKJH-UHFFFAOYSA-N 0.000 description 1
- WBADKWZPRONLNC-UHFFFAOYSA-N tert-butyl n-[2-[(4-formylbenzoyl)amino]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCNC(=O)C1=CC=C(C=O)C=C1 WBADKWZPRONLNC-UHFFFAOYSA-N 0.000 description 1
- FKRCZWQVTPZQGI-UHFFFAOYSA-N tert-butyl n-[5-[2-(3,4-dichlorophenyl)ethenyl]-1-methyl-2,3-dihydro-1,4-benzodiazepin-7-yl]carbamate Chemical compound C12=CC(NC(=O)OC(C)(C)C)=CC=C2N(C)CCN=C1C=CC1=CC=C(Cl)C(Cl)=C1 FKRCZWQVTPZQGI-UHFFFAOYSA-N 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- ARYHTUPFQTUBBG-UHFFFAOYSA-N thiophen-2-ylboronic acid Chemical compound OB(O)C1=CC=CS1 ARYHTUPFQTUBBG-UHFFFAOYSA-N 0.000 description 1
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical compound OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 description 1
- 229940103494 thiosalicylic acid Drugs 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- QIWRFOJWQSSRJZ-UHFFFAOYSA-N tributyl(ethenyl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C=C QIWRFOJWQSSRJZ-UHFFFAOYSA-N 0.000 description 1
- SANWDQJIWZEKOD-UHFFFAOYSA-N tributyl(furan-2-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1=CC=CO1 SANWDQJIWZEKOD-UHFFFAOYSA-N 0.000 description 1
- 125000000165 tricyclic carbocycle group Chemical group 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 241000701447 unidentified baculovirus Species 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229920001285 xanthan gum Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Oncology (AREA)
- Communicable Diseases (AREA)
- Virology (AREA)
- Dermatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB0015904.6A GB0015904D0 (en) | 2000-06-28 | 2000-06-28 | Inhibitors of HPV E1 helicase enzyme |
| PCT/EP2001/006895 WO2002000632A1 (en) | 2000-06-28 | 2001-06-19 | Benzodiazepines as inhibitors of hpv e1 helicase |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2004501904A true JP2004501904A (ja) | 2004-01-22 |
| JP2004501904A5 JP2004501904A5 (cg-RX-API-DMAC7.html) | 2005-02-03 |
Family
ID=9894630
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2002505380A Pending JP2004501904A (ja) | 2000-06-28 | 2001-06-19 | Hpve1ヘリカーゼ阻害剤としてのベンゾジアゼピン |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US6703387B2 (cg-RX-API-DMAC7.html) |
| EP (1) | EP1299364A1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP2004501904A (cg-RX-API-DMAC7.html) |
| AU (1) | AU2001270580A1 (cg-RX-API-DMAC7.html) |
| CA (1) | CA2411157A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB0015904D0 (cg-RX-API-DMAC7.html) |
| WO (1) | WO2002000632A1 (cg-RX-API-DMAC7.html) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1615878B1 (en) | 2003-01-14 | 2012-04-04 | Cytokinetics, Inc. | Compounds, compositions and methods of treatment for heart failure |
| ATE411981T1 (de) * | 2003-06-10 | 2008-11-15 | Smithkline Beecham Corp | Tetrahydrocarbazolderivate und deren pharmazeutische verwendung |
| CA2528336A1 (en) | 2003-06-12 | 2005-01-20 | Smithkline Beecham Corporation | Tetrahydrocarbazole derivatives and their pharmaceutical use |
| KR101276136B1 (ko) | 2004-06-17 | 2013-06-18 | 싸이토키네틱스, 인코포레이티드 | 화합물, 조성물 및 방법 |
| US7176222B2 (en) | 2004-07-27 | 2007-02-13 | Cytokinetics, Inc. | Syntheses of ureas |
| US20060161076A1 (en) * | 2005-01-06 | 2006-07-20 | Diamics, Inc. | Systems and methods for collection of cell clusters |
| US20060189893A1 (en) * | 2005-01-06 | 2006-08-24 | Diamics, Inc. | Systems and methods for detecting abnormal cells |
| US7538223B2 (en) | 2005-08-04 | 2009-05-26 | Cytokinetics, Inc. | Compounds, compositions and methods |
| US7825120B2 (en) | 2005-12-15 | 2010-11-02 | Cytokinetics, Inc. | Certain substituted ((piperazin-1-ylmethyl)benzyl)ureas |
| WO2007070683A2 (en) | 2005-12-15 | 2007-06-21 | Cytokinetics, Inc. | Certain chemical entities, compositions and methods |
| WO2007078815A2 (en) | 2005-12-16 | 2007-07-12 | Cytokinetics, Inc. | Certain chemical entities, compositions, and methods |
| JP5178526B2 (ja) | 2005-12-19 | 2013-04-10 | サイトキネティクス・インコーポレーテッド | 化合物、組成物および方法 |
| GB0619325D0 (en) | 2006-09-30 | 2006-11-08 | Univ Strathclyde | New compounds |
| WO2011046646A2 (en) * | 2009-07-10 | 2011-04-21 | Microbiotix, Inc. | Inhibitors of filovirus entry into host cells |
| CN102902895B (zh) * | 2010-05-18 | 2017-04-05 | 小江生物技术有限公司 | 预防和治疗人乳头瘤病毒感染类疾病的化合物的筛选方法 |
| JP2013010740A (ja) * | 2011-06-03 | 2013-01-17 | Sumitomo Chemical Co Ltd | イソキサゾリン化合物を製造する方法 |
| EP3367798A1 (en) | 2015-10-28 | 2018-09-05 | Syngenta Participations AG | Microbiocidal oxadiazole derivatives |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1455048A (fr) * | 1965-01-09 | 1966-04-01 | Clin Byla Ets | Composés de la série des benzodiazépines et leur préparation |
| TW219896B (cg-RX-API-DMAC7.html) * | 1988-07-07 | 1994-02-01 | Duphar Int Res | |
| US4847129A (en) * | 1988-09-16 | 1989-07-11 | Continental Pet Technologies, Inc. | Multilayer preform for hot fill containers |
| US5141735A (en) * | 1990-06-18 | 1992-08-25 | Hoffman-La Roche, Inc. | Substituted amino-benzodiazepines having anitviral activity |
| BR9913226A (pt) * | 1998-09-01 | 2001-05-22 | Innogenetics Nv | Benzodiazepinas e derivados de benzotiazepinas e peptìdios de hbsag ligados a anexinas, suas composições e uso |
| CA2342858A1 (en) * | 1998-09-04 | 2000-03-16 | Institute Of Molecular & Cell Biology | Method of screening compounds useful in the treatment of a desease caused by or exacerbated by mpv |
-
2000
- 2000-06-28 GB GBGB0015904.6A patent/GB0015904D0/en not_active Ceased
-
2001
- 2001-06-19 WO PCT/EP2001/006895 patent/WO2002000632A1/en not_active Ceased
- 2001-06-19 JP JP2002505380A patent/JP2004501904A/ja active Pending
- 2001-06-19 EP EP01949420A patent/EP1299364A1/en not_active Withdrawn
- 2001-06-19 CA CA002411157A patent/CA2411157A1/en not_active Abandoned
- 2001-06-19 AU AU2001270580A patent/AU2001270580A1/en not_active Abandoned
- 2001-06-26 US US09/892,148 patent/US6703387B2/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| AU2001270580A1 (en) | 2002-01-08 |
| US6703387B2 (en) | 2004-03-09 |
| WO2002000632A1 (en) | 2002-01-03 |
| EP1299364A1 (en) | 2003-04-09 |
| GB0015904D0 (en) | 2000-08-23 |
| CA2411157A1 (en) | 2002-01-03 |
| US20020128262A1 (en) | 2002-09-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2004501904A (ja) | Hpve1ヘリカーゼ阻害剤としてのベンゾジアゼピン | |
| JP6680683B2 (ja) | テトラヒドロ−ベンゾジアゼピノン類 | |
| TWI406857B (zh) | 關於診斷與治療有關蝟狀途徑之病理學疾病的新穎化合物、其醫藥組合物及用途 | |
| US6828315B1 (en) | 1-Amino triazoloc4,3-a! quinazoline-5-ones and/or -5-thiones inhibiting phosphodiesterase IV | |
| OA12147A (en) | PyrroloÄ2,3dÜpyrimidine compositions and their use. | |
| RU2113437C1 (ru) | Замещенные пиримидины, или их фармацевтически приемлемые соли, или n-оксиды, способы их получения и фармацевтическая композиция на их основе | |
| CA2409998A1 (en) | Benzodiazepine derivatives as app modulators | |
| US20040152888A1 (en) | Cyclic nucleotide phosphodiesterase inhibitors, preparation and uses thereof | |
| EP1851225B1 (en) | Pyrazolo-pyrimidine derivatives as mglur2 antagonists | |
| UA76798C2 (uk) | Заміщені 1,4-бензодіазепіни та їх використання для лікування раку, фармацевтична композиція (варіанти) на їх основі та спосіб лікування захворювань (варіанти) | |
| EP2271646A1 (en) | Apoptosis signal-regulating kinase 1 inhibitors | |
| JPH10510512A (ja) | 尿素誘導体とacat阻害剤としての用途 | |
| CN1880317B (zh) | 作为细胞周期蛋白依赖性激酶抑制剂的吡唑并嘧啶 | |
| TW200418861A (en) | Pyrrolopyridazine derivatives | |
| HUP0301269A2 (hu) | Ftalazinonszármazékok és ezeket tartalmazó gyógyszerkészítmények | |
| CN1964944A (zh) | 作为抗病毒药的吲哚衍生物 | |
| AU2788792A (en) | Benzodiazepine derivatives and their use as antagonists of cholecystokinin and/or gastrin receptors | |
| TW202110845A (zh) | 三環化合物 | |
| JP4980358B2 (ja) | C型肝炎感染症を治療するためのベンゾジアゼピン誘導体 | |
| US3429874A (en) | 1-polyhalogenoalkyl-2-oxo-1,3-dihydro-2h-1,4-benzodiazepines | |
| EP1812112B1 (en) | Benzodiazepine derivatives as ROCK kinases inhibitors | |
| JP2007538068A (ja) | 新規な縮合複素環およびそれらの使用 | |
| JPH09509957A (ja) | 免疫調節剤としてのキノリン誘導体 | |
| JP3012338B2 (ja) | アリールおよびヘテロアリールアルコキシナフタレン誘導体 | |
| EP0595924B1 (en) | Platelet activating factor antagonists |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20060919 |
|
| A601 | Written request for extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A601 Effective date: 20061218 |
|
| A602 | Written permission of extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A602 Effective date: 20061227 |
|
| A02 | Decision of refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A02 Effective date: 20070605 |