IL27126A - 4,3,2,1-Tetrahydro-6-sulfamyl-H) -43) Coinazolinones and the process for their preparation - Google Patents
4,3,2,1-Tetrahydro-6-sulfamyl-H) -43) Coinazolinones and the process for their preparationInfo
- Publication number
- IL27126A IL27126A IL27126A IL2712666A IL27126A IL 27126 A IL27126 A IL 27126A IL 27126 A IL27126 A IL 27126A IL 2712666 A IL2712666 A IL 2712666A IL 27126 A IL27126 A IL 27126A
- Authority
- IL
- Israel
- Prior art keywords
- lower alkyl
- hydrogen
- methyl
- sulfamyl
- chloro
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 28
- 125000000217 alkyl group Chemical group 0.000 claims description 25
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- 229910052736 halogen Inorganic materials 0.000 claims description 18
- 150000002431 hydrogen Chemical class 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 12
- 238000003756 stirring Methods 0.000 claims description 12
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 10
- 150000002367 halogens Chemical class 0.000 claims description 9
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- -1 NH^ Chemical group 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 229910000033 sodium borohydride Inorganic materials 0.000 claims description 5
- 239000012279 sodium borohydride Substances 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 239000002585 base Substances 0.000 claims description 2
- 239000003456 ion exchange resin Substances 0.000 claims description 2
- 229920003303 ion-exchange polymer Polymers 0.000 claims description 2
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 3
- 239000004480 active ingredient Substances 0.000 claims 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 claims 1
- IOJZLMRWACLAMH-UHFFFAOYSA-N 7-chloro-2-methyl-3-(2-methylphenyl)-4-oxoquinazoline-6-sulfonamide Chemical compound CC1=CC=CC=C1N1C(=O)C2=CC(S(N)(=O)=O)=C(Cl)C=C2N=C1C IOJZLMRWACLAMH-UHFFFAOYSA-N 0.000 claims 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 238000005187 foaming Methods 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 238000003556 assay Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000002934 diuretic Substances 0.000 description 4
- AGMMTXLNIQSRCG-UHFFFAOYSA-N quinethazone Chemical compound NS(=O)(=O)C1=C(Cl)C=C2NC(CC)NC(=O)C2=C1 AGMMTXLNIQSRCG-UHFFFAOYSA-N 0.000 description 4
- 229960000577 quinethazone Drugs 0.000 description 4
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical compound C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 230000001882 diuretic effect Effects 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- JBMKAUGHUNFTOL-UHFFFAOYSA-N Aldoclor Chemical class C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NC=NS2(=O)=O JBMKAUGHUNFTOL-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000001647 drug administration Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 229960002003 hydrochlorothiazide Drugs 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000003451 thiazide diuretic agent Substances 0.000 description 2
- 230000002485 urinary effect Effects 0.000 description 2
- 210000002700 urine Anatomy 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- BSOCSVYHFRYVKM-UHFFFAOYSA-N 2,3,4a,5-tetrahydro-1h-quinazolin-4-one Chemical compound C1=CCC2C(=O)NCNC2=C1 BSOCSVYHFRYVKM-UHFFFAOYSA-N 0.000 description 1
- YUHXSVUWDBFINU-UHFFFAOYSA-N 2-acetamido-4-chloro-5-sulfamoylbenzoic acid Chemical compound CC(=O)NC1=CC(Cl)=C(S(N)(=O)=O)C=C1C(O)=O YUHXSVUWDBFINU-UHFFFAOYSA-N 0.000 description 1
- YNJXJWNIKLJHQS-UHFFFAOYSA-N 2-benzyl-7-chloro-3-(2-methylphenyl)-4-oxo-1,2-dihydroquinazoline-6-sulfonamide Chemical compound C(C1=CC=CC=C1)C1NC2=CC(=C(C=C2C(N1C1=C(C=CC=C1)C)=O)S(N)(=O)=O)Cl YNJXJWNIKLJHQS-UHFFFAOYSA-N 0.000 description 1
- WRZOMWDJOLIVQP-UHFFFAOYSA-N 5-Chloro-ortho-toluidine Chemical compound CC1=CC=C(Cl)C=C1N WRZOMWDJOLIVQP-UHFFFAOYSA-N 0.000 description 1
- KTEXRFPNWJJGME-UHFFFAOYSA-N 7-chloro-3-(4-methoxy-2-methylphenyl)-2-methyl-4-oxo-1,2-dihydroquinazoline-6-sulfonamide Chemical compound CC1NC2=CC(=C(C=C2C(N1C1=C(C=C(C=C1)OC)C)=O)S(N)(=O)=O)Cl KTEXRFPNWJJGME-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 208000004880 Polyuria Diseases 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 101150052863 THY1 gene Proteins 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 210000000748 cardiovascular system Anatomy 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 229940023913 cation exchange resins Drugs 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 1
- 230000035619 diuresis Effects 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000002631 hypothermal effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 230000037023 motor activity Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000000894 saliuretic effect Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229940076133 sodium carbonate monohydrate Drugs 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
- C07D239/91—Oxygen atoms with aryl or aralkyl radicals attached in position 2 or 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US517995A US3360518A (en) | 1966-01-03 | 1966-01-03 | Tetrahydro-halo-sulfamyl quinazolinones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL27126A true IL27126A (en) | 1972-01-27 |
Family
ID=24062092
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL27126A IL27126A (en) | 1966-01-03 | 1966-12-22 | 4,3,2,1-Tetrahydro-6-sulfamyl-H) -43) Coinazolinones and the process for their preparation |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3360518A (de) |
| AT (2) | AT286989B (de) |
| BE (1) | BE692082A (de) |
| BR (1) | BR6785894D0 (de) |
| CH (1) | CH515910A (de) |
| DE (1) | DE1620740C3 (de) |
| DK (1) | DK134113B (de) |
| ES (1) | ES334560A1 (de) |
| FI (1) | FI51350C (de) |
| FR (1) | FR6844M (de) |
| GB (1) | GB1170790A (de) |
| IL (1) | IL27126A (de) |
| NL (1) | NL149493B (de) |
| SE (1) | SE390969B (de) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3458513A (en) * | 1967-11-02 | 1969-07-29 | Wallace & Tiernan Inc | 2-substituted-tetrahydro-halosulfamyl-quinazolinones |
| US3452020A (en) * | 1967-11-09 | 1969-06-24 | Wallace & Tiernan Inc | 2-alkenyl and 2-alkynyl substituted - tetrahydro - halo-sulfamyl-quinazolinones |
| US3452019A (en) * | 1967-11-16 | 1969-06-24 | Wallace & Tiernan Inc | 1-phenylalkyl-tetrahydro-halo-sulfamyl-quinazolinone |
| US3518267A (en) * | 1968-02-23 | 1970-06-30 | Pennwalt Corp | 1-aminoalkyl and 1-hydroxyalkyl-tetrahydro-halo-sulfamyl-quinazolinone |
| US3549629A (en) * | 1968-02-29 | 1970-12-22 | Pennwalt Corp | 2 - substituted or unsubstituted carboxy tetrahydro - halo - sulfamyl-quinazolinones |
| US3549636A (en) * | 1968-02-29 | 1970-12-22 | Pennwalt Corp | 2-alkanoyl,alkanoylalkyl,alkanoyloxyalkyl,and hydroxyalkyl substituted tetrahydro - halo - sulfamyl- quinazolinones |
| US3549634A (en) * | 1968-03-28 | 1970-12-22 | Pennwalt Corp | 8,5 - amino - substituted - tetrahydrohalo-sulfamyl-quinazolinones |
| US3541096A (en) * | 1968-12-24 | 1970-11-17 | Pennwalt Corp | 2-aryl-substituted-tetrahydro-halo-sulfamyl-quinazolinones |
| ZA732937B (en) * | 1972-05-05 | 1974-03-27 | Maggioni & C Spa | Non mercurial diuretics |
| EP0057763A1 (de) * | 1981-01-26 | 1982-08-18 | Pennwalt Corporation | Verfahren zur Herstellung von 2-Methyl-3-(o-tolyl)-7-chlor-1,2,3,4-tetrahydro-4-oxo-6-chinazolinsulfonamid |
| US4522818A (en) * | 1982-10-14 | 1985-06-11 | Pennwalt Corporation | Diuretic/antihypertensive compositions |
| US4517179A (en) * | 1983-04-29 | 1985-05-14 | Pennwalt Corporation | Rapid dissolving, uniform drug compositions and their preparation |
| US5264439A (en) * | 1990-02-13 | 1993-11-23 | Merck & Co., Inc. | Quinazolinone, triazolinone and pyrimidinone angiotensin II antagonists incorporating a substituted benzyl element |
| US5633240A (en) * | 1994-09-01 | 1997-05-27 | Academic Pharmaceuticals | Parenteral solutions containing metolazone |
| IT1288123B1 (it) * | 1996-09-04 | 1998-09-10 | Nicox Sa | Uso di nitroderivati per l'incontinenza urinaria |
| PT1336407E (pt) * | 2000-11-21 | 2006-07-31 | Sankyo Co | Composicao contendo um antagonista do receptor de angiotensina e um diuretico e sua utilizacao para o tratamento da hipertensao |
| EP1545519B1 (de) | 2002-08-19 | 2011-03-23 | Pfizer Inc. | Kombinationstherapie gegen hyperproliferative erkrankungen |
| US20080275093A1 (en) * | 2004-11-15 | 2008-11-06 | Nitromed, Inc. | Diuretic Compounds Comprising Heterocyclic Nitric Oxide Donor Groups, Compositions and Methods of Use |
| US7741317B2 (en) | 2005-10-21 | 2010-06-22 | Bristol-Myers Squibb Company | LXR modulators |
| US7888376B2 (en) | 2005-11-23 | 2011-02-15 | Bristol-Myers Squibb Company | Heterocyclic CETP inhibitors |
| JP5498168B2 (ja) | 2006-12-01 | 2014-05-21 | ブリストル−マイヤーズ スクイブ カンパニー | アテローム性動脈硬化および循環器疾患の治療のためのcetp阻害剤としてのn−((3−ベンジル)−2,2−(ビス−フェニル)−プロパン−1−アミン誘導体 |
| SG11201507496UA (en) | 2013-04-17 | 2015-11-27 | Pfizer | N-piperidin-3-ylbenzamide derivatives for treating cardiovascular diseases |
| EP3025711B1 (de) | 2013-07-23 | 2020-11-18 | Daiichi Sankyo Company, Limited | Medikament zur vorbeugung oder behandlung von hypertonie |
| WO2016055901A1 (en) | 2014-10-08 | 2016-04-14 | Pfizer Inc. | Substituted amide compounds |
| US11248001B2 (en) | 2019-01-18 | 2022-02-15 | Astrazeneca Ab | PCSK9 inhibitors and methods of use thereof |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2976289A (en) * | 1961-03-21 | X-tetrahydro - | ||
| GB1464445A (en) * | 1973-02-19 | 1977-02-16 | Mitsubishi Electric Corp | Apparatus for making a printing master |
| DE3266655D1 (en) * | 1982-06-04 | 1985-11-07 | Hell Rudolf Dr Ing Gmbh | Process to avoid image defects in multicolour printing caused by non coincident printing of the colour separations |
| GB8410860D0 (en) * | 1984-04-27 | 1984-06-06 | Crosfield Electronics Ltd | Image modification |
-
1966
- 1966-01-03 US US517995A patent/US3360518A/en not_active Expired - Lifetime
- 1966-12-15 ES ES0334560A patent/ES334560A1/es not_active Expired
- 1966-12-22 IL IL27126A patent/IL27126A/en unknown
- 1966-12-23 GB GB57788/66A patent/GB1170790A/en not_active Expired
- 1966-12-24 DE DE1620740A patent/DE1620740C3/de not_active Expired
- 1966-12-28 AT AT1193066A patent/AT286989B/de not_active IP Right Cessation
- 1966-12-28 AT AT926769A patent/AT291269B/de not_active IP Right Cessation
- 1966-12-29 CH CH1872966A patent/CH515910A/de not_active IP Right Cessation
-
1967
- 1967-01-02 DK DK567AA patent/DK134113B/da not_active IP Right Cessation
- 1967-01-02 SE SE6700024A patent/SE390969B/xx unknown
- 1967-01-03 NL NL676700083A patent/NL149493B/xx not_active IP Right Cessation
- 1967-01-03 BR BR185894/67A patent/BR6785894D0/pt unknown
- 1967-01-03 FR FR89802A patent/FR6844M/fr not_active Expired
- 1967-01-03 FI FI670013A patent/FI51350C/fi active
- 1967-01-03 BE BE692082D patent/BE692082A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AT286989B (de) | 1971-01-11 |
| US3360518A (en) | 1967-12-26 |
| NL149493B (nl) | 1976-05-17 |
| GB1170790A (en) | 1969-11-19 |
| DK134113B (da) | 1976-09-13 |
| SE390969B (sv) | 1977-01-31 |
| NL6700083A (de) | 1967-07-04 |
| BR6785894D0 (pt) | 1973-12-27 |
| FI51350B (de) | 1976-08-31 |
| DE1620740B2 (de) | 1978-09-14 |
| FR6844M (de) | 1969-04-08 |
| FI51350C (fi) | 1976-12-10 |
| DE1620740C3 (de) | 1979-05-10 |
| DE1620740A1 (de) | 1970-05-21 |
| AT291269B (de) | 1971-07-12 |
| CH515910A (de) | 1971-11-30 |
| ES334560A1 (es) | 1967-11-01 |
| DK134113C (de) | 1977-02-14 |
| BE692082A (de) | 1967-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3360518A (en) | Tetrahydro-halo-sulfamyl quinazolinones | |
| US3058882A (en) | N'-substituted-3-carboxy-6-halo-sulfanilamide and derivatives thereof | |
| US2910488A (en) | Aniline derivatives | |
| Yale et al. | Substituted s-triazoles and related compounds | |
| JPH0314315B2 (de) | ||
| US3313848A (en) | Anthranilic acids and derivatives | |
| EP0030351B1 (de) | Ergolin-Derivate, ihre Herstellung und sie enthaltende therapeutische Zusammensetzung | |
| Cain et al. | Potential antitumor agents. 19. Multiply substituted 4'-(9-acridinylamino) methanesulfonanilides | |
| US3472848A (en) | 3-hydroxy and 3-mercapto-pyrazinoyl-guanidines,corresponding ethers and thioethers and processes for their preparation | |
| US3464988A (en) | 3-hydrazinobenzo(h)cinnolines and 3 - hydrazinobenzocyclohepta-(5,6-c)pyridazines | |
| SU730306A3 (ru) | Способ получени производных пиразоло (1,5-с) хиназолина или солей | |
| JPS6236361A (ja) | キノロン治療薬及びその製法 | |
| EP0055068B1 (de) | Chinolonderivate und ihre Verwendung als Arzneimittel | |
| US3933827A (en) | 9-Acyloxy-5,11-dimethyl-6H-pyrido[4,3-B]carbazoles | |
| US3567746A (en) | N-aryl benzamides | |
| US4333933A (en) | Benzoguanamine derivatives, their production and pharmaceutical compositions containing the same | |
| KR880001719B1 (ko) | 1,4,9,10-테트라하이드로-피라졸로[4,3-e]-피리도[3,2-b][1,4]디아제핀-10-온의 제조 방법 | |
| PL103682B1 (pl) | Sposob wytwarzania nowych pochodnych indazoliloksy-4-propanoloaminy | |
| US3268406A (en) | Compositions and method of using (3-amino-pyrazinoyl) guanidines | |
| US3745216A (en) | Compositions and methods for producing hypotensive activity with imidazo and pyrimido(2,1-b)quinazoline compounds | |
| IL26725A (en) | Benzodiazepine derivatives and process for the manufacture thereof | |
| US3452020A (en) | 2-alkenyl and 2-alkynyl substituted - tetrahydro - halo-sulfamyl-quinazolinones | |
| US3277086A (en) | 1, 2, 4-benzothiadiazine 1, 1-dioxides having a heterocyclic ring fused to the "b" face thereof | |
| EP0015065B1 (de) | Pyrazolo (5,1-b) chinazolin-9(4H)-on-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zusammensetzungen | |
| HU176942B (hu) | Sposob poluchenija 2,3- i 3,4-dvuzamehhjonnykh tetragidro-pirrolo!1,2-a!-pirimidinov |