IL34508A - Basically substituted 1,2,3-benzotriazine-4(3h)-one derivatives and processes for the production thereof and pharmaceutical compositions containing them - Google Patents
Basically substituted 1,2,3-benzotriazine-4(3h)-one derivatives and processes for the production thereof and pharmaceutical compositions containing themInfo
- Publication number
- IL34508A IL34508A IL34508A IL3450870A IL34508A IL 34508 A IL34508 A IL 34508A IL 34508 A IL34508 A IL 34508A IL 3450870 A IL3450870 A IL 3450870A IL 34508 A IL34508 A IL 34508A
- Authority
- IL
- Israel
- Prior art keywords
- benzotriazine
- general formula
- derivatives
- carbon atoms
- substituted
- Prior art date
Links
- DMSSTTLDFWKBSX-UHFFFAOYSA-N 1h-1,2,3-benzotriazin-4-one Chemical class C1=CC=C2C(=O)N=NNC2=C1 DMSSTTLDFWKBSX-UHFFFAOYSA-N 0.000 title claims description 14
- 238000000034 method Methods 0.000 title claims description 14
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 239000008194 pharmaceutical composition Substances 0.000 title description 2
- -1 phenyl- Chemical group 0.000 claims description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000005711 Benzoic acid Substances 0.000 claims description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 3
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 235000010233 benzoic acid Nutrition 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- PXBFMLJZNCDSMP-UHFFFAOYSA-N 2-Aminobenzamide Chemical class NC(=O)C1=CC=CC=C1N PXBFMLJZNCDSMP-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 2
- 150000002440 hydroxy compounds Chemical class 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 1
- 239000012059 conventional drug carrier Substances 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 125000004663 dialkyl amino group Chemical group 0.000 claims 1
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- 125000004434 sulfur atom Chemical group 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 238000003756 stirring Methods 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 239000008280 blood Substances 0.000 description 5
- 210000004369 blood Anatomy 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 229940086542 triethylamine Drugs 0.000 description 5
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzene carboxamide Natural products NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- BUHYMJLFRZAFBF-UHFFFAOYSA-N 3,4,5-trimethoxybenzoyl chloride Chemical compound COC1=CC(C(Cl)=O)=CC(OC)=C1OC BUHYMJLFRZAFBF-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- JFCITVLHUMNYAL-UHFFFAOYSA-N 3,4,5-trimethoxy-2-nitrobenzoyl chloride Chemical compound [N+](=O)([O-])C1=C(C(=O)Cl)C=C(C(=C1OC)OC)OC JFCITVLHUMNYAL-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 230000004872 arterial blood pressure Effects 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 210000004351 coronary vessel Anatomy 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- RSOVYHJBOYUBKJ-UHFFFAOYSA-N 3-ethoxy-n-methylpropan-1-amine Chemical compound CCOCCCNC RSOVYHJBOYUBKJ-UHFFFAOYSA-N 0.000 description 1
- HJELPNLGHMWKQT-UHFFFAOYSA-N 3-methoxy-n-methylpropan-1-amine Chemical compound CNCCCOC HJELPNLGHMWKQT-UHFFFAOYSA-N 0.000 description 1
- QIKYZXDTTPVVAC-UHFFFAOYSA-N 4-Aminobenzamide Chemical class NC(=O)C1=CC=C(N)C=C1 QIKYZXDTTPVVAC-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- ICDRTXPPHIEECJ-UHFFFAOYSA-N 6,7,8-trimethoxy-1h-1,2,3-benzotriazin-4-one Chemical compound COC1=C(OC)C(OC)=CC2=C1NN=NC2=O ICDRTXPPHIEECJ-UHFFFAOYSA-N 0.000 description 1
- 125000003341 7 membered heterocyclic group Chemical group 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- PAMIQIKDUOTOBW-UHFFFAOYSA-N N-methylcyclohexylamine Natural products CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 1
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 239000003218 coronary vasodilator agent Substances 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- VEBLEROFGPOMPB-UHFFFAOYSA-N n-methylcyclopropanamine Chemical compound CNC1CC1 VEBLEROFGPOMPB-UHFFFAOYSA-N 0.000 description 1
- SASNBVQSOZSTPD-UHFFFAOYSA-N n-methylphenethylamine Chemical compound CNCCC1=CC=CC=C1 SASNBVQSOZSTPD-UHFFFAOYSA-N 0.000 description 1
- IOXXVNYDGIXMIP-UHFFFAOYSA-N n-methylprop-2-en-1-amine Chemical compound CNCC=C IOXXVNYDGIXMIP-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/08—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1926075A DE1926075C3 (de) | 1969-05-22 | 1969-05-22 | 3-(3-Amino-2-benzoxy-propyl)-6,7,8trimethoxy-3H-1 ^3-benzotriazin-4on-Derivate, ihre Herstellung und Verwendung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL34508A0 IL34508A0 (en) | 1970-07-19 |
| IL34508A true IL34508A (en) | 1973-07-30 |
Family
ID=5734859
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL34508A IL34508A (en) | 1969-05-22 | 1970-05-12 | Basically substituted 1,2,3-benzotriazine-4(3h)-one derivatives and processes for the production thereof and pharmaceutical compositions containing them |
Country Status (19)
| Country | Link |
|---|---|
| US (4) | US3706739A (member.php) |
| AT (2) | AT297720B (member.php) |
| BE (1) | BE750841A (member.php) |
| BR (1) | BR6915398D0 (member.php) |
| CA (1) | CA972371A (member.php) |
| CH (2) | CH535774A (member.php) |
| CS (2) | CS155241B2 (member.php) |
| DE (1) | DE1926075C3 (member.php) |
| ES (2) | ES379868A1 (member.php) |
| FI (1) | FI50241C (member.php) |
| FR (1) | FR2051552B1 (member.php) |
| GB (1) | GB1280942A (member.php) |
| IE (1) | IE34167B1 (member.php) |
| IL (1) | IL34508A (member.php) |
| NL (1) | NL7006791A (member.php) |
| NO (1) | NO127582B (member.php) |
| PL (1) | PL80853B1 (member.php) |
| RO (2) | RO57511A (member.php) |
| ZA (1) | ZA703463B (member.php) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4680293A (en) * | 1986-03-03 | 1987-07-14 | American Cyanamid Company | 3-imidazolylalkyl-, triazolylalkyl-, pyridinylalkyl-1,2,3-benzotriazin-4(3H)-ones and derivatives thereof |
| CN104530037B (zh) * | 2015-01-21 | 2020-12-18 | 华东理工大学 | 一种具有杀线虫活性的三嗪杂环化合物及其制法和用途 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR51163E (fr) * | 1940-04-29 | 1941-09-30 | Lampe électrique mobile pouvant être facilement placée sur un lit, un fauteuil et sur d'autres meubles ou d'autres supports | |
| DE1259349B (de) * | 1964-10-17 | 1968-01-25 | Cassella Farbwerke Mainkur Ag | Verfahren zur Herstellung von Derivaten des 7-Oxycumarins |
| US3534085A (en) * | 1968-10-16 | 1970-10-13 | Squibb & Sons Inc | 5,8-dihydronaphthloxy-aminopropanols and related compounds |
-
1969
- 1969-05-22 DE DE1926075A patent/DE1926075C3/de not_active Expired
- 1969-12-19 BR BR215398/69A patent/BR6915398D0/pt unknown
-
1970
- 1970-05-11 NL NL7006791A patent/NL7006791A/xx unknown
- 1970-05-12 IL IL34508A patent/IL34508A/en unknown
- 1970-05-15 IE IE636/70A patent/IE34167B1/xx unknown
- 1970-05-18 US US38544A patent/US3706739A/en not_active Expired - Lifetime
- 1970-05-20 RO RO63406A patent/RO57511A/ro unknown
- 1970-05-20 RO RO71242A patent/RO57941A/ro unknown
- 1970-05-21 PL PL1970140773A patent/PL80853B1/pl unknown
- 1970-05-21 ES ES379868A patent/ES379868A1/es not_active Expired
- 1970-05-21 FI FI701432A patent/FI50241C/fi active
- 1970-05-21 CA CA083,279A patent/CA972371A/en not_active Expired
- 1970-05-21 NO NO01941/70A patent/NO127582B/no unknown
- 1970-05-21 GB GB24680/70A patent/GB1280942A/en not_active Expired
- 1970-05-21 AT AT454170A patent/AT297720B/de not_active IP Right Cessation
- 1970-05-21 FR FR7018462A patent/FR2051552B1/fr not_active Expired
- 1970-05-21 ZA ZA703463A patent/ZA703463B/xx unknown
- 1970-05-21 AT AT454270A patent/AT297721B/de not_active IP Right Cessation
- 1970-05-21 ES ES379869A patent/ES379869A1/es not_active Expired
- 1970-05-22 CS CS360270A patent/CS155241B2/cs unknown
- 1970-05-22 CS CS360170A patent/CS155240B2/cs unknown
- 1970-05-22 CH CH763070A patent/CH535774A/de not_active IP Right Cessation
- 1970-05-22 BE BE750841D patent/BE750841A/xx unknown
- 1970-05-22 CH CH551988D patent/CH551988A/xx not_active IP Right Cessation
-
1972
- 1972-06-22 US US00265249A patent/US3757019A/en not_active Expired - Lifetime
- 1972-06-22 US US00265221A patent/US3751413A/en not_active Expired - Lifetime
- 1972-06-22 US US00265225A patent/US3759907A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AT297721B (de) | 1972-04-10 |
| BE750841A (fr) | 1970-11-23 |
| ES379869A1 (es) | 1973-04-01 |
| FR2051552B1 (member.php) | 1974-04-12 |
| ZA703463B (en) | 1971-01-27 |
| DE1926075C3 (de) | 1980-07-31 |
| IE34167B1 (en) | 1975-02-19 |
| RO57511A (member.php) | 1975-03-15 |
| PL80853B1 (member.php) | 1975-08-30 |
| RO57941A (member.php) | 1975-04-15 |
| IE34167L (en) | 1970-11-22 |
| IL34508A0 (en) | 1970-07-19 |
| NO127582B (member.php) | 1973-07-16 |
| AT297720B (de) | 1972-04-10 |
| CH551988A (de) | 1974-07-31 |
| BR6915398D0 (pt) | 1973-01-04 |
| US3706739A (en) | 1972-12-19 |
| DE1926075B2 (de) | 1979-11-22 |
| GB1280942A (en) | 1972-07-12 |
| US3751413A (en) | 1973-08-07 |
| US3759907A (en) | 1973-09-18 |
| CS155240B2 (member.php) | 1974-05-30 |
| FI50241C (fi) | 1976-01-12 |
| CA972371A (en) | 1975-08-05 |
| DE1926075A1 (de) | 1970-11-26 |
| FI50241B (member.php) | 1975-09-30 |
| FR2051552A1 (member.php) | 1971-04-09 |
| CH535774A (de) | 1973-04-15 |
| US3757019A (en) | 1973-09-04 |
| ES379868A1 (es) | 1973-04-01 |
| NL7006791A (member.php) | 1970-11-24 |
| CS155241B2 (member.php) | 1974-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0047005B1 (en) | Benzoxazine derivatives | |
| US3655663A (en) | 4-(3-secondary amino-2-hydroxy-proxy) 1 2 5-thiadiazoles | |
| PL69767B1 (en) | 11-substituted 5 11-dihydro-6h-pyrido(2 3-b)(1 4)benzodiazepin-6-ones [us3660380a] | |
| US2852510A (en) | Heterocyclic compounds and process for producing same | |
| PL119520B1 (en) | Process for preparing novel,condensed pyrimidine derivatives pirimidina | |
| US3933802A (en) | New sulphamoylbenzoic acid amides | |
| US3748327A (en) | Basically substituted 4(3h)-quinazolinone derivatives | |
| US3600391A (en) | N-(dibenzo (b,f)azepin-10-yl)-piperazine compounds | |
| JPH01294670A (ja) | 2−(ピペラジニル)−2−オキソエチレン−置換フラボノイド誘導体、その製法およびそれを含有する医薬組成物 | |
| GB2108495A (en) | Triazoloquinazolone derivatives | |
| US3118884A (en) | Derivatives of 3-azaphenothiazine and 3-azaphenoxazine | |
| US3457264A (en) | N-(5h-dibenzo-(a,d)-cyclohepten - 5 - one-11-yl)-piperazines and method of preparing the same | |
| US3907996A (en) | Pharmaceutical composition containing a 2-amino-4,5,7,8-tetrahydro-6H-thiazolo or -oxazolo 5,4-D azepine and method of use | |
| US3845052A (en) | Basically substituted 1(2h)-phthalazinone derivatives | |
| IL34508A (en) | Basically substituted 1,2,3-benzotriazine-4(3h)-one derivatives and processes for the production thereof and pharmaceutical compositions containing them | |
| US3718648A (en) | Basically substituted 2,4-(1h,3h)-quinazolindione derivatives | |
| CS254971B2 (en) | Method of new bis-(piperazinyl-or homopiperazinyl)alkanes production | |
| JPH0441149B2 (member.php) | ||
| US4672064A (en) | 1,5-benzoxathiepin derivatives, their production and use | |
| US3631034A (en) | Derivatives of 5-cinnamoyl benzofuran their process of preparation and their therapeutic utilization | |
| US4118494A (en) | Substituted 3,4-dihydro-2H-isoquinolin-1-thiones | |
| US3740398A (en) | Basically substituted 2,4-(1h,3h)-quinazolindione derivatives | |
| US3738985A (en) | Certain 3-(3-amino-2-benzoyloxypropyl)-4(3h)-quinazolinones | |
| US3860581A (en) | Preparation of 1,4-benzodiazepines | |
| US3538098A (en) | Process for the production of coumarin derivatives |