IL33040A - Novel n-phenylmaleimide derivatives,process for preparing the same and fungicides and bactericides containing the same - Google Patents
Novel n-phenylmaleimide derivatives,process for preparing the same and fungicides and bactericides containing the sameInfo
- Publication number
- IL33040A IL33040A IL33040A IL3304069A IL33040A IL 33040 A IL33040 A IL 33040A IL 33040 A IL33040 A IL 33040A IL 3304069 A IL3304069 A IL 3304069A IL 33040 A IL33040 A IL 33040A
- Authority
- IL
- Israel
- Prior art keywords
- halogen
- hydrogen
- derivative represented
- formula
- same
- Prior art date
Links
- 230000000844 anti-bacterial effect Effects 0.000 title claims description 14
- 238000004519 manufacturing process Methods 0.000 title claims 2
- HIDBROSJWZYGSZ-UHFFFAOYSA-N 1-phenylpyrrole-2,5-dione Chemical class O=C1C=CC(=O)N1C1=CC=CC=C1 HIDBROSJWZYGSZ-UHFFFAOYSA-N 0.000 title description 10
- 239000003899 bactericide agent Substances 0.000 title description 7
- 239000000417 fungicide Substances 0.000 title description 7
- 125000005843 halogen group Chemical group 0.000 claims description 13
- 230000000855 fungicidal effect Effects 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 4
- 239000007921 spray Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims 8
- 150000002367 halogens Chemical class 0.000 claims 8
- 229910052739 hydrogen Inorganic materials 0.000 claims 8
- 239000001257 hydrogen Substances 0.000 claims 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 3
- 238000010438 heat treatment Methods 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 35
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 13
- 230000000694 effects Effects 0.000 description 13
- 239000000428 dust Substances 0.000 description 12
- 239000000126 substance Substances 0.000 description 12
- 241000209094 Oryza Species 0.000 description 11
- 241000233866 Fungi Species 0.000 description 10
- 238000000034 method Methods 0.000 description 10
- 241000196324 Embryophyta Species 0.000 description 8
- 239000004480 active ingredient Substances 0.000 description 7
- 230000001276 controlling effect Effects 0.000 description 7
- 201000010099 disease Diseases 0.000 description 7
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 7
- 235000007164 Oryza sativa Nutrition 0.000 description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 6
- 235000009566 rice Nutrition 0.000 description 6
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 5
- -1 N-(3 ' , 5 '-dichlorophenyl)-2-chloromaleimide Chemical compound 0.000 description 5
- 239000004495 emulsifiable concentrate Substances 0.000 description 5
- FSQQTNAZHBEJLS-UPHRSURJSA-N maleamic acid Chemical compound NC(=O)\C=C/C(O)=O FSQQTNAZHBEJLS-UPHRSURJSA-N 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- 240000008067 Cucumis sativus Species 0.000 description 4
- 239000004927 clay Substances 0.000 description 4
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical class O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 239000004563 wettable powder Substances 0.000 description 4
- WHZLCOICKHIPRL-SREVYHEPSA-N (z)-4-anilino-4-oxobut-2-enoic acid Chemical class OC(=O)\C=C/C(=O)NC1=CC=CC=C1 WHZLCOICKHIPRL-SREVYHEPSA-N 0.000 description 3
- 150000003923 2,5-pyrrolediones Chemical class 0.000 description 3
- 241001450781 Bipolaris oryzae Species 0.000 description 3
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 3
- 241000371644 Curvularia ravenelii Species 0.000 description 3
- 241001330975 Magnaporthe oryzae Species 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001448 anilines Chemical class 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 241000228245 Aspergillus niger Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000221785 Erysiphales Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 241000233629 Phytophthora parasitica Species 0.000 description 2
- 241000317981 Podosphaera fuliginea Species 0.000 description 2
- 241000231139 Pyricularia Species 0.000 description 2
- 241000813090 Rhizoctonia solani Species 0.000 description 2
- 241001617088 Thanatephorus sasakii Species 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000002131 composite material Substances 0.000 description 2
- AUZONCFQVSMFAP-UHFFFAOYSA-N disulfiram Chemical compound CCN(CC)C(=S)SSC(=S)N(CC)CC AUZONCFQVSMFAP-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000009422 growth inhibiting effect Effects 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- WCJYTPVNMWIZCG-UHFFFAOYSA-N xylylcarb Chemical compound CNC(=O)OC1=CC=C(C)C(C)=C1 WCJYTPVNMWIZCG-UHFFFAOYSA-N 0.000 description 2
- CXNPLSGKWMLZPZ-GIFSMMMISA-N (2r,3r,6s)-3-[[(3s)-3-amino-5-[carbamimidoyl(methyl)amino]pentanoyl]amino]-6-(4-amino-2-oxopyrimidin-1-yl)-3,6-dihydro-2h-pyran-2-carboxylic acid Chemical compound O1[C@@H](C(O)=O)[C@H](NC(=O)C[C@@H](N)CCN(C)C(N)=N)C=C[C@H]1N1C(=O)N=C(N)C=C1 CXNPLSGKWMLZPZ-GIFSMMMISA-N 0.000 description 1
- MDCYQGRGADEEKU-UHFFFAOYSA-N 1-(3,5-dichlorophenyl)-3-phenylpyrrole-2,5-dione Chemical compound ClC1=CC(Cl)=CC(N2C(C(=CC2=O)C=2C=CC=CC=2)=O)=C1 MDCYQGRGADEEKU-UHFFFAOYSA-N 0.000 description 1
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 1
- FJBYYZKYMWMKRT-UHFFFAOYSA-N 3,4,5-tribromoaniline Chemical compound NC1=CC(Br)=C(Br)C(Br)=C1 FJBYYZKYMWMKRT-UHFFFAOYSA-N 0.000 description 1
- XOGYQVITULCUGU-UHFFFAOYSA-N 3,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C(Cl)=C1 XOGYQVITULCUGU-UHFFFAOYSA-N 0.000 description 1
- STUCDJFRZFSHTB-UHFFFAOYSA-N 3,5-dibromo-4-chloroaniline Chemical compound NC1=CC(Br)=C(Cl)C(Br)=C1 STUCDJFRZFSHTB-UHFFFAOYSA-N 0.000 description 1
- AQZDIKCNODUMNY-UHFFFAOYSA-N 3,5-dibromo-4-methylaniline Chemical compound CC1=C(Br)C=C(N)C=C1Br AQZDIKCNODUMNY-UHFFFAOYSA-N 0.000 description 1
- GTEUMCIATAHZFK-UHFFFAOYSA-N 3,5-dichloro-4-methylaniline Chemical compound CC1=C(Cl)C=C(N)C=C1Cl GTEUMCIATAHZFK-UHFFFAOYSA-N 0.000 description 1
- KQOIBXZRCYFZSO-UHFFFAOYSA-N 3,5-difluoroaniline Chemical compound NC1=CC(F)=CC(F)=C1 KQOIBXZRCYFZSO-UHFFFAOYSA-N 0.000 description 1
- CHLBMXJABUVAJX-UHFFFAOYSA-N 3,5-diiodoaniline Chemical compound NC1=CC(I)=CC(I)=C1 CHLBMXJABUVAJX-UHFFFAOYSA-N 0.000 description 1
- VKDYPJMSKQLLOJ-UHFFFAOYSA-N 3-(2-chlorophenyl)furan-2,5-dione Chemical compound ClC1=CC=CC=C1C1=CC(=O)OC1=O VKDYPJMSKQLLOJ-UHFFFAOYSA-N 0.000 description 1
- KCTMGSXRVOLTIB-UHFFFAOYSA-N 3-(3-chlorophenyl)furan-2,5-dione Chemical compound ClC1=CC=CC(C=2C(OC(=O)C=2)=O)=C1 KCTMGSXRVOLTIB-UHFFFAOYSA-N 0.000 description 1
- BSZGHMTWYIUDFZ-UHFFFAOYSA-N 3-(4-chlorophenyl)furan-2,5-dione Chemical compound C1=CC(Cl)=CC=C1C1=CC(=O)OC1=O BSZGHMTWYIUDFZ-UHFFFAOYSA-N 0.000 description 1
- YPRMWCKXOZFJGF-UHFFFAOYSA-N 3-bromofuran-2,5-dione Chemical compound BrC1=CC(=O)OC1=O YPRMWCKXOZFJGF-UHFFFAOYSA-N 0.000 description 1
- CXJAFLQWMOMYOW-UHFFFAOYSA-N 3-chlorofuran-2,5-dione Chemical compound ClC1=CC(=O)OC1=O CXJAFLQWMOMYOW-UHFFFAOYSA-N 0.000 description 1
- AXGOOCLYBPQWNG-UHFFFAOYSA-N 3-ethylfuran-2,5-dione Chemical compound CCC1=CC(=O)OC1=O AXGOOCLYBPQWNG-UHFFFAOYSA-N 0.000 description 1
- AYKYXWQEBUNJCN-UHFFFAOYSA-N 3-methylfuran-2,5-dione Chemical compound CC1=CC(=O)OC1=O AYKYXWQEBUNJCN-UHFFFAOYSA-N 0.000 description 1
- QZYCWJVSPFQUQC-UHFFFAOYSA-N 3-phenylfuran-2,5-dione Chemical compound O=C1OC(=O)C(C=2C=CC=CC=2)=C1 QZYCWJVSPFQUQC-UHFFFAOYSA-N 0.000 description 1
- LPFJFXRQANKTRA-UHFFFAOYSA-N 3-propylfuran-2,5-dione Chemical compound CCCC1=CC(=O)OC1=O LPFJFXRQANKTRA-UHFFFAOYSA-N 0.000 description 1
- QOPGULWHAXFEIP-UHFFFAOYSA-N 4-bromo-3,5-dichloroaniline Chemical compound NC1=CC(Cl)=C(Br)C(Cl)=C1 QOPGULWHAXFEIP-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241000252229 Carassius auratus Species 0.000 description 1
- 240000001980 Cucurbita pepo Species 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 206010058667 Oral toxicity Diseases 0.000 description 1
- 229930182764 Polyoxin Natural products 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 101100166816 Schizosaccharomyces pombe (strain 972 / ATCC 24843) fta3 gene Proteins 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 229940045971 anti bac Drugs 0.000 description 1
- 230000000843 anti-fungal effect Effects 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 244000000005 bacterial plant pathogen Species 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- CXNPLSGKWMLZPZ-UHFFFAOYSA-N blasticidin-S Natural products O1C(C(O)=O)C(NC(=O)CC(N)CCN(C)C(N)=N)C=CC1N1C(=O)N=C(N)C=C1 CXNPLSGKWMLZPZ-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- NAGJZTKCGNOGPW-UHFFFAOYSA-K dioxido-sulfanylidene-sulfido-$l^{5}-phosphane Chemical compound [O-]P([O-])([S-])=S NAGJZTKCGNOGPW-UHFFFAOYSA-K 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 244000000004 fungal plant pathogen Species 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000266 injurious effect Effects 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- UPHVDBIPEJJINY-UHFFFAOYSA-L iron(2+);methyl-dioxido-oxo-$l^{5}-arsane Chemical compound [Fe+2].C[As]([O-])([O-])=O UPHVDBIPEJJINY-UHFFFAOYSA-L 0.000 description 1
- PVTHJAPFENJVNC-MHRBZPPQSA-N kasugamycin Chemical compound N[C@H]1C[C@H](NC(=N)C(O)=O)[C@@H](C)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O PVTHJAPFENJVNC-MHRBZPPQSA-N 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 229960002809 lindane Drugs 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 231100000418 oral toxicity Toxicity 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- YEBIHIICWDDQOL-YBHNRIQQSA-N polyoxin Polymers O[C@@H]1[C@H](O)[C@@H](C(C=O)N)O[C@H]1N1C(=O)NC(=O)C(C(O)=O)=C1 YEBIHIICWDDQOL-YBHNRIQQSA-N 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 230000000644 propagated effect Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- AMHNZOICSMBGDH-UHFFFAOYSA-L zineb Chemical compound [Zn+2].[S-]C(=S)NCCNC([S-])=S AMHNZOICSMBGDH-UHFFFAOYSA-L 0.000 description 1
- DUBNHZYBDBBJHD-UHFFFAOYSA-L ziram Chemical compound [Zn+2].CN(C)C([S-])=S.CN(C)C([S-])=S DUBNHZYBDBBJHD-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/448—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide
- C07D207/452—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide with hydrocarbon radicals, substituted by hetero atoms, directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/456—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7380068 | 1968-10-09 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL33040A0 IL33040A0 (en) | 1969-11-30 |
| IL33040A true IL33040A (en) | 1973-01-30 |
Family
ID=13528597
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL33040A IL33040A (en) | 1968-10-09 | 1969-09-21 | Novel n-phenylmaleimide derivatives,process for preparing the same and fungicides and bactericides containing the same |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3743654A (d) |
| BE (1) | BE739960A (d) |
| CH (1) | CH514283A (d) |
| CS (1) | CS181654B2 (d) |
| DE (1) | DE1949435C3 (d) |
| DK (1) | DK127478B (d) |
| ES (1) | ES371932A1 (d) |
| FR (1) | FR2020206A1 (d) |
| GB (1) | GB1238123A (d) |
| IL (1) | IL33040A (d) |
| NL (1) | NL143919B (d) |
| PL (2) | PL80867B1 (d) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4179444A (en) * | 1976-02-11 | 1979-12-18 | Ciba-Geigy Corporation | Process for the manufacture of iso-imides or mixtures of iso-imides and imides |
| JPS6017764B2 (ja) * | 1976-07-10 | 1985-05-07 | イハラケミカル工業株式会社 | 水中生物忌避剤 |
| CN111316986B (zh) * | 2019-12-31 | 2021-10-15 | 浙江工业大学 | 顺丁烯二酰亚胺类化合物作为几丁质合成酶抑制剂的应用 |
-
1969
- 1969-09-11 US US00857217A patent/US3743654A/en not_active Expired - Lifetime
- 1969-09-19 DK DK501969AA patent/DK127478B/da unknown
- 1969-09-21 IL IL33040A patent/IL33040A/en unknown
- 1969-09-26 ES ES371932A patent/ES371932A1/es not_active Expired
- 1969-09-26 GB GB1238123D patent/GB1238123A/en not_active Expired
- 1969-09-30 DE DE1949435A patent/DE1949435C3/de not_active Expired
- 1969-10-02 CS CS6900006622A patent/CS181654B2/cs unknown
- 1969-10-06 FR FR6934028A patent/FR2020206A1/fr not_active Withdrawn
- 1969-10-08 PL PL1969138858A patent/PL80867B1/pl unknown
- 1969-10-08 PL PL1969136215A patent/PL80283B1/pl unknown
- 1969-10-08 CH CH1512369A patent/CH514283A/fr not_active IP Right Cessation
- 1969-10-08 BE BE739960D patent/BE739960A/xx unknown
- 1969-10-08 NL NL696915212A patent/NL143919B/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1238123A (d) | 1971-07-07 |
| DE1949435B2 (de) | 1973-06-28 |
| DK127478B (da) | 1973-11-12 |
| IL33040A0 (en) | 1969-11-30 |
| US3743654A (en) | 1973-07-03 |
| ES371932A1 (es) | 1972-04-01 |
| NL6915212A (d) | 1970-04-13 |
| CH514283A (fr) | 1971-10-31 |
| BE739960A (d) | 1970-03-16 |
| PL80283B1 (d) | 1975-08-30 |
| FR2020206A1 (d) | 1970-07-10 |
| CS181654B2 (en) | 1978-03-31 |
| NL143919B (nl) | 1974-11-15 |
| PL80867B1 (d) | 1975-08-30 |
| DE1949435A1 (de) | 1970-04-23 |
| DE1949435C3 (de) | 1974-01-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3745170A (en) | Novel n-(3,5-dihalophenyl)-imide compounds | |
| US3668217A (en) | 3-(3{40 ,5{40 -dihalogenophenyl)imidazolidine-2,4-dione derivatives | |
| US3903090A (en) | Novel n-(3,5-dihalophenyl)-imide compounds | |
| US3741981A (en) | N-phenylsuccinimide derivatives | |
| EP0248086A1 (en) | Imidazole derivatives, bactericides containing them, and process for their preparation | |
| US4839378A (en) | Fluorophthalimides and agricultural and horticultural fungicides containing them | |
| US3586697A (en) | Novel n-(3,5-dichlorophenyl) cyclic imide derivatives | |
| IL33040A (en) | Novel n-phenylmaleimide derivatives,process for preparing the same and fungicides and bactericides containing the same | |
| US4082849A (en) | Halogenated n-(3,5-dihalophenyl)cyclopropanedicarboximides | |
| US3186905A (en) | Bactericidal and fungicidal dichloronitro-quinoxalines | |
| US4594353A (en) | Azolyl-furan-derivatives having fungicide activity | |
| US3969362A (en) | Isopropyl-N-(5-bromo or chloropyridyl-2)carbamate | |
| US4151290A (en) | Fungicidal 1-cycloalkylcarbonyl-3-(3,5-dihalophenyl)imidazolidine-2,4-diones | |
| US5352822A (en) | Pesticides | |
| US3963746A (en) | 4,5 Dihalopyrrol 2-yl di and tri halomethyl ketones | |
| US3538226A (en) | Method of destroying plant fungi | |
| US4303667A (en) | Phenylprrole derivatives | |
| US4181732A (en) | 1-Branched-alkylcarbonyl-3-(3,5-dihalophenyl)imidazolidine-2,4-diones | |
| US4942178A (en) | Plant protection agents for control of fungi | |
| EP0412681B1 (en) | Azolidine derivatives, process for preparing the same and agricultural and horticultural fungicide | |
| US4028438A (en) | Phosphorothiolates | |
| JPS599521B2 (ja) | 除草剤 | |
| JPH05507907A (ja) | ペスチサイド | |
| AU656047B2 (en) | Pesticides | |
| IL45751A (en) | Benzimidazole-1-carboximidic acid esters process for their preparation and their use |