IL106077A - Process for the preparation of 2-deoxy-2,2-difluoro-D-ribopornosyl soloponates rich in anomer alpha - Google Patents
Process for the preparation of 2-deoxy-2,2-difluoro-D-ribopornosyl soloponates rich in anomer alphaInfo
- Publication number
- IL106077A IL106077A IL10607793A IL10607793A IL106077A IL 106077 A IL106077 A IL 106077A IL 10607793 A IL10607793 A IL 10607793A IL 10607793 A IL10607793 A IL 10607793A IL 106077 A IL106077 A IL 106077A
- Authority
- IL
- Israel
- Prior art keywords
- acid
- sulfonate
- anomer
- beta
- ribofuranosyl
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 3
- 150000003871 sulfonates Chemical class 0.000 title description 3
- -1 ribofuranosyl sulfonate Chemical compound 0.000 claims abstract description 46
- 239000000203 mixture Substances 0.000 claims abstract description 35
- 238000000034 method Methods 0.000 claims abstract description 28
- 150000001450 anions Chemical class 0.000 claims abstract description 17
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims abstract description 15
- 239000012442 inert solvent Substances 0.000 claims abstract description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 33
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 32
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 25
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 17
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 15
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 14
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 claims description 14
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 claims description 12
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 claims description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 6
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 claims description 5
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 claims description 5
- 239000002585 base Substances 0.000 claims description 5
- 239000003054 catalyst Substances 0.000 claims description 5
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims description 5
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 5
- 125000006239 protecting group Chemical group 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 claims description 4
- COUZKCVTEDNHBT-UHFFFAOYSA-N CCN(CC)CC.BrC1=CC=CC=C1 Chemical compound CCN(CC)CC.BrC1=CC=CC=C1 COUZKCVTEDNHBT-UHFFFAOYSA-N 0.000 claims description 4
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 claims description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 4
- KQYREKISXCBRQB-UHFFFAOYSA-N n,n-diethylethanamine;methanesulfonic acid Chemical class CS(O)(=O)=O.CCN(CC)CC KQYREKISXCBRQB-UHFFFAOYSA-N 0.000 claims description 4
- 239000008096 xylene Substances 0.000 claims description 4
- LDHXMQXUOUZOLF-HERZVMAMSA-N (4r,5r)-3,3-difluoro-5-(hydroxymethyl)oxolane-2,4-diol Chemical compound OC[C@H]1OC(O)C(F)(F)[C@@H]1O LDHXMQXUOUZOLF-HERZVMAMSA-N 0.000 claims description 3
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 claims description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 claims description 3
- 229940092714 benzenesulfonic acid Drugs 0.000 claims description 3
- FWZLPDFJDKDFSL-UHFFFAOYSA-N chlorobenzene;n,n-diethylethanamine Chemical compound CCN(CC)CC.ClC1=CC=CC=C1 FWZLPDFJDKDFSL-UHFFFAOYSA-N 0.000 claims description 3
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- BLTAPEIEHGWKKN-UHFFFAOYSA-N methanesulfonate;pyridin-1-ium Chemical compound CS(O)(=O)=O.C1=CC=NC=C1 BLTAPEIEHGWKKN-UHFFFAOYSA-N 0.000 claims description 3
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical compound CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 claims description 3
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical class CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 claims description 3
- 150000003738 xylenes Chemical class 0.000 claims description 3
- CFQPVBJOKYSPKG-UHFFFAOYSA-N 1,3-dimethylimidazol-2-one Chemical compound CN1C=CN(C)C1=O CFQPVBJOKYSPKG-UHFFFAOYSA-N 0.000 claims description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 claims description 2
- RUCCIRTVEYMEQG-UHFFFAOYSA-N 2-nitrobenzenesulfonate;pyridin-1-ium Chemical compound C1=CC=[NH+]C=C1.[O-][N+](=O)C1=CC=CC=C1S([O-])(=O)=O RUCCIRTVEYMEQG-UHFFFAOYSA-N 0.000 claims description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 150000003983 crown ethers Chemical class 0.000 claims description 2
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 2
- 239000003444 phase transfer catalyst Substances 0.000 claims description 2
- ZAEQTGTVGUJEFV-UHFFFAOYSA-N phenylmethanesulfonate;pyridin-1-ium Chemical compound C1=CC=[NH+]C=C1.[O-]S(=O)(=O)CC1=CC=CC=C1 ZAEQTGTVGUJEFV-UHFFFAOYSA-N 0.000 claims description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 claims description 2
- FMWLUWPQPKEARP-UHFFFAOYSA-N bromodichloromethane Chemical compound ClC(Cl)Br FMWLUWPQPKEARP-UHFFFAOYSA-N 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims 1
- 229940086542 triethylamine Drugs 0.000 claims 1
- 239000000047 product Substances 0.000 description 16
- 238000004128 high performance liquid chromatography Methods 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 238000010992 reflux Methods 0.000 description 9
- 125000000217 alkyl group Chemical group 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 238000004007 reversed phase HPLC Methods 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- DSEPTYOCUKEWRG-UHFFFAOYSA-N n,n-dimethyl-1-phenylmethanamine;methanesulfonic acid Chemical compound CS([O-])(=O)=O.C[NH+](C)CC1=CC=CC=C1 DSEPTYOCUKEWRG-UHFFFAOYSA-N 0.000 description 5
- 239000002777 nucleoside Substances 0.000 description 5
- QKFFSWPNFCXGIQ-UHFFFAOYSA-M 4-methylbenzenesulfonate;tetraethylazanium Chemical compound CC[N+](CC)(CC)CC.CC1=CC=C(S([O-])(=O)=O)C=C1 QKFFSWPNFCXGIQ-UHFFFAOYSA-M 0.000 description 4
- 238000006206 glycosylation reaction Methods 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- YKYONYBAUNKHLG-UHFFFAOYSA-N propyl acetate Chemical compound CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- PYMYPHUHKUWMLA-LMVFSUKVSA-N Ribose Natural products OC[C@@H](O)[C@@H](O)[C@@H](O)C=O PYMYPHUHKUWMLA-LMVFSUKVSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 2
- XGLVDUUYFKXKPL-UHFFFAOYSA-N 2-(2-methoxyethoxy)-n,n-bis[2-(2-methoxyethoxy)ethyl]ethanamine Chemical compound COCCOCCN(CCOCCOC)CCOCCOC XGLVDUUYFKXKPL-UHFFFAOYSA-N 0.000 description 2
- RJWBTWIBUIGANW-UHFFFAOYSA-N 4-chlorobenzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=C(Cl)C=C1 RJWBTWIBUIGANW-UHFFFAOYSA-N 0.000 description 2
- HMFHBZSHGGEWLO-SOOFDHNKSA-N D-ribofuranose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H]1O HMFHBZSHGGEWLO-SOOFDHNKSA-N 0.000 description 2
- XPDWGBQVDMORPB-UHFFFAOYSA-N Fluoroform Chemical compound FC(F)F XPDWGBQVDMORPB-UHFFFAOYSA-N 0.000 description 2
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- HMFHBZSHGGEWLO-UHFFFAOYSA-N alpha-D-Furanose-Ribose Natural products OCC1OC(O)C(O)C1O HMFHBZSHGGEWLO-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical compound [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 2
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical class CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 2
- 230000013595 glycosylation Effects 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 125000000548 ribosyl group Chemical group C1([C@H](O)[C@H](O)[C@H](O1)CO)* 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- KFCWJXULHYUQKL-UHFFFAOYSA-N (4-bromophenyl)sulfonyl 4-bromobenzenesulfonate Chemical compound C1=CC(Br)=CC=C1S(=O)(=O)OS(=O)(=O)C1=CC=C(Br)C=C1 KFCWJXULHYUQKL-UHFFFAOYSA-N 0.000 description 1
- KBDKOYYFINOWDM-HERZVMAMSA-N (4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolane-2-sulfonic acid Chemical class OC[C@H]1OC(S(O)(=O)=O)C(F)(F)[C@@H]1O KBDKOYYFINOWDM-HERZVMAMSA-N 0.000 description 1
- AZGPBMFJVDJEQQ-PYHARJCCSA-N (4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolane-2-sulfonic acid Chemical class OC[C@H]1OC(S(O)(=O)=O)C[C@@H]1O AZGPBMFJVDJEQQ-PYHARJCCSA-N 0.000 description 1
- XQQZRZQVBFHBHL-UHFFFAOYSA-N 12-crown-4 Chemical compound C1COCCOCCOCCO1 XQQZRZQVBFHBHL-UHFFFAOYSA-N 0.000 description 1
- VFTFKUDGYRBSAL-UHFFFAOYSA-N 15-crown-5 Chemical compound C1COCCOCCOCCOCCO1 VFTFKUDGYRBSAL-UHFFFAOYSA-N 0.000 description 1
- LSEFXLGTUCVBPE-UHFFFAOYSA-N 1h-imidazol-2-ylcarbamic acid Chemical compound OC(=O)NC1=NC=CN1 LSEFXLGTUCVBPE-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- JTNCEQNHURODLX-UHFFFAOYSA-N 2-phenylethanimidamide Chemical compound NC(=N)CC1=CC=CC=C1 JTNCEQNHURODLX-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- WZZFZXZRKPNZOC-UHFFFAOYSA-N 3-nitrobenzenesulfonic acid;pyridine Chemical compound C1=CC=[NH+]C=C1.[O-][N+](=O)C1=CC=CC(S([O-])(=O)=O)=C1 WZZFZXZRKPNZOC-UHFFFAOYSA-N 0.000 description 1
- JZDGXAKHVBBVAU-UHFFFAOYSA-N BrC1=CC=CC=C1.C(C)[N+](CC)(CC)CC Chemical compound BrC1=CC=CC=C1.C(C)[N+](CC)(CC)CC JZDGXAKHVBBVAU-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical class CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- USAAQJXEFRHWFZ-ZZKAVYKESA-N [(4r,5r)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] methanesulfonate Chemical compound CS(=O)(=O)OC1O[C@H](CO)[C@@H](O)C1(F)F USAAQJXEFRHWFZ-ZZKAVYKESA-N 0.000 description 1
- XXFXTBNFFMQVKJ-UHFFFAOYSA-N [diphenyl(trityloxy)methyl]benzene Chemical class C=1C=CC=CC=1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)OC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 XXFXTBNFFMQVKJ-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- SRBFZHDQGSBBOR-MBMOQRBOSA-N alpha-D-arabinopyranose Chemical group O[C@@H]1CO[C@H](O)[C@@H](O)[C@@H]1O SRBFZHDQGSBBOR-MBMOQRBOSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- MLWPJXZKQOPTKZ-UHFFFAOYSA-N benzenesulfonyl benzenesulfonate Chemical compound C=1C=CC=CC=1S(=O)(=O)OS(=O)(=O)C1=CC=CC=C1 MLWPJXZKQOPTKZ-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 238000006345 epimerization reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 150000002243 furanoses Chemical class 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- IZDROVVXIHRYMH-UHFFFAOYSA-N methanesulfonic anhydride Chemical compound CS(=O)(=O)OS(C)(=O)=O IZDROVVXIHRYMH-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- GWVLAXGYZUVAGV-UHFFFAOYSA-N n,n-dimethylmethanamine;methanesulfonic acid Chemical compound C[NH+](C)C.CS([O-])(=O)=O GWVLAXGYZUVAGV-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000007523 nucleic acids Chemical class 0.000 description 1
- 102000039446 nucleic acids Human genes 0.000 description 1
- 108020004707 nucleic acids Proteins 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 125000003835 nucleoside group Chemical group 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical compound OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- 125000000025 triisopropylsilyl group Chemical group C(C)(C)[Si](C(C)C)(C(C)C)* 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H13/00—Compounds containing saccharide radicals esterified by carbonic acid or derivatives thereof, or by organic acids, e.g. phosphonic acids
- C07H13/02—Compounds containing saccharide radicals esterified by carbonic acid or derivatives thereof, or by organic acids, e.g. phosphonic acids by carboxylic acids
- C07H13/08—Compounds containing saccharide radicals esterified by carbonic acid or derivatives thereof, or by organic acids, e.g. phosphonic acids by carboxylic acids having the esterifying carboxyl radicals directly attached to carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H11/00—Compounds containing saccharide radicals esterified by inorganic acids; Metal salts thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Biotechnology (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Molecular Biology (AREA)
- Saccharide Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/902,305 US5256798A (en) | 1992-06-22 | 1992-06-22 | Process for preparing alpha-anomer enriched 2-deoxy-2,2-difluoro-D-ribofuranosyl sulfonates |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL106077A0 IL106077A0 (en) | 1993-10-20 |
| IL106077A true IL106077A (en) | 1998-07-15 |
Family
ID=25415655
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL10607793A IL106077A (en) | 1992-06-22 | 1993-06-21 | Process for the preparation of 2-deoxy-2,2-difluoro-D-ribopornosyl soloponates rich in anomer alpha |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US5256798A (show.php) |
| EP (1) | EP0577302B1 (show.php) |
| JP (1) | JP3379993B2 (show.php) |
| AT (1) | ATE155476T1 (show.php) |
| BR (1) | BR9302429A (show.php) |
| CA (1) | CA2098882C (show.php) |
| DE (1) | DE69312176T2 (show.php) |
| DK (1) | DK0577302T3 (show.php) |
| ES (1) | ES2105114T3 (show.php) |
| GR (1) | GR3024975T3 (show.php) |
| HU (1) | HU216832B (show.php) |
| IL (1) | IL106077A (show.php) |
| MX (1) | MX9303712A (show.php) |
| TW (1) | TW224101B (show.php) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE69311000T2 (de) * | 1992-06-22 | 1997-11-27 | Lilly Co Eli | Verfahren zur Herstellung von mit Alpha-Anomeren angereicherten 1-Halogen-2-Deoxy-2,2-Difluor-D-Ribofuranosyl-Derivaten |
| UA41261C2 (uk) * | 1992-06-22 | 2001-09-17 | Елі Ліллі Енд Компані | Спосіб одержання збагачених бета-аномером нуклеозидів |
| RU2131880C1 (ru) * | 1992-06-22 | 1999-06-20 | Эли Лилли Энд Компани | Способ получения обогащенных бета-аномером нуклеозидов |
| US5424416A (en) * | 1993-08-25 | 1995-06-13 | Eli Lilly And Company | Process for preparation of 2-deoxy-2,2-difluoro-D-ribofuranosyl-3,5-hydroxy protected-1-alkyl and aryl sulfonates and their use in preparation of 2',2'-difluoro-2'-deoxy nucleosides |
| US7214791B2 (en) * | 2004-07-01 | 2007-05-08 | Shenzhen Hande Technology Co., Ltd. | Method for preparation of 2′-deoxy-2′, 2′-difluoro-β-cytidine or pharmaceutically acceptable salts thereof by using 1,6-anhydro-β-d-glucose as raw material |
| CN101023094B (zh) | 2004-07-21 | 2011-05-18 | 法莫赛特股份有限公司 | 烷基取代的2-脱氧-2-氟代-d-呋喃核糖基嘧啶和嘌呤及其衍生物的制备 |
| SG158136A1 (en) * | 2004-09-14 | 2010-01-29 | Pharmasset Inc | Preparation of 2`-fluoro-2`- alkyl- substituted or other optionally substituted ribofuranosyl pyrimidines and purines and their derivatives |
| CA2598895A1 (en) * | 2005-03-04 | 2006-09-08 | Dabur Pharma Limited | Intermediate and process for preparing of beta- anomer enriched 21deoxy, 21 ,21-difluoro-d-ribofuranosyl nucleosides |
| BRPI0610950A2 (pt) * | 2005-06-03 | 2010-08-03 | Scinopharm Taiwan Ltd | processo para produção de um sulfonato de 2-deoxi-2, 2-difluoro-d-ribofuranosil enriquecido de alfa anÈmero, e uso do mesmo para produção de um beta nocleosìdeo |
| AU2011202539B2 (en) * | 2005-06-03 | 2012-07-05 | Scinopharm Taiwan, Ltd. | Process of making an alpha-anomer enriched 2-deoxy-2,2-difluoro-d-ribofuranosyl sulfonate and use thereof for making a beta nucleoside |
| AT502221A1 (de) * | 2005-07-20 | 2007-02-15 | Pharmacon Forschung & Beratung Gmbh | Homogemcitabine, verfahren zu ihrer herstellung sowie deren verwendung |
| WO2007092705A2 (en) * | 2006-02-07 | 2007-08-16 | Chemagis Ltd. | Process for preparing gemcitabine and associated intermediates |
| US20070249823A1 (en) * | 2006-04-20 | 2007-10-25 | Chemagis Ltd. | Process for preparing gemcitabine and associated intermediates |
| US7964580B2 (en) | 2007-03-30 | 2011-06-21 | Pharmasset, Inc. | Nucleoside phosphoramidate prodrugs |
| CN101024667B (zh) * | 2007-03-30 | 2011-01-26 | 湖北益泰药业有限公司 | 盐酸吉西他宾的合成方法 |
| US20080262215A1 (en) * | 2007-04-23 | 2008-10-23 | Chemagis Ltd. | Gemcitabine production process |
| US8173621B2 (en) | 2008-06-11 | 2012-05-08 | Gilead Pharmasset Llc | Nucleoside cyclicphosphates |
| BRPI0923815A2 (pt) * | 2008-12-23 | 2015-07-14 | Pharmasset Inc | Síntese de nucleosídeos de purina |
| TWI598358B (zh) | 2009-05-20 | 2017-09-11 | 基利法瑪席特有限責任公司 | 核苷磷醯胺 |
| US8618076B2 (en) | 2009-05-20 | 2013-12-31 | Gilead Pharmasset Llc | Nucleoside phosphoramidates |
| SI3290428T1 (sl) | 2010-03-31 | 2022-01-31 | Gilead Pharmasset Llc | Tableta, ki obsega kristalinični (S)-izopropil 2-(((S)-(((2R,3R,4R,5R) -5-(2,4-diokso-3,4-dihidropirimidin-1(2H)-il)-4-fluoro-3-hidroksi-4- metiltetrahidrofuran-2-il)metoksi)(fenoksi)fosforil)amino)propanoat |
| PL3290428T3 (pl) | 2010-03-31 | 2022-02-07 | Gilead Pharmasset Llc | Tabletka zawierająca krystaliczny (S)-2-(((S)-(((2R,3R,4R,5R)-5-(2,4-diokso-3,4-dihydropirymidyn-1(2H)-ylo)-4-fluoro-3-hydroksy-4-metylotetrahydrofuran-2-ylo)metoksy)(fenoksy)fosforylo)amino)propanian izopropylu |
| ES2716158T3 (es) | 2010-11-30 | 2019-06-10 | Gilead Pharmasset Llc | 2'-spiro-nucleótidos para el tratamiento de hepatitis C |
| US8889159B2 (en) | 2011-11-29 | 2014-11-18 | Gilead Pharmasset Llc | Compositions and methods for treating hepatitis C virus |
| CN102603838B (zh) * | 2012-02-14 | 2015-02-18 | 江苏八巨药业有限公司 | 一种制备吉西他滨盐酸盐的方法 |
| WO2015030853A1 (en) | 2013-08-27 | 2015-03-05 | Gilead Pharmasset Llc | Combination formulation of two antiviral compounds |
| CN103692332B (zh) * | 2013-12-31 | 2015-12-09 | 景宁畲族自治县通用机械配件厂(普通合伙) | 全自动抛光除油机 |
| CN107793334A (zh) * | 2017-09-27 | 2018-03-13 | 九江善水科技股份有限公司 | 芳基磺酸铵盐化合物、其制备方法及应用 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4526988A (en) * | 1983-03-10 | 1985-07-02 | Eli Lilly And Company | Difluoro antivirals and intermediate therefor |
| DE3856158T2 (de) * | 1987-08-28 | 1998-08-20 | Lilly Co Eli | Verfahren zur Herstellung von Zwischenverbindungen verwendbar in der Herstellung von 2',2'-Difluoronucleosiden |
| US4965374A (en) * | 1987-08-28 | 1990-10-23 | Eli Lilly And Company | Process for and intermediates of 2',2'-difluoronucleosides |
-
1992
- 1992-06-22 US US07/902,305 patent/US5256798A/en not_active Expired - Lifetime
-
1993
- 1993-06-21 AT AT93304814T patent/ATE155476T1/de not_active IP Right Cessation
- 1993-06-21 ES ES93304814T patent/ES2105114T3/es not_active Expired - Lifetime
- 1993-06-21 BR BR9302429A patent/BR9302429A/pt not_active Application Discontinuation
- 1993-06-21 HU HU9301825A patent/HU216832B/hu not_active IP Right Cessation
- 1993-06-21 DE DE69312176T patent/DE69312176T2/de not_active Expired - Lifetime
- 1993-06-21 JP JP14916193A patent/JP3379993B2/ja not_active Expired - Fee Related
- 1993-06-21 EP EP93304814A patent/EP0577302B1/en not_active Expired - Lifetime
- 1993-06-21 MX MX9303712A patent/MX9303712A/es not_active IP Right Cessation
- 1993-06-21 IL IL10607793A patent/IL106077A/en not_active IP Right Cessation
- 1993-06-21 CA CA002098882A patent/CA2098882C/en not_active Expired - Lifetime
- 1993-06-21 DK DK93304814.2T patent/DK0577302T3/da active
- 1993-06-22 TW TW082104989A patent/TW224101B/zh active
-
1997
- 1997-10-09 GR GR970402617T patent/GR3024975T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE69312176D1 (de) | 1997-08-21 |
| HU216832B (hu) | 1999-09-28 |
| HUT65207A (en) | 1994-05-02 |
| JP3379993B2 (ja) | 2003-02-24 |
| CA2098882A1 (en) | 1993-12-23 |
| ATE155476T1 (de) | 1997-08-15 |
| IL106077A0 (en) | 1993-10-20 |
| MX9303712A (es) | 1994-05-31 |
| TW224101B (show.php) | 1994-05-21 |
| ES2105114T3 (es) | 1997-10-16 |
| DK0577302T3 (da) | 1997-10-06 |
| CA2098882C (en) | 2004-05-04 |
| US5256798A (en) | 1993-10-26 |
| EP0577302A1 (en) | 1994-01-05 |
| EP0577302B1 (en) | 1997-07-16 |
| JPH0656865A (ja) | 1994-03-01 |
| BR9302429A (pt) | 1994-01-11 |
| GR3024975T3 (en) | 1998-01-30 |
| HU9301825D0 (en) | 1993-09-28 |
| DE69312176T2 (de) | 1997-12-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0577302B1 (en) | Process for preparing alpha-anomer enriched 2-deoxy-2,2-difluoro-D-ribofuranosyl sulfonates | |
| Hertel et al. | Synthesis of 2-deoxy-2, 2-difluoro-D-ribose and 2-deoxy-2, 2'-difluoro-D-ribofuranosyl nucleosides | |
| US5401838A (en) | Stereoselective fusion glycosylation process for preparing 2'-deoxy-2',2'-difluoronucleosides and 2'-deoxy-2'-fluoronucleosides | |
| US4889928A (en) | Sucrose alkyl 4,6-orthoacylates | |
| JP3313191B2 (ja) | 立体選択的グリコシル化法 | |
| US5371210A (en) | Stereoselective fusion glycosylation process for preparing 2'-deoxy-2',2'-difluoronucleosides and 2'-deoxy-2'-fluoronucleosides | |
| US5453499A (en) | Process for preparing alpha-anomer enriched 1-halo-2-deoxy-2,2-difluoro-D-ribofuranosyl derivatives | |
| US5744597A (en) | Stereoselective anion glycosylation process for preparing 2'-deoxy-2',2'-difluoronucleosides and 2'-deoxy-2'-fluoronucleosides | |
| US5401861A (en) | Low temperature process for preparing alpha-anomer enriched 2-deoxy-2,2-difluoro-D-ribofuranosyl sulfonates | |
| US5821357A (en) | Stereoselective glycosylation process for preparing 2'-deoxy-2',2'-difluoropurine and triazole nucleosides | |
| Dyson et al. | An improved synthesis of benzyl 3, 5-di-O-benzyl-2-deoxy-1, 4-dithio-D-erythro-pentofuranoside, an intermediate in the synthesis of 4′-thionucleosides | |
| US5648473A (en) | 2'-deoxy-2', 2'-difluoropyrimidine nucleosides and 2'-deoxy-2'-fluoropyrimidine nucleosides and intermediates | |
| CZ20031209A3 (cs) | Způsob glykosidace indolokarbazolu | |
| IL106074A (en) | Process for separating anomers of 2-deoxy-2,2-difluoro-D-pantopornosyl alkylsulfonate | |
| US5424416A (en) | Process for preparation of 2-deoxy-2,2-difluoro-D-ribofuranosyl-3,5-hydroxy protected-1-alkyl and aryl sulfonates and their use in preparation of 2',2'-difluoro-2'-deoxy nucleosides | |
| US5625057A (en) | Process for preparing 2',3'-Dideoxy-2',3'-dehydronucleosides | |
| WO1998039347A2 (en) | Synthesis of l-ribose and 2-deoxy l-ribose | |
| US5252756A (en) | Process for preparing beta-anomer enriched 2-deoxy-2,2-difluoro-D-ribofuranosyl-arylsulfonates | |
| TANAKA et al. | The reaction of 6-phenylthiouridine with sulfur nucleophiles: a simple and regiospecific preparation of 6-alkylthiouridines and 6-alkylthiouridylic acids | |
| Yamasaki et al. | Syntheses of 2-Amino-2, 3-dideoxy-l-and-d-Ribohexose by Utilizing an O→ N Acetyl Migration | |
| RU2346948C2 (ru) | ПРОИЗВОДНЫЕ 1-α-ГАЛОГЕН-2,2-ДИФТОР-2-ДЕЗОКСИ-D-РИБОФУРАНОЗЫ И СПОСОБ ИХ ПОЛУЧЕНИЯ | |
| RU2131880C1 (ru) | Способ получения обогащенных бета-аномером нуклеозидов | |
| Hammerschmidt et al. | Synthesis of D-apio-β-D-furanosyl maleimide, an analogue of showdomycin with transposed hydroxymethyl group | |
| EP0450585A2 (en) | Process for the manufacture of 2-deoxy-D-threo-pentofuranosides, intermediates for their manufacture and their use | |
| Michalik et al. | Syntheses of pyrazole iso-C-nucleosides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FF | Patent granted | ||
| KB | Patent renewed | ||
| RH1 | Patent not in force |